/*!
  * Bootstrap v4.1.1 (https://getbootstrap.com/)
  * Copyright 2011-2018 The Bootstrap Authors (https://github.com/twbs/bootstrap/graphs/contributors)
  * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
  */
!function(t,e){"object"==typeof exports&&"undefined"!=typeof module?e(exports,require("jquery")):"function"==typeof define&&define.amd?define(["exports","jquery"],e):e(t.bootstrap={},t.jQuery)}(this,function(t,e){"use strict";function i(t,e){for(var n=0;n<e.length;n++){var i=e[n];i.enumerable=i.enumerable||!1,i.configurable=!0,"value"in i&&(i.writable=!0),Object.defineProperty(t,i.key,i)}}function s(t,e,n){return e&&i(t.prototype,e),n&&i(t,n),t}function c(r){for(var t=1;t<arguments.length;t++){var o=null!=arguments[t]?arguments[t]:{},e=Object.keys(o);"function"==typeof Object.getOwnPropertySymbols&&(e=e.concat(Object.getOwnPropertySymbols(o).filter(function(t){return Object.getOwnPropertyDescriptor(o,t).enumerable}))),e.forEach(function(t){var e,n,i;e=r,i=o[n=t],n in e?Object.defineProperty(e,n,{value:i,enumerable:!0,configurable:!0,writable:!0}):e[n]=i})}return r}for(var r,n,o,a,l,f,h,u,d,p,g,m,_,v,E,y,b,T,C,w,I,D,A,S,O,N,k,L,P,x,j,M,R,H,W,F,U,B,K,V,Q,Y,G,q,z,X,J,Z,$,tt,et,nt,it,rt,ot,st,at,lt,ct,ft,ht,ut,dt,pt,gt=function(i){var e="transitionend";function t(t){var e=this,n=!1;return i(this).one(l.TRANSITION_END,function(){n=!0}),setTimeout(function(){n||l.triggerTransitionEnd(e)},t),this}var l={TRANSITION_END:"bsTransitionEnd",getUID:function(t){for(;t+=~~(1e6*Math.random()),document.getElementById(t););return t},getSelectorFromElement:function(t){var e=t.getAttribute("data-target");e&&"#"!==e||(e=t.getAttribute("href")||"");try{return 0<i(document).find(e).length?e:null}catch(t){return null}},getTransitionDurationFromElement:function(t){if(!t)return 0;var e=i(t).css("transition-duration");return parseFloat(e)?(e=e.split(",")[0],1e3*parseFloat(e)):0},reflow:function(t){return t.offsetHeight},triggerTransitionEnd:function(t){i(t).trigger(e)},supportsTransitionEnd:function(){return Boolean(e)},isElement:function(t){return(t[0]||t).nodeType},typeCheckConfig:function(t,e,n){for(var i in n)if(Object.prototype.hasOwnProperty.call(n,i)){var r=n[i],o=e[i],s=o&&l.isElement(o)?"element":(a=o,{}.toString.call(a).match(/\s([a-z]+)/i)[1].toLowerCase());if(!new RegExp(r).test(s))throw new Error(t.toUpperCase()+': Option "'+i+'" provided type "'+s+'" but expected type "'+r+'".')}var a}};return i.fn.emulateTransitionEnd=t,i.event.special[l.TRANSITION_END]={bindType:e,delegateType:e,handle:function(t){if(i(t.target).is(this))return t.handleObj.handler.apply(this,arguments)}},l}(e=e&&e.hasOwnProperty("default")?e.default:e),mt=(n="alert",a="."+(o="bs.alert"),l=(r=e).fn[n],f={CLOSE:"close"+a,CLOSED:"closed"+a,CLICK_DATA_API:"click"+a+".data-api"},h="alert",u="fade",d="show",p=function(){function i(t){this._element=t}var t=i.prototype;return t.close=function(t){var e=this._element;t&&(e=this._getRootElement(t)),this._triggerCloseEvent(e).isDefaultPrevented()||this._removeElement(e)},t.dispose=function(){r.removeData(this._element,o),this._element=null},t._getRootElement=function(t){var e=gt.getSelectorFromElement(t),n=!1;return e&&(n=r(e)[0]),n||(n=r(t).closest("."+h)[0]),n},t._triggerCloseEvent=function(t){var e=r.Event(f.CLOSE);return r(t).trigger(e),e},t._removeElement=function(e){var n=this;if(r(e).removeClass(d),r(e).hasClass(u)){var t=gt.getTransitionDurationFromElement(e);r(e).one(gt.TRANSITION_END,function(t){return n._destroyElement(e,t)}).emulateTransitionEnd(t)}else this._destroyElement(e)},t._destroyElement=function(t){r(t).detach().trigger(f.CLOSED).remove()},i._jQueryInterface=function(n){return this.each(function(){var t=r(this),e=t.data(o);e||(e=new i(this),t.data(o,e)),"close"===n&&e[n](this)})},i._handleDismiss=function(e){return function(t){t&&t.preventDefault(),e.close(this)}},s(i,null,[{key:"VERSION",get:function(){return"4.1.1"}}]),i}(),r(document).on(f.CLICK_DATA_API,'[data-dismiss="alert"]',p._handleDismiss(new p)),r.fn[n]=p._jQueryInterface,r.fn[n].Constructor=p,r.fn[n].noConflict=function(){return r.fn[n]=l,p._jQueryInterface},p),_t=(m="button",v="."+(_="bs.button"),E=".data-api",y=(g=e).fn[m],b="active",T="btn",w='[data-toggle^="button"]',I='[data-toggle="buttons"]',D="input",A=".active",S=".btn",O={CLICK_DATA_API:"click"+v+E,FOCUS_BLUR_DATA_API:(C="focus")+v+E+" blur"+v+E},N=function(){function n(t){this._element=t}var t=n.prototype;return t.toggle=function(){var t=!0,e=!0,n=g(this._element).closest(I)[0];if(n){var i=g(this._element).find(D)[0];if(i){if("radio"===i.type)if(i.checked&&g(this._element).hasClass(b))t=!1;else{var r=g(n).find(A)[0];r&&g(r).removeClass(b)}if(t){if(i.hasAttribute("disabled")||n.hasAttribute("disabled")||i.classList.contains("disabled")||n.classList.contains("disabled"))return;i.checked=!g(this._element).hasClass(b),g(i).trigger("change")}i.focus(),e=!1}}e&&this._element.setAttribute("aria-pressed",!g(this._element).hasClass(b)),t&&g(this._element).toggleClass(b)},t.dispose=function(){g.removeData(this._element,_),this._element=null},n._jQueryInterface=function(e){return this.each(function(){var t=g(this).data(_);t||(t=new n(this),g(this).data(_,t)),"toggle"===e&&t[e]()})},s(n,null,[{key:"VERSION",get:function(){return"4.1.1"}}]),n}(),g(document).on(O.CLICK_DATA_API,w,function(t){t.preventDefault();var e=t.target;g(e).hasClass(T)||(e=g(e).closest(S)),N._jQueryInterface.call(g(e),"toggle")}).on(O.FOCUS_BLUR_DATA_API,w,function(t){var e=g(t.target).closest(S)[0];g(e).toggleClass(C,/^focus(in)?$/.test(t.type))}),g.fn[m]=N._jQueryInterface,g.fn[m].Constructor=N,g.fn[m].noConflict=function(){return g.fn[m]=y,N._jQueryInterface},N),vt=(L="carousel",x="."+(P="bs.carousel"),j=".data-api",M=(k=e).fn[L],R={interval:5e3,keyboard:!0,slide:!1,pause:"hover",wrap:!0},H={interval:"(number|boolean)",keyboard:"boolean",slide:"(boolean|string)",pause:"(string|boolean)",wrap:"boolean"},W="next",F="prev",U="left",B="right",K={SLIDE:"slide"+x,SLID:"slid"+x,KEYDOWN:"keydown"+x,MOUSEENTER:"mouseenter"+x,MOUSELEAVE:"mouseleave"+x,TOUCHEND:"touchend"+x,LOAD_DATA_API:"load"+x+j,CLICK_DATA_API:"click"+x+j},V="carousel",Q="active",Y="slide",G="carousel-item-right",q="carousel-item-left",z="carousel-item-next",X="carousel-item-prev",J={ACTIVE:".active",ACTIVE_ITEM:".active.carousel-item",ITEM:".carousel-item",NEXT_PREV:".carousel-item-next, .carousel-item-prev",INDICATORS:".carousel-indicators",DATA_SLIDE:"[data-slide], [data-slide-to]",DATA_RIDE:'[data-ride="carousel"]'},Z=function(){function o(t,e){this._items=null,this._interval=null,this._activeElement=null,this._isPaused=!1,this._isSliding=!1,this.touchTimeout=null,this._config=this._getConfig(e),this._element=k(t)[0],this._indicatorsElement=k(this._element).find(J.INDICATORS)[0],this._addEventListeners()}var t=o.prototype;return t.next=function(){this._isSliding||this._slide(W)},t.nextWhenVisible=function(){!document.hidden&&k(this._element).is(":visible")&&"hidden"!==k(this._element).css("visibility")&&this.next()},t.prev=function(){this._isSliding||this._slide(F)},t.pause=function(t){t||(this._isPaused=!0),k(this._element).find(J.NEXT_PREV)[0]&&(gt.triggerTransitionEnd(this._element),this.cycle(!0)),clearInterval(this._interval),this._interval=null},t.cycle=function(t){t||(this._isPaused=!1),this._interval&&(clearInterval(this._interval),this._interval=null),this._config.interval&&!this._isPaused&&(this._interval=setInterval((document.visibilityState?this.nextWhenVisible:this.next).bind(this),this._config.interval))},t.to=function(t){var e=this;this._activeElement=k(this._element).find(J.ACTIVE_ITEM)[0];var n=this._getItemIndex(this._activeElement);if(!(t>this._items.length-1||t<0))if(this._isSliding)k(this._element).one(K.SLID,function(){return e.to(t)});else{if(n===t)return this.pause(),void this.cycle();var i=n<t?W:F;this._slide(i,this._items[t])}},t.dispose=function(){k(this._element).off(x),k.removeData(this._element,P),this._items=null,this._config=null,this._element=null,this._interval=null,this._isPaused=null,this._isSliding=null,this._activeElement=null,this._indicatorsElement=null},t._getConfig=function(t){return t=c({},R,t),gt.typeCheckConfig(L,t,H),t},t._addEventListeners=function(){var e=this;this._config.keyboard&&k(this._element).on(K.KEYDOWN,function(t){return e._keydown(t)}),"hover"===this._config.pause&&(k(this._element).on(K.MOUSEENTER,function(t){return e.pause(t)}).on(K.MOUSELEAVE,function(t){return e.cycle(t)}),"ontouchstart"in document.documentElement&&k(this._element).on(K.TOUCHEND,function(){e.pause(),e.touchTimeout&&clearTimeout(e.touchTimeout),e.touchTimeout=setTimeout(function(t){return e.cycle(t)},500+e._config.interval)}))},t._keydown=function(t){if(!/input|textarea/i.test(t.target.tagName))switch(t.which){case 37:t.preventDefault(),this.prev();break;case 39:t.preventDefault(),this.next()}},t._getItemIndex=function(t){return this._items=k.makeArray(k(t).parent().find(J.ITEM)),this._items.indexOf(t)},t._getItemByDirection=function(t,e){var n=t===W,i=t===F,r=this._getItemIndex(e),o=this._items.length-1;if((i&&0===r||n&&r===o)&&!this._config.wrap)return e;var s=(r+(t===F?-1:1))%this._items.length;return-1===s?this._items[this._items.length-1]:this._items[s]},t._triggerSlideEvent=function(t,e){var n=this._getItemIndex(t),i=this._getItemIndex(k(this._element).find(J.ACTIVE_ITEM)[0]),r=k.Event(K.SLIDE,{relatedTarget:t,direction:e,from:i,to:n});return k(this._element).trigger(r),r},t._setActiveIndicatorElement=function(t){if(this._indicatorsElement){k(this._indicatorsElement).find(J.ACTIVE).removeClass(Q);var e=this._indicatorsElement.children[this._getItemIndex(t)];e&&k(e).addClass(Q)}},t._slide=function(t,e){var n,i,r,o=this,s=k(this._element).find(J.ACTIVE_ITEM)[0],a=this._getItemIndex(s),l=e||s&&this._getItemByDirection(t,s),c=this._getItemIndex(l),f=Boolean(this._interval);if(t===W?(n=q,i=z,r=U):(n=G,i=X,r=B),l&&k(l).hasClass(Q))this._isSliding=!1;else if(!this._triggerSlideEvent(l,r).isDefaultPrevented()&&s&&l){this._isSliding=!0,f&&this.pause(),this._setActiveIndicatorElement(l);var h=k.Event(K.SLID,{relatedTarget:l,direction:r,from:a,to:c});if(k(this._element).hasClass(Y)){k(l).addClass(i),gt.reflow(l),k(s).addClass(n),k(l).addClass(n);var u=gt.getTransitionDurationFromElement(s);k(s).one(gt.TRANSITION_END,function(){k(l).removeClass(n+" "+i).addClass(Q),k(s).removeClass(Q+" "+i+" "+n),o._isSliding=!1,setTimeout(function(){return k(o._element).trigger(h)},0)}).emulateTransitionEnd(u)}else k(s).removeClass(Q),k(l).addClass(Q),this._isSliding=!1,k(this._element).trigger(h);f&&this.cycle()}},o._jQueryInterface=function(i){return this.each(function(){var t=k(this).data(P),e=c({},R,k(this).data());"object"==typeof i&&(e=c({},e,i));var n="string"==typeof i?i:e.slide;if(t||(t=new o(this,e),k(this).data(P,t)),"number"==typeof i)t.to(i);else if("string"==typeof n){if("undefined"==typeof t[n])throw new TypeError('No method named "'+n+'"');t[n]()}else e.interval&&(t.pause(),t.cycle())})},o._dataApiClickHandler=function(t){var e=gt.getSelectorFromElement(this);if(e){var n=k(e)[0];if(n&&k(n).hasClass(V)){var i=c({},k(n).data(),k(this).data()),r=this.getAttribute("data-slide-to");r&&(i.interval=!1),o._jQueryInterface.call(k(n),i),r&&k(n).data(P).to(r),t.preventDefault()}}},s(o,null,[{key:"VERSION",get:function(){return"4.1.1"}},{key:"Default",get:function(){return R}}]),o}(),k(document).on(K.CLICK_DATA_API,J.DATA_SLIDE,Z._dataApiClickHandler),k(window).on(K.LOAD_DATA_API,function(){k(J.DATA_RIDE).each(function(){var t=k(this);Z._jQueryInterface.call(t,t.data())})}),k.fn[L]=Z._jQueryInterface,k.fn[L].Constructor=Z,k.fn[L].noConflict=function(){return k.fn[L]=M,Z._jQueryInterface},Z),Et=(tt="collapse",nt="."+(et="bs.collapse"),it=($=e).fn[tt],rt={toggle:!0,parent:""},ot={toggle:"boolean",parent:"(string|element)"},st={SHOW:"show"+nt,SHOWN:"shown"+nt,HIDE:"hide"+nt,HIDDEN:"hidden"+nt,CLICK_DATA_API:"click"+nt+".data-api"},at="show",lt="collapse",ct="collapsing",ft="collapsed",ht="width",ut="height",dt={ACTIVES:".show, .collapsing",DATA_TOGGLE:'[data-toggle="collapse"]'},pt=function(){function a(t,e){this._isTransitioning=!1,this._element=t,this._config=this._getConfig(e),this._triggerArray=$.makeArray($('[data-toggle="collapse"][href="#'+t.id+'"],[data-toggle="collapse"][data-target="#'+t.id+'"]'));for(var n=$(dt.DATA_TOGGLE),i=0;i<n.length;i++){var r=n[i],o=gt.getSelectorFromElement(r);null!==o&&0<$(o).filter(t).length&&(this._selector=o,this._triggerArray.push(r))}this._parent=this._config.parent?this._getParent():null,this._config.parent||this._addAriaAndCollapsedClass(this._element,this._triggerArray),this._config.toggle&&this.toggle()}var t=a.prototype;return t.toggle=function(){$(this._element).hasClass(at)?this.hide():this.show()},t.show=function(){var t,e,n=this;if(!this._isTransitioning&&!$(this._element).hasClass(at)&&(this._parent&&0===(t=$.makeArray($(this._parent).find(dt.ACTIVES).filter('[data-parent="'+this._config.parent+'"]'))).length&&(t=null),!(t&&(e=$(t).not(this._selector).data(et))&&e._isTransitioning))){var i=$.Event(st.SHOW);if($(this._element).trigger(i),!i.isDefaultPrevented()){t&&(a._jQueryInterface.call($(t).not(this._selector),"hide"),e||$(t).data(et,null));var r=this._getDimension();$(this._element).removeClass(lt).addClass(ct),(this._element.style[r]=0)<this._triggerArray.length&&$(this._triggerArray).removeClass(ft).attr("aria-expanded",!0),this.setTransitioning(!0);var o="scroll"+(r[0].toUpperCase()+r.slice(1)),s=gt.getTransitionDurationFromElement(this._element);$(this._element).one(gt.TRANSITION_END,function(){$(n._element).removeClass(ct).addClass(lt).addClass(at),n._element.style[r]="",n.setTransitioning(!1),$(n._element).trigger(st.SHOWN)}).emulateTransitionEnd(s),this._element.style[r]=this._element[o]+"px"}}},t.hide=function(){var t=this;if(!this._isTransitioning&&$(this._element).hasClass(at)){var e=$.Event(st.HIDE);if($(this._element).trigger(e),!e.isDefaultPrevented()){var n=this._getDimension();if(this._element.style[n]=this._element.getBoundingClientRect()[n]+"px",gt.reflow(this._element),$(this._element).addClass(ct).removeClass(lt).removeClass(at),0<this._triggerArray.length)for(var i=0;i<this._triggerArray.length;i++){var r=this._triggerArray[i],o=gt.getSelectorFromElement(r);if(null!==o)$(o).hasClass(at)||$(r).addClass(ft).attr("aria-expanded",!1)}this.setTransitioning(!0);this._element.style[n]="";var s=gt.getTransitionDurationFromElement(this._element);$(this._element).one(gt.TRANSITION_END,function(){t.setTransitioning(!1),$(t._element).removeClass(ct).addClass(lt).trigger(st.HIDDEN)}).emulateTransitionEnd(s)}}},t.setTransitioning=function(t){this._isTransitioning=t},t.dispose=function(){$.removeData(this._element,et),this._config=null,this._parent=null,this._element=null,this._triggerArray=null,this._isTransitioning=null},t._getConfig=function(t){return(t=c({},rt,t)).toggle=Boolean(t.toggle),gt.typeCheckConfig(tt,t,ot),t},t._getDimension=function(){return $(this._element).hasClass(ht)?ht:ut},t._getParent=function(){var n=this,t=null;gt.isElement(this._config.parent)?(t=this._config.parent,"undefined"!=typeof this._config.parent.jquery&&(t=this._config.parent[0])):t=$(this._config.parent)[0];var e='[data-toggle="collapse"][data-parent="'+this._config.parent+'"]';return $(t).find(e).each(function(t,e){n._addAriaAndCollapsedClass(a._getTargetFromElement(e),[e])}),t},t._addAriaAndCollapsedClass=function(t,e){if(t){var n=$(t).hasClass(at);0<e.length&&$(e).toggleClass(ft,!n).attr("aria-expanded",n)}},a._getTargetFromElement=function(t){var e=gt.getSelectorFromElement(t);return e?$(e)[0]:null},a._jQueryInterface=function(i){return this.each(function(){var t=$(this),e=t.data(et),n=c({},rt,t.data(),"object"==typeof i&&i?i:{});if(!e&&n.toggle&&/show|hide/.test(i)&&(n.toggle=!1),e||(e=new a(this,n),t.data(et,e)),"string"==typeof i){if("undefined"==typeof e[i])throw new TypeError('No method named "'+i+'"');e[i]()}})},s(a,null,[{key:"VERSION",get:function(){return"4.1.1"}},{key:"Default",get:function(){return rt}}]),a}(),$(document).on(st.CLICK_DATA_API,dt.DATA_TOGGLE,function(t){"A"===t.currentTarget.tagName&&t.preventDefault();var n=$(this),e=gt.getSelectorFromElement(this);$(e).each(function(){var t=$(this),e=t.data(et)?"toggle":n.data();pt._jQueryInterface.call(t,e)})}),$.fn[tt]=pt._jQueryInterface,$.fn[tt].Constructor=pt,$.fn[tt].noConflict=function(){return $.fn[tt]=it,pt._jQueryInterface},pt),yt="undefined"!=typeof window&&"undefined"!=typeof document,bt=["Edge","Trident","Firefox"],Tt=0,Ct=0;Ct<bt.length;Ct+=1)if(yt&&0<=navigator.userAgent.indexOf(bt[Ct])){Tt=1;break}var wt=yt&&window.Promise?function(t){var e=!1;return function(){e||(e=!0,window.Promise.resolve().then(function(){e=!1,t()}))}}:function(t){var e=!1;return function(){e||(e=!0,setTimeout(function(){e=!1,t()},Tt))}};function It(t){return t&&"[object Function]"==={}.toString.call(t)}function Dt(t,e){if(1!==t.nodeType)return[];var n=getComputedStyle(t,null);return e?n[e]:n}function At(t){return"HTML"===t.nodeName?t:t.parentNode||t.host}function St(t){if(!t)return document.body;switch(t.nodeName){case"HTML":case"BODY":return t.ownerDocument.body;case"#document":return t.body}var e=Dt(t),n=e.overflow,i=e.overflowX,r=e.overflowY;return/(auto|scroll|overlay)/.test(n+r+i)?t:St(At(t))}var Ot=yt&&!(!window.MSInputMethodContext||!document.documentMode),Nt=yt&&/MSIE 10/.test(navigator.userAgent);function kt(t){return 11===t?Ot:10===t?Nt:Ot||Nt}function Lt(t){if(!t)return document.documentElement;for(var e=kt(10)?document.body:null,n=t.offsetParent;n===e&&t.nextElementSibling;)n=(t=t.nextElementSibling).offsetParent;var i=n&&n.nodeName;return i&&"BODY"!==i&&"HTML"!==i?-1!==["TD","TABLE"].indexOf(n.nodeName)&&"static"===Dt(n,"position")?Lt(n):n:t?t.ownerDocument.documentElement:document.documentElement}function Pt(t){return null!==t.parentNode?Pt(t.parentNode):t}function xt(t,e){if(!(t&&t.nodeType&&e&&e.nodeType))return document.documentElement;var n=t.compareDocumentPosition(e)&Node.DOCUMENT_POSITION_FOLLOWING,i=n?t:e,r=n?e:t,o=document.createRange();o.setStart(i,0),o.setEnd(r,0);var s,a,l=o.commonAncestorContainer;if(t!==l&&e!==l||i.contains(r))return"BODY"===(a=(s=l).nodeName)||"HTML"!==a&&Lt(s.firstElementChild)!==s?Lt(l):l;var c=Pt(t);return c.host?xt(c.host,e):xt(t,Pt(e).host)}function jt(t){var e="top"===(1<arguments.length&&void 0!==arguments[1]?arguments[1]:"top")?"scrollTop":"scrollLeft",n=t.nodeName;if("BODY"===n||"HTML"===n){var i=t.ownerDocument.documentElement;return(t.ownerDocument.scrollingElement||i)[e]}return t[e]}function Mt(t,e){var n="x"===e?"Left":"Top",i="Left"===n?"Right":"Bottom";return parseFloat(t["border"+n+"Width"],10)+parseFloat(t["border"+i+"Width"],10)}function Rt(t,e,n,i){return Math.max(e["offset"+t],e["scroll"+t],n["client"+t],n["offset"+t],n["scroll"+t],kt(10)?n["offset"+t]+i["margin"+("Height"===t?"Top":"Left")]+i["margin"+("Height"===t?"Bottom":"Right")]:0)}function Ht(){var t=document.body,e=document.documentElement,n=kt(10)&&getComputedStyle(e);return{height:Rt("Height",t,e,n),width:Rt("Width",t,e,n)}}var Wt=function(t,e){if(!(t instanceof e))throw new TypeError("Cannot call a class as a function")},Ft=function(){function i(t,e){for(var n=0;n<e.length;n++){var i=e[n];i.enumerable=i.enumerable||!1,i.configurable=!0,"value"in i&&(i.writable=!0),Object.defineProperty(t,i.key,i)}}return function(t,e,n){return e&&i(t.prototype,e),n&&i(t,n),t}}(),Ut=function(t,e,n){return e in t?Object.defineProperty(t,e,{value:n,enumerable:!0,configurable:!0,writable:!0}):t[e]=n,t},Bt=Object.assign||function(t){for(var e=1;e<arguments.length;e++){var n=arguments[e];for(var i in n)Object.prototype.hasOwnProperty.call(n,i)&&(t[i]=n[i])}return t};function Kt(t){return Bt({},t,{right:t.left+t.width,bottom:t.top+t.height})}function Vt(t){var e={};try{if(kt(10)){e=t.getBoundingClientRect();var n=jt(t,"top"),i=jt(t,"left");e.top+=n,e.left+=i,e.bottom+=n,e.right+=i}else e=t.getBoundingClientRect()}catch(t){}var r={left:e.left,top:e.top,width:e.right-e.left,height:e.bottom-e.top},o="HTML"===t.nodeName?Ht():{},s=o.width||t.clientWidth||r.right-r.left,a=o.height||t.clientHeight||r.bottom-r.top,l=t.offsetWidth-s,c=t.offsetHeight-a;if(l||c){var f=Dt(t);l-=Mt(f,"x"),c-=Mt(f,"y"),r.width-=l,r.height-=c}return Kt(r)}function Qt(t,e){var n=2<arguments.length&&void 0!==arguments[2]&&arguments[2],i=kt(10),r="HTML"===e.nodeName,o=Vt(t),s=Vt(e),a=St(t),l=Dt(e),c=parseFloat(l.borderTopWidth,10),f=parseFloat(l.borderLeftWidth,10);n&&"HTML"===e.nodeName&&(s.top=Math.max(s.top,0),s.left=Math.max(s.left,0));var h=Kt({top:o.top-s.top-c,left:o.left-s.left-f,width:o.width,height:o.height});if(h.marginTop=0,h.marginLeft=0,!i&&r){var u=parseFloat(l.marginTop,10),d=parseFloat(l.marginLeft,10);h.top-=c-u,h.bottom-=c-u,h.left-=f-d,h.right-=f-d,h.marginTop=u,h.marginLeft=d}return(i&&!n?e.contains(a):e===a&&"BODY"!==a.nodeName)&&(h=function(t,e){var n=2<arguments.length&&void 0!==arguments[2]&&arguments[2],i=jt(e,"top"),r=jt(e,"left"),o=n?-1:1;return t.top+=i*o,t.bottom+=i*o,t.left+=r*o,t.right+=r*o,t}(h,e)),h}function Yt(t){if(!t||!t.parentElement||kt())return document.documentElement;for(var e=t.parentElement;e&&"none"===Dt(e,"transform");)e=e.parentElement;return e||document.documentElement}function Gt(t,e,n,i){var r=4<arguments.length&&void 0!==arguments[4]&&arguments[4],o={top:0,left:0},s=r?Yt(t):xt(t,e);if("viewport"===i)o=function(t){var e=1<arguments.length&&void 0!==arguments[1]&&arguments[1],n=t.ownerDocument.documentElement,i=Qt(t,n),r=Math.max(n.clientWidth,window.innerWidth||0),o=Math.max(n.clientHeight,window.innerHeight||0),s=e?0:jt(n),a=e?0:jt(n,"left");return Kt({top:s-i.top+i.marginTop,left:a-i.left+i.marginLeft,width:r,height:o})}(s,r);else{var a=void 0;"scrollParent"===i?"BODY"===(a=St(At(e))).nodeName&&(a=t.ownerDocument.documentElement):a="window"===i?t.ownerDocument.documentElement:i;var l=Qt(a,s,r);if("HTML"!==a.nodeName||function t(e){var n=e.nodeName;return"BODY"!==n&&"HTML"!==n&&("fixed"===Dt(e,"position")||t(At(e)))}(s))o=l;else{var c=Ht(),f=c.height,h=c.width;o.top+=l.top-l.marginTop,o.bottom=f+l.top,o.left+=l.left-l.marginLeft,o.right=h+l.left}}return o.left+=n,o.top+=n,o.right-=n,o.bottom-=n,o}function qt(t,e,i,n,r){var o=5<arguments.length&&void 0!==arguments[5]?arguments[5]:0;if(-1===t.indexOf("auto"))return t;var s=Gt(i,n,o,r),a={top:{width:s.width,height:e.top-s.top},right:{width:s.right-e.right,height:s.height},bottom:{width:s.width,height:s.bottom-e.bottom},left:{width:e.left-s.left,height:s.height}},l=Object.keys(a).map(function(t){return Bt({key:t},a[t],{area:(e=a[t],e.width*e.height)});var e}).sort(function(t,e){return e.area-t.area}),c=l.filter(function(t){var e=t.width,n=t.height;return e>=i.clientWidth&&n>=i.clientHeight}),f=0<c.length?c[0].key:l[0].key,h=t.split("-")[1];return f+(h?"-"+h:"")}function zt(t,e,n){var i=3<arguments.length&&void 0!==arguments[3]?arguments[3]:null;return Qt(n,i?Yt(e):xt(e,n),i)}function Xt(t){var e=getComputedStyle(t),n=parseFloat(e.marginTop)+parseFloat(e.marginBottom),i=parseFloat(e.marginLeft)+parseFloat(e.marginRight);return{width:t.offsetWidth+i,height:t.offsetHeight+n}}function Jt(t){var e={left:"right",right:"left",bottom:"top",top:"bottom"};return t.replace(/left|right|bottom|top/g,function(t){return e[t]})}function Zt(t,e,n){n=n.split("-")[0];var i=Xt(t),r={width:i.width,height:i.height},o=-1!==["right","left"].indexOf(n),s=o?"top":"left",a=o?"left":"top",l=o?"height":"width",c=o?"width":"height";return r[s]=e[s]+e[l]/2-i[l]/2,r[a]=n===a?e[a]-i[c]:e[Jt(a)],r}function $t(t,e){return Array.prototype.find?t.find(e):t.filter(e)[0]}function te(t,n,e){return(void 0===e?t:t.slice(0,function(t,e,n){if(Array.prototype.findIndex)return t.findIndex(function(t){return t[e]===n});var i=$t(t,function(t){return t[e]===n});return t.indexOf(i)}(t,"name",e))).forEach(function(t){t.function&&console.warn("`modifier.function` is deprecated, use `modifier.fn`!");var e=t.function||t.fn;t.enabled&&It(e)&&(n.offsets.popper=Kt(n.offsets.popper),n.offsets.reference=Kt(n.offsets.reference),n=e(n,t))}),n}function ee(t,n){return t.some(function(t){var e=t.name;return t.enabled&&e===n})}function ne(t){for(var e=[!1,"ms","Webkit","Moz","O"],n=t.charAt(0).toUpperCase()+t.slice(1),i=0;i<e.length;i++){var r=e[i],o=r?""+r+n:t;if("undefined"!=typeof document.body.style[o])return o}return null}function ie(t){var e=t.ownerDocument;return e?e.defaultView:window}function re(t,e,n,i){n.updateBound=i,ie(t).addEventListener("resize",n.updateBound,{passive:!0});var r=St(t);return function t(e,n,i,r){var o="BODY"===e.nodeName,s=o?e.ownerDocument.defaultView:e;s.addEventListener(n,i,{passive:!0}),o||t(St(s.parentNode),n,i,r),r.push(s)}(r,"scroll",n.updateBound,n.scrollParents),n.scrollElement=r,n.eventsEnabled=!0,n}function oe(){var t,e;this.state.eventsEnabled&&(cancelAnimationFrame(this.scheduleUpdate),this.state=(t=this.reference,e=this.state,ie(t).removeEventListener("resize",e.updateBound),e.scrollParents.forEach(function(t){t.removeEventListener("scroll",e.updateBound)}),e.updateBound=null,e.scrollParents=[],e.scrollElement=null,e.eventsEnabled=!1,e))}function se(t){return""!==t&&!isNaN(parseFloat(t))&&isFinite(t)}function ae(n,i){Object.keys(i).forEach(function(t){var e="";-1!==["width","height","top","right","bottom","left"].indexOf(t)&&se(i[t])&&(e="px"),n.style[t]=i[t]+e})}function le(t,e,n){var i=$t(t,function(t){return t.name===e}),r=!!i&&t.some(function(t){return t.name===n&&t.enabled&&t.order<i.order});if(!r){var o="`"+e+"`",s="`"+n+"`";console.warn(s+" modifier is required by "+o+" modifier in order to work, be sure to include it before "+o+"!")}return r}var ce=["auto-start","auto","auto-end","top-start","top","top-end","right-start","right","right-end","bottom-end","bottom","bottom-start","left-end","left","left-start"],fe=ce.slice(3);function he(t){var e=1<arguments.length&&void 0!==arguments[1]&&arguments[1],n=fe.indexOf(t),i=fe.slice(n+1).concat(fe.slice(0,n));return e?i.reverse():i}var ue={FLIP:"flip",CLOCKWISE:"clockwise",COUNTERCLOCKWISE:"counterclockwise"};function de(t,r,o,e){var s=[0,0],a=-1!==["right","left"].indexOf(e),n=t.split(/(\+|\-)/).map(function(t){return t.trim()}),i=n.indexOf($t(n,function(t){return-1!==t.search(/,|\s/)}));n[i]&&-1===n[i].indexOf(",")&&console.warn("Offsets separated by white space(s) are deprecated, use a comma (,) instead.");var l=/\s*,\s*|\s+/,c=-1!==i?[n.slice(0,i).concat([n[i].split(l)[0]]),[n[i].split(l)[1]].concat(n.slice(i+1))]:[n];return(c=c.map(function(t,e){var n=(1===e?!a:a)?"height":"width",i=!1;return t.reduce(function(t,e){return""===t[t.length-1]&&-1!==["+","-"].indexOf(e)?(t[t.length-1]=e,i=!0,t):i?(t[t.length-1]+=e,i=!1,t):t.concat(e)},[]).map(function(t){return function(t,e,n,i){var r=t.match(/((?:\-|\+)?\d*\.?\d*)(.*)/),o=+r[1],s=r[2];if(!o)return t;if(0===s.indexOf("%")){var a=void 0;switch(s){case"%p":a=n;break;case"%":case"%r":default:a=i}return Kt(a)[e]/100*o}if("vh"===s||"vw"===s)return("vh"===s?Math.max(document.documentElement.clientHeight,window.innerHeight||0):Math.max(document.documentElement.clientWidth,window.innerWidth||0))/100*o;return o}(t,n,r,o)})})).forEach(function(n,i){n.forEach(function(t,e){se(t)&&(s[i]+=t*("-"===n[e-1]?-1:1))})}),s}var pe={placement:"bottom",positionFixed:!1,eventsEnabled:!0,removeOnDestroy:!1,onCreate:function(){},onUpdate:function(){},modifiers:{shift:{order:100,enabled:!0,fn:function(t){var e=t.placement,n=e.split("-")[0],i=e.split("-")[1];if(i){var r=t.offsets,o=r.reference,s=r.popper,a=-1!==["bottom","top"].indexOf(n),l=a?"left":"top",c=a?"width":"height",f={start:Ut({},l,o[l]),end:Ut({},l,o[l]+o[c]-s[c])};t.offsets.popper=Bt({},s,f[i])}return t}},offset:{order:200,enabled:!0,fn:function(t,e){var n=e.offset,i=t.placement,r=t.offsets,o=r.popper,s=r.reference,a=i.split("-")[0],l=void 0;return l=se(+n)?[+n,0]:de(n,o,s,a),"left"===a?(o.top+=l[0],o.left-=l[1]):"right"===a?(o.top+=l[0],o.left+=l[1]):"top"===a?(o.left+=l[0],o.top-=l[1]):"bottom"===a&&(o.left+=l[0],o.top+=l[1]),t.popper=o,t},offset:0},preventOverflow:{order:300,enabled:!0,fn:function(t,i){var e=i.boundariesElement||Lt(t.instance.popper);t.instance.reference===e&&(e=Lt(e));var n=ne("transform"),r=t.instance.popper.style,o=r.top,s=r.left,a=r[n];r.top="",r.left="",r[n]="";var l=Gt(t.instance.popper,t.instance.reference,i.padding,e,t.positionFixed);r.top=o,r.left=s,r[n]=a,i.boundaries=l;var c=i.priority,f=t.offsets.popper,h={primary:function(t){var e=f[t];return f[t]<l[t]&&!i.escapeWithReference&&(e=Math.max(f[t],l[t])),Ut({},t,e)},secondary:function(t){var e="right"===t?"left":"top",n=f[e];return f[t]>l[t]&&!i.escapeWithReference&&(n=Math.min(f[e],l[t]-("right"===t?f.width:f.height))),Ut({},e,n)}};return c.forEach(function(t){var e=-1!==["left","top"].indexOf(t)?"primary":"secondary";f=Bt({},f,h[e](t))}),t.offsets.popper=f,t},priority:["left","right","top","bottom"],padding:5,boundariesElement:"scrollParent"},keepTogether:{order:400,enabled:!0,fn:function(t){var e=t.offsets,n=e.popper,i=e.reference,r=t.placement.split("-")[0],o=Math.floor,s=-1!==["top","bottom"].indexOf(r),a=s?"right":"bottom",l=s?"left":"top",c=s?"width":"height";return n[a]<o(i[l])&&(t.offsets.popper[l]=o(i[l])-n[c]),n[l]>o(i[a])&&(t.offsets.popper[l]=o(i[a])),t}},arrow:{order:500,enabled:!0,fn:function(t,e){var n;if(!le(t.instance.modifiers,"arrow","keepTogether"))return t;var i=e.element;if("string"==typeof i){if(!(i=t.instance.popper.querySelector(i)))return t}else if(!t.instance.popper.contains(i))return console.warn("WARNING: `arrow.element` must be child of its popper element!"),t;var r=t.placement.split("-")[0],o=t.offsets,s=o.popper,a=o.reference,l=-1!==["left","right"].indexOf(r),c=l?"height":"width",f=l?"Top":"Left",h=f.toLowerCase(),u=l?"left":"top",d=l?"bottom":"right",p=Xt(i)[c];a[d]-p<s[h]&&(t.offsets.popper[h]-=s[h]-(a[d]-p)),a[h]+p>s[d]&&(t.offsets.popper[h]+=a[h]+p-s[d]),t.offsets.popper=Kt(t.offsets.popper);var g=a[h]+a[c]/2-p/2,m=Dt(t.instance.popper),_=parseFloat(m["margin"+f],10),v=parseFloat(m["border"+f+"Width"],10),E=g-t.offsets.popper[h]-_-v;return E=Math.max(Math.min(s[c]-p,E),0),t.arrowElement=i,t.offsets.arrow=(Ut(n={},h,Math.round(E)),Ut(n,u,""),n),t},element:"[x-arrow]"},flip:{order:600,enabled:!0,fn:function(p,g){if(ee(p.instance.modifiers,"inner"))return p;if(p.flipped&&p.placement===p.originalPlacement)return p;var m=Gt(p.instance.popper,p.instance.reference,g.padding,g.boundariesElement,p.positionFixed),_=p.placement.split("-")[0],v=Jt(_),E=p.placement.split("-")[1]||"",y=[];switch(g.behavior){case ue.FLIP:y=[_,v];break;case ue.CLOCKWISE:y=he(_);break;case ue.COUNTERCLOCKWISE:y=he(_,!0);break;default:y=g.behavior}return y.forEach(function(t,e){if(_!==t||y.length===e+1)return p;_=p.placement.split("-")[0],v=Jt(_);var n,i=p.offsets.popper,r=p.offsets.reference,o=Math.floor,s="left"===_&&o(i.right)>o(r.left)||"right"===_&&o(i.left)<o(r.right)||"top"===_&&o(i.bottom)>o(r.top)||"bottom"===_&&o(i.top)<o(r.bottom),a=o(i.left)<o(m.left),l=o(i.right)>o(m.right),c=o(i.top)<o(m.top),f=o(i.bottom)>o(m.bottom),h="left"===_&&a||"right"===_&&l||"top"===_&&c||"bottom"===_&&f,u=-1!==["top","bottom"].indexOf(_),d=!!g.flipVariations&&(u&&"start"===E&&a||u&&"end"===E&&l||!u&&"start"===E&&c||!u&&"end"===E&&f);(s||h||d)&&(p.flipped=!0,(s||h)&&(_=y[e+1]),d&&(E="end"===(n=E)?"start":"start"===n?"end":n),p.placement=_+(E?"-"+E:""),p.offsets.popper=Bt({},p.offsets.popper,Zt(p.instance.popper,p.offsets.reference,p.placement)),p=te(p.instance.modifiers,p,"flip"))}),p},behavior:"flip",padding:5,boundariesElement:"viewport"},inner:{order:700,enabled:!1,fn:function(t){var e=t.placement,n=e.split("-")[0],i=t.offsets,r=i.popper,o=i.reference,s=-1!==["left","right"].indexOf(n),a=-1===["top","left"].indexOf(n);return r[s?"left":"top"]=o[n]-(a?r[s?"width":"height"]:0),t.placement=Jt(e),t.offsets.popper=Kt(r),t}},hide:{order:800,enabled:!0,fn:function(t){if(!le(t.instance.modifiers,"hide","preventOverflow"))return t;var e=t.offsets.reference,n=$t(t.instance.modifiers,function(t){return"preventOverflow"===t.name}).boundaries;if(e.bottom<n.top||e.left>n.right||e.top>n.bottom||e.right<n.left){if(!0===t.hide)return t;t.hide=!0,t.attributes["x-out-of-boundaries"]=""}else{if(!1===t.hide)return t;t.hide=!1,t.attributes["x-out-of-boundaries"]=!1}return t}},computeStyle:{order:850,enabled:!0,fn:function(t,e){var n=e.x,i=e.y,r=t.offsets.popper,o=$t(t.instance.modifiers,function(t){return"applyStyle"===t.name}).gpuAcceleration;void 0!==o&&console.warn("WARNING: `gpuAcceleration` option moved to `computeStyle` modifier and will not be supported in future versions of Popper.js!");var s=void 0!==o?o:e.gpuAcceleration,a=Vt(Lt(t.instance.popper)),l={position:r.position},c={left:Math.floor(r.left),top:Math.round(r.top),bottom:Math.round(r.bottom),right:Math.floor(r.right)},f="bottom"===n?"top":"bottom",h="right"===i?"left":"right",u=ne("transform"),d=void 0,p=void 0;if(p="bottom"===f?-a.height+c.bottom:c.top,d="right"===h?-a.width+c.right:c.left,s&&u)l[u]="translate3d("+d+"px, "+p+"px, 0)",l[f]=0,l[h]=0,l.willChange="transform";else{var g="bottom"===f?-1:1,m="right"===h?-1:1;l[f]=p*g,l[h]=d*m,l.willChange=f+", "+h}var _={"x-placement":t.placement};return t.attributes=Bt({},_,t.attributes),t.styles=Bt({},l,t.styles),t.arrowStyles=Bt({},t.offsets.arrow,t.arrowStyles),t},gpuAcceleration:!0,x:"bottom",y:"right"},applyStyle:{order:900,enabled:!0,fn:function(t){var e,n;return ae(t.instance.popper,t.styles),e=t.instance.popper,n=t.attributes,Object.keys(n).forEach(function(t){!1!==n[t]?e.setAttribute(t,n[t]):e.removeAttribute(t)}),t.arrowElement&&Object.keys(t.arrowStyles).length&&ae(t.arrowElement,t.arrowStyles),t},onLoad:function(t,e,n,i,r){var o=zt(r,e,t,n.positionFixed),s=qt(n.placement,o,e,t,n.modifiers.flip.boundariesElement,n.modifiers.flip.padding);return e.setAttribute("x-placement",s),ae(e,{position:n.positionFixed?"fixed":"absolute"}),n},gpuAcceleration:void 0}}},ge=function(){function o(t,e){var n=this,i=2<arguments.length&&void 0!==arguments[2]?arguments[2]:{};Wt(this,o),this.scheduleUpdate=function(){return requestAnimationFrame(n.update)},this.update=wt(this.update.bind(this)),this.options=Bt({},o.Defaults,i),this.state={isDestroyed:!1,isCreated:!1,scrollParents:[]},this.reference=t&&t.jquery?t[0]:t,this.popper=e&&e.jquery?e[0]:e,this.options.modifiers={},Object.keys(Bt({},o.Defaults.modifiers,i.modifiers)).forEach(function(t){n.options.modifiers[t]=Bt({},o.Defaults.modifiers[t]||{},i.modifiers?i.modifiers[t]:{})}),this.modifiers=Object.keys(this.options.modifiers).map(function(t){return Bt({name:t},n.options.modifiers[t])}).sort(function(t,e){return t.order-e.order}),this.modifiers.forEach(function(t){t.enabled&&It(t.onLoad)&&t.onLoad(n.reference,n.popper,n.options,t,n.state)}),this.update();var r=this.options.eventsEnabled;r&&this.enableEventListeners(),this.state.eventsEnabled=r}return Ft(o,[{key:"update",value:function(){return function(){if(!this.state.isDestroyed){var t={instance:this,styles:{},arrowStyles:{},attributes:{},flipped:!1,offsets:{}};t.offsets.reference=zt(this.state,this.popper,this.reference,this.options.positionFixed),t.placement=qt(this.options.placement,t.offsets.reference,this.popper,this.reference,this.options.modifiers.flip.boundariesElement,this.options.modifiers.flip.padding),t.originalPlacement=t.placement,t.positionFixed=this.options.positionFixed,t.offsets.popper=Zt(this.popper,t.offsets.reference,t.placement),t.offsets.popper.position=this.options.positionFixed?"fixed":"absolute",t=te(this.modifiers,t),this.state.isCreated?this.options.onUpdate(t):(this.state.isCreated=!0,this.options.onCreate(t))}}.call(this)}},{key:"destroy",value:function(){return function(){return this.state.isDestroyed=!0,ee(this.modifiers,"applyStyle")&&(this.popper.removeAttribute("x-placement"),this.popper.style.position="",this.popper.style.top="",this.popper.style.left="",this.popper.style.right="",this.popper.style.bottom="",this.popper.style.willChange="",this.popper.style[ne("transform")]=""),this.disableEventListeners(),this.options.removeOnDestroy&&this.popper.parentNode.removeChild(this.popper),this}.call(this)}},{key:"enableEventListeners",value:function(){return function(){this.state.eventsEnabled||(this.state=re(this.reference,this.options,this.state,this.scheduleUpdate))}.call(this)}},{key:"disableEventListeners",value:function(){return oe.call(this)}}]),o}();ge.Utils=("undefined"!=typeof window?window:global).PopperUtils,ge.placements=ce,ge.Defaults=pe;var me,_e,ve,Ee,ye,be,Te,Ce,we,Ie,De,Ae,Se,Oe,Ne,ke,Le,Pe,xe,je,Me,Re,He,We,Fe,Ue,Be,Ke,Ve,Qe,Ye,Ge,qe,ze,Xe,Je,Ze,$e,tn,en,nn,rn,on,sn,an,ln,cn,fn,hn,un,dn,pn,gn,mn,_n,vn,En,yn,bn,Tn,Cn,wn,In,Dn,An,Sn,On,Nn,kn,Ln,Pn,xn,jn,Mn,Rn,Hn,Wn,Fn,Un,Bn,Kn,Vn,Qn,Yn,Gn,qn,zn,Xn,Jn,Zn,$n,ti,ei,ni,ii,ri,oi,si,ai,li,ci,fi,hi,ui,di,pi,gi,mi,_i,vi,Ei,yi,bi,Ti=(_e="dropdown",Ee="."+(ve="bs.dropdown"),ye=".data-api",be=(me=e).fn[_e],Te=new RegExp("38|40|27"),Ce={HIDE:"hide"+Ee,HIDDEN:"hidden"+Ee,SHOW:"show"+Ee,SHOWN:"shown"+Ee,CLICK:"click"+Ee,CLICK_DATA_API:"click"+Ee+ye,KEYDOWN_DATA_API:"keydown"+Ee+ye,KEYUP_DATA_API:"keyup"+Ee+ye},we="disabled",Ie="show",De="dropup",Ae="dropright",Se="dropleft",Oe="dropdown-menu-right",Ne="position-static",ke='[data-toggle="dropdown"]',Le=".dropdown form",Pe=".dropdown-menu",xe=".navbar-nav",je=".dropdown-menu .dropdown-item:not(.disabled):not(:disabled)",Me="top-start",Re="top-end",He="bottom-start",We="bottom-end",Fe="right-start",Ue="left-start",Be={offset:0,flip:!0,boundary:"scrollParent",reference:"toggle",display:"dynamic"},Ke={offset:"(number|string|function)",flip:"boolean",boundary:"(string|element)",reference:"(string|element)",display:"string"},Ve=function(){function l(t,e){this._element=t,this._popper=null,this._config=this._getConfig(e),this._menu=this._getMenuElement(),this._inNavbar=this._detectNavbar(),this._addEventListeners()}var t=l.prototype;return t.toggle=function(){if(!this._element.disabled&&!me(this._element).hasClass(we)){var t=l._getParentFromElement(this._element),e=me(this._menu).hasClass(Ie);if(l._clearMenus(),!e){var n={relatedTarget:this._element},i=me.Event(Ce.SHOW,n);if(me(t).trigger(i),!i.isDefaultPrevented()){if(!this._inNavbar){if("undefined"==typeof ge)throw new TypeError("Bootstrap dropdown require Popper.js (https://popper.js.org)");var r=this._element;"parent"===this._config.reference?r=t:gt.isElement(this._config.reference)&&(r=this._config.reference,"undefined"!=typeof this._config.reference.jquery&&(r=this._config.reference[0])),"scrollParent"!==this._config.boundary&&me(t).addClass(Ne),this._popper=new ge(r,this._menu,this._getPopperConfig())}"ontouchstart"in document.documentElement&&0===me(t).closest(xe).length&&me(document.body).children().on("mouseover",null,me.noop),this._element.focus(),this._element.setAttribute("aria-expanded",!0),me(this._menu).toggleClass(Ie),me(t).toggleClass(Ie).trigger(me.Event(Ce.SHOWN,n))}}}},t.dispose=function(){me.removeData(this._element,ve),me(this._element).off(Ee),this._element=null,(this._menu=null)!==this._popper&&(this._popper.destroy(),this._popper=null)},t.update=function(){this._inNavbar=this._detectNavbar(),null!==this._popper&&this._popper.scheduleUpdate()},t._addEventListeners=function(){var e=this;me(this._element).on(Ce.CLICK,function(t){t.preventDefault(),t.stopPropagation(),e.toggle()})},t._getConfig=function(t){return t=c({},this.constructor.Default,me(this._element).data(),t),gt.typeCheckConfig(_e,t,this.constructor.DefaultType),t},t._getMenuElement=function(){if(!this._menu){var t=l._getParentFromElement(this._element);this._menu=me(t).find(Pe)[0]}return this._menu},t._getPlacement=function(){var t=me(this._element).parent(),e=He;return t.hasClass(De)?(e=Me,me(this._menu).hasClass(Oe)&&(e=Re)):t.hasClass(Ae)?e=Fe:t.hasClass(Se)?e=Ue:me(this._menu).hasClass(Oe)&&(e=We),e},t._detectNavbar=function(){return 0<me(this._element).closest(".navbar").length},t._getPopperConfig=function(){var e=this,t={};"function"==typeof this._config.offset?t.fn=function(t){return t.offsets=c({},t.offsets,e._config.offset(t.offsets)||{}),t}:t.offset=this._config.offset;var n={placement:this._getPlacement(),modifiers:{offset:t,flip:{enabled:this._config.flip},preventOverflow:{boundariesElement:this._config.boundary}}};return"static"===this._config.display&&(n.modifiers.applyStyle={enabled:!1}),n},l._jQueryInterface=function(e){return this.each(function(){var t=me(this).data(ve);if(t||(t=new l(this,"object"==typeof e?e:null),me(this).data(ve,t)),"string"==typeof e){if("undefined"==typeof t[e])throw new TypeError('No method named "'+e+'"');t[e]()}})},l._clearMenus=function(t){if(!t||3!==t.which&&("keyup"!==t.type||9===t.which))for(var e=me.makeArray(me(ke)),n=0;n<e.length;n++){var i=l._getParentFromElement(e[n]),r=me(e[n]).data(ve),o={relatedTarget:e[n]};if(r){var s=r._menu;if(me(i).hasClass(Ie)&&!(t&&("click"===t.type&&/input|textarea/i.test(t.target.tagName)||"keyup"===t.type&&9===t.which)&&me.contains(i,t.target))){var a=me.Event(Ce.HIDE,o);me(i).trigger(a),a.isDefaultPrevented()||("ontouchstart"in document.documentElement&&me(document.body).children().off("mouseover",null,me.noop),e[n].setAttribute("aria-expanded","false"),me(s).removeClass(Ie),me(i).removeClass(Ie).trigger(me.Event(Ce.HIDDEN,o)))}}}},l._getParentFromElement=function(t){var e,n=gt.getSelectorFromElement(t);return n&&(e=me(n)[0]),e||t.parentNode},l._dataApiKeydownHandler=function(t){if((/input|textarea/i.test(t.target.tagName)?!(32===t.which||27!==t.which&&(40!==t.which&&38!==t.which||me(t.target).closest(Pe).length)):Te.test(t.which))&&(t.preventDefault(),t.stopPropagation(),!this.disabled&&!me(this).hasClass(we))){var e=l._getParentFromElement(this),n=me(e).hasClass(Ie);if((n||27===t.which&&32===t.which)&&(!n||27!==t.which&&32!==t.which)){var i=me(e).find(je).get();if(0!==i.length){var r=i.indexOf(t.target);38===t.which&&0<r&&r--,40===t.which&&r<i.length-1&&r++,r<0&&(r=0),i[r].focus()}}else{if(27===t.which){var o=me(e).find(ke)[0];me(o).trigger("focus")}me(this).trigger("click")}}},s(l,null,[{key:"VERSION",get:function(){return"4.1.1"}},{key:"Default",get:function(){return Be}},{key:"DefaultType",get:function(){return Ke}}]),l}(),me(document).on(Ce.KEYDOWN_DATA_API,ke,Ve._dataApiKeydownHandler).on(Ce.KEYDOWN_DATA_API,Pe,Ve._dataApiKeydownHandler).on(Ce.CLICK_DATA_API+" "+Ce.KEYUP_DATA_API,Ve._clearMenus).on(Ce.CLICK_DATA_API,ke,function(t){t.preventDefault(),t.stopPropagation(),Ve._jQueryInterface.call(me(this),"toggle")}).on(Ce.CLICK_DATA_API,Le,function(t){t.stopPropagation()}),me.fn[_e]=Ve._jQueryInterface,me.fn[_e].Constructor=Ve,me.fn[_e].noConflict=function(){return me.fn[_e]=be,Ve._jQueryInterface},Ve),Ci=(Ye="modal",qe="."+(Ge="bs.modal"),ze=(Qe=e).fn[Ye],Xe={backdrop:!0,keyboard:!0,focus:!0,show:!0},Je={backdrop:"(boolean|string)",keyboard:"boolean",focus:"boolean",show:"boolean"},Ze={HIDE:"hide"+qe,HIDDEN:"hidden"+qe,SHOW:"show"+qe,SHOWN:"shown"+qe,FOCUSIN:"focusin"+qe,RESIZE:"resize"+qe,CLICK_DISMISS:"click.dismiss"+qe,KEYDOWN_DISMISS:"keydown.dismiss"+qe,MOUSEUP_DISMISS:"mouseup.dismiss"+qe,MOUSEDOWN_DISMISS:"mousedown.dismiss"+qe,CLICK_DATA_API:"click"+qe+".data-api"},$e="modal-scrollbar-measure",tn="modal-backdrop",en="modal-open",nn="fade",rn="show",on={DIALOG:".modal-dialog",DATA_TOGGLE:'[data-toggle="modal"]',DATA_DISMISS:'[data-dismiss="modal"]',FIXED_CONTENT:".fixed-top, .fixed-bottom, .is-fixed, .sticky-top",STICKY_CONTENT:".sticky-top",NAVBAR_TOGGLER:".navbar-toggler"},sn=function(){function r(t,e){this._config=this._getConfig(e),this._element=t,this._dialog=Qe(t).find(on.DIALOG)[0],this._backdrop=null,this._isShown=!1,this._isBodyOverflowing=!1,this._ignoreBackdropClick=!1,this._scrollbarWidth=0}var t=r.prototype;return t.toggle=function(t){return this._isShown?this.hide():this.show(t)},t.show=function(t){var e=this;if(!this._isTransitioning&&!this._isShown){Qe(this._element).hasClass(nn)&&(this._isTransitioning=!0);var n=Qe.Event(Ze.SHOW,{relatedTarget:t});Qe(this._element).trigger(n),this._isShown||n.isDefaultPrevented()||(this._isShown=!0,this._checkScrollbar(),this._setScrollbar(),this._adjustDialog(),Qe(document.body).addClass(en),this._setEscapeEvent(),this._setResizeEvent(),Qe(this._element).on(Ze.CLICK_DISMISS,on.DATA_DISMISS,function(t){return e.hide(t)}),Qe(this._dialog).on(Ze.MOUSEDOWN_DISMISS,function(){Qe(e._element).one(Ze.MOUSEUP_DISMISS,function(t){Qe(t.target).is(e._element)&&(e._ignoreBackdropClick=!0)})}),this._showBackdrop(function(){return e._showElement(t)}))}},t.hide=function(t){var e=this;if(t&&t.preventDefault(),!this._isTransitioning&&this._isShown){var n=Qe.Event(Ze.HIDE);if(Qe(this._element).trigger(n),this._isShown&&!n.isDefaultPrevented()){this._isShown=!1;var i=Qe(this._element).hasClass(nn);if(i&&(this._isTransitioning=!0),this._setEscapeEvent(),this._setResizeEvent(),Qe(document).off(Ze.FOCUSIN),Qe(this._element).removeClass(rn),Qe(this._element).off(Ze.CLICK_DISMISS),Qe(this._dialog).off(Ze.MOUSEDOWN_DISMISS),i){var r=gt.getTransitionDurationFromElement(this._element);Qe(this._element).one(gt.TRANSITION_END,function(t){return e._hideModal(t)}).emulateTransitionEnd(r)}else this._hideModal()}}},t.dispose=function(){Qe.removeData(this._element,Ge),Qe(window,document,this._element,this._backdrop).off(qe),this._config=null,this._element=null,this._dialog=null,this._backdrop=null,this._isShown=null,this._isBodyOverflowing=null,this._ignoreBackdropClick=null,this._scrollbarWidth=null},t.handleUpdate=function(){this._adjustDialog()},t._getConfig=function(t){return t=c({},Xe,t),gt.typeCheckConfig(Ye,t,Je),t},t._showElement=function(t){var e=this,n=Qe(this._element).hasClass(nn);this._element.parentNode&&this._element.parentNode.nodeType===Node.ELEMENT_NODE||document.body.appendChild(this._element),this._element.style.display="block",this._element.removeAttribute("aria-hidden"),this._element.scrollTop=0,n&&gt.reflow(this._element),Qe(this._element).addClass(rn),this._config.focus&&this._enforceFocus();var i=Qe.Event(Ze.SHOWN,{relatedTarget:t}),r=function(){e._config.focus&&e._element.focus(),e._isTransitioning=!1,Qe(e._element).trigger(i)};if(n){var o=gt.getTransitionDurationFromElement(this._element);Qe(this._dialog).one(gt.TRANSITION_END,r).emulateTransitionEnd(o)}else r()},t._enforceFocus=function(){var e=this;Qe(document).off(Ze.FOCUSIN).on(Ze.FOCUSIN,function(t){document!==t.target&&e._element!==t.target&&0===Qe(e._element).has(t.target).length&&e._element.focus()})},t._setEscapeEvent=function(){var e=this;this._isShown&&this._config.keyboard?Qe(this._element).on(Ze.KEYDOWN_DISMISS,function(t){27===t.which&&(t.preventDefault(),e.hide())}):this._isShown||Qe(this._element).off(Ze.KEYDOWN_DISMISS)},t._setResizeEvent=function(){var e=this;this._isShown?Qe(window).on(Ze.RESIZE,function(t){return e.handleUpdate(t)}):Qe(window).off(Ze.RESIZE)},t._hideModal=function(){var t=this;this._element.style.display="none",this._element.setAttribute("aria-hidden",!0),this._isTransitioning=!1,this._showBackdrop(function(){Qe(document.body).removeClass(en),t._resetAdjustments(),t._resetScrollbar(),Qe(t._element).trigger(Ze.HIDDEN)})},t._removeBackdrop=function(){this._backdrop&&(Qe(this._backdrop).remove(),this._backdrop=null)},t._showBackdrop=function(t){var e=this,n=Qe(this._element).hasClass(nn)?nn:"";if(this._isShown&&this._config.backdrop){if(this._backdrop=document.createElement("div"),this._backdrop.className=tn,n&&Qe(this._backdrop).addClass(n),Qe(this._backdrop).appendTo(document.body),Qe(this._element).on(Ze.CLICK_DISMISS,function(t){e._ignoreBackdropClick?e._ignoreBackdropClick=!1:t.target===t.currentTarget&&("static"===e._config.backdrop?e._element.focus():e.hide())}),n&&gt.reflow(this._backdrop),Qe(this._backdrop).addClass(rn),!t)return;if(!n)return void t();var i=gt.getTransitionDurationFromElement(this._backdrop);Qe(this._backdrop).one(gt.TRANSITION_END,t).emulateTransitionEnd(i)}else if(!this._isShown&&this._backdrop){Qe(this._backdrop).removeClass(rn);var r=function(){e._removeBackdrop(),t&&t()};if(Qe(this._element).hasClass(nn)){var o=gt.getTransitionDurationFromElement(this._backdrop);Qe(this._backdrop).one(gt.TRANSITION_END,r).emulateTransitionEnd(o)}else r()}else t&&t()},t._adjustDialog=function(){var t=this._element.scrollHeight>document.documentElement.clientHeight;!this._isBodyOverflowing&&t&&(this._element.style.paddingLeft=this._scrollbarWidth+"px"),this._isBodyOverflowing&&!t&&(this._element.style.paddingRight=this._scrollbarWidth+"px")},t._resetAdjustments=function(){this._element.style.paddingLeft="",this._element.style.paddingRight=""},t._checkScrollbar=function(){var t=document.body.getBoundingClientRect();this._isBodyOverflowing=t.left+t.right<window.innerWidth,this._scrollbarWidth=this._getScrollbarWidth()},t._setScrollbar=function(){var r=this;if(this._isBodyOverflowing){Qe(on.FIXED_CONTENT).each(function(t,e){var n=Qe(e)[0].style.paddingRight,i=Qe(e).css("padding-right");Qe(e).data("padding-right",n).css("padding-right",parseFloat(i)+r._scrollbarWidth+"px")}),Qe(on.STICKY_CONTENT).each(function(t,e){var n=Qe(e)[0].style.marginRight,i=Qe(e).css("margin-right");Qe(e).data("margin-right",n).css("margin-right",parseFloat(i)-r._scrollbarWidth+"px")}),Qe(on.NAVBAR_TOGGLER).each(function(t,e){var n=Qe(e)[0].style.marginRight,i=Qe(e).css("margin-right");Qe(e).data("margin-right",n).css("margin-right",parseFloat(i)+r._scrollbarWidth+"px")});var t=document.body.style.paddingRight,e=Qe(document.body).css("padding-right");Qe(document.body).data("padding-right",t).css("padding-right",parseFloat(e)+this._scrollbarWidth+"px")}},t._resetScrollbar=function(){Qe(on.FIXED_CONTENT).each(function(t,e){var n=Qe(e).data("padding-right");"undefined"!=typeof n&&Qe(e).css("padding-right",n).removeData("padding-right")}),Qe(on.STICKY_CONTENT+", "+on.NAVBAR_TOGGLER).each(function(t,e){var n=Qe(e).data("margin-right");"undefined"!=typeof n&&Qe(e).css("margin-right",n).removeData("margin-right")});var t=Qe(document.body).data("padding-right");"undefined"!=typeof t&&Qe(document.body).css("padding-right",t).removeData("padding-right")},t._getScrollbarWidth=function(){var t=document.createElement("div");t.className=$e,document.body.appendChild(t);var e=t.getBoundingClientRect().width-t.clientWidth;return document.body.removeChild(t),e},r._jQueryInterface=function(n,i){return this.each(function(){var t=Qe(this).data(Ge),e=c({},Xe,Qe(this).data(),"object"==typeof n&&n?n:{});if(t||(t=new r(this,e),Qe(this).data(Ge,t)),"string"==typeof n){if("undefined"==typeof t[n])throw new TypeError('No method named "'+n+'"');t[n](i)}else e.show&&t.show(i)})},s(r,null,[{key:"VERSION",get:function(){return"4.1.1"}},{key:"Default",get:function(){return Xe}}]),r}(),Qe(document).on(Ze.CLICK_DATA_API,on.DATA_TOGGLE,function(t){var e,n=this,i=gt.getSelectorFromElement(this);i&&(e=Qe(i)[0]);var r=Qe(e).data(Ge)?"toggle":c({},Qe(e).data(),Qe(this).data());"A"!==this.tagName&&"AREA"!==this.tagName||t.preventDefault();var o=Qe(e).one(Ze.SHOW,function(t){t.isDefaultPrevented()||o.one(Ze.HIDDEN,function(){Qe(n).is(":visible")&&n.focus()})});sn._jQueryInterface.call(Qe(e),r,this)}),Qe.fn[Ye]=sn._jQueryInterface,Qe.fn[Ye].Constructor=sn,Qe.fn[Ye].noConflict=function(){return Qe.fn[Ye]=ze,sn._jQueryInterface},sn),wi=(ln="tooltip",fn="."+(cn="bs.tooltip"),hn=(an=e).fn[ln],un="bs-tooltip",dn=new RegExp("(^|\\s)"+un+"\\S+","g"),mn={animation:!0,template:'<div class="tooltip" role="tooltip"><div class="arrow"></div><div class="tooltip-inner"></div></div>',trigger:"hover focus",title:"",delay:0,html:!(gn={AUTO:"auto",TOP:"top",RIGHT:"right",BOTTOM:"bottom",LEFT:"left"}),selector:!(pn={animation:"boolean",template:"string",title:"(string|element|function)",trigger:"string",delay:"(number|object)",html:"boolean",selector:"(string|boolean)",placement:"(string|function)",offset:"(number|string)",container:"(string|element|boolean)",fallbackPlacement:"(string|array)",boundary:"(string|element)"}),placement:"top",offset:0,container:!1,fallbackPlacement:"flip",boundary:"scrollParent"},vn="out",En={HIDE:"hide"+fn,HIDDEN:"hidden"+fn,SHOW:(_n="show")+fn,SHOWN:"shown"+fn,INSERTED:"inserted"+fn,CLICK:"click"+fn,FOCUSIN:"focusin"+fn,FOCUSOUT:"focusout"+fn,MOUSEENTER:"mouseenter"+fn,MOUSELEAVE:"mouseleave"+fn},yn="fade",bn="show",Tn=".tooltip-inner",Cn=".arrow",wn="hover",In="focus",Dn="click",An="manual",Sn=function(){function i(t,e){if("undefined"==typeof ge)throw new TypeError("Bootstrap tooltips require Popper.js (https://popper.js.org)");this._isEnabled=!0,this._timeout=0,this._hoverState="",this._activeTrigger={},this._popper=null,this.element=t,this.config=this._getConfig(e),this.tip=null,this._setListeners()}var t=i.prototype;return t.enable=function(){this._isEnabled=!0},t.disable=function(){this._isEnabled=!1},t.toggleEnabled=function(){this._isEnabled=!this._isEnabled},t.toggle=function(t){if(this._isEnabled)if(t){var e=this.constructor.DATA_KEY,n=an(t.currentTarget).data(e);n||(n=new this.constructor(t.currentTarget,this._getDelegateConfig()),an(t.currentTarget).data(e,n)),n._activeTrigger.click=!n._activeTrigger.click,n._isWithActiveTrigger()?n._enter(null,n):n._leave(null,n)}else{if(an(this.getTipElement()).hasClass(bn))return void this._leave(null,this);this._enter(null,this)}},t.dispose=function(){clearTimeout(this._timeout),an.removeData(this.element,this.constructor.DATA_KEY),an(this.element).off(this.constructor.EVENT_KEY),an(this.element).closest(".modal").off("hide.bs.modal"),this.tip&&an(this.tip).remove(),this._isEnabled=null,this._timeout=null,this._hoverState=null,(this._activeTrigger=null)!==this._popper&&this._popper.destroy(),this._popper=null,this.element=null,this.config=null,this.tip=null},t.show=function(){var e=this;if("none"===an(this.element).css("display"))throw new Error("Please use show on visible elements");var t=an.Event(this.constructor.Event.SHOW);if(this.isWithContent()&&this._isEnabled){an(this.element).trigger(t);var n=an.contains(this.element.ownerDocument.documentElement,this.element);if(t.isDefaultPrevented()||!n)return;var i=this.getTipElement(),r=gt.getUID(this.constructor.NAME);i.setAttribute("id",r),this.element.setAttribute("aria-describedby",r),this.setContent(),this.config.animation&&an(i).addClass(yn);var o="function"==typeof this.config.placement?this.config.placement.call(this,i,this.element):this.config.placement,s=this._getAttachment(o);this.addAttachmentClass(s);var a=!1===this.config.container?document.body:an(this.config.container);an(i).data(this.constructor.DATA_KEY,this),an.contains(this.element.ownerDocument.documentElement,this.tip)||an(i).appendTo(a),an(this.element).trigger(this.constructor.Event.INSERTED),this._popper=new ge(this.element,i,{placement:s,modifiers:{offset:{offset:this.config.offset},flip:{behavior:this.config.fallbackPlacement},arrow:{element:Cn},preventOverflow:{boundariesElement:this.config.boundary}},onCreate:function(t){t.originalPlacement!==t.placement&&e._handlePopperPlacementChange(t)},onUpdate:function(t){e._handlePopperPlacementChange(t)}}),an(i).addClass(bn),"ontouchstart"in document.documentElement&&an(document.body).children().on("mouseover",null,an.noop);var l=function(){e.config.animation&&e._fixTransition();var t=e._hoverState;e._hoverState=null,an(e.element).trigger(e.constructor.Event.SHOWN),t===vn&&e._leave(null,e)};if(an(this.tip).hasClass(yn)){var c=gt.getTransitionDurationFromElement(this.tip);an(this.tip).one(gt.TRANSITION_END,l).emulateTransitionEnd(c)}else l()}},t.hide=function(t){var e=this,n=this.getTipElement(),i=an.Event(this.constructor.Event.HIDE),r=function(){e._hoverState!==_n&&n.parentNode&&n.parentNode.removeChild(n),e._cleanTipClass(),e.element.removeAttribute("aria-describedby"),an(e.element).trigger(e.constructor.Event.HIDDEN),null!==e._popper&&e._popper.destroy(),t&&t()};if(an(this.element).trigger(i),!i.isDefaultPrevented()){if(an(n).removeClass(bn),"ontouchstart"in document.documentElement&&an(document.body).children().off("mouseover",null,an.noop),this._activeTrigger[Dn]=!1,this._activeTrigger[In]=!1,this._activeTrigger[wn]=!1,an(this.tip).hasClass(yn)){var o=gt.getTransitionDurationFromElement(n);an(n).one(gt.TRANSITION_END,r).emulateTransitionEnd(o)}else r();this._hoverState=""}},t.update=function(){null!==this._popper&&this._popper.scheduleUpdate()},t.isWithContent=function(){return Boolean(this.getTitle())},t.addAttachmentClass=function(t){an(this.getTipElement()).addClass(un+"-"+t)},t.getTipElement=function(){return this.tip=this.tip||an(this.config.template)[0],this.tip},t.setContent=function(){var t=an(this.getTipElement());this.setElementContent(t.find(Tn),this.getTitle()),t.removeClass(yn+" "+bn)},t.setElementContent=function(t,e){var n=this.config.html;"object"==typeof e&&(e.nodeType||e.jquery)?n?an(e).parent().is(t)||t.empty().append(e):t.text(an(e).text()):t[n?"html":"text"](e)},t.getTitle=function(){var t=this.element.getAttribute("data-original-title");return t||(t="function"==typeof this.config.title?this.config.title.call(this.element):this.config.title),t},t._getAttachment=function(t){return gn[t.toUpperCase()]},t._setListeners=function(){var i=this;this.config.trigger.split(" ").forEach(function(t){if("click"===t)an(i.element).on(i.constructor.Event.CLICK,i.config.selector,function(t){return i.toggle(t)});else if(t!==An){var e=t===wn?i.constructor.Event.MOUSEENTER:i.constructor.Event.FOCUSIN,n=t===wn?i.constructor.Event.MOUSELEAVE:i.constructor.Event.FOCUSOUT;an(i.element).on(e,i.config.selector,function(t){return i._enter(t)}).on(n,i.config.selector,function(t){return i._leave(t)})}an(i.element).closest(".modal").on("hide.bs.modal",function(){return i.hide()})}),this.config.selector?this.config=c({},this.config,{trigger:"manual",selector:""}):this._fixTitle()},t._fixTitle=function(){var t=typeof this.element.getAttribute("data-original-title");(this.element.getAttribute("title")||"string"!==t)&&(this.element.setAttribute("data-original-title",this.element.getAttribute("title")||""),this.element.setAttribute("title",""))},t._enter=function(t,e){var n=this.constructor.DATA_KEY;(e=e||an(t.currentTarget).data(n))||(e=new this.constructor(t.currentTarget,this._getDelegateConfig()),an(t.currentTarget).data(n,e)),t&&(e._activeTrigger["focusin"===t.type?In:wn]=!0),an(e.getTipElement()).hasClass(bn)||e._hoverState===_n?e._hoverState=_n:(clearTimeout(e._timeout),e._hoverState=_n,e.config.delay&&e.config.delay.show?e._timeout=setTimeout(function(){e._hoverState===_n&&e.show()},e.config.delay.show):e.show())},t._leave=function(t,e){var n=this.constructor.DATA_KEY;(e=e||an(t.currentTarget).data(n))||(e=new this.constructor(t.currentTarget,this._getDelegateConfig()),an(t.currentTarget).data(n,e)),t&&(e._activeTrigger["focusout"===t.type?In:wn]=!1),e._isWithActiveTrigger()||(clearTimeout(e._timeout),e._hoverState=vn,e.config.delay&&e.config.delay.hide?e._timeout=setTimeout(function(){e._hoverState===vn&&e.hide()},e.config.delay.hide):e.hide())},t._isWithActiveTrigger=function(){for(var t in this._activeTrigger)if(this._activeTrigger[t])return!0;return!1},t._getConfig=function(t){return"number"==typeof(t=c({},this.constructor.Default,an(this.element).data(),"object"==typeof t&&t?t:{})).delay&&(t.delay={show:t.delay,hide:t.delay}),"number"==typeof t.title&&(t.title=t.title.toString()),"number"==typeof t.content&&(t.content=t.content.toString()),gt.typeCheckConfig(ln,t,this.constructor.DefaultType),t},t._getDelegateConfig=function(){var t={};if(this.config)for(var e in this.config)this.constructor.Default[e]!==this.config[e]&&(t[e]=this.config[e]);return t},t._cleanTipClass=function(){var t=an(this.getTipElement()),e=t.attr("class").match(dn);null!==e&&0<e.length&&t.removeClass(e.join(""))},t._handlePopperPlacementChange=function(t){this._cleanTipClass(),this.addAttachmentClass(this._getAttachment(t.placement))},t._fixTransition=function(){var t=this.getTipElement(),e=this.config.animation;null===t.getAttribute("x-placement")&&(an(t).removeClass(yn),this.config.animation=!1,this.hide(),this.show(),this.config.animation=e)},i._jQueryInterface=function(n){return this.each(function(){var t=an(this).data(cn),e="object"==typeof n&&n;if((t||!/dispose|hide/.test(n))&&(t||(t=new i(this,e),an(this).data(cn,t)),"string"==typeof n)){if("undefined"==typeof t[n])throw new TypeError('No method named "'+n+'"');t[n]()}})},s(i,null,[{key:"VERSION",get:function(){return"4.1.1"}},{key:"Default",get:function(){return mn}},{key:"NAME",get:function(){return ln}},{key:"DATA_KEY",get:function(){return cn}},{key:"Event",get:function(){return En}},{key:"EVENT_KEY",get:function(){return fn}},{key:"DefaultType",get:function(){return pn}}]),i}(),an.fn[ln]=Sn._jQueryInterface,an.fn[ln].Constructor=Sn,an.fn[ln].noConflict=function(){return an.fn[ln]=hn,Sn._jQueryInterface},Sn),Ii=(Nn="popover",Ln="."+(kn="bs.popover"),Pn=(On=e).fn[Nn],xn="bs-popover",jn=new RegExp("(^|\\s)"+xn+"\\S+","g"),Mn=c({},wi.Default,{placement:"right",trigger:"click",content:"",template:'<div class="popover" role="tooltip"><div class="arrow"></div><h3 class="popover-header"></h3><div class="popover-body"></div></div>'}),Rn=c({},wi.DefaultType,{content:"(string|element|function)"}),Hn="fade",Fn=".popover-header",Un=".popover-body",Bn={HIDE:"hide"+Ln,HIDDEN:"hidden"+Ln,SHOW:(Wn="show")+Ln,SHOWN:"shown"+Ln,INSERTED:"inserted"+Ln,CLICK:"click"+Ln,FOCUSIN:"focusin"+Ln,FOCUSOUT:"focusout"+Ln,MOUSEENTER:"mouseenter"+Ln,MOUSELEAVE:"mouseleave"+Ln},Kn=function(t){var e,n;function i(){return t.apply(this,arguments)||this}n=t,(e=i).prototype=Object.create(n.prototype),(e.prototype.constructor=e).__proto__=n;var r=i.prototype;return r.isWithContent=function(){return this.getTitle()||this._getContent()},r.addAttachmentClass=function(t){On(this.getTipElement()).addClass(xn+"-"+t)},r.getTipElement=function(){return this.tip=this.tip||On(this.config.template)[0],this.tip},r.setContent=function(){var t=On(this.getTipElement());this.setElementContent(t.find(Fn),this.getTitle());var e=this._getContent();"function"==typeof e&&(e=e.call(this.element)),this.setElementContent(t.find(Un),e),t.removeClass(Hn+" "+Wn)},r._getContent=function(){return this.element.getAttribute("data-content")||this.config.content},r._cleanTipClass=function(){var t=On(this.getTipElement()),e=t.attr("class").match(jn);null!==e&&0<e.length&&t.removeClass(e.join(""))},i._jQueryInterface=function(n){return this.each(function(){var t=On(this).data(kn),e="object"==typeof n?n:null;if((t||!/destroy|hide/.test(n))&&(t||(t=new i(this,e),On(this).data(kn,t)),"string"==typeof n)){if("undefined"==typeof t[n])throw new TypeError('No method named "'+n+'"');t[n]()}})},s(i,null,[{key:"VERSION",get:function(){return"4.1.1"}},{key:"Default",get:function(){return Mn}},{key:"NAME",get:function(){return Nn}},{key:"DATA_KEY",get:function(){return kn}},{key:"Event",get:function(){return Bn}},{key:"EVENT_KEY",get:function(){return Ln}},{key:"DefaultType",get:function(){return Rn}}]),i}(wi),On.fn[Nn]=Kn._jQueryInterface,On.fn[Nn].Constructor=Kn,On.fn[Nn].noConflict=function(){return On.fn[Nn]=Pn,Kn._jQueryInterface},Kn),Di=(Qn="scrollspy",Gn="."+(Yn="bs.scrollspy"),qn=(Vn=e).fn[Qn],zn={offset:10,method:"auto",target:""},Xn={offset:"number",method:"string",target:"(string|element)"},Jn={ACTIVATE:"activate"+Gn,SCROLL:"scroll"+Gn,LOAD_DATA_API:"load"+Gn+".data-api"},Zn="dropdown-item",$n="active",ti={DATA_SPY:'[data-spy="scroll"]',ACTIVE:".active",NAV_LIST_GROUP:".nav, .list-group",NAV_LINKS:".nav-link",NAV_ITEMS:".nav-item",LIST_ITEMS:".list-group-item",DROPDOWN:".dropdown",DROPDOWN_ITEMS:".dropdown-item",DROPDOWN_TOGGLE:".dropdown-toggle"},ei="offset",ni="position",ii=function(){function n(t,e){var n=this;this._element=t,this._scrollElement="BODY"===t.tagName?window:t,this._config=this._getConfig(e),this._selector=this._config.target+" "+ti.NAV_LINKS+","+this._config.target+" "+ti.LIST_ITEMS+","+this._config.target+" "+ti.DROPDOWN_ITEMS,this._offsets=[],this._targets=[],this._activeTarget=null,this._scrollHeight=0,Vn(this._scrollElement).on(Jn.SCROLL,function(t){return n._process(t)}),this.refresh(),this._process()}var t=n.prototype;return t.refresh=function(){var e=this,t=this._scrollElement===this._scrollElement.window?ei:ni,r="auto"===this._config.method?t:this._config.method,o=r===ni?this._getScrollTop():0;this._offsets=[],this._targets=[],this._scrollHeight=this._getScrollHeight(),Vn.makeArray(Vn(this._selector)).map(function(t){var e,n=gt.getSelectorFromElement(t);if(n&&(e=Vn(n)[0]),e){var i=e.getBoundingClientRect();if(i.width||i.height)return[Vn(e)[r]().top+o,n]}return null}).filter(function(t){return t}).sort(function(t,e){return t[0]-e[0]}).forEach(function(t){e._offsets.push(t[0]),e._targets.push(t[1])})},t.dispose=function(){Vn.removeData(this._element,Yn),Vn(this._scrollElement).off(Gn),this._element=null,this._scrollElement=null,this._config=null,this._selector=null,this._offsets=null,this._targets=null,this._activeTarget=null,this._scrollHeight=null},t._getConfig=function(t){if("string"!=typeof(t=c({},zn,"object"==typeof t&&t?t:{})).target){var e=Vn(t.target).attr("id");e||(e=gt.getUID(Qn),Vn(t.target).attr("id",e)),t.target="#"+e}return gt.typeCheckConfig(Qn,t,Xn),t},t._getScrollTop=function(){return this._scrollElement===window?this._scrollElement.pageYOffset:this._scrollElement.scrollTop},t._getScrollHeight=function(){return this._scrollElement.scrollHeight||Math.max(document.body.scrollHeight,document.documentElement.scrollHeight)},t._getOffsetHeight=function(){return this._scrollElement===window?window.innerHeight:this._scrollElement.getBoundingClientRect().height},t._process=function(){var t=this._getScrollTop()+this._config.offset,e=this._getScrollHeight(),n=this._config.offset+e-this._getOffsetHeight();if(this._scrollHeight!==e&&this.refresh(),n<=t){var i=this._targets[this._targets.length-1];this._activeTarget!==i&&this._activate(i)}else{if(this._activeTarget&&t<this._offsets[0]&&0<this._offsets[0])return this._activeTarget=null,void this._clear();for(var r=this._offsets.length;r--;){this._activeTarget!==this._targets[r]&&t>=this._offsets[r]&&("undefined"==typeof this._offsets[r+1]||t<this._offsets[r+1])&&this._activate(this._targets[r])}}},t._activate=function(e){this._activeTarget=e,this._clear();var t=this._selector.split(",");t=t.map(function(t){return t+'[data-target="'+e+'"],'+t+'[href="'+e+'"]'});var n=Vn(t.join(","));n.hasClass(Zn)?(n.closest(ti.DROPDOWN).find(ti.DROPDOWN_TOGGLE).addClass($n),n.addClass($n)):(n.addClass($n),n.parents(ti.NAV_LIST_GROUP).prev(ti.NAV_LINKS+", "+ti.LIST_ITEMS).addClass($n),n.parents(ti.NAV_LIST_GROUP).prev(ti.NAV_ITEMS).children(ti.NAV_LINKS).addClass($n)),Vn(this._scrollElement).trigger(Jn.ACTIVATE,{relatedTarget:e})},t._clear=function(){Vn(this._selector).filter(ti.ACTIVE).removeClass($n)},n._jQueryInterface=function(e){return this.each(function(){var t=Vn(this).data(Yn);if(t||(t=new n(this,"object"==typeof e&&e),Vn(this).data(Yn,t)),"string"==typeof e){if("undefined"==typeof t[e])throw new TypeError('No method named "'+e+'"');t[e]()}})},s(n,null,[{key:"VERSION",get:function(){return"4.1.1"}},{key:"Default",get:function(){return zn}}]),n}(),Vn(window).on(Jn.LOAD_DATA_API,function(){for(var t=Vn.makeArray(Vn(ti.DATA_SPY)),e=t.length;e--;){var n=Vn(t[e]);ii._jQueryInterface.call(n,n.data())}}),Vn.fn[Qn]=ii._jQueryInterface,Vn.fn[Qn].Constructor=ii,Vn.fn[Qn].noConflict=function(){return Vn.fn[Qn]=qn,ii._jQueryInterface},ii),Ai=(si="."+(oi="bs.tab"),ai=(ri=e).fn.tab,li={HIDE:"hide"+si,HIDDEN:"hidden"+si,SHOW:"show"+si,SHOWN:"shown"+si,CLICK_DATA_API:"click"+si+".data-api"},ci="dropdown-menu",fi="active",hi="disabled",ui="fade",di="show",pi=".dropdown",gi=".nav, .list-group",mi=".active",_i="> li > .active",vi='[data-toggle="tab"], [data-toggle="pill"], [data-toggle="list"]',Ei=".dropdown-toggle",yi="> .dropdown-menu .active",bi=function(){function i(t){this._element=t}var t=i.prototype;return t.show=function(){var n=this;if(!(this._element.parentNode&&this._element.parentNode.nodeType===Node.ELEMENT_NODE&&ri(this._element).hasClass(fi)||ri(this._element).hasClass(hi))){var t,i,e=ri(this._element).closest(gi)[0],r=gt.getSelectorFromElement(this._element);if(e){var o="UL"===e.nodeName?_i:mi;i=(i=ri.makeArray(ri(e).find(o)))[i.length-1]}var s=ri.Event(li.HIDE,{relatedTarget:this._element}),a=ri.Event(li.SHOW,{relatedTarget:i});if(i&&ri(i).trigger(s),ri(this._element).trigger(a),!a.isDefaultPrevented()&&!s.isDefaultPrevented()){r&&(t=ri(r)[0]),this._activate(this._element,e);var l=function(){var t=ri.Event(li.HIDDEN,{relatedTarget:n._element}),e=ri.Event(li.SHOWN,{relatedTarget:i});ri(i).trigger(t),ri(n._element).trigger(e)};t?this._activate(t,t.parentNode,l):l()}}},t.dispose=function(){ri.removeData(this._element,oi),this._element=null},t._activate=function(t,e,n){var i=this,r=("UL"===e.nodeName?ri(e).find(_i):ri(e).children(mi))[0],o=n&&r&&ri(r).hasClass(ui),s=function(){return i._transitionComplete(t,r,n)};if(r&&o){var a=gt.getTransitionDurationFromElement(r);ri(r).one(gt.TRANSITION_END,s).emulateTransitionEnd(a)}else s()},t._transitionComplete=function(t,e,n){if(e){ri(e).removeClass(di+" "+fi);var i=ri(e.parentNode).find(yi)[0];i&&ri(i).removeClass(fi),"tab"===e.getAttribute("role")&&e.setAttribute("aria-selected",!1)}if(ri(t).addClass(fi),"tab"===t.getAttribute("role")&&t.setAttribute("aria-selected",!0),gt.reflow(t),ri(t).addClass(di),t.parentNode&&ri(t.parentNode).hasClass(ci)){var r=ri(t).closest(pi)[0];r&&ri(r).find(Ei).addClass(fi),t.setAttribute("aria-expanded",!0)}n&&n()},i._jQueryInterface=function(n){return this.each(function(){var t=ri(this),e=t.data(oi);if(e||(e=new i(this),t.data(oi,e)),"string"==typeof n){if("undefined"==typeof e[n])throw new TypeError('No method named "'+n+'"');e[n]()}})},s(i,null,[{key:"VERSION",get:function(){return"4.1.1"}}]),i}(),ri(document).on(li.CLICK_DATA_API,vi,function(t){t.preventDefault(),bi._jQueryInterface.call(ri(this),"show")}),ri.fn.tab=bi._jQueryInterface,ri.fn.tab.Constructor=bi,ri.fn.tab.noConflict=function(){return ri.fn.tab=ai,bi._jQueryInterface},bi);!function(t){if("undefined"==typeof t)throw new TypeError("Bootstrap's JavaScript requires jQuery. jQuery must be included before Bootstrap's JavaScript.");var e=t.fn.jquery.split(" ")[0].split(".");if(e[0]<2&&e[1]<9||1===e[0]&&9===e[1]&&e[2]<1||4<=e[0])throw new Error("Bootstrap's JavaScript requires at least jQuery v1.9.1 but less than v4.0.0")}(e),t.Util=gt,t.Alert=mt,t.Button=_t,t.Carousel=vt,t.Collapse=Et,t.Dropdown=Ti,t.Modal=Ci,t.Popover=Ii,t.Scrollspy=Di,t.Tab=Ai,t.Tooltip=wi,Object.defineProperty(t,"__esModule",{value:!0})});
//# sourceMappingURL=bootstrap.bundle.min.js.map
/*! Respond.js v1.4.2: min/max-width media query polyfill * Copyright 2013 Scott Jehl
 * Licensed under https://github.com/scottjehl/Respond/blob/master/LICENSE-MIT
 *  */

!function(a){"use strict";a.matchMedia=a.matchMedia||function(a){var b,c=a.documentElement,d=c.firstElementChild||c.firstChild,e=a.createElement("body"),f=a.createElement("div");return f.id="mq-test-1",f.style.cssText="position:absolute;top:-100em",e.style.background="none",e.appendChild(f),function(a){return f.innerHTML='&shy;<style media="'+a+'"> #mq-test-1 { width: 42px; }</style>',c.insertBefore(e,d),b=42===f.offsetWidth,c.removeChild(e),{matches:b,media:a}}}(a.document)}(this),function(a){"use strict";function b(){u(!0)}var c={};a.respond=c,c.update=function(){};var d=[],e=function(){var b=!1;try{b=new a.XMLHttpRequest}catch(c){b=new a.ActiveXObject("Microsoft.XMLHTTP")}return function(){return b}}(),f=function(a,b){var c=e();c&&(c.open("GET",a,!0),c.onreadystatechange=function(){4!==c.readyState||200!==c.status&&304!==c.status||b(c.responseText)},4!==c.readyState&&c.send(null))};if(c.ajax=f,c.queue=d,c.regex={media:/@media[^\{]+\{([^\{\}]*\{[^\}\{]*\})+/gi,keyframes:/@(?:\-(?:o|moz|webkit)\-)?keyframes[^\{]+\{(?:[^\{\}]*\{[^\}\{]*\})+[^\}]*\}/gi,urls:/(url\()['"]?([^\/\)'"][^:\)'"]+)['"]?(\))/g,findStyles:/@media *([^\{]+)\{([\S\s]+?)$/,only:/(only\s+)?([a-zA-Z]+)\s?/,minw:/\([\s]*min\-width\s*:[\s]*([\s]*[0-9\.]+)(px|em)[\s]*\)/,maxw:/\([\s]*max\-width\s*:[\s]*([\s]*[0-9\.]+)(px|em)[\s]*\)/},c.mediaQueriesSupported=a.matchMedia&&null!==a.matchMedia("only all")&&a.matchMedia("only all").matches,!c.mediaQueriesSupported){var g,h,i,j=a.document,k=j.documentElement,l=[],m=[],n=[],o={},p=30,q=j.getElementsByTagName("head")[0]||k,r=j.getElementsByTagName("base")[0],s=q.getElementsByTagName("link"),t=function(){var a,b=j.createElement("div"),c=j.body,d=k.style.fontSize,e=c&&c.style.fontSize,f=!1;return b.style.cssText="position:absolute;font-size:1em;width:1em",c||(c=f=j.createElement("body"),c.style.background="none"),k.style.fontSize="100%",c.style.fontSize="100%",c.appendChild(b),f&&k.insertBefore(c,k.firstChild),a=b.offsetWidth,f?k.removeChild(c):c.removeChild(b),k.style.fontSize=d,e&&(c.style.fontSize=e),a=i=parseFloat(a)},u=function(b){var c="clientWidth",d=k[c],e="CSS1Compat"===j.compatMode&&d||j.body[c]||d,f={},o=s[s.length-1],r=(new Date).getTime();if(b&&g&&p>r-g)return a.clearTimeout(h),h=a.setTimeout(u,p),void 0;g=r;for(var v in l)if(l.hasOwnProperty(v)){var w=l[v],x=w.minw,y=w.maxw,z=null===x,A=null===y,B="em";x&&(x=parseFloat(x)*(x.indexOf(B)>-1?i||t():1)),y&&(y=parseFloat(y)*(y.indexOf(B)>-1?i||t():1)),w.hasquery&&(z&&A||!(z||e>=x)||!(A||y>=e))||(f[w.media]||(f[w.media]=[]),f[w.media].push(m[w.rules]))}for(var C in n)n.hasOwnProperty(C)&&n[C]&&n[C].parentNode===q&&q.removeChild(n[C]);n.length=0;for(var D in f)if(f.hasOwnProperty(D)){var E=j.createElement("style"),F=f[D].join("\n");E.type="text/css",E.media=D,q.insertBefore(E,o.nextSibling),E.styleSheet?E.styleSheet.cssText=F:E.appendChild(j.createTextNode(F)),n.push(E)}},v=function(a,b,d){var e=a.replace(c.regex.keyframes,"").match(c.regex.media),f=e&&e.length||0;b=b.substring(0,b.lastIndexOf("/"));var g=function(a){return a.replace(c.regex.urls,"$1"+b+"$2$3")},h=!f&&d;b.length&&(b+="/"),h&&(f=1);for(var i=0;f>i;i++){var j,k,n,o;h?(j=d,m.push(g(a))):(j=e[i].match(c.regex.findStyles)&&RegExp.$1,m.push(RegExp.$2&&g(RegExp.$2))),n=j.split(","),o=n.length;for(var p=0;o>p;p++)k=n[p],l.push({media:k.split("(")[0].match(c.regex.only)&&RegExp.$2||"all",rules:m.length-1,hasquery:k.indexOf("(")>-1,minw:k.match(c.regex.minw)&&parseFloat(RegExp.$1)+(RegExp.$2||""),maxw:k.match(c.regex.maxw)&&parseFloat(RegExp.$1)+(RegExp.$2||"")})}u()},w=function(){if(d.length){var b=d.shift();f(b.href,function(c){v(c,b.href,b.media),o[b.href]=!0,a.setTimeout(function(){w()},0)})}},x=function(){for(var b=0;b<s.length;b++){var c=s[b],e=c.href,f=c.media,g=c.rel&&"stylesheet"===c.rel.toLowerCase();e&&g&&!o[e]&&(c.styleSheet&&c.styleSheet.rawCssText?(v(c.styleSheet.rawCssText,e,f),o[e]=!0):(!/^([a-zA-Z:]*\/\/)/.test(e)&&!r||e.replace(RegExp.$1,"").split("/")[0]===a.location.host)&&("//"===e.substring(0,2)&&(e=a.location.protocol+e),d.push({href:e,media:f})))}w()};x(),c.update=x,c.getEmValue=t,a.addEventListener?a.addEventListener("resize",b,!1):a.attachEvent&&a.attachEvent("onresize",b)}}(this);
$(function(){$(".sidebar").find(".nav-link.active").removeClass("active");location.pathname==="/Manage"?$("#userDropdown").addClass("active"):$('.sidebar a[href^="/'+location.pathname.split("/")[1]+'"]').addClass("active");location.pathname.split("/")[1].length<1&&$(".sidebar").find(".nav-link.active").removeClass("active")});
/*
 Copyright (C) Federico Zivolo 2017
 Distributed under the MIT License (license terms are at http://opensource.org/licenses/MIT).
 */(function(e,t){'object'==typeof exports&&'undefined'!=typeof module?module.exports=t():'function'==typeof define&&define.amd?define(t):e.Popper=t()})(this,function(){'use strict';function e(e){return e&&'[object Function]'==={}.toString.call(e)}function t(e,t){if(1!==e.nodeType)return[];var o=getComputedStyle(e,null);return t?o[t]:o}function o(e){return'HTML'===e.nodeName?e:e.parentNode||e.host}function n(e){if(!e)return document.body;switch(e.nodeName){case'HTML':case'BODY':return e.ownerDocument.body;case'#document':return e.body;}var i=t(e),r=i.overflow,p=i.overflowX,s=i.overflowY;return /(auto|scroll)/.test(r+s+p)?e:n(o(e))}function r(e){var o=e&&e.offsetParent,i=o&&o.nodeName;return i&&'BODY'!==i&&'HTML'!==i?-1!==['TD','TABLE'].indexOf(o.nodeName)&&'static'===t(o,'position')?r(o):o:e?e.ownerDocument.documentElement:document.documentElement}function p(e){var t=e.nodeName;return'BODY'!==t&&('HTML'===t||r(e.firstElementChild)===e)}function s(e){return null===e.parentNode?e:s(e.parentNode)}function d(e,t){if(!e||!e.nodeType||!t||!t.nodeType)return document.documentElement;var o=e.compareDocumentPosition(t)&Node.DOCUMENT_POSITION_FOLLOWING,i=o?e:t,n=o?t:e,a=document.createRange();a.setStart(i,0),a.setEnd(n,0);var l=a.commonAncestorContainer;if(e!==l&&t!==l||i.contains(n))return p(l)?l:r(l);var f=s(e);return f.host?d(f.host,t):d(e,s(t).host)}function a(e){var t=1<arguments.length&&void 0!==arguments[1]?arguments[1]:'top',o='top'===t?'scrollTop':'scrollLeft',i=e.nodeName;if('BODY'===i||'HTML'===i){var n=e.ownerDocument.documentElement,r=e.ownerDocument.scrollingElement||n;return r[o]}return e[o]}function l(e,t){var o=2<arguments.length&&void 0!==arguments[2]&&arguments[2],i=a(t,'top'),n=a(t,'left'),r=o?-1:1;return e.top+=i*r,e.bottom+=i*r,e.left+=n*r,e.right+=n*r,e}function f(e,t){var o='x'===t?'Left':'Top',i='Left'==o?'Right':'Bottom';return parseFloat(e['border'+o+'Width'],10)+parseFloat(e['border'+i+'Width'],10)}function m(e,t,o,i){return J(t['offset'+e],t['scroll'+e],o['client'+e],o['offset'+e],o['scroll'+e],ie()?o['offset'+e]+i['margin'+('Height'===e?'Top':'Left')]+i['margin'+('Height'===e?'Bottom':'Right')]:0)}function h(){var e=document.body,t=document.documentElement,o=ie()&&getComputedStyle(t);return{height:m('Height',e,t,o),width:m('Width',e,t,o)}}function c(e){return se({},e,{right:e.left+e.width,bottom:e.top+e.height})}function g(e){var o={};if(ie())try{o=e.getBoundingClientRect();var i=a(e,'top'),n=a(e,'left');o.top+=i,o.left+=n,o.bottom+=i,o.right+=n}catch(e){}else o=e.getBoundingClientRect();var r={left:o.left,top:o.top,width:o.right-o.left,height:o.bottom-o.top},p='HTML'===e.nodeName?h():{},s=p.width||e.clientWidth||r.right-r.left,d=p.height||e.clientHeight||r.bottom-r.top,l=e.offsetWidth-s,m=e.offsetHeight-d;if(l||m){var g=t(e);l-=f(g,'x'),m-=f(g,'y'),r.width-=l,r.height-=m}return c(r)}function u(e,o){var i=ie(),r='HTML'===o.nodeName,p=g(e),s=g(o),d=n(e),a=t(o),f=parseFloat(a.borderTopWidth,10),m=parseFloat(a.borderLeftWidth,10),h=c({top:p.top-s.top-f,left:p.left-s.left-m,width:p.width,height:p.height});if(h.marginTop=0,h.marginLeft=0,!i&&r){var u=parseFloat(a.marginTop,10),b=parseFloat(a.marginLeft,10);h.top-=f-u,h.bottom-=f-u,h.left-=m-b,h.right-=m-b,h.marginTop=u,h.marginLeft=b}return(i?o.contains(d):o===d&&'BODY'!==d.nodeName)&&(h=l(h,o)),h}function b(e){var t=e.ownerDocument.documentElement,o=u(e,t),i=J(t.clientWidth,window.innerWidth||0),n=J(t.clientHeight,window.innerHeight||0),r=a(t),p=a(t,'left'),s={top:r-o.top+o.marginTop,left:p-o.left+o.marginLeft,width:i,height:n};return c(s)}function w(e){var i=e.nodeName;return'BODY'===i||'HTML'===i?!1:'fixed'===t(e,'position')||w(o(e))}function y(e,t,i,r){var p={top:0,left:0},s=d(e,t);if('viewport'===r)p=b(s);else{var a;'scrollParent'===r?(a=n(o(t)),'BODY'===a.nodeName&&(a=e.ownerDocument.documentElement)):'window'===r?a=e.ownerDocument.documentElement:a=r;var l=u(a,s);if('HTML'===a.nodeName&&!w(s)){var f=h(),m=f.height,c=f.width;p.top+=l.top-l.marginTop,p.bottom=m+l.top,p.left+=l.left-l.marginLeft,p.right=c+l.left}else p=l}return p.left+=i,p.top+=i,p.right-=i,p.bottom-=i,p}function E(e){var t=e.width,o=e.height;return t*o}function v(e,t,o,i,n){var r=5<arguments.length&&void 0!==arguments[5]?arguments[5]:0;if(-1===e.indexOf('auto'))return e;var p=y(o,i,r,n),s={top:{width:p.width,height:t.top-p.top},right:{width:p.right-t.right,height:p.height},bottom:{width:p.width,height:p.bottom-t.bottom},left:{width:t.left-p.left,height:p.height}},d=Object.keys(s).map(function(e){return se({key:e},s[e],{area:E(s[e])})}).sort(function(e,t){return t.area-e.area}),a=d.filter(function(e){var t=e.width,i=e.height;return t>=o.clientWidth&&i>=o.clientHeight}),l=0<a.length?a[0].key:d[0].key,f=e.split('-')[1];return l+(f?'-'+f:'')}function O(e,t,o){var i=d(t,o);return u(o,i)}function L(e){var t=getComputedStyle(e),o=parseFloat(t.marginTop)+parseFloat(t.marginBottom),i=parseFloat(t.marginLeft)+parseFloat(t.marginRight),n={width:e.offsetWidth+i,height:e.offsetHeight+o};return n}function x(e){var t={left:'right',right:'left',bottom:'top',top:'bottom'};return e.replace(/left|right|bottom|top/g,function(e){return t[e]})}function S(e,t,o){o=o.split('-')[0];var i=L(e),n={width:i.width,height:i.height},r=-1!==['right','left'].indexOf(o),p=r?'top':'left',s=r?'left':'top',d=r?'height':'width',a=r?'width':'height';return n[p]=t[p]+t[d]/2-i[d]/2,n[s]=o===s?t[s]-i[a]:t[x(s)],n}function T(e,t){return Array.prototype.find?e.find(t):e.filter(t)[0]}function D(e,t,o){if(Array.prototype.findIndex)return e.findIndex(function(e){return e[t]===o});var i=T(e,function(e){return e[t]===o});return e.indexOf(i)}function C(t,o,i){var n=void 0===i?t:t.slice(0,D(t,'name',i));return n.forEach(function(t){t['function']&&console.warn('`modifier.function` is deprecated, use `modifier.fn`!');var i=t['function']||t.fn;t.enabled&&e(i)&&(o.offsets.popper=c(o.offsets.popper),o.offsets.reference=c(o.offsets.reference),o=i(o,t))}),o}function N(){if(!this.state.isDestroyed){var e={instance:this,styles:{},arrowStyles:{},attributes:{},flipped:!1,offsets:{}};e.offsets.reference=O(this.state,this.popper,this.reference),e.placement=v(this.options.placement,e.offsets.reference,this.popper,this.reference,this.options.modifiers.flip.boundariesElement,this.options.modifiers.flip.padding),e.originalPlacement=e.placement,e.offsets.popper=S(this.popper,e.offsets.reference,e.placement),e.offsets.popper.position='absolute',e=C(this.modifiers,e),this.state.isCreated?this.options.onUpdate(e):(this.state.isCreated=!0,this.options.onCreate(e))}}function k(e,t){return e.some(function(e){var o=e.name,i=e.enabled;return i&&o===t})}function W(e){for(var t=[!1,'ms','Webkit','Moz','O'],o=e.charAt(0).toUpperCase()+e.slice(1),n=0;n<t.length-1;n++){var i=t[n],r=i?''+i+o:e;if('undefined'!=typeof document.body.style[r])return r}return null}function P(){return this.state.isDestroyed=!0,k(this.modifiers,'applyStyle')&&(this.popper.removeAttribute('x-placement'),this.popper.style.left='',this.popper.style.position='',this.popper.style.top='',this.popper.style[W('transform')]=''),this.disableEventListeners(),this.options.removeOnDestroy&&this.popper.parentNode.removeChild(this.popper),this}function B(e){var t=e.ownerDocument;return t?t.defaultView:window}function H(e,t,o,i){var r='BODY'===e.nodeName,p=r?e.ownerDocument.defaultView:e;p.addEventListener(t,o,{passive:!0}),r||H(n(p.parentNode),t,o,i),i.push(p)}function A(e,t,o,i){o.updateBound=i,B(e).addEventListener('resize',o.updateBound,{passive:!0});var r=n(e);return H(r,'scroll',o.updateBound,o.scrollParents),o.scrollElement=r,o.eventsEnabled=!0,o}function I(){this.state.eventsEnabled||(this.state=A(this.reference,this.options,this.state,this.scheduleUpdate))}function M(e,t){return B(e).removeEventListener('resize',t.updateBound),t.scrollParents.forEach(function(e){e.removeEventListener('scroll',t.updateBound)}),t.updateBound=null,t.scrollParents=[],t.scrollElement=null,t.eventsEnabled=!1,t}function R(){this.state.eventsEnabled&&(cancelAnimationFrame(this.scheduleUpdate),this.state=M(this.reference,this.state))}function U(e){return''!==e&&!isNaN(parseFloat(e))&&isFinite(e)}function Y(e,t){Object.keys(t).forEach(function(o){var i='';-1!==['width','height','top','right','bottom','left'].indexOf(o)&&U(t[o])&&(i='px'),e.style[o]=t[o]+i})}function j(e,t){Object.keys(t).forEach(function(o){var i=t[o];!1===i?e.removeAttribute(o):e.setAttribute(o,t[o])})}function F(e,t,o){var i=T(e,function(e){var o=e.name;return o===t}),n=!!i&&e.some(function(e){return e.name===o&&e.enabled&&e.order<i.order});if(!n){var r='`'+t+'`';console.warn('`'+o+'`'+' modifier is required by '+r+' modifier in order to work, be sure to include it before '+r+'!')}return n}function K(e){return'end'===e?'start':'start'===e?'end':e}function q(e){var t=1<arguments.length&&void 0!==arguments[1]&&arguments[1],o=ae.indexOf(e),i=ae.slice(o+1).concat(ae.slice(0,o));return t?i.reverse():i}function V(e,t,o,i){var n=e.match(/((?:\-|\+)?\d*\.?\d*)(.*)/),r=+n[1],p=n[2];if(!r)return e;if(0===p.indexOf('%')){var s;switch(p){case'%p':s=o;break;case'%':case'%r':default:s=i;}var d=c(s);return d[t]/100*r}if('vh'===p||'vw'===p){var a;return a='vh'===p?J(document.documentElement.clientHeight,window.innerHeight||0):J(document.documentElement.clientWidth,window.innerWidth||0),a/100*r}return r}function z(e,t,o,i){var n=[0,0],r=-1!==['right','left'].indexOf(i),p=e.split(/(\+|\-)/).map(function(e){return e.trim()}),s=p.indexOf(T(p,function(e){return-1!==e.search(/,|\s/)}));p[s]&&-1===p[s].indexOf(',')&&console.warn('Offsets separated by white space(s) are deprecated, use a comma (,) instead.');var d=/\s*,\s*|\s+/,a=-1===s?[p]:[p.slice(0,s).concat([p[s].split(d)[0]]),[p[s].split(d)[1]].concat(p.slice(s+1))];return a=a.map(function(e,i){var n=(1===i?!r:r)?'height':'width',p=!1;return e.reduce(function(e,t){return''===e[e.length-1]&&-1!==['+','-'].indexOf(t)?(e[e.length-1]=t,p=!0,e):p?(e[e.length-1]+=t,p=!1,e):e.concat(t)},[]).map(function(e){return V(e,n,t,o)})}),a.forEach(function(e,t){e.forEach(function(o,i){U(o)&&(n[t]+=o*('-'===e[i-1]?-1:1))})}),n}function G(e,t){var o,i=t.offset,n=e.placement,r=e.offsets,p=r.popper,s=r.reference,d=n.split('-')[0];return o=U(+i)?[+i,0]:z(i,p,s,d),'left'===d?(p.top+=o[0],p.left-=o[1]):'right'===d?(p.top+=o[0],p.left+=o[1]):'top'===d?(p.left+=o[0],p.top-=o[1]):'bottom'===d&&(p.left+=o[0],p.top+=o[1]),e.popper=p,e}for(var _=Math.min,X=Math.floor,J=Math.max,Q='undefined'!=typeof window&&'undefined'!=typeof document,Z=['Edge','Trident','Firefox'],$=0,ee=0;ee<Z.length;ee+=1)if(Q&&0<=navigator.userAgent.indexOf(Z[ee])){$=1;break}var i,te=Q&&window.Promise,oe=te?function(e){var t=!1;return function(){t||(t=!0,window.Promise.resolve().then(function(){t=!1,e()}))}}:function(e){var t=!1;return function(){t||(t=!0,setTimeout(function(){t=!1,e()},$))}},ie=function(){return void 0==i&&(i=-1!==navigator.appVersion.indexOf('MSIE 10')),i},ne=function(e,t){if(!(e instanceof t))throw new TypeError('Cannot call a class as a function')},re=function(){function e(e,t){for(var o,n=0;n<t.length;n++)o=t[n],o.enumerable=o.enumerable||!1,o.configurable=!0,'value'in o&&(o.writable=!0),Object.defineProperty(e,o.key,o)}return function(t,o,i){return o&&e(t.prototype,o),i&&e(t,i),t}}(),pe=function(e,t,o){return t in e?Object.defineProperty(e,t,{value:o,enumerable:!0,configurable:!0,writable:!0}):e[t]=o,e},se=Object.assign||function(e){for(var t,o=1;o<arguments.length;o++)for(var i in t=arguments[o],t)Object.prototype.hasOwnProperty.call(t,i)&&(e[i]=t[i]);return e},de=['auto-start','auto','auto-end','top-start','top','top-end','right-start','right','right-end','bottom-end','bottom','bottom-start','left-end','left','left-start'],ae=de.slice(3),le={FLIP:'flip',CLOCKWISE:'clockwise',COUNTERCLOCKWISE:'counterclockwise'},fe=function(){function t(o,i){var n=this,r=2<arguments.length&&void 0!==arguments[2]?arguments[2]:{};ne(this,t),this.scheduleUpdate=function(){return requestAnimationFrame(n.update)},this.update=oe(this.update.bind(this)),this.options=se({},t.Defaults,r),this.state={isDestroyed:!1,isCreated:!1,scrollParents:[]},this.reference=o&&o.jquery?o[0]:o,this.popper=i&&i.jquery?i[0]:i,this.options.modifiers={},Object.keys(se({},t.Defaults.modifiers,r.modifiers)).forEach(function(e){n.options.modifiers[e]=se({},t.Defaults.modifiers[e]||{},r.modifiers?r.modifiers[e]:{})}),this.modifiers=Object.keys(this.options.modifiers).map(function(e){return se({name:e},n.options.modifiers[e])}).sort(function(e,t){return e.order-t.order}),this.modifiers.forEach(function(t){t.enabled&&e(t.onLoad)&&t.onLoad(n.reference,n.popper,n.options,t,n.state)}),this.update();var p=this.options.eventsEnabled;p&&this.enableEventListeners(),this.state.eventsEnabled=p}return re(t,[{key:'update',value:function(){return N.call(this)}},{key:'destroy',value:function(){return P.call(this)}},{key:'enableEventListeners',value:function(){return I.call(this)}},{key:'disableEventListeners',value:function(){return R.call(this)}}]),t}();return fe.Utils=('undefined'==typeof window?global:window).PopperUtils,fe.placements=de,fe.Defaults={placement:'bottom',eventsEnabled:!0,removeOnDestroy:!1,onCreate:function(){},onUpdate:function(){},modifiers:{shift:{order:100,enabled:!0,fn:function(e){var t=e.placement,o=t.split('-')[0],i=t.split('-')[1];if(i){var n=e.offsets,r=n.reference,p=n.popper,s=-1!==['bottom','top'].indexOf(o),d=s?'left':'top',a=s?'width':'height',l={start:pe({},d,r[d]),end:pe({},d,r[d]+r[a]-p[a])};e.offsets.popper=se({},p,l[i])}return e}},offset:{order:200,enabled:!0,fn:G,offset:0},preventOverflow:{order:300,enabled:!0,fn:function(e,t){var o=t.boundariesElement||r(e.instance.popper);e.instance.reference===o&&(o=r(o));var i=y(e.instance.popper,e.instance.reference,t.padding,o);t.boundaries=i;var n=t.priority,p=e.offsets.popper,s={primary:function(e){var o=p[e];return p[e]<i[e]&&!t.escapeWithReference&&(o=J(p[e],i[e])),pe({},e,o)},secondary:function(e){var o='right'===e?'left':'top',n=p[o];return p[e]>i[e]&&!t.escapeWithReference&&(n=_(p[o],i[e]-('right'===e?p.width:p.height))),pe({},o,n)}};return n.forEach(function(e){var t=-1===['left','top'].indexOf(e)?'secondary':'primary';p=se({},p,s[t](e))}),e.offsets.popper=p,e},priority:['left','right','top','bottom'],padding:5,boundariesElement:'scrollParent'},keepTogether:{order:400,enabled:!0,fn:function(e){var t=e.offsets,o=t.popper,i=t.reference,n=e.placement.split('-')[0],r=X,p=-1!==['top','bottom'].indexOf(n),s=p?'right':'bottom',d=p?'left':'top',a=p?'width':'height';return o[s]<r(i[d])&&(e.offsets.popper[d]=r(i[d])-o[a]),o[d]>r(i[s])&&(e.offsets.popper[d]=r(i[s])),e}},arrow:{order:500,enabled:!0,fn:function(e,o){var i;if(!F(e.instance.modifiers,'arrow','keepTogether'))return e;var n=o.element;if('string'==typeof n){if(n=e.instance.popper.querySelector(n),!n)return e;}else if(!e.instance.popper.contains(n))return console.warn('WARNING: `arrow.element` must be child of its popper element!'),e;var r=e.placement.split('-')[0],p=e.offsets,s=p.popper,d=p.reference,a=-1!==['left','right'].indexOf(r),l=a?'height':'width',f=a?'Top':'Left',m=f.toLowerCase(),h=a?'left':'top',g=a?'bottom':'right',u=L(n)[l];d[g]-u<s[m]&&(e.offsets.popper[m]-=s[m]-(d[g]-u)),d[m]+u>s[g]&&(e.offsets.popper[m]+=d[m]+u-s[g]),e.offsets.popper=c(e.offsets.popper);var b=d[m]+d[l]/2-u/2,w=t(e.instance.popper),y=parseFloat(w['margin'+f],10),E=parseFloat(w['border'+f+'Width'],10),v=b-e.offsets.popper[m]-y-E;return v=J(_(s[l]-u,v),0),e.arrowElement=n,e.offsets.arrow=(i={},pe(i,m,Math.round(v)),pe(i,h,''),i),e},element:'[x-arrow]'},flip:{order:600,enabled:!0,fn:function(e,t){if(k(e.instance.modifiers,'inner'))return e;if(e.flipped&&e.placement===e.originalPlacement)return e;var o=y(e.instance.popper,e.instance.reference,t.padding,t.boundariesElement),i=e.placement.split('-')[0],n=x(i),r=e.placement.split('-')[1]||'',p=[];switch(t.behavior){case le.FLIP:p=[i,n];break;case le.CLOCKWISE:p=q(i);break;case le.COUNTERCLOCKWISE:p=q(i,!0);break;default:p=t.behavior;}return p.forEach(function(s,d){if(i!==s||p.length===d+1)return e;i=e.placement.split('-')[0],n=x(i);var a=e.offsets.popper,l=e.offsets.reference,f=X,m='left'===i&&f(a.right)>f(l.left)||'right'===i&&f(a.left)<f(l.right)||'top'===i&&f(a.bottom)>f(l.top)||'bottom'===i&&f(a.top)<f(l.bottom),h=f(a.left)<f(o.left),c=f(a.right)>f(o.right),g=f(a.top)<f(o.top),u=f(a.bottom)>f(o.bottom),b='left'===i&&h||'right'===i&&c||'top'===i&&g||'bottom'===i&&u,w=-1!==['top','bottom'].indexOf(i),y=!!t.flipVariations&&(w&&'start'===r&&h||w&&'end'===r&&c||!w&&'start'===r&&g||!w&&'end'===r&&u);(m||b||y)&&(e.flipped=!0,(m||b)&&(i=p[d+1]),y&&(r=K(r)),e.placement=i+(r?'-'+r:''),e.offsets.popper=se({},e.offsets.popper,S(e.instance.popper,e.offsets.reference,e.placement)),e=C(e.instance.modifiers,e,'flip'))}),e},behavior:'flip',padding:5,boundariesElement:'viewport'},inner:{order:700,enabled:!1,fn:function(e){var t=e.placement,o=t.split('-')[0],i=e.offsets,n=i.popper,r=i.reference,p=-1!==['left','right'].indexOf(o),s=-1===['top','left'].indexOf(o);return n[p?'left':'top']=r[o]-(s?n[p?'width':'height']:0),e.placement=x(t),e.offsets.popper=c(n),e}},hide:{order:800,enabled:!0,fn:function(e){if(!F(e.instance.modifiers,'hide','preventOverflow'))return e;var t=e.offsets.reference,o=T(e.instance.modifiers,function(e){return'preventOverflow'===e.name}).boundaries;if(t.bottom<o.top||t.left>o.right||t.top>o.bottom||t.right<o.left){if(!0===e.hide)return e;e.hide=!0,e.attributes['x-out-of-boundaries']=''}else{if(!1===e.hide)return e;e.hide=!1,e.attributes['x-out-of-boundaries']=!1}return e}},computeStyle:{order:850,enabled:!0,fn:function(e,t){var o=t.x,i=t.y,n=e.offsets.popper,p=T(e.instance.modifiers,function(e){return'applyStyle'===e.name}).gpuAcceleration;void 0!==p&&console.warn('WARNING: `gpuAcceleration` option moved to `computeStyle` modifier and will not be supported in future versions of Popper.js!');var s,d,a=void 0===p?t.gpuAcceleration:p,l=r(e.instance.popper),f=g(l),m={position:n.position},h={left:X(n.left),top:X(n.top),bottom:X(n.bottom),right:X(n.right)},c='bottom'===o?'top':'bottom',u='right'===i?'left':'right',b=W('transform');if(d='bottom'==c?-f.height+h.bottom:h.top,s='right'==u?-f.width+h.right:h.left,a&&b)m[b]='translate3d('+s+'px, '+d+'px, 0)',m[c]=0,m[u]=0,m.willChange='transform';else{var w='bottom'==c?-1:1,y='right'==u?-1:1;m[c]=d*w,m[u]=s*y,m.willChange=c+', '+u}var E={"x-placement":e.placement};return e.attributes=se({},E,e.attributes),e.styles=se({},m,e.styles),e.arrowStyles=se({},e.offsets.arrow,e.arrowStyles),e},gpuAcceleration:!0,x:'bottom',y:'right'},applyStyle:{order:900,enabled:!0,fn:function(e){return Y(e.instance.popper,e.styles),j(e.instance.popper,e.attributes),e.arrowElement&&Object.keys(e.arrowStyles).length&&Y(e.arrowElement,e.arrowStyles),e},onLoad:function(e,t,o,i,n){var r=O(n,t,e),p=v(o.placement,r,t,e,o.modifiers.flip.boundariesElement,o.modifiers.flip.padding);return t.setAttribute('x-placement',p),Y(t,{position:'absolute'}),o},gpuAcceleration:void 0}}},fe});
//# sourceMappingURL=popper.min.js.map

(function(factory){if(typeof define==="function"&&define.amd){define(["jquery"],function($){return factory($)})}else if(typeof module==="object"&&typeof module.exports==="object"){exports=factory(require("jquery"))}else{factory(jQuery)}})(function($){$.easing.jswing=$.easing.swing;var pow=Math.pow,sqrt=Math.sqrt,sin=Math.sin,cos=Math.cos,PI=Math.PI,c1=1.70158,c2=c1*1.525,c3=c1+1,c4=2*PI/3,c5=2*PI/4.5;function bounceOut(x){var n1=7.5625,d1=2.75;if(x<1/d1){return n1*x*x}else if(x<2/d1){return n1*(x-=1.5/d1)*x+.75}else if(x<2.5/d1){return n1*(x-=2.25/d1)*x+.9375}else{return n1*(x-=2.625/d1)*x+.984375}}$.extend($.easing,{def:"easeOutQuad",swing:function(x){return $.easing[$.easing.def](x)},easeInQuad:function(x){return x*x},easeOutQuad:function(x){return 1-(1-x)*(1-x)},easeInOutQuad:function(x){return x<.5?2*x*x:1-pow(-2*x+2,2)/2},easeInCubic:function(x){return x*x*x},easeOutCubic:function(x){return 1-pow(1-x,3)},easeInOutCubic:function(x){return x<.5?4*x*x*x:1-pow(-2*x+2,3)/2},easeInQuart:function(x){return x*x*x*x},easeOutQuart:function(x){return 1-pow(1-x,4)},easeInOutQuart:function(x){return x<.5?8*x*x*x*x:1-pow(-2*x+2,4)/2},easeInQuint:function(x){return x*x*x*x*x},easeOutQuint:function(x){return 1-pow(1-x,5)},easeInOutQuint:function(x){return x<.5?16*x*x*x*x*x:1-pow(-2*x+2,5)/2},easeInSine:function(x){return 1-cos(x*PI/2)},easeOutSine:function(x){return sin(x*PI/2)},easeInOutSine:function(x){return-(cos(PI*x)-1)/2},easeInExpo:function(x){return x===0?0:pow(2,10*x-10)},easeOutExpo:function(x){return x===1?1:1-pow(2,-10*x)},easeInOutExpo:function(x){return x===0?0:x===1?1:x<.5?pow(2,20*x-10)/2:(2-pow(2,-20*x+10))/2},easeInCirc:function(x){return 1-sqrt(1-pow(x,2))},easeOutCirc:function(x){return sqrt(1-pow(x-1,2))},easeInOutCirc:function(x){return x<.5?(1-sqrt(1-pow(2*x,2)))/2:(sqrt(1-pow(-2*x+2,2))+1)/2},easeInElastic:function(x){return x===0?0:x===1?1:-pow(2,10*x-10)*sin((x*10-10.75)*c4)},easeOutElastic:function(x){return x===0?0:x===1?1:pow(2,-10*x)*sin((x*10-.75)*c4)+1},easeInOutElastic:function(x){return x===0?0:x===1?1:x<.5?-(pow(2,20*x-10)*sin((20*x-11.125)*c5))/2:pow(2,-20*x+10)*sin((20*x-11.125)*c5)/2+1},easeInBack:function(x){return c3*x*x*x-c1*x*x},easeOutBack:function(x){return 1+c3*pow(x-1,3)+c1*pow(x-1,2)},easeInOutBack:function(x){return x<.5?pow(2*x,2)*((c2+1)*2*x-c2)/2:(pow(2*x-2,2)*((c2+1)*(x*2-2)+c2)+2)/2},easeInBounce:function(x){return 1-bounceOut(1-x)},easeOutBounce:bounceOut,easeInOutBounce:function(x){return x<.5?(1-bounceOut(1-2*x))/2:(1+bounceOut(2*x-1))/2}})});
var DateFormatter;!function(){"use strict";var e,t,a,n,r,o,i;o=864e5,i=3600,e=function(e,t){return"string"==typeof e&&"string"==typeof t&&e.toLowerCase()===t.toLowerCase()},t=function(e,a,n){var r=n||"0",o=e.toString();return o.length<a?t(r+o,a):o},a=function(e){var t,n;for(e=e||{},t=1;t<arguments.length;t++)if(n=arguments[t])for(var r in n)n.hasOwnProperty(r)&&("object"==typeof n[r]?a(e[r],n[r]):e[r]=n[r]);return e},n=function(e,t){for(var a=0;a<t.length;a++)if(t[a].toLowerCase()===e.toLowerCase())return a;return-1},r={dateSettings:{days:["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"],daysShort:["Sun","Mon","Tue","Wed","Thu","Fri","Sat"],months:["January","February","March","April","May","June","July","August","September","October","November","December"],monthsShort:["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"],meridiem:["AM","PM"],ordinal:function(e){var t=e%10,a={1:"st",2:"nd",3:"rd"};return 1!==Math.floor(e%100/10)&&a[t]?a[t]:"th"}},separators:/[ \-+\/\.T:@]/g,validParts:/[dDjlNSwzWFmMntLoYyaABgGhHisueTIOPZcrU]/g,intParts:/[djwNzmnyYhHgGis]/g,tzParts:/\b(?:[PMCEA][SDP]T|(?:Pacific|Mountain|Central|Eastern|Atlantic) (?:Standard|Daylight|Prevailing) Time|(?:GMT|UTC)(?:[-+]\d{4})?)\b/g,tzClip:/[^-+\dA-Z]/g},(DateFormatter=function(e){var t=this,n=a(r,e);t.dateSettings=n.dateSettings,t.separators=n.separators,t.validParts=n.validParts,t.intParts=n.intParts,t.tzParts=n.tzParts,t.tzClip=n.tzClip}).prototype={constructor:DateFormatter,getMonth:function(e){var t,a=this;return 0===(t=n(e,a.dateSettings.monthsShort)+1)&&(t=n(e,a.dateSettings.months)+1),t},parseDate:function(t,a){var n,r,o,i,s,d,u,l,f,c,m=this,h=!1,g=!1,p=m.dateSettings,y={date:null,year:null,month:null,day:null,hour:0,min:0,sec:0};if(!t)return null;if(t instanceof Date)return t;if("U"===a)return(o=parseInt(t))?new Date(1e3*o):t;switch(typeof t){case"number":return new Date(t);case"string":break;default:return null}if(!(n=a.match(m.validParts))||0===n.length)throw new Error("Invalid date format definition.");for(r=t.replace(m.separators,"\0").split("\0"),o=0;o<r.length;o++)switch(i=r[o],s=parseInt(i),n[o]){case"y":case"Y":if(!s)return null;f=i.length,y.year=2===f?parseInt((70>s?"20":"19")+i):s,h=!0;break;case"m":case"n":case"M":case"F":if(isNaN(s)){if(!((d=m.getMonth(i))>0))return null;y.month=d}else{if(!(s>=1&&12>=s))return null;y.month=s}h=!0;break;case"d":case"j":if(!(s>=1&&31>=s))return null;y.day=s,h=!0;break;case"g":case"h":if(u=n.indexOf("a")>-1?n.indexOf("a"):n.indexOf("A")>-1?n.indexOf("A"):-1,c=r[u],u>-1)l=e(c,p.meridiem[0])?0:e(c,p.meridiem[1])?12:-1,s>=1&&12>=s&&l>-1?y.hour=s+l-1:s>=0&&23>=s&&(y.hour=s);else{if(!(s>=0&&23>=s))return null;y.hour=s}g=!0;break;case"G":case"H":if(!(s>=0&&23>=s))return null;y.hour=s,g=!0;break;case"i":if(!(s>=0&&59>=s))return null;y.min=s,g=!0;break;case"s":if(!(s>=0&&59>=s))return null;y.sec=s,g=!0}if(!0===h&&y.year&&y.month&&y.day)y.date=new Date(y.year,y.month-1,y.day,y.hour,y.min,y.sec,0);else{if(!0!==g)return null;y.date=new Date(0,0,0,y.hour,y.min,y.sec,0)}return y.date},guessDate:function(e,t){if("string"!=typeof e)return e;var a,n,r,o,i,s,d=this,u=e.replace(d.separators,"\0").split("\0"),l=/^[djmn]/g,f=t.match(d.validParts),c=new Date,m=0;if(!l.test(f[0]))return e;for(r=0;r<u.length;r++){if(m=2,i=u[r],s=parseInt(i.substr(0,2)),isNaN(s))return null;switch(r){case 0:"m"===f[0]||"n"===f[0]?c.setMonth(s-1):c.setDate(s);break;case 1:"m"===f[0]||"n"===f[0]?c.setDate(s):c.setMonth(s-1);break;case 2:if(n=c.getFullYear(),a=i.length,m=4>a?a:4,!(n=parseInt(4>a?n.toString().substr(0,4-a)+i:i.substr(0,4))))return null;c.setFullYear(n);break;case 3:c.setHours(s);break;case 4:c.setMinutes(s);break;case 5:c.setSeconds(s)}(o=i.substr(m)).length>0&&u.splice(r+1,0,o)}return c},parseFormat:function(e,a){var n,r=this,s=r.dateSettings,d=/\\?(.?)/gi,u=function(e,t){return n[e]?n[e]():t};return n={d:function(){return t(n.j(),2)},D:function(){return s.daysShort[n.w()]},j:function(){return a.getDate()},l:function(){return s.days[n.w()]},N:function(){return n.w()||7},w:function(){return a.getDay()},z:function(){var e=new Date(n.Y(),n.n()-1,n.j()),t=new Date(n.Y(),0,1);return Math.round((e-t)/o)},W:function(){var e=new Date(n.Y(),n.n()-1,n.j()-n.N()+3),a=new Date(e.getFullYear(),0,4);return t(1+Math.round((e-a)/o/7),2)},F:function(){return s.months[a.getMonth()]},m:function(){return t(n.n(),2)},M:function(){return s.monthsShort[a.getMonth()]},n:function(){return a.getMonth()+1},t:function(){return new Date(n.Y(),n.n(),0).getDate()},L:function(){var e=n.Y();return e%4==0&&e%100!=0||e%400==0?1:0},o:function(){var e=n.n(),t=n.W();return n.Y()+(12===e&&9>t?1:1===e&&t>9?-1:0)},Y:function(){return a.getFullYear()},y:function(){return n.Y().toString().slice(-2)},a:function(){return n.A().toLowerCase()},A:function(){var e=n.G()<12?0:1;return s.meridiem[e]},B:function(){var e=a.getUTCHours()*i,n=60*a.getUTCMinutes(),r=a.getUTCSeconds();return t(Math.floor((e+n+r+i)/86.4)%1e3,3)},g:function(){return n.G()%12||12},G:function(){return a.getHours()},h:function(){return t(n.g(),2)},H:function(){return t(n.G(),2)},i:function(){return t(a.getMinutes(),2)},s:function(){return t(a.getSeconds(),2)},u:function(){return t(1e3*a.getMilliseconds(),6)},e:function(){return/\((.*)\)/.exec(String(a))[1]||"Coordinated Universal Time"},I:function(){return new Date(n.Y(),0)-Date.UTC(n.Y(),0)!=new Date(n.Y(),6)-Date.UTC(n.Y(),6)?1:0},O:function(){var e=a.getTimezoneOffset(),n=Math.abs(e);return(e>0?"-":"+")+t(100*Math.floor(n/60)+n%60,4)},P:function(){var e=n.O();return e.substr(0,3)+":"+e.substr(3,2)},T:function(){return(String(a).match(r.tzParts)||[""]).pop().replace(r.tzClip,"")||"UTC"},Z:function(){return 60*-a.getTimezoneOffset()},c:function(){return"Y-m-d\\TH:i:sP".replace(d,u)},r:function(){return"D, d M Y H:i:s O".replace(d,u)},U:function(){return a.getTime()/1e3||0}},u(e,e)},formatDate:function(e,t){var a,n,r,o,i,s=this,d="";if("string"==typeof e&&!(e=s.parseDate(e,t)))return null;if(e instanceof Date){for(r=t.length,a=0;r>a;a++)"S"!==(i=t.charAt(a))&&"\\"!==i&&(a>0&&"\\"===t.charAt(a-1)?d+=i:(o=s.parseFormat(i,e),a!==r-1&&s.intParts.test(i)&&"S"===t.charAt(a+1)&&(n=parseInt(o)||0,o+=s.dateSettings.ordinal(n)),d+=o));return d}return""}}}();var datetimepickerFactory=function(e){"use strict";function t(e,t,a){this.date=e,this.desc=t,this.style=a}var a={i18n:{ar:{months:["كانون الثاني","شباط","آذار","نيسان","مايو","حزيران","تموز","آب","أيلول","تشرين الأول","تشرين الثاني","كانون الأول"],dayOfWeekShort:["ن","ث","ع","خ","ج","س","ح"],dayOfWeek:["الأحد","الاثنين","الثلاثاء","الأربعاء","الخميس","الجمعة","السبت","الأحد"]},ro:{months:["Ianuarie","Februarie","Martie","Aprilie","Mai","Iunie","Iulie","August","Septembrie","Octombrie","Noiembrie","Decembrie"],dayOfWeekShort:["Du","Lu","Ma","Mi","Jo","Vi","Sâ"],dayOfWeek:["Duminică","Luni","Marţi","Miercuri","Joi","Vineri","Sâmbătă"]},id:{months:["Januari","Februari","Maret","April","Mei","Juni","Juli","Agustus","September","Oktober","November","Desember"],dayOfWeekShort:["Min","Sen","Sel","Rab","Kam","Jum","Sab"],dayOfWeek:["Minggu","Senin","Selasa","Rabu","Kamis","Jumat","Sabtu"]},is:{months:["Janúar","Febrúar","Mars","Apríl","Maí","Júní","Júlí","Ágúst","September","Október","Nóvember","Desember"],dayOfWeekShort:["Sun","Mán","Þrið","Mið","Fim","Fös","Lau"],dayOfWeek:["Sunnudagur","Mánudagur","Þriðjudagur","Miðvikudagur","Fimmtudagur","Föstudagur","Laugardagur"]},bg:{months:["Януари","Февруари","Март","Април","Май","Юни","Юли","Август","Септември","Октомври","Ноември","Декември"],dayOfWeekShort:["Нд","Пн","Вт","Ср","Чт","Пт","Сб"],dayOfWeek:["Неделя","Понеделник","Вторник","Сряда","Четвъртък","Петък","Събота"]},fa:{months:["فروردین","اردیبهشت","خرداد","تیر","مرداد","شهریور","مهر","آبان","آذر","دی","بهمن","اسفند"],dayOfWeekShort:["یکشنبه","دوشنبه","سه شنبه","چهارشنبه","پنجشنبه","جمعه","شنبه"],dayOfWeek:["یک‌شنبه","دوشنبه","سه‌شنبه","چهارشنبه","پنج‌شنبه","جمعه","شنبه","یک‌شنبه"]},ru:{months:["Январь","Февраль","Март","Апрель","Май","Июнь","Июль","Август","Сентябрь","Октябрь","Ноябрь","Декабрь"],dayOfWeekShort:["Вс","Пн","Вт","Ср","Чт","Пт","Сб"],dayOfWeek:["Воскресенье","Понедельник","Вторник","Среда","Четверг","Пятница","Суббота"]},uk:{months:["Січень","Лютий","Березень","Квітень","Травень","Червень","Липень","Серпень","Вересень","Жовтень","Листопад","Грудень"],dayOfWeekShort:["Ндл","Пнд","Втр","Срд","Чтв","Птн","Сбт"],dayOfWeek:["Неділя","Понеділок","Вівторок","Середа","Четвер","П'ятниця","Субота"]},en:{months:["January","February","March","April","May","June","July","August","September","October","November","December"],dayOfWeekShort:["Sun","Mon","Tue","Wed","Thu","Fri","Sat"],dayOfWeek:["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"]},el:{months:["Ιανουάριος","Φεβρουάριος","Μάρτιος","Απρίλιος","Μάιος","Ιούνιος","Ιούλιος","Αύγουστος","Σεπτέμβριος","Οκτώβριος","Νοέμβριος","Δεκέμβριος"],dayOfWeekShort:["Κυρ","Δευ","Τρι","Τετ","Πεμ","Παρ","Σαβ"],dayOfWeek:["Κυριακή","Δευτέρα","Τρίτη","Τετάρτη","Πέμπτη","Παρασκευή","Σάββατο"]},de:{months:["Januar","Februar","März","April","Mai","Juni","Juli","August","September","Oktober","November","Dezember"],dayOfWeekShort:["So","Mo","Di","Mi","Do","Fr","Sa"],dayOfWeek:["Sonntag","Montag","Dienstag","Mittwoch","Donnerstag","Freitag","Samstag"]},nl:{months:["januari","februari","maart","april","mei","juni","juli","augustus","september","oktober","november","december"],dayOfWeekShort:["zo","ma","di","wo","do","vr","za"],dayOfWeek:["zondag","maandag","dinsdag","woensdag","donderdag","vrijdag","zaterdag"]},tr:{months:["Ocak","Şubat","Mart","Nisan","Mayıs","Haziran","Temmuz","Ağustos","Eylül","Ekim","Kasım","Aralık"],dayOfWeekShort:["Paz","Pts","Sal","Çar","Per","Cum","Cts"],dayOfWeek:["Pazar","Pazartesi","Salı","Çarşamba","Perşembe","Cuma","Cumartesi"]},fr:{months:["Janvier","Février","Mars","Avril","Mai","Juin","Juillet","Août","Septembre","Octobre","Novembre","Décembre"],dayOfWeekShort:["Dim","Lun","Mar","Mer","Jeu","Ven","Sam"],dayOfWeek:["dimanche","lundi","mardi","mercredi","jeudi","vendredi","samedi"]},es:{months:["Enero","Febrero","Marzo","Abril","Mayo","Junio","Julio","Agosto","Septiembre","Octubre","Noviembre","Diciembre"],dayOfWeekShort:["Dom","Lun","Mar","Mié","Jue","Vie","Sáb"],dayOfWeek:["Domingo","Lunes","Martes","Miércoles","Jueves","Viernes","Sábado"]},th:{months:["มกราคม","กุมภาพันธ์","มีนาคม","เมษายน","พฤษภาคม","มิถุนายน","กรกฎาคม","สิงหาคม","กันยายน","ตุลาคม","พฤศจิกายน","ธันวาคม"],dayOfWeekShort:["อา.","จ.","อ.","พ.","พฤ.","ศ.","ส."],dayOfWeek:["อาทิตย์","จันทร์","อังคาร","พุธ","พฤหัส","ศุกร์","เสาร์","อาทิตย์"]},pl:{months:["styczeń","luty","marzec","kwiecień","maj","czerwiec","lipiec","sierpień","wrzesień","październik","listopad","grudzień"],dayOfWeekShort:["nd","pn","wt","śr","cz","pt","sb"],dayOfWeek:["niedziela","poniedziałek","wtorek","środa","czwartek","piątek","sobota"]},pt:{months:["Janeiro","Fevereiro","Março","Abril","Maio","Junho","Julho","Agosto","Setembro","Outubro","Novembro","Dezembro"],dayOfWeekShort:["Dom","Seg","Ter","Qua","Qui","Sex","Sab"],dayOfWeek:["Domingo","Segunda","Terça","Quarta","Quinta","Sexta","Sábado"]},ch:{months:["一月","二月","三月","四月","五月","六月","七月","八月","九月","十月","十一月","十二月"],dayOfWeekShort:["日","一","二","三","四","五","六"]},se:{months:["Januari","Februari","Mars","April","Maj","Juni","Juli","Augusti","September","Oktober","November","December"],dayOfWeekShort:["Sön","Mån","Tis","Ons","Tor","Fre","Lör"]},km:{months:["មករា​","កុម្ភៈ","មិនា​","មេសា​","ឧសភា​","មិថុនា​","កក្កដា​","សីហា​","កញ្ញា​","តុលា​","វិច្ឆិកា","ធ្នូ​"],dayOfWeekShort:["អាទិ​","ច័ន្ទ​","អង្គារ​","ពុធ​","ព្រហ​​","សុក្រ​","សៅរ៍"],dayOfWeek:["អាទិត្យ​","ច័ន្ទ​","អង្គារ​","ពុធ​","ព្រហស្បតិ៍​","សុក្រ​","សៅរ៍"]},kr:{months:["1월","2월","3월","4월","5월","6월","7월","8월","9월","10월","11월","12월"],dayOfWeekShort:["일","월","화","수","목","금","토"],dayOfWeek:["일요일","월요일","화요일","수요일","목요일","금요일","토요일"]},it:{months:["Gennaio","Febbraio","Marzo","Aprile","Maggio","Giugno","Luglio","Agosto","Settembre","Ottobre","Novembre","Dicembre"],dayOfWeekShort:["Dom","Lun","Mar","Mer","Gio","Ven","Sab"],dayOfWeek:["Domenica","Lunedì","Martedì","Mercoledì","Giovedì","Venerdì","Sabato"]},da:{months:["Januar","Februar","Marts","April","Maj","Juni","Juli","August","September","Oktober","November","December"],dayOfWeekShort:["Søn","Man","Tir","Ons","Tor","Fre","Lør"],dayOfWeek:["søndag","mandag","tirsdag","onsdag","torsdag","fredag","lørdag"]},no:{months:["Januar","Februar","Mars","April","Mai","Juni","Juli","August","September","Oktober","November","Desember"],dayOfWeekShort:["Søn","Man","Tir","Ons","Tor","Fre","Lør"],dayOfWeek:["Søndag","Mandag","Tirsdag","Onsdag","Torsdag","Fredag","Lørdag"]},ja:{months:["1月","2月","3月","4月","5月","6月","7月","8月","9月","10月","11月","12月"],dayOfWeekShort:["日","月","火","水","木","金","土"],dayOfWeek:["日曜","月曜","火曜","水曜","木曜","金曜","土曜"]},vi:{months:["Tháng 1","Tháng 2","Tháng 3","Tháng 4","Tháng 5","Tháng 6","Tháng 7","Tháng 8","Tháng 9","Tháng 10","Tháng 11","Tháng 12"],dayOfWeekShort:["CN","T2","T3","T4","T5","T6","T7"],dayOfWeek:["Chủ nhật","Thứ hai","Thứ ba","Thứ tư","Thứ năm","Thứ sáu","Thứ bảy"]},sl:{months:["Januar","Februar","Marec","April","Maj","Junij","Julij","Avgust","September","Oktober","November","December"],dayOfWeekShort:["Ned","Pon","Tor","Sre","Čet","Pet","Sob"],dayOfWeek:["Nedelja","Ponedeljek","Torek","Sreda","Četrtek","Petek","Sobota"]},cs:{months:["Leden","Únor","Březen","Duben","Květen","Červen","Červenec","Srpen","Září","Říjen","Listopad","Prosinec"],dayOfWeekShort:["Ne","Po","Út","St","Čt","Pá","So"]},hu:{months:["Január","Február","Március","Április","Május","Június","Július","Augusztus","Szeptember","Október","November","December"],dayOfWeekShort:["Va","Hé","Ke","Sze","Cs","Pé","Szo"],dayOfWeek:["vasárnap","hétfő","kedd","szerda","csütörtök","péntek","szombat"]},az:{months:["Yanvar","Fevral","Mart","Aprel","May","Iyun","Iyul","Avqust","Sentyabr","Oktyabr","Noyabr","Dekabr"],dayOfWeekShort:["B","Be","Ça","Ç","Ca","C","Ş"],dayOfWeek:["Bazar","Bazar ertəsi","Çərşənbə axşamı","Çərşənbə","Cümə axşamı","Cümə","Şənbə"]},bs:{months:["Januar","Februar","Mart","April","Maj","Jun","Jul","Avgust","Septembar","Oktobar","Novembar","Decembar"],dayOfWeekShort:["Ned","Pon","Uto","Sri","Čet","Pet","Sub"],dayOfWeek:["Nedjelja","Ponedjeljak","Utorak","Srijeda","Četvrtak","Petak","Subota"]},ca:{months:["Gener","Febrer","Març","Abril","Maig","Juny","Juliol","Agost","Setembre","Octubre","Novembre","Desembre"],dayOfWeekShort:["Dg","Dl","Dt","Dc","Dj","Dv","Ds"],dayOfWeek:["Diumenge","Dilluns","Dimarts","Dimecres","Dijous","Divendres","Dissabte"]},"en-GB":{months:["January","February","March","April","May","June","July","August","September","October","November","December"],dayOfWeekShort:["Sun","Mon","Tue","Wed","Thu","Fri","Sat"],dayOfWeek:["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"]},et:{months:["Jaanuar","Veebruar","Märts","Aprill","Mai","Juuni","Juuli","August","September","Oktoober","November","Detsember"],dayOfWeekShort:["P","E","T","K","N","R","L"],dayOfWeek:["Pühapäev","Esmaspäev","Teisipäev","Kolmapäev","Neljapäev","Reede","Laupäev"]},eu:{months:["Urtarrila","Otsaila","Martxoa","Apirila","Maiatza","Ekaina","Uztaila","Abuztua","Iraila","Urria","Azaroa","Abendua"],dayOfWeekShort:["Ig.","Al.","Ar.","Az.","Og.","Or.","La."],dayOfWeek:["Igandea","Astelehena","Asteartea","Asteazkena","Osteguna","Ostirala","Larunbata"]},fi:{months:["Tammikuu","Helmikuu","Maaliskuu","Huhtikuu","Toukokuu","Kesäkuu","Heinäkuu","Elokuu","Syyskuu","Lokakuu","Marraskuu","Joulukuu"],dayOfWeekShort:["Su","Ma","Ti","Ke","To","Pe","La"],dayOfWeek:["sunnuntai","maanantai","tiistai","keskiviikko","torstai","perjantai","lauantai"]},gl:{months:["Xan","Feb","Maz","Abr","Mai","Xun","Xul","Ago","Set","Out","Nov","Dec"],dayOfWeekShort:["Dom","Lun","Mar","Mer","Xov","Ven","Sab"],dayOfWeek:["Domingo","Luns","Martes","Mércores","Xoves","Venres","Sábado"]},hr:{months:["Siječanj","Veljača","Ožujak","Travanj","Svibanj","Lipanj","Srpanj","Kolovoz","Rujan","Listopad","Studeni","Prosinac"],dayOfWeekShort:["Ned","Pon","Uto","Sri","Čet","Pet","Sub"],dayOfWeek:["Nedjelja","Ponedjeljak","Utorak","Srijeda","Četvrtak","Petak","Subota"]},ko:{months:["1월","2월","3월","4월","5월","6월","7월","8월","9월","10월","11월","12월"],dayOfWeekShort:["일","월","화","수","목","금","토"],dayOfWeek:["일요일","월요일","화요일","수요일","목요일","금요일","토요일"]},lt:{months:["Sausio","Vasario","Kovo","Balandžio","Gegužės","Birželio","Liepos","Rugpjūčio","Rugsėjo","Spalio","Lapkričio","Gruodžio"],dayOfWeekShort:["Sek","Pir","Ant","Tre","Ket","Pen","Šeš"],dayOfWeek:["Sekmadienis","Pirmadienis","Antradienis","Trečiadienis","Ketvirtadienis","Penktadienis","Šeštadienis"]},lv:{months:["Janvāris","Februāris","Marts","Aprīlis ","Maijs","Jūnijs","Jūlijs","Augusts","Septembris","Oktobris","Novembris","Decembris"],dayOfWeekShort:["Sv","Pr","Ot","Tr","Ct","Pk","St"],dayOfWeek:["Svētdiena","Pirmdiena","Otrdiena","Trešdiena","Ceturtdiena","Piektdiena","Sestdiena"]},mk:{months:["јануари","февруари","март","април","мај","јуни","јули","август","септември","октомври","ноември","декември"],dayOfWeekShort:["нед","пон","вто","сре","чет","пет","саб"],dayOfWeek:["Недела","Понеделник","Вторник","Среда","Четврток","Петок","Сабота"]},mn:{months:["1-р сар","2-р сар","3-р сар","4-р сар","5-р сар","6-р сар","7-р сар","8-р сар","9-р сар","10-р сар","11-р сар","12-р сар"],dayOfWeekShort:["Дав","Мяг","Лха","Пүр","Бсн","Бям","Ням"],dayOfWeek:["Даваа","Мягмар","Лхагва","Пүрэв","Баасан","Бямба","Ням"]},"pt-BR":{months:["Janeiro","Fevereiro","Março","Abril","Maio","Junho","Julho","Agosto","Setembro","Outubro","Novembro","Dezembro"],dayOfWeekShort:["Dom","Seg","Ter","Qua","Qui","Sex","Sáb"],dayOfWeek:["Domingo","Segunda","Terça","Quarta","Quinta","Sexta","Sábado"]},sk:{months:["Január","Február","Marec","Apríl","Máj","Jún","Júl","August","September","Október","November","December"],dayOfWeekShort:["Ne","Po","Ut","St","Št","Pi","So"],dayOfWeek:["Nedeľa","Pondelok","Utorok","Streda","Štvrtok","Piatok","Sobota"]},sq:{months:["Janar","Shkurt","Mars","Prill","Maj","Qershor","Korrik","Gusht","Shtator","Tetor","Nëntor","Dhjetor"],dayOfWeekShort:["Die","Hën","Mar","Mër","Enj","Pre","Shtu"],dayOfWeek:["E Diel","E Hënë","E Martē","E Mërkurë","E Enjte","E Premte","E Shtunë"]},"sr-YU":{months:["Januar","Februar","Mart","April","Maj","Jun","Jul","Avgust","Septembar","Oktobar","Novembar","Decembar"],dayOfWeekShort:["Ned","Pon","Uto","Sre","čet","Pet","Sub"],dayOfWeek:["Nedelja","Ponedeljak","Utorak","Sreda","Četvrtak","Petak","Subota"]},sr:{months:["јануар","фебруар","март","април","мај","јун","јул","август","септембар","октобар","новембар","децембар"],dayOfWeekShort:["нед","пон","уто","сре","чет","пет","суб"],dayOfWeek:["Недеља","Понедељак","Уторак","Среда","Четвртак","Петак","Субота"]},sv:{months:["Januari","Februari","Mars","April","Maj","Juni","Juli","Augusti","September","Oktober","November","December"],dayOfWeekShort:["Sön","Mån","Tis","Ons","Tor","Fre","Lör"],dayOfWeek:["Söndag","Måndag","Tisdag","Onsdag","Torsdag","Fredag","Lördag"]},"zh-TW":{months:["一月","二月","三月","四月","五月","六月","七月","八月","九月","十月","十一月","十二月"],dayOfWeekShort:["日","一","二","三","四","五","六"],dayOfWeek:["星期日","星期一","星期二","星期三","星期四","星期五","星期六"]},zh:{months:["一月","二月","三月","四月","五月","六月","七月","八月","九月","十月","十一月","十二月"],dayOfWeekShort:["日","一","二","三","四","五","六"],dayOfWeek:["星期日","星期一","星期二","星期三","星期四","星期五","星期六"]},ug:{months:["1-ئاي","2-ئاي","3-ئاي","4-ئاي","5-ئاي","6-ئاي","7-ئاي","8-ئاي","9-ئاي","10-ئاي","11-ئاي","12-ئاي"],dayOfWeek:["يەكشەنبە","دۈشەنبە","سەيشەنبە","چارشەنبە","پەيشەنبە","جۈمە","شەنبە"]},he:{months:["ינואר","פברואר","מרץ","אפריל","מאי","יוני","יולי","אוגוסט","ספטמבר","אוקטובר","נובמבר","דצמבר"],dayOfWeekShort:["א'","ב'","ג'","ד'","ה'","ו'","שבת"],dayOfWeek:["ראשון","שני","שלישי","רביעי","חמישי","שישי","שבת","ראשון"]},hy:{months:["Հունվար","Փետրվար","Մարտ","Ապրիլ","Մայիս","Հունիս","Հուլիս","Օգոստոս","Սեպտեմբեր","Հոկտեմբեր","Նոյեմբեր","Դեկտեմբեր"],dayOfWeekShort:["Կի","Երկ","Երք","Չոր","Հնգ","Ուրբ","Շբթ"],dayOfWeek:["Կիրակի","Երկուշաբթի","Երեքշաբթի","Չորեքշաբթի","Հինգշաբթի","Ուրբաթ","Շաբաթ"]},kg:{months:["Үчтүн айы","Бирдин айы","Жалган Куран","Чын Куран","Бугу","Кулжа","Теке","Баш Оона","Аяк Оона","Тогуздун айы","Жетинин айы","Бештин айы"],dayOfWeekShort:["Жек","Дүй","Шей","Шар","Бей","Жум","Ише"],dayOfWeek:["Жекшемб","Дүйшөмб","Шейшемб","Шаршемб","Бейшемби","Жума","Ишенб"]},rm:{months:["Schaner","Favrer","Mars","Avrigl","Matg","Zercladur","Fanadur","Avust","Settember","October","November","December"],dayOfWeekShort:["Du","Gli","Ma","Me","Gie","Ve","So"],dayOfWeek:["Dumengia","Glindesdi","Mardi","Mesemna","Gievgia","Venderdi","Sonda"]},ka:{months:["იანვარი","თებერვალი","მარტი","აპრილი","მაისი","ივნისი","ივლისი","აგვისტო","სექტემბერი","ოქტომბერი","ნოემბერი","დეკემბერი"],dayOfWeekShort:["კვ","ორშ","სამშ","ოთხ","ხუთ","პარ","შაბ"],dayOfWeek:["კვირა","ორშაბათი","სამშაბათი","ოთხშაბათი","ხუთშაბათი","პარასკევი","შაბათი"]}},ownerDocument:document,contentWindow:window,value:"",rtl:!1,format:"Y/m/d H:i",formatTime:"H:i",formatDate:"Y/m/d",startDate:!1,step:60,monthChangeSpinner:!0,closeOnDateSelect:!1,closeOnTimeSelect:!0,closeOnWithoutClick:!0,closeOnInputClick:!0,openOnFocus:!0,timepicker:!0,datepicker:!0,weeks:!1,defaultTime:!1,defaultDate:!1,minDate:!1,maxDate:!1,minTime:!1,maxTime:!1,minDateTime:!1,disabledMinTime:!1,disabledMaxTime:!1,allowTimes:[],opened:!1,initTime:!0,inline:!1,theme:"",touchMovedThreshold:5,onSelectDate:function(){},onSelectTime:function(){},onChangeMonth:function(){},onGetWeekOfYear:function(){},onChangeYear:function(){},onChangeDateTime:function(){},onShow:function(){},onClose:function(){},onGenerate:function(){},withoutCopyright:!0,inverseButton:!1,hours12:!1,next:"xdsoft_next",prev:"xdsoft_prev",dayOfWeekStart:0,parentID:"body",timeHeightInTimePicker:25,timepickerScrollbar:!0,todayButton:!0,prevButton:!0,nextButton:!0,defaultSelect:!0,scrollMonth:!0,scrollTime:!0,scrollInput:!0,lazyInit:!1,mask:!1,validateOnBlur:!0,allowBlank:!0,yearStart:1950,yearEnd:2050,monthStart:0,monthEnd:11,style:"",id:"",fixed:!1,roundTime:"round",className:"",weekends:[],highlightedDates:[],highlightedPeriods:[],allowDates:[],allowDateRe:null,disabledDates:[],disabledWeekDays:[],yearOffset:0,beforeShowDay:null,enterLikeTab:!0,showApplyButton:!1},n=null,r=null,o="en",i={meridiem:["AM","PM"]},s=function(){var t=a.i18n[o],s={days:t.dayOfWeek,daysShort:t.dayOfWeekShort,months:t.months,monthsShort:e.map(t.months,function(e){return e.substring(0,3)})};"function"==typeof DateFormatter&&(n=r=new DateFormatter({dateSettings:e.extend({},i,s)}))},d={moment:{default_options:{format:"YYYY/MM/DD HH:mm",formatDate:"YYYY/MM/DD",formatTime:"HH:mm"},formatter:{parseDate:function(e,t){if(l(t))return r.parseDate(e,t);var a=moment(e,t);return!!a.isValid()&&a.toDate()},formatDate:function(e,t){return l(t)?r.formatDate(e,t):moment(e).format(t)},formatMask:function(e){return e.replace(/Y{4}/g,"9999").replace(/Y{2}/g,"99").replace(/M{2}/g,"19").replace(/D{2}/g,"39").replace(/H{2}/g,"29").replace(/m{2}/g,"59").replace(/s{2}/g,"59")}}}};e.datetimepicker={setLocale:function(e){var t=a.i18n[e]?e:"en";o!==t&&(o=t,s())},setDateFormatter:function(t){if("string"==typeof t&&d.hasOwnProperty(t)){var r=d[t];e.extend(a,r.default_options),n=r.formatter}else n=t}};var u={RFC_2822:"D, d M Y H:i:s O",ATOM:"Y-m-dTH:i:sP",ISO_8601:"Y-m-dTH:i:sO",RFC_822:"D, d M y H:i:s O",RFC_850:"l, d-M-y H:i:s T",RFC_1036:"D, d M y H:i:s O",RFC_1123:"D, d M Y H:i:s O",RSS:"D, d M Y H:i:s O",W3C:"Y-m-dTH:i:sP"},l=function(e){return-1!==Object.values(u).indexOf(e)};e.extend(e.datetimepicker,u),s(),window.getComputedStyle||(window.getComputedStyle=function(e){return this.el=e,this.getPropertyValue=function(t){var a=/(-([a-z]))/g;return"float"===t&&(t="styleFloat"),a.test(t)&&(t=t.replace(a,function(e,t,a){return a.toUpperCase()})),e.currentStyle[t]||null},this}),Array.prototype.indexOf||(Array.prototype.indexOf=function(e,t){var a,n;for(a=t||0,n=this.length;a<n;a+=1)if(this[a]===e)return a;return-1}),Date.prototype.countDaysInMonth=function(){return new Date(this.getFullYear(),this.getMonth()+1,0).getDate()},e.fn.xdsoftScroller=function(t,a){return this.each(function(){var n,r,o,i,s,d=e(this),u=function(e){var t,a={x:0,y:0};return"touchstart"===e.type||"touchmove"===e.type||"touchend"===e.type||"touchcancel"===e.type?(t=e.originalEvent.touches[0]||e.originalEvent.changedTouches[0],a.x=t.clientX,a.y=t.clientY):"mousedown"!==e.type&&"mouseup"!==e.type&&"mousemove"!==e.type&&"mouseover"!==e.type&&"mouseout"!==e.type&&"mouseenter"!==e.type&&"mouseleave"!==e.type||(a.x=e.clientX,a.y=e.clientY),a},l=100,f=!1,c=0,m=0,h=0,g=!1,p=0,y=function(){};"hide"!==a?(e(this).hasClass("xdsoft_scroller_box")||(n=d.children().eq(0),r=d[0].clientHeight,o=n[0].offsetHeight,i=e('<div class="xdsoft_scrollbar"></div>'),s=e('<div class="xdsoft_scroller"></div>'),i.append(s),d.addClass("xdsoft_scroller_box").append(i),y=function(e){var t=u(e).y-c+p;t<0&&(t=0),t+s[0].offsetHeight>h&&(t=h-s[0].offsetHeight),d.trigger("scroll_element.xdsoft_scroller",[l?t/l:0])},s.on("touchstart.xdsoft_scroller mousedown.xdsoft_scroller",function(n){r||d.trigger("resize_scroll.xdsoft_scroller",[a]),c=u(n).y,p=parseInt(s.css("margin-top"),10),h=i[0].offsetHeight,"mousedown"===n.type||"touchstart"===n.type?(t.ownerDocument&&e(t.ownerDocument.body).addClass("xdsoft_noselect"),e([t.ownerDocument.body,t.contentWindow]).on("touchend mouseup.xdsoft_scroller",function a(){e([t.ownerDocument.body,t.contentWindow]).off("touchend mouseup.xdsoft_scroller",a).off("mousemove.xdsoft_scroller",y).removeClass("xdsoft_noselect")}),e(t.ownerDocument.body).on("mousemove.xdsoft_scroller",y)):(g=!0,n.stopPropagation(),n.preventDefault())}).on("touchmove",function(e){g&&(e.preventDefault(),y(e))}).on("touchend touchcancel",function(){g=!1,p=0}),d.on("scroll_element.xdsoft_scroller",function(e,t){r||d.trigger("resize_scroll.xdsoft_scroller",[t,!0]),t=t>1?1:t<0||isNaN(t)?0:t,s.css("margin-top",l*t),setTimeout(function(){n.css("marginTop",-parseInt((n[0].offsetHeight-r)*t,10))},10)}).on("resize_scroll.xdsoft_scroller",function(e,t,a){var u,f;r=d[0].clientHeight,o=n[0].offsetHeight,f=(u=r/o)*i[0].offsetHeight,u>1?s.hide():(s.show(),s.css("height",parseInt(f>10?f:10,10)),l=i[0].offsetHeight-s[0].offsetHeight,!0!==a&&d.trigger("scroll_element.xdsoft_scroller",[t||Math.abs(parseInt(n.css("marginTop"),10))/(o-r)]))}),d.on("mousewheel",function(e){var t=Math.abs(parseInt(n.css("marginTop"),10));return(t-=20*e.deltaY)<0&&(t=0),d.trigger("scroll_element.xdsoft_scroller",[t/(o-r)]),e.stopPropagation(),!1}),d.on("touchstart",function(e){f=u(e),m=Math.abs(parseInt(n.css("marginTop"),10))}),d.on("touchmove",function(e){if(f){e.preventDefault();var t=u(e);d.trigger("scroll_element.xdsoft_scroller",[(m-(t.y-f.y))/(o-r)])}}),d.on("touchend touchcancel",function(){f=!1,m=0})),d.trigger("resize_scroll.xdsoft_scroller",[a])):d.find(".xdsoft_scrollbar").hide()})},e.fn.datetimepicker=function(r,i){var s,d,u=this,l=48,f=57,c=96,m=105,h=17,g=46,p=13,y=27,v=8,D=37,b=38,k=39,x=40,T=9,S=116,M=65,w=67,O=86,W=90,_=89,F=!1,C=e.isPlainObject(r)||!r?e.extend(!0,{},a,r):e.extend(!0,{},a),P=0,Y=function(e){e.on("open.xdsoft focusin.xdsoft mousedown.xdsoft touchstart",function t(){e.is(":disabled")||e.data("xdsoft_datetimepicker")||(clearTimeout(P),P=setTimeout(function(){e.data("xdsoft_datetimepicker")||s(e),e.off("open.xdsoft focusin.xdsoft mousedown.xdsoft touchstart",t).trigger("open.xdsoft")},100))})};return s=function(a){function i(){var e,t=!1;return C.startDate?t=A.strToDate(C.startDate):(t=C.value||(a&&a.val&&a.val()?a.val():""))?(t=A.strToDateTime(t),C.yearOffset&&(t=new Date(t.getFullYear()-C.yearOffset,t.getMonth(),t.getDate(),t.getHours(),t.getMinutes(),t.getSeconds(),t.getMilliseconds()))):C.defaultDate&&(t=A.strToDateTime(C.defaultDate),C.defaultTime&&(e=A.strtotime(C.defaultTime),t.setHours(e.getHours()),t.setMinutes(e.getMinutes()))),t&&A.isValidDate(t)?H.data("changed",!0):t="",t||0}function s(t){var r=function(e,t){var a=e.replace(/([\[\]\/\{\}\(\)\-\.\+]{1})/g,"\\$1").replace(/_/g,"{digit+}").replace(/([0-9]{1})/g,"{digit$1}").replace(/\{digit([0-9]{1})\}/g,"[0-$1_]{1}").replace(/\{digit[\+]\}/g,"[0-9_]{1}");return new RegExp(a).test(t)},o=function(e,a){if(!(e="string"==typeof e||e instanceof String?t.ownerDocument.getElementById(e):e))return!1;if(e.createTextRange){var n=e.createTextRange();return n.collapse(!0),n.moveEnd("character",a),n.moveStart("character",a),n.select(),!0}return!!e.setSelectionRange&&(e.setSelectionRange(a,a),!0)};t.mask&&a.off("keydown.xdsoft"),!0===t.mask&&(n.formatMask?t.mask=n.formatMask(t.format):t.mask=t.format.replace(/Y/g,"9999").replace(/F/g,"9999").replace(/m/g,"19").replace(/d/g,"39").replace(/H/g,"29").replace(/i/g,"59").replace(/s/g,"59")),"string"===e.type(t.mask)&&(r(t.mask,a.val())||(a.val(t.mask.replace(/[0-9]/g,"_")),o(a[0],0)),a.on("paste.xdsoft",function(n){var i=(n.clipboardData||n.originalEvent.clipboardData||window.clipboardData).getData("text"),s=this.value,d=this.selectionStart;return s=s.substr(0,d)+i+s.substr(d+i.length),d+=i.length,r(t.mask,s)?(this.value=s,o(this,d)):""===e.trim(s)?this.value=t.mask.replace(/[0-9]/g,"_"):a.trigger("error_input.xdsoft"),n.preventDefault(),!1}),a.on("keydown.xdsoft",function(n){var i,s=this.value,d=n.which,u=this.selectionStart,C=this.selectionEnd,P=u!==C;if(d>=l&&d<=f||d>=c&&d<=m||d===v||d===g){for(i=d===v||d===g?"_":String.fromCharCode(c<=d&&d<=m?d-l:d),d===v&&u&&!P&&(u-=1);;){var Y=t.mask.substr(u,1),A=u<t.mask.length,j=u>0;if(!(/[^0-9_]/.test(Y)&&A&&j))break;u+=d!==v||P?1:-1}if(P){var H=C-u,J=t.mask.replace(/[0-9]/g,"_"),z=J.substr(u,H).substr(1);s=s.substr(0,u)+(i+z)+s.substr(u+H)}else s=s.substr(0,u)+i+s.substr(u+1);if(""===e.trim(s))s=J;else if(u===t.mask.length)return n.preventDefault(),!1;for(u+=d===v?0:1;/[^0-9_]/.test(t.mask.substr(u,1))&&u<t.mask.length&&u>0;)u+=d===v?0:1;r(t.mask,s)?(this.value=s,o(this,u)):""===e.trim(s)?this.value=t.mask.replace(/[0-9]/g,"_"):a.trigger("error_input.xdsoft")}else if(-1!==[M,w,O,W,_].indexOf(d)&&F||-1!==[y,b,x,D,k,S,h,T,p].indexOf(d))return!0;return n.preventDefault(),!1}))}var d,u,P,Y,A,j,H=e('<div class="xdsoft_datetimepicker xdsoft_noselect"></div>'),J=e('<div class="xdsoft_copyright"><a target="_blank" href="http://xdsoft.net/jqplugins/datetimepicker/">xdsoft.net</a></div>'),z=e('<div class="xdsoft_datepicker active"></div>'),I=e('<div class="xdsoft_monthpicker"><button type="button" class="xdsoft_prev"></button><button type="button" class="xdsoft_today_button"></button><div class="xdsoft_label xdsoft_month"><span></span><i></i></div><div class="xdsoft_label xdsoft_year"><span></span><i></i></div><button type="button" class="xdsoft_next"></button></div>'),N=e('<div class="xdsoft_calendar"></div>'),L=e('<div class="xdsoft_timepicker active"><button type="button" class="xdsoft_prev"></button><div class="xdsoft_time_box"></div><button type="button" class="xdsoft_next"></button></div>'),E=L.find(".xdsoft_time_box").eq(0),R=e('<div class="xdsoft_time_variant"></div>'),V=e('<button type="button" class="xdsoft_save_selected blue-gradient-button">Save Selected</button>'),B=e('<div class="xdsoft_select xdsoft_monthselect"><div></div></div>'),G=e('<div class="xdsoft_select xdsoft_yearselect"><div></div></div>'),U=!1,q=0;C.id&&H.attr("id",C.id),C.style&&H.attr("style",C.style),C.weeks&&H.addClass("xdsoft_showweeks"),C.rtl&&H.addClass("xdsoft_rtl"),H.addClass("xdsoft_"+C.theme),H.addClass(C.className),I.find(".xdsoft_month span").after(B),I.find(".xdsoft_year span").after(G),I.find(".xdsoft_month,.xdsoft_year").on("touchstart mousedown.xdsoft",function(t){var a,n,r=e(this).find(".xdsoft_select").eq(0),o=0,i=0,s=r.is(":visible");for(I.find(".xdsoft_select").hide(),A.currentTime&&(o=A.currentTime[e(this).hasClass("xdsoft_month")?"getMonth":"getFullYear"]()),r[s?"hide":"show"](),a=r.find("div.xdsoft_option"),n=0;n<a.length&&a.eq(n).data("value")!==o;n+=1)i+=a[0].offsetHeight;return r.xdsoftScroller(C,i/(r.children()[0].offsetHeight-r[0].clientHeight)),t.stopPropagation(),!1});var X=function(e){this.touchStartPosition=this.touchStartPosition||e.originalEvent.touches[0];var t=e.originalEvent.touches[0],a=Math.abs(this.touchStartPosition.clientX-t.clientX),n=Math.abs(this.touchStartPosition.clientY-t.clientY);Math.sqrt(a*a+n*n)>C.touchMovedThreshold&&(this.touchMoved=!0)};I.find(".xdsoft_select").xdsoftScroller(C).on("touchstart mousedown.xdsoft",function(e){this.touchMoved=!1,this.touchStartPosition=e.originalEvent.touches[0],e.stopPropagation(),e.preventDefault()}).on("touchmove",".xdsoft_option",X).on("touchend mousedown.xdsoft",".xdsoft_option",function(){if(!this.touchMoved){void 0!==A.currentTime&&null!==A.currentTime||(A.currentTime=A.now());var t=A.currentTime.getFullYear();A&&A.currentTime&&A.currentTime[e(this).parent().parent().hasClass("xdsoft_monthselect")?"setMonth":"setFullYear"](e(this).data("value")),e(this).parent().parent().hide(),H.trigger("xchange.xdsoft"),C.onChangeMonth&&e.isFunction(C.onChangeMonth)&&C.onChangeMonth.call(H,A.currentTime,H.data("input")),t!==A.currentTime.getFullYear()&&e.isFunction(C.onChangeYear)&&C.onChangeYear.call(H,A.currentTime,H.data("input"))}}),H.getValue=function(){return A.getCurrentTime()},H.setOptions=function(r){var o={};C=e.extend(!0,{},C,r),r.allowTimes&&e.isArray(r.allowTimes)&&r.allowTimes.length&&(C.allowTimes=e.extend(!0,[],r.allowTimes)),r.weekends&&e.isArray(r.weekends)&&r.weekends.length&&(C.weekends=e.extend(!0,[],r.weekends)),r.allowDates&&e.isArray(r.allowDates)&&r.allowDates.length&&(C.allowDates=e.extend(!0,[],r.allowDates)),r.allowDateRe&&"[object String]"===Object.prototype.toString.call(r.allowDateRe)&&(C.allowDateRe=new RegExp(r.allowDateRe)),r.highlightedDates&&e.isArray(r.highlightedDates)&&r.highlightedDates.length&&(e.each(r.highlightedDates,function(a,r){var i,s=e.map(r.split(","),e.trim),d=new t(n.parseDate(s[0],C.formatDate),s[1],s[2]),u=n.formatDate(d.date,C.formatDate);void 0!==o[u]?(i=o[u].desc)&&i.length&&d.desc&&d.desc.length&&(o[u].desc=i+"\n"+d.desc):o[u]=d}),C.highlightedDates=e.extend(!0,[],o)),r.highlightedPeriods&&e.isArray(r.highlightedPeriods)&&r.highlightedPeriods.length&&(o=e.extend(!0,[],C.highlightedDates),e.each(r.highlightedPeriods,function(a,r){var i,s,d,u,l,f,c;if(e.isArray(r))i=r[0],s=r[1],d=r[2],c=r[3];else{var m=e.map(r.split(","),e.trim);i=n.parseDate(m[0],C.formatDate),s=n.parseDate(m[1],C.formatDate),d=m[2],c=m[3]}for(;i<=s;)u=new t(i,d,c),l=n.formatDate(i,C.formatDate),i.setDate(i.getDate()+1),void 0!==o[l]?(f=o[l].desc)&&f.length&&u.desc&&u.desc.length&&(o[l].desc=f+"\n"+u.desc):o[l]=u}),C.highlightedDates=e.extend(!0,[],o)),r.disabledDates&&e.isArray(r.disabledDates)&&r.disabledDates.length&&(C.disabledDates=e.extend(!0,[],r.disabledDates)),r.disabledWeekDays&&e.isArray(r.disabledWeekDays)&&r.disabledWeekDays.length&&(C.disabledWeekDays=e.extend(!0,[],r.disabledWeekDays)),!C.open&&!C.opened||C.inline||a.trigger("open.xdsoft"),C.inline&&(U=!0,H.addClass("xdsoft_inline"),a.after(H).hide()),C.inverseButton&&(C.next="xdsoft_prev",C.prev="xdsoft_next"),C.datepicker?z.addClass("active"):z.removeClass("active"),C.timepicker?L.addClass("active"):L.removeClass("active"),C.value&&(A.setCurrentTime(C.value),a&&a.val&&a.val(A.str)),isNaN(C.dayOfWeekStart)?C.dayOfWeekStart=0:C.dayOfWeekStart=parseInt(C.dayOfWeekStart,10)%7,C.timepickerScrollbar||E.xdsoftScroller(C,"hide"),C.minDate&&/^[\+\-](.*)$/.test(C.minDate)&&(C.minDate=n.formatDate(A.strToDateTime(C.minDate),C.formatDate)),C.maxDate&&/^[\+\-](.*)$/.test(C.maxDate)&&(C.maxDate=n.formatDate(A.strToDateTime(C.maxDate),C.formatDate)),C.minDateTime&&/^\+(.*)$/.test(C.minDateTime)&&(C.minDateTime=A.strToDateTime(C.minDateTime).dateFormat(C.formatDate)),V.toggle(C.showApplyButton),I.find(".xdsoft_today_button").css("visibility",C.todayButton?"visible":"hidden"),I.find("."+C.prev).css("visibility",C.prevButton?"visible":"hidden"),I.find("."+C.next).css("visibility",C.nextButton?"visible":"hidden"),s(C),C.validateOnBlur&&a.off("blur.xdsoft").on("blur.xdsoft",function(){if(C.allowBlank&&(!e.trim(e(this).val()).length||"string"==typeof C.mask&&e.trim(e(this).val())===C.mask.replace(/[0-9]/g,"_")))e(this).val(null),H.data("xdsoft_datetime").empty();else{var t=n.parseDate(e(this).val(),C.format);if(t)e(this).val(n.formatDate(t,C.format));else{var a=+[e(this).val()[0],e(this).val()[1]].join(""),r=+[e(this).val()[2],e(this).val()[3]].join("");!C.datepicker&&C.timepicker&&a>=0&&a<24&&r>=0&&r<60?e(this).val([a,r].map(function(e){return e>9?e:"0"+e}).join(":")):e(this).val(n.formatDate(A.now(),C.format))}H.data("xdsoft_datetime").setCurrentTime(e(this).val())}H.trigger("changedatetime.xdsoft"),H.trigger("close.xdsoft")}),C.dayOfWeekStartPrev=0===C.dayOfWeekStart?6:C.dayOfWeekStart-1,H.trigger("xchange.xdsoft").trigger("afterOpen.xdsoft")},H.data("options",C).on("touchstart mousedown.xdsoft",function(e){return e.stopPropagation(),e.preventDefault(),G.hide(),B.hide(),!1}),E.append(R),E.xdsoftScroller(C),H.on("afterOpen.xdsoft",function(){E.xdsoftScroller(C)}),H.append(z).append(L),!0!==C.withoutCopyright&&H.append(J),z.append(I).append(N).append(V),e(C.parentID).append(H),A=new function(){var t=this;t.now=function(e){var a,n,r=new Date;return!e&&C.defaultDate&&(a=t.strToDateTime(C.defaultDate),r.setFullYear(a.getFullYear()),r.setMonth(a.getMonth()),r.setDate(a.getDate())),r.setFullYear(r.getFullYear()),!e&&C.defaultTime&&(n=t.strtotime(C.defaultTime),r.setHours(n.getHours()),r.setMinutes(n.getMinutes()),r.setSeconds(n.getSeconds()),r.setMilliseconds(n.getMilliseconds())),r},t.isValidDate=function(e){return"[object Date]"===Object.prototype.toString.call(e)&&!isNaN(e.getTime())},t.setCurrentTime=function(e,a){"string"==typeof e?t.currentTime=t.strToDateTime(e):t.isValidDate(e)?t.currentTime=e:e||a||!C.allowBlank||C.inline?t.currentTime=t.now():t.currentTime=null,H.trigger("xchange.xdsoft")},t.empty=function(){t.currentTime=null},t.getCurrentTime=function(){return t.currentTime},t.nextMonth=function(){void 0!==t.currentTime&&null!==t.currentTime||(t.currentTime=t.now());var a,n=t.currentTime.getMonth()+1;return 12===n&&(t.currentTime.setFullYear(t.currentTime.getFullYear()+1),n=0),a=t.currentTime.getFullYear(),t.currentTime.setDate(Math.min(new Date(t.currentTime.getFullYear(),n+1,0).getDate(),t.currentTime.getDate())),t.currentTime.setMonth(n),C.onChangeMonth&&e.isFunction(C.onChangeMonth)&&C.onChangeMonth.call(H,A.currentTime,H.data("input")),a!==t.currentTime.getFullYear()&&e.isFunction(C.onChangeYear)&&C.onChangeYear.call(H,A.currentTime,H.data("input")),H.trigger("xchange.xdsoft"),n},t.prevMonth=function(){void 0!==t.currentTime&&null!==t.currentTime||(t.currentTime=t.now());var a=t.currentTime.getMonth()-1;return-1===a&&(t.currentTime.setFullYear(t.currentTime.getFullYear()-1),a=11),t.currentTime.setDate(Math.min(new Date(t.currentTime.getFullYear(),a+1,0).getDate(),t.currentTime.getDate())),t.currentTime.setMonth(a),C.onChangeMonth&&e.isFunction(C.onChangeMonth)&&C.onChangeMonth.call(H,A.currentTime,H.data("input")),H.trigger("xchange.xdsoft"),a},t.getWeekOfYear=function(t){if(C.onGetWeekOfYear&&e.isFunction(C.onGetWeekOfYear)){var a=C.onGetWeekOfYear.call(H,t);if(void 0!==a)return a}var n=new Date(t.getFullYear(),0,1);return 4!==n.getDay()&&n.setMonth(0,1+(4-n.getDay()+7)%7),Math.ceil(((t-n)/864e5+n.getDay()+1)/7)},t.strToDateTime=function(e){var a,r,o=[];return e&&e instanceof Date&&t.isValidDate(e)?e:((o=/^([+-]{1})(.*)$/.exec(e))&&(o[2]=n.parseDate(o[2],C.formatDate)),o&&o[2]?(a=o[2].getTime()-6e4*o[2].getTimezoneOffset(),r=new Date(t.now(!0).getTime()+parseInt(o[1]+"1",10)*a)):r=e?n.parseDate(e,C.format):t.now(),t.isValidDate(r)||(r=t.now()),r)},t.strToDate=function(e){if(e&&e instanceof Date&&t.isValidDate(e))return e;var a=e?n.parseDate(e,C.formatDate):t.now(!0);return t.isValidDate(a)||(a=t.now(!0)),a},t.strtotime=function(e){if(e&&e instanceof Date&&t.isValidDate(e))return e;var a=e?n.parseDate(e,C.formatTime):t.now(!0);return t.isValidDate(a)||(a=t.now(!0)),a},t.str=function(){var e=C.format;return C.yearOffset&&(e=(e=e.replace("Y",t.currentTime.getFullYear()+C.yearOffset)).replace("y",String(t.currentTime.getFullYear()+C.yearOffset).substring(2,4))),n.formatDate(t.currentTime,e)},t.currentTime=this.now()},V.on("touchend click",function(e){e.preventDefault(),H.data("changed",!0),A.setCurrentTime(i()),a.val(A.str()),H.trigger("close.xdsoft")}),I.find(".xdsoft_today_button").on("touchend mousedown.xdsoft",function(){H.data("changed",!0),A.setCurrentTime(0,!0),H.trigger("afterOpen.xdsoft")}).on("dblclick.xdsoft",function(){var e,t,n=A.getCurrentTime();n=new Date(n.getFullYear(),n.getMonth(),n.getDate()),e=A.strToDate(C.minDate),n<(e=new Date(e.getFullYear(),e.getMonth(),e.getDate()))||(t=A.strToDate(C.maxDate),n>(t=new Date(t.getFullYear(),t.getMonth(),t.getDate()))||(a.val(A.str()),a.trigger("change"),H.trigger("close.xdsoft")))}),I.find(".xdsoft_prev,.xdsoft_next").on("touchend mousedown.xdsoft",function(){var t=e(this),a=0,n=!1;!function e(r){t.hasClass(C.next)?A.nextMonth():t.hasClass(C.prev)&&A.prevMonth(),C.monthChangeSpinner&&(n||(a=setTimeout(e,r||100)))}(500),e([C.ownerDocument.body,C.contentWindow]).on("touchend mouseup.xdsoft",function t(){clearTimeout(a),n=!0,e([C.ownerDocument.body,C.contentWindow]).off("touchend mouseup.xdsoft",t)})}),L.find(".xdsoft_prev,.xdsoft_next").on("touchend mousedown.xdsoft",function(){var t=e(this),a=0,n=!1,r=110;!function e(o){var i=E[0].clientHeight,s=R[0].offsetHeight,d=Math.abs(parseInt(R.css("marginTop"),10));t.hasClass(C.next)&&s-i-C.timeHeightInTimePicker>=d?R.css("marginTop","-"+(d+C.timeHeightInTimePicker)+"px"):t.hasClass(C.prev)&&d-C.timeHeightInTimePicker>=0&&R.css("marginTop","-"+(d-C.timeHeightInTimePicker)+"px"),E.trigger("scroll_element.xdsoft_scroller",[Math.abs(parseInt(R[0].style.marginTop,10)/(s-i))]),r=r>10?10:r-10,n||(a=setTimeout(e,o||r))}(500),e([C.ownerDocument.body,C.contentWindow]).on("touchend mouseup.xdsoft",function t(){clearTimeout(a),n=!0,e([C.ownerDocument.body,C.contentWindow]).off("touchend mouseup.xdsoft",t)})}),d=0,H.on("xchange.xdsoft",function(t){clearTimeout(d),d=setTimeout(function(){void 0!==A.currentTime&&null!==A.currentTime||(A.currentTime=A.now());for(var t,i,s,d,u,l,f,c,m,h,g="",p=new Date(A.currentTime.getFullYear(),A.currentTime.getMonth(),1,12,0,0),y=0,v=A.now(),D=!1,b=!1,k=!1,x=[],T=!0,S="";p.getDay()!==C.dayOfWeekStart;)p.setDate(p.getDate()-1);for(g+="<table><thead><tr>",C.weeks&&(g+="<th></th>"),t=0;t<7;t+=1)g+="<th>"+C.i18n[o].dayOfWeekShort[(t+C.dayOfWeekStart)%7]+"</th>";for(g+="</tr></thead>",g+="<tbody>",!1!==C.maxDate&&(D=A.strToDate(C.maxDate),D=new Date(D.getFullYear(),D.getMonth(),D.getDate(),23,59,59,999)),!1!==C.minDate&&(b=A.strToDate(C.minDate),b=new Date(b.getFullYear(),b.getMonth(),b.getDate())),!1!==C.minDateTime&&(k=A.strToDate(C.minDateTime),k=new Date(k.getFullYear(),k.getMonth(),k.getDate(),k.getHours(),k.getMinutes(),k.getSeconds()));y<A.currentTime.countDaysInMonth()||p.getDay()!==C.dayOfWeekStart||A.currentTime.getMonth()===p.getMonth();)x=[],y+=1,s=p.getDay(),d=p.getDate(),u=p.getFullYear(),l=p.getMonth(),f=A.getWeekOfYear(p),h="",x.push("xdsoft_date"),c=C.beforeShowDay&&e.isFunction(C.beforeShowDay.call)?C.beforeShowDay.call(H,p):null,C.allowDateRe&&"[object RegExp]"===Object.prototype.toString.call(C.allowDateRe)&&(C.allowDateRe.test(n.formatDate(p,C.formatDate))||x.push("xdsoft_disabled")),C.allowDates&&C.allowDates.length>0&&-1===C.allowDates.indexOf(n.formatDate(p,C.formatDate))&&x.push("xdsoft_disabled"),(!1!==D&&p>D||!1!==k&&p<k||!1!==b&&p<b||c&&!1===c[0])&&x.push("xdsoft_disabled"),-1!==C.disabledDates.indexOf(n.formatDate(p,C.formatDate))&&x.push("xdsoft_disabled"),-1!==C.disabledWeekDays.indexOf(s)&&x.push("xdsoft_disabled"),a.is("[disabled]")&&x.push("xdsoft_disabled"),c&&""!==c[1]&&x.push(c[1]),A.currentTime.getMonth()!==l&&x.push("xdsoft_other_month"),(C.defaultSelect||H.data("changed"))&&n.formatDate(A.currentTime,C.formatDate)===n.formatDate(p,C.formatDate)&&x.push("xdsoft_current"),n.formatDate(v,C.formatDate)===n.formatDate(p,C.formatDate)&&x.push("xdsoft_today"),0!==p.getDay()&&6!==p.getDay()&&-1===C.weekends.indexOf(n.formatDate(p,C.formatDate))||x.push("xdsoft_weekend"),void 0!==C.highlightedDates[n.formatDate(p,C.formatDate)]&&(i=C.highlightedDates[n.formatDate(p,C.formatDate)],x.push(void 0===i.style?"xdsoft_highlighted_default":i.style),h=void 0===i.desc?"":i.desc),C.beforeShowDay&&e.isFunction(C.beforeShowDay)&&x.push(C.beforeShowDay(p)),T&&(g+="<tr>",T=!1,C.weeks&&(g+="<th>"+f+"</th>")),g+='<td data-date="'+d+'" data-month="'+l+'" data-year="'+u+'" class="xdsoft_date xdsoft_day_of_week'+p.getDay()+" "+x.join(" ")+'" title="'+h+'"><div>'+d+"</div></td>",p.getDay()===C.dayOfWeekStartPrev&&(g+="</tr>",T=!0),p.setDate(d+1);if(g+="</tbody></table>",N.html(g),I.find(".xdsoft_label span").eq(0).text(C.i18n[o].months[A.currentTime.getMonth()]),I.find(".xdsoft_label span").eq(1).text(A.currentTime.getFullYear()+C.yearOffset),S="","",l="",m=function(t,r){var o,i,s=A.now(),d=C.allowTimes&&e.isArray(C.allowTimes)&&C.allowTimes.length;s.setHours(t),t=parseInt(s.getHours(),10),s.setMinutes(r),r=parseInt(s.getMinutes(),10),(o=new Date(A.currentTime)).setHours(t),o.setMinutes(r),x=[],!1!==C.minDateTime&&C.minDateTime>o||!1!==C.maxTime&&A.strtotime(C.maxTime).getTime()<s.getTime()||!1!==C.minTime&&A.strtotime(C.minTime).getTime()>s.getTime()?x.push("xdsoft_disabled"):!1!==C.minDateTime&&C.minDateTime>o||!1!==C.disabledMinTime&&s.getTime()>A.strtotime(C.disabledMinTime).getTime()&&!1!==C.disabledMaxTime&&s.getTime()<A.strtotime(C.disabledMaxTime).getTime()?x.push("xdsoft_disabled"):a.is("[disabled]")&&x.push("xdsoft_disabled"),(i=new Date(A.currentTime)).setHours(parseInt(A.currentTime.getHours(),10)),d||i.setMinutes(Math[C.roundTime](A.currentTime.getMinutes()/C.step)*C.step),(C.initTime||C.defaultSelect||H.data("changed"))&&i.getHours()===parseInt(t,10)&&(!d&&C.step>59||i.getMinutes()===parseInt(r,10))&&(C.defaultSelect||H.data("changed")?x.push("xdsoft_current"):C.initTime&&x.push("xdsoft_init_time")),parseInt(v.getHours(),10)===parseInt(t,10)&&parseInt(v.getMinutes(),10)===parseInt(r,10)&&x.push("xdsoft_today"),S+='<div class="xdsoft_time '+x.join(" ")+'" data-hour="'+t+'" data-minute="'+r+'">'+n.formatDate(s,C.formatTime)+"</div>"},C.allowTimes&&e.isArray(C.allowTimes)&&C.allowTimes.length)for(y=0;y<C.allowTimes.length;y+=1)m(A.strtotime(C.allowTimes[y]).getHours(),l=A.strtotime(C.allowTimes[y]).getMinutes());else for(y=0,t=0;y<(C.hours12?12:24);y+=1)for(t=0;t<60;t+=C.step)m((y<10?"0":"")+y,l=(t<10?"0":"")+t);for(R.html(S),r="",y=parseInt(C.yearStart,10);y<=parseInt(C.yearEnd,10);y+=1)r+='<div class="xdsoft_option '+(A.currentTime.getFullYear()===y?"xdsoft_current":"")+'" data-value="'+y+'">'+(y+C.yearOffset)+"</div>";for(G.children().eq(0).html(r),y=parseInt(C.monthStart,10),r="";y<=parseInt(C.monthEnd,10);y+=1)r+='<div class="xdsoft_option '+(A.currentTime.getMonth()===y?"xdsoft_current":"")+'" data-value="'+y+'">'+C.i18n[o].months[y]+"</div>";B.children().eq(0).html(r),e(H).trigger("generate.xdsoft")},10),t.stopPropagation()}).on("afterOpen.xdsoft",function(){if(C.timepicker){var e,t,a,n;R.find(".xdsoft_current").length?e=".xdsoft_current":R.find(".xdsoft_init_time").length&&(e=".xdsoft_init_time"),e?(t=E[0].clientHeight,(a=R[0].offsetHeight)-t<(n=R.find(e).index()*C.timeHeightInTimePicker+1)&&(n=a-t),E.trigger("scroll_element.xdsoft_scroller",[parseInt(n,10)/(a-t)])):E.trigger("scroll_element.xdsoft_scroller",[0])}}),u=0,N.on("touchend click.xdsoft","td",function(t){t.stopPropagation(),u+=1;var n=e(this),r=A.currentTime;if(void 0!==r&&null!==r||(A.currentTime=A.now(),r=A.currentTime),n.hasClass("xdsoft_disabled"))return!1;r.setDate(1),r.setFullYear(n.data("year")),r.setMonth(n.data("month")),r.setDate(n.data("date")),H.trigger("select.xdsoft",[r]),a.val(A.str()),C.onSelectDate&&e.isFunction(C.onSelectDate)&&C.onSelectDate.call(H,A.currentTime,H.data("input"),t),H.data("changed",!0),H.trigger("xchange.xdsoft"),H.trigger("changedatetime.xdsoft"),(u>1||!0===C.closeOnDateSelect||!1===C.closeOnDateSelect&&!C.timepicker)&&!C.inline&&H.trigger("close.xdsoft"),setTimeout(function(){u=0},200)}),R.on("touchstart","div",function(e){this.touchMoved=!1}).on("touchmove","div",X).on("touchend click.xdsoft","div",function(t){if(!this.touchMoved){t.stopPropagation();var a=e(this),n=A.currentTime;if(void 0!==n&&null!==n||(A.currentTime=A.now(),n=A.currentTime),a.hasClass("xdsoft_disabled"))return!1;n.setHours(a.data("hour")),n.setMinutes(a.data("minute")),H.trigger("select.xdsoft",[n]),H.data("input").val(A.str()),C.onSelectTime&&e.isFunction(C.onSelectTime)&&C.onSelectTime.call(H,A.currentTime,H.data("input"),t),H.data("changed",!0),H.trigger("xchange.xdsoft"),H.trigger("changedatetime.xdsoft"),!0!==C.inline&&!0===C.closeOnTimeSelect&&H.trigger("close.xdsoft")}}),z.on("mousewheel.xdsoft",function(e){return!C.scrollMonth||(e.deltaY<0?A.nextMonth():A.prevMonth(),!1)}),a.on("mousewheel.xdsoft",function(e){return!C.scrollInput||(!C.datepicker&&C.timepicker?((P=R.find(".xdsoft_current").length?R.find(".xdsoft_current").eq(0).index():0)+e.deltaY>=0&&P+e.deltaY<R.children().length&&(P+=e.deltaY),R.children().eq(P).length&&R.children().eq(P).trigger("mousedown"),!1):C.datepicker&&!C.timepicker?(z.trigger(e,[e.deltaY,e.deltaX,e.deltaY]),a.val&&a.val(A.str()),H.trigger("changedatetime.xdsoft"),!1):void 0)}),H.on("changedatetime.xdsoft",function(t){if(C.onChangeDateTime&&e.isFunction(C.onChangeDateTime)){var a=H.data("input");C.onChangeDateTime.call(H,A.currentTime,a,t),delete C.value,a.trigger("change")}}).on("generate.xdsoft",function(){C.onGenerate&&e.isFunction(C.onGenerate)&&C.onGenerate.call(H,A.currentTime,H.data("input")),U&&(H.trigger("afterOpen.xdsoft"),U=!1)}).on("click.xdsoft",function(e){e.stopPropagation()}),P=0,j=function(e,t){do{if(!(e=e.parentNode)||!1===t(e))break}while("HTML"!==e.nodeName)},Y=function(){var t,a,n,r,o,i,s,d,u,l,f,c,m;if(d=H.data("input"),t=d.offset(),a=d[0],l="top",n=t.top+a.offsetHeight-1,r=t.left,o="absolute",u=e(C.contentWindow).width(),c=e(C.contentWindow).height(),m=e(C.contentWindow).scrollTop(),C.ownerDocument.documentElement.clientWidth-t.left<z.parent().outerWidth(!0)){var h=z.parent().outerWidth(!0)-a.offsetWidth;r-=h}"rtl"===d.parent().css("direction")&&(r-=H.outerWidth()-d.outerWidth()),C.fixed?(n-=m,r-=e(C.contentWindow).scrollLeft(),o="fixed"):(s=!1,j(a,function(e){return null!==e&&("fixed"===C.contentWindow.getComputedStyle(e).getPropertyValue("position")?(s=!0,!1):void 0)}),s?(o="fixed",n+H.outerHeight()>c+m?(l="bottom",n=c+m-t.top):n-=m):n+H[0].offsetHeight>c+m&&(n=t.top-H[0].offsetHeight+1),n<0&&(n=0),r+a.offsetWidth>u&&(r=u-a.offsetWidth)),i=H[0],j(i,function(e){if("relative"===C.contentWindow.getComputedStyle(e).getPropertyValue("position")&&u>=e.offsetWidth)return r-=(u-e.offsetWidth)/2,!1}),(f={position:o,left:r,top:"",bottom:""})[l]=n,H.css(f)},H.on("open.xdsoft",function(t){var a=!0;C.onShow&&e.isFunction(C.onShow)&&(a=C.onShow.call(H,A.currentTime,H.data("input"),t)),!1!==a&&(H.show(),Y(),e(C.contentWindow).off("resize.xdsoft",Y).on("resize.xdsoft",Y),C.closeOnWithoutClick&&e([C.ownerDocument.body,C.contentWindow]).on("touchstart mousedown.xdsoft",function t(){H.trigger("close.xdsoft"),e([C.ownerDocument.body,C.contentWindow]).off("touchstart mousedown.xdsoft",t)}))}).on("close.xdsoft",function(t){var a=!0;I.find(".xdsoft_month,.xdsoft_year").find(".xdsoft_select").hide(),C.onClose&&e.isFunction(C.onClose)&&(a=C.onClose.call(H,A.currentTime,H.data("input"),t)),!1===a||C.opened||C.inline||H.hide(),t.stopPropagation()}).on("toggle.xdsoft",function(){H.is(":visible")?H.trigger("close.xdsoft"):H.trigger("open.xdsoft")}).data("input",a),q=0,H.data("xdsoft_datetime",A),H.setOptions(C),A.setCurrentTime(i()),a.data("xdsoft_datetimepicker",H).on("open.xdsoft focusin.xdsoft mousedown.xdsoft touchstart",function(){a.is(":disabled")||a.data("xdsoft_datetimepicker").is(":visible")&&C.closeOnInputClick||C.openOnFocus&&(clearTimeout(q),q=setTimeout(function(){a.is(":disabled")||(U=!0,A.setCurrentTime(i(),!0),C.mask&&s(C),H.trigger("open.xdsoft"))},100))}).on("keydown.xdsoft",function(t){var a,n=t.which;return-1!==[p].indexOf(n)&&C.enterLikeTab?(a=e("input:visible,textarea:visible,button:visible,a:visible"),H.trigger("close.xdsoft"),a.eq(a.index(this)+1).focus(),!1):-1!==[T].indexOf(n)?(H.trigger("close.xdsoft"),!0):void 0}).on("blur.xdsoft",function(){H.trigger("close.xdsoft")})},d=function(t){var a=t.data("xdsoft_datetimepicker");a&&(a.data("xdsoft_datetime",null),a.remove(),t.data("xdsoft_datetimepicker",null).off(".xdsoft"),e(C.contentWindow).off("resize.xdsoft"),e([C.contentWindow,C.ownerDocument.body]).off("mousedown.xdsoft touchstart"),t.unmousewheel&&t.unmousewheel())},e(C.ownerDocument).off("keydown.xdsoftctrl keyup.xdsoftctrl").on("keydown.xdsoftctrl",function(e){e.keyCode===h&&(F=!0)}).on("keyup.xdsoftctrl",function(e){e.keyCode===h&&(F=!1)}),this.each(function(){var t=e(this).data("xdsoft_datetimepicker");if(t){if("string"===e.type(r))switch(r){case"show":e(this).select().focus(),t.trigger("open.xdsoft");break;case"hide":t.trigger("close.xdsoft");break;case"toggle":t.trigger("toggle.xdsoft");break;case"destroy":d(e(this));break;case"reset":this.value=this.defaultValue,this.value&&t.data("xdsoft_datetime").isValidDate(n.parseDate(this.value,C.format))||t.data("changed",!1),t.data("xdsoft_datetime").setCurrentTime(this.value);break;case"validate":t.data("input").trigger("blur.xdsoft");break;default:t[r]&&e.isFunction(t[r])&&(u=t[r](i))}else t.setOptions(r);return 0}"string"!==e.type(r)&&(!C.lazyInit||C.open||C.inline?s(e(this)):Y(e(this)))}),u},e.fn.datetimepicker.defaults=a};!function(e){"function"==typeof define&&define.amd?define(["jquery","jquery-mousewheel"],e):"object"==typeof exports?module.exports=e(require("jquery")):e(jQuery)}(datetimepickerFactory),function(e){"function"==typeof define&&define.amd?define(["jquery"],e):"object"==typeof exports?module.exports=e:e(jQuery)}(function(e){function t(t){var i=t||window.event,s=d.call(arguments,1),u=0,f=0,c=0,m=0,h=0,g=0;if(t=e.event.fix(i),t.type="mousewheel","detail"in i&&(c=-1*i.detail),"wheelDelta"in i&&(c=i.wheelDelta),"wheelDeltaY"in i&&(c=i.wheelDeltaY),"wheelDeltaX"in i&&(f=-1*i.wheelDeltaX),"axis"in i&&i.axis===i.HORIZONTAL_AXIS&&(f=-1*c,c=0),u=0===c?f:c,"deltaY"in i&&(u=c=-1*i.deltaY),"deltaX"in i&&(f=i.deltaX,0===c&&(u=-1*f)),0!==c||0!==f){if(1===i.deltaMode){var p=e.data(this,"mousewheel-line-height");u*=p,c*=p,f*=p}else if(2===i.deltaMode){var y=e.data(this,"mousewheel-page-height");u*=y,c*=y,f*=y}if(m=Math.max(Math.abs(c),Math.abs(f)),(!o||m<o)&&(o=m,n(i,m)&&(o/=40)),n(i,m)&&(u/=40,f/=40,c/=40),u=Math[u>=1?"floor":"ceil"](u/o),f=Math[f>=1?"floor":"ceil"](f/o),c=Math[c>=1?"floor":"ceil"](c/o),l.settings.normalizeOffset&&this.getBoundingClientRect){var v=this.getBoundingClientRect();h=t.clientX-v.left,g=t.clientY-v.top}return t.deltaX=f,t.deltaY=c,t.deltaFactor=o,t.offsetX=h,t.offsetY=g,t.deltaMode=0,s.unshift(t,u,f,c),r&&clearTimeout(r),r=setTimeout(a,200),(e.event.dispatch||e.event.handle).apply(this,s)}}function a(){o=null}function n(e,t){return l.settings.adjustOldDeltas&&"mousewheel"===e.type&&t%120==0}var r,o,i=["wheel","mousewheel","DOMMouseScroll","MozMousePixelScroll"],s="onwheel"in document||document.documentMode>=9?["wheel"]:["mousewheel","DomMouseScroll","MozMousePixelScroll"],d=Array.prototype.slice;if(e.event.fixHooks)for(var u=i.length;u;)e.event.fixHooks[i[--u]]=e.event.mouseHooks;var l=e.event.special.mousewheel={version:"3.1.12",setup:function(){if(this.addEventListener)for(var a=s.length;a;)this.addEventListener(s[--a],t,!1);else this.onmousewheel=t;e.data(this,"mousewheel-line-height",l.getLineHeight(this)),e.data(this,"mousewheel-page-height",l.getPageHeight(this))},teardown:function(){if(this.removeEventListener)for(var a=s.length;a;)this.removeEventListener(s[--a],t,!1);else this.onmousewheel=null;e.removeData(this,"mousewheel-line-height"),e.removeData(this,"mousewheel-page-height")},getLineHeight:function(t){var a=e(t),n=a["offsetParent"in e.fn?"offsetParent":"parent"]();return n.length||(n=e("body")),parseInt(n.css("fontSize"),10)||parseInt(a.css("fontSize"),10)||16},getPageHeight:function(t){return e(t).height()},settings:{adjustOldDeltas:!0,normalizeOffset:!0}};e.fn.extend({mousewheel:function(e){return e?this.bind("mousewheel",e):this.trigger("mousewheel")},unmousewheel:function(e){return this.unbind("mousewheel",e)}})});
!function(e,t){"object"==typeof exports&&"undefined"!=typeof module?module.exports=t():"function"==typeof define&&define.amd?define(t):e.moment=t()}(this,function(){"use strict";var H;function _(){return H.apply(null,arguments)}function y(e){return e instanceof Array||"[object Array]"===Object.prototype.toString.call(e)}function F(e){return null!=e&&"[object Object]"===Object.prototype.toString.call(e)}function c(e,t){return Object.prototype.hasOwnProperty.call(e,t)}function L(e){if(Object.getOwnPropertyNames)return 0===Object.getOwnPropertyNames(e).length;for(var t in e)if(c(e,t))return;return 1}function g(e){return void 0===e}function w(e){return"number"==typeof e||"[object Number]"===Object.prototype.toString.call(e)}function V(e){return e instanceof Date||"[object Date]"===Object.prototype.toString.call(e)}function G(e,t){for(var n=[],s=e.length,i=0;i<s;++i)n.push(t(e[i],i));return n}function E(e,t){for(var n in t)c(t,n)&&(e[n]=t[n]);return c(t,"toString")&&(e.toString=t.toString),c(t,"valueOf")&&(e.valueOf=t.valueOf),e}function l(e,t,n,s){return Wt(e,t,n,s,!0).utc()}function p(e){return null==e._pf&&(e._pf={empty:!1,unusedTokens:[],unusedInput:[],overflow:-2,charsLeftOver:0,nullInput:!1,invalidEra:null,invalidMonth:null,invalidFormat:!1,userInvalidated:!1,iso:!1,parsedDateParts:[],era:null,meridiem:null,rfc2822:!1,weekdayMismatch:!1}),e._pf}function A(e){var t,n,s=e._d&&!isNaN(e._d.getTime());return s&&(t=p(e),n=j.call(t.parsedDateParts,function(e){return null!=e}),s=t.overflow<0&&!t.empty&&!t.invalidEra&&!t.invalidMonth&&!t.invalidWeekday&&!t.weekdayMismatch&&!t.nullInput&&!t.invalidFormat&&!t.userInvalidated&&(!t.meridiem||t.meridiem&&n),e._strict)&&(s=s&&0===t.charsLeftOver&&0===t.unusedTokens.length&&void 0===t.bigHour),null!=Object.isFrozen&&Object.isFrozen(e)?s:(e._isValid=s,e._isValid)}function I(e){var t=l(NaN);return null!=e?E(p(t),e):p(t).userInvalidated=!0,t}var j=Array.prototype.some||function(e){for(var t=Object(this),n=t.length>>>0,s=0;s<n;s++)if(s in t&&e.call(this,t[s],s,t))return!0;return!1},Z=_.momentProperties=[],z=!1;function q(e,t){var n,s,i,r=Z.length;if(g(t._isAMomentObject)||(e._isAMomentObject=t._isAMomentObject),g(t._i)||(e._i=t._i),g(t._f)||(e._f=t._f),g(t._l)||(e._l=t._l),g(t._strict)||(e._strict=t._strict),g(t._tzm)||(e._tzm=t._tzm),g(t._isUTC)||(e._isUTC=t._isUTC),g(t._offset)||(e._offset=t._offset),g(t._pf)||(e._pf=p(t)),g(t._locale)||(e._locale=t._locale),0<r)for(n=0;n<r;n++)g(i=t[s=Z[n]])||(e[s]=i);return e}function $(e){q(this,e),this._d=new Date(null!=e._d?e._d.getTime():NaN),this.isValid()||(this._d=new Date(NaN)),!1===z&&(z=!0,_.updateOffset(this),z=!1)}function k(e){return e instanceof $||null!=e&&null!=e._isAMomentObject}function B(e){!1===_.suppressDeprecationWarnings&&"undefined"!=typeof console&&console.warn&&console.warn("Deprecation warning: "+e)}function e(r,a){var o=!0;return E(function(){if(null!=_.deprecationHandler&&_.deprecationHandler(null,r),o){for(var e,t,n=[],s=arguments.length,i=0;i<s;i++){if(e="","object"==typeof arguments[i]){for(t in e+="\n["+i+"] ",arguments[0])c(arguments[0],t)&&(e+=t+": "+arguments[0][t]+", ");e=e.slice(0,-2)}else e=arguments[i];n.push(e)}B(r+"\nArguments: "+Array.prototype.slice.call(n).join("")+"\n"+(new Error).stack),o=!1}return a.apply(this,arguments)},a)}var J={};function Q(e,t){null!=_.deprecationHandler&&_.deprecationHandler(e,t),J[e]||(B(t),J[e]=!0)}function a(e){return"undefined"!=typeof Function&&e instanceof Function||"[object Function]"===Object.prototype.toString.call(e)}function X(e,t){var n,s=E({},e);for(n in t)c(t,n)&&(F(e[n])&&F(t[n])?(s[n]={},E(s[n],e[n]),E(s[n],t[n])):null!=t[n]?s[n]=t[n]:delete s[n]);for(n in e)c(e,n)&&!c(t,n)&&F(e[n])&&(s[n]=E({},s[n]));return s}function K(e){null!=e&&this.set(e)}_.suppressDeprecationWarnings=!1,_.deprecationHandler=null;var ee=Object.keys||function(e){var t,n=[];for(t in e)c(e,t)&&n.push(t);return n};function r(e,t,n){var s=""+Math.abs(e);return(0<=e?n?"+":"":"-")+Math.pow(10,Math.max(0,t-s.length)).toString().substr(1)+s}var te=/(\[[^\[]*\])|(\\)?([Hh]mm(ss)?|Mo|MM?M?M?|Do|DDDo|DD?D?D?|ddd?d?|do?|w[o|w]?|W[o|W]?|Qo?|N{1,5}|YYYYYY|YYYYY|YYYY|YY|y{2,4}|yo?|gg(ggg?)?|GG(GGG?)?|e|E|a|A|hh?|HH?|kk?|mm?|ss?|S{1,9}|x|X|zz?|ZZ?|.)/g,ne=/(\[[^\[]*\])|(\\)?(LTS|LT|LL?L?L?|l{1,4})/g,se={},ie={};function s(e,t,n,s){var i="string"==typeof s?function(){return this[s]()}:s;e&&(ie[e]=i),t&&(ie[t[0]]=function(){return r(i.apply(this,arguments),t[1],t[2])}),n&&(ie[n]=function(){return this.localeData().ordinal(i.apply(this,arguments),e)})}function re(e,t){return e.isValid()?(t=ae(t,e.localeData()),se[t]=se[t]||function(s){for(var e,i=s.match(te),t=0,r=i.length;t<r;t++)ie[i[t]]?i[t]=ie[i[t]]:i[t]=(e=i[t]).match(/\[[\s\S]/)?e.replace(/^\[|\]$/g,""):e.replace(/\\/g,"");return function(e){for(var t="",n=0;n<r;n++)t+=a(i[n])?i[n].call(e,s):i[n];return t}}(t),se[t](e)):e.localeData().invalidDate()}function ae(e,t){var n=5;function s(e){return t.longDateFormat(e)||e}for(ne.lastIndex=0;0<=n&&ne.test(e);)e=e.replace(ne,s),ne.lastIndex=0,--n;return e}var oe={D:"date",dates:"date",date:"date",d:"day",days:"day",day:"day",e:"weekday",weekdays:"weekday",weekday:"weekday",E:"isoWeekday",isoweekdays:"isoWeekday",isoweekday:"isoWeekday",DDD:"dayOfYear",dayofyears:"dayOfYear",dayofyear:"dayOfYear",h:"hour",hours:"hour",hour:"hour",ms:"millisecond",milliseconds:"millisecond",millisecond:"millisecond",m:"minute",minutes:"minute",minute:"minute",M:"month",months:"month",month:"month",Q:"quarter",quarters:"quarter",quarter:"quarter",s:"second",seconds:"second",second:"second",gg:"weekYear",weekyears:"weekYear",weekyear:"weekYear",GG:"isoWeekYear",isoweekyears:"isoWeekYear",isoweekyear:"isoWeekYear",w:"week",weeks:"week",week:"week",W:"isoWeek",isoweeks:"isoWeek",isoweek:"isoWeek",y:"year",years:"year",year:"year"};function o(e){return"string"==typeof e?oe[e]||oe[e.toLowerCase()]:void 0}function ue(e){var t,n,s={};for(n in e)c(e,n)&&(t=o(n))&&(s[t]=e[n]);return s}var le={date:9,day:11,weekday:11,isoWeekday:11,dayOfYear:4,hour:13,millisecond:16,minute:14,month:8,quarter:7,second:15,weekYear:1,isoWeekYear:1,week:5,isoWeek:5,year:1};var de=/\d/,t=/\d\d/,he=/\d{3}/,ce=/\d{4}/,fe=/[+-]?\d{6}/,n=/\d\d?/,me=/\d\d\d\d?/,_e=/\d\d\d\d\d\d?/,ye=/\d{1,3}/,ge=/\d{1,4}/,we=/[+-]?\d{1,6}/,pe=/\d+/,ke=/[+-]?\d+/,Me=/Z|[+-]\d\d:?\d\d/gi,ve=/Z|[+-]\d\d(?::?\d\d)?/gi,i=/[0-9]{0,256}['a-z\u00A0-\u05FF\u0700-\uD7FF\uF900-\uFDCF\uFDF0-\uFF07\uFF10-\uFFEF]{1,256}|[\u0600-\u06FF\/]{1,256}(\s*?[\u0600-\u06FF]{1,256}){1,2}/i,u=/^[1-9]\d?/,d=/^([1-9]\d|\d)/;function h(e,n,s){Ye[e]=a(n)?n:function(e,t){return e&&s?s:n}}function De(e,t){return c(Ye,e)?Ye[e](t._strict,t._locale):new RegExp(f(e.replace("\\","").replace(/\\(\[)|\\(\])|\[([^\]\[]*)\]|\\(.)/g,function(e,t,n,s,i){return t||n||s||i})))}function f(e){return e.replace(/[-\/\\^$*+?.()|[\]{}]/g,"\\$&")}function m(e){return e<0?Math.ceil(e)||0:Math.floor(e)}function M(e){var e=+e,t=0;return t=0!=e&&isFinite(e)?m(e):t}var Ye={},Se={};function v(e,n){var t,s,i=n;for("string"==typeof e&&(e=[e]),w(n)&&(i=function(e,t){t[n]=M(e)}),s=e.length,t=0;t<s;t++)Se[e[t]]=i}function Oe(e,i){v(e,function(e,t,n,s){n._w=n._w||{},i(e,n._w,n,s)})}function be(e){return e%4==0&&e%100!=0||e%400==0}var D=0,Y=1,S=2,O=3,b=4,T=5,Te=6,xe=7,Ne=8;function We(e){return be(e)?366:365}s("Y",0,0,function(){var e=this.year();return e<=9999?r(e,4):"+"+e}),s(0,["YY",2],0,function(){return this.year()%100}),s(0,["YYYY",4],0,"year"),s(0,["YYYYY",5],0,"year"),s(0,["YYYYYY",6,!0],0,"year"),h("Y",ke),h("YY",n,t),h("YYYY",ge,ce),h("YYYYY",we,fe),h("YYYYYY",we,fe),v(["YYYYY","YYYYYY"],D),v("YYYY",function(e,t){t[D]=2===e.length?_.parseTwoDigitYear(e):M(e)}),v("YY",function(e,t){t[D]=_.parseTwoDigitYear(e)}),v("Y",function(e,t){t[D]=parseInt(e,10)}),_.parseTwoDigitYear=function(e){return M(e)+(68<M(e)?1900:2e3)};var x,Pe=Re("FullYear",!0);function Re(t,n){return function(e){return null!=e?(Ue(this,t,e),_.updateOffset(this,n),this):Ce(this,t)}}function Ce(e,t){if(!e.isValid())return NaN;var n=e._d,s=e._isUTC;switch(t){case"Milliseconds":return s?n.getUTCMilliseconds():n.getMilliseconds();case"Seconds":return s?n.getUTCSeconds():n.getSeconds();case"Minutes":return s?n.getUTCMinutes():n.getMinutes();case"Hours":return s?n.getUTCHours():n.getHours();case"Date":return s?n.getUTCDate():n.getDate();case"Day":return s?n.getUTCDay():n.getDay();case"Month":return s?n.getUTCMonth():n.getMonth();case"FullYear":return s?n.getUTCFullYear():n.getFullYear();default:return NaN}}function Ue(e,t,n){var s,i,r;if(e.isValid()&&!isNaN(n)){switch(s=e._d,i=e._isUTC,t){case"Milliseconds":return i?s.setUTCMilliseconds(n):s.setMilliseconds(n);case"Seconds":return i?s.setUTCSeconds(n):s.setSeconds(n);case"Minutes":return i?s.setUTCMinutes(n):s.setMinutes(n);case"Hours":return i?s.setUTCHours(n):s.setHours(n);case"Date":return i?s.setUTCDate(n):s.setDate(n);case"FullYear":break;default:return}t=n,r=e.month(),e=29!==(e=e.date())||1!==r||be(t)?e:28,i?s.setUTCFullYear(t,r,e):s.setFullYear(t,r,e)}}function He(e,t){var n;return isNaN(e)||isNaN(t)?NaN:(n=(t%(n=12)+n)%n,e+=(t-n)/12,1==n?be(e)?29:28:31-n%7%2)}x=Array.prototype.indexOf||function(e){for(var t=0;t<this.length;++t)if(this[t]===e)return t;return-1},s("M",["MM",2],"Mo",function(){return this.month()+1}),s("MMM",0,0,function(e){return this.localeData().monthsShort(this,e)}),s("MMMM",0,0,function(e){return this.localeData().months(this,e)}),h("M",n,u),h("MM",n,t),h("MMM",function(e,t){return t.monthsShortRegex(e)}),h("MMMM",function(e,t){return t.monthsRegex(e)}),v(["M","MM"],function(e,t){t[Y]=M(e)-1}),v(["MMM","MMMM"],function(e,t,n,s){s=n._locale.monthsParse(e,s,n._strict);null!=s?t[Y]=s:p(n).invalidMonth=e});var Fe="January_February_March_April_May_June_July_August_September_October_November_December".split("_"),Le="Jan_Feb_Mar_Apr_May_Jun_Jul_Aug_Sep_Oct_Nov_Dec".split("_"),Ve=/D[oD]?(\[[^\[\]]*\]|\s)+MMMM?/,Ge=i,Ee=i;function Ae(e,t){if(e.isValid()){if("string"==typeof t)if(/^\d+$/.test(t))t=M(t);else if(!w(t=e.localeData().monthsParse(t)))return;var n=(n=e.date())<29?n:Math.min(n,He(e.year(),t));e._isUTC?e._d.setUTCMonth(t,n):e._d.setMonth(t,n)}}function Ie(e){return null!=e?(Ae(this,e),_.updateOffset(this,!0),this):Ce(this,"Month")}function je(){function e(e,t){return t.length-e.length}for(var t,n,s=[],i=[],r=[],a=0;a<12;a++)n=l([2e3,a]),t=f(this.monthsShort(n,"")),n=f(this.months(n,"")),s.push(t),i.push(n),r.push(n),r.push(t);s.sort(e),i.sort(e),r.sort(e),this._monthsRegex=new RegExp("^("+r.join("|")+")","i"),this._monthsShortRegex=this._monthsRegex,this._monthsStrictRegex=new RegExp("^("+i.join("|")+")","i"),this._monthsShortStrictRegex=new RegExp("^("+s.join("|")+")","i")}function Ze(e,t,n,s,i,r,a){var o;return e<100&&0<=e?(o=new Date(e+400,t,n,s,i,r,a),isFinite(o.getFullYear())&&o.setFullYear(e)):o=new Date(e,t,n,s,i,r,a),o}function ze(e){var t;return e<100&&0<=e?((t=Array.prototype.slice.call(arguments))[0]=e+400,t=new Date(Date.UTC.apply(null,t)),isFinite(t.getUTCFullYear())&&t.setUTCFullYear(e)):t=new Date(Date.UTC.apply(null,arguments)),t}function qe(e,t,n){n=7+t-n;return n-(7+ze(e,0,n).getUTCDay()-t)%7-1}function $e(e,t,n,s,i){var r,t=1+7*(t-1)+(7+n-s)%7+qe(e,s,i),n=t<=0?We(r=e-1)+t:t>We(e)?(r=e+1,t-We(e)):(r=e,t);return{year:r,dayOfYear:n}}function Be(e,t,n){var s,i,r=qe(e.year(),t,n),r=Math.floor((e.dayOfYear()-r-1)/7)+1;return r<1?s=r+N(i=e.year()-1,t,n):r>N(e.year(),t,n)?(s=r-N(e.year(),t,n),i=e.year()+1):(i=e.year(),s=r),{week:s,year:i}}function N(e,t,n){var s=qe(e,t,n),t=qe(e+1,t,n);return(We(e)-s+t)/7}s("w",["ww",2],"wo","week"),s("W",["WW",2],"Wo","isoWeek"),h("w",n,u),h("ww",n,t),h("W",n,u),h("WW",n,t),Oe(["w","ww","W","WW"],function(e,t,n,s){t[s.substr(0,1)]=M(e)});function Je(e,t){return e.slice(t,7).concat(e.slice(0,t))}s("d",0,"do","day"),s("dd",0,0,function(e){return this.localeData().weekdaysMin(this,e)}),s("ddd",0,0,function(e){return this.localeData().weekdaysShort(this,e)}),s("dddd",0,0,function(e){return this.localeData().weekdays(this,e)}),s("e",0,0,"weekday"),s("E",0,0,"isoWeekday"),h("d",n),h("e",n),h("E",n),h("dd",function(e,t){return t.weekdaysMinRegex(e)}),h("ddd",function(e,t){return t.weekdaysShortRegex(e)}),h("dddd",function(e,t){return t.weekdaysRegex(e)}),Oe(["dd","ddd","dddd"],function(e,t,n,s){s=n._locale.weekdaysParse(e,s,n._strict);null!=s?t.d=s:p(n).invalidWeekday=e}),Oe(["d","e","E"],function(e,t,n,s){t[s]=M(e)});var Qe="Sunday_Monday_Tuesday_Wednesday_Thursday_Friday_Saturday".split("_"),Xe="Sun_Mon_Tue_Wed_Thu_Fri_Sat".split("_"),Ke="Su_Mo_Tu_We_Th_Fr_Sa".split("_"),et=i,tt=i,nt=i;function st(){function e(e,t){return t.length-e.length}for(var t,n,s,i=[],r=[],a=[],o=[],u=0;u<7;u++)s=l([2e3,1]).day(u),t=f(this.weekdaysMin(s,"")),n=f(this.weekdaysShort(s,"")),s=f(this.weekdays(s,"")),i.push(t),r.push(n),a.push(s),o.push(t),o.push(n),o.push(s);i.sort(e),r.sort(e),a.sort(e),o.sort(e),this._weekdaysRegex=new RegExp("^("+o.join("|")+")","i"),this._weekdaysShortRegex=this._weekdaysRegex,this._weekdaysMinRegex=this._weekdaysRegex,this._weekdaysStrictRegex=new RegExp("^("+a.join("|")+")","i"),this._weekdaysShortStrictRegex=new RegExp("^("+r.join("|")+")","i"),this._weekdaysMinStrictRegex=new RegExp("^("+i.join("|")+")","i")}function it(){return this.hours()%12||12}function rt(e,t){s(e,0,0,function(){return this.localeData().meridiem(this.hours(),this.minutes(),t)})}function at(e,t){return t._meridiemParse}s("H",["HH",2],0,"hour"),s("h",["hh",2],0,it),s("k",["kk",2],0,function(){return this.hours()||24}),s("hmm",0,0,function(){return""+it.apply(this)+r(this.minutes(),2)}),s("hmmss",0,0,function(){return""+it.apply(this)+r(this.minutes(),2)+r(this.seconds(),2)}),s("Hmm",0,0,function(){return""+this.hours()+r(this.minutes(),2)}),s("Hmmss",0,0,function(){return""+this.hours()+r(this.minutes(),2)+r(this.seconds(),2)}),rt("a",!0),rt("A",!1),h("a",at),h("A",at),h("H",n,d),h("h",n,u),h("k",n,u),h("HH",n,t),h("hh",n,t),h("kk",n,t),h("hmm",me),h("hmmss",_e),h("Hmm",me),h("Hmmss",_e),v(["H","HH"],O),v(["k","kk"],function(e,t,n){e=M(e);t[O]=24===e?0:e}),v(["a","A"],function(e,t,n){n._isPm=n._locale.isPM(e),n._meridiem=e}),v(["h","hh"],function(e,t,n){t[O]=M(e),p(n).bigHour=!0}),v("hmm",function(e,t,n){var s=e.length-2;t[O]=M(e.substr(0,s)),t[b]=M(e.substr(s)),p(n).bigHour=!0}),v("hmmss",function(e,t,n){var s=e.length-4,i=e.length-2;t[O]=M(e.substr(0,s)),t[b]=M(e.substr(s,2)),t[T]=M(e.substr(i)),p(n).bigHour=!0}),v("Hmm",function(e,t,n){var s=e.length-2;t[O]=M(e.substr(0,s)),t[b]=M(e.substr(s))}),v("Hmmss",function(e,t,n){var s=e.length-4,i=e.length-2;t[O]=M(e.substr(0,s)),t[b]=M(e.substr(s,2)),t[T]=M(e.substr(i))});i=Re("Hours",!0);var ot,ut={calendar:{sameDay:"[Today at] LT",nextDay:"[Tomorrow at] LT",nextWeek:"dddd [at] LT",lastDay:"[Yesterday at] LT",lastWeek:"[Last] dddd [at] LT",sameElse:"L"},longDateFormat:{LTS:"h:mm:ss A",LT:"h:mm A",L:"MM/DD/YYYY",LL:"MMMM D, YYYY",LLL:"MMMM D, YYYY h:mm A",LLLL:"dddd, MMMM D, YYYY h:mm A"},invalidDate:"Invalid date",ordinal:"%d",dayOfMonthOrdinalParse:/\d{1,2}/,relativeTime:{future:"in %s",past:"%s ago",s:"a few seconds",ss:"%d seconds",m:"a minute",mm:"%d minutes",h:"an hour",hh:"%d hours",d:"a day",dd:"%d days",w:"a week",ww:"%d weeks",M:"a month",MM:"%d months",y:"a year",yy:"%d years"},months:Fe,monthsShort:Le,week:{dow:0,doy:6},weekdays:Qe,weekdaysMin:Ke,weekdaysShort:Xe,meridiemParse:/[ap]\.?m?\.?/i},W={},lt={};function dt(e){return e&&e.toLowerCase().replace("_","-")}function ht(e){for(var t,n,s,i,r=0;r<e.length;){for(t=(i=dt(e[r]).split("-")).length,n=(n=dt(e[r+1]))?n.split("-"):null;0<t;){if(s=ct(i.slice(0,t).join("-")))return s;if(n&&n.length>=t&&function(e,t){for(var n=Math.min(e.length,t.length),s=0;s<n;s+=1)if(e[s]!==t[s])return s;return n}(i,n)>=t-1)break;t--}r++}return ot}function ct(t){var e,n;if(void 0===W[t]&&"undefined"!=typeof module&&module&&module.exports&&(n=t)&&n.match("^[^/\\\\]*$"))try{e=ot._abbr,require("./locale/"+t),ft(e)}catch(e){W[t]=null}return W[t]}function ft(e,t){return e&&((t=g(t)?P(e):mt(e,t))?ot=t:"undefined"!=typeof console&&console.warn&&console.warn("Locale "+e+" not found. Did you forget to load it?")),ot._abbr}function mt(e,t){if(null===t)return delete W[e],null;var n,s=ut;if(t.abbr=e,null!=W[e])Q("defineLocaleOverride","use moment.updateLocale(localeName, config) to change an existing locale. moment.defineLocale(localeName, config) should only be used for creating a new locale See http://momentjs.com/guides/#/warnings/define-locale/ for more info."),s=W[e]._config;else if(null!=t.parentLocale)if(null!=W[t.parentLocale])s=W[t.parentLocale]._config;else{if(null==(n=ct(t.parentLocale)))return lt[t.parentLocale]||(lt[t.parentLocale]=[]),lt[t.parentLocale].push({name:e,config:t}),null;s=n._config}return W[e]=new K(X(s,t)),lt[e]&&lt[e].forEach(function(e){mt(e.name,e.config)}),ft(e),W[e]}function P(e){var t;if(!(e=e&&e._locale&&e._locale._abbr?e._locale._abbr:e))return ot;if(!y(e)){if(t=ct(e))return t;e=[e]}return ht(e)}function _t(e){var t=e._a;return t&&-2===p(e).overflow&&(t=t[Y]<0||11<t[Y]?Y:t[S]<1||t[S]>He(t[D],t[Y])?S:t[O]<0||24<t[O]||24===t[O]&&(0!==t[b]||0!==t[T]||0!==t[Te])?O:t[b]<0||59<t[b]?b:t[T]<0||59<t[T]?T:t[Te]<0||999<t[Te]?Te:-1,p(e)._overflowDayOfYear&&(t<D||S<t)&&(t=S),p(e)._overflowWeeks&&-1===t&&(t=xe),p(e)._overflowWeekday&&-1===t&&(t=Ne),p(e).overflow=t),e}var yt=/^\s*((?:[+-]\d{6}|\d{4})-(?:\d\d-\d\d|W\d\d-\d|W\d\d|\d\d\d|\d\d))(?:(T| )(\d\d(?::\d\d(?::\d\d(?:[.,]\d+)?)?)?)([+-]\d\d(?::?\d\d)?|\s*Z)?)?$/,gt=/^\s*((?:[+-]\d{6}|\d{4})(?:\d\d\d\d|W\d\d\d|W\d\d|\d\d\d|\d\d|))(?:(T| )(\d\d(?:\d\d(?:\d\d(?:[.,]\d+)?)?)?)([+-]\d\d(?::?\d\d)?|\s*Z)?)?$/,wt=/Z|[+-]\d\d(?::?\d\d)?/,pt=[["YYYYYY-MM-DD",/[+-]\d{6}-\d\d-\d\d/],["YYYY-MM-DD",/\d{4}-\d\d-\d\d/],["GGGG-[W]WW-E",/\d{4}-W\d\d-\d/],["GGGG-[W]WW",/\d{4}-W\d\d/,!1],["YYYY-DDD",/\d{4}-\d{3}/],["YYYY-MM",/\d{4}-\d\d/,!1],["YYYYYYMMDD",/[+-]\d{10}/],["YYYYMMDD",/\d{8}/],["GGGG[W]WWE",/\d{4}W\d{3}/],["GGGG[W]WW",/\d{4}W\d{2}/,!1],["YYYYDDD",/\d{7}/],["YYYYMM",/\d{6}/,!1],["YYYY",/\d{4}/,!1]],kt=[["HH:mm:ss.SSSS",/\d\d:\d\d:\d\d\.\d+/],["HH:mm:ss,SSSS",/\d\d:\d\d:\d\d,\d+/],["HH:mm:ss",/\d\d:\d\d:\d\d/],["HH:mm",/\d\d:\d\d/],["HHmmss.SSSS",/\d\d\d\d\d\d\.\d+/],["HHmmss,SSSS",/\d\d\d\d\d\d,\d+/],["HHmmss",/\d\d\d\d\d\d/],["HHmm",/\d\d\d\d/],["HH",/\d\d/]],Mt=/^\/?Date\((-?\d+)/i,vt=/^(?:(Mon|Tue|Wed|Thu|Fri|Sat|Sun),?\s)?(\d{1,2})\s(Jan|Feb|Mar|Apr|May|Jun|Jul|Aug|Sep|Oct|Nov|Dec)\s(\d{2,4})\s(\d\d):(\d\d)(?::(\d\d))?\s(?:(UT|GMT|[ECMP][SD]T)|([Zz])|([+-]\d{4}))$/,Dt={UT:0,GMT:0,EDT:-240,EST:-300,CDT:-300,CST:-360,MDT:-360,MST:-420,PDT:-420,PST:-480};function Yt(e){var t,n,s,i,r,a,o=e._i,u=yt.exec(o)||gt.exec(o),o=pt.length,l=kt.length;if(u){for(p(e).iso=!0,t=0,n=o;t<n;t++)if(pt[t][1].exec(u[1])){i=pt[t][0],s=!1!==pt[t][2];break}if(null==i)e._isValid=!1;else{if(u[3]){for(t=0,n=l;t<n;t++)if(kt[t][1].exec(u[3])){r=(u[2]||" ")+kt[t][0];break}if(null==r)return void(e._isValid=!1)}if(s||null==r){if(u[4]){if(!wt.exec(u[4]))return void(e._isValid=!1);a="Z"}e._f=i+(r||"")+(a||""),xt(e)}else e._isValid=!1}}else e._isValid=!1}function St(e,t,n,s,i,r){e=[function(e){e=parseInt(e,10);{if(e<=49)return 2e3+e;if(e<=999)return 1900+e}return e}(e),Le.indexOf(t),parseInt(n,10),parseInt(s,10),parseInt(i,10)];return r&&e.push(parseInt(r,10)),e}function Ot(e){var t,n,s=vt.exec(e._i.replace(/\([^()]*\)|[\n\t]/g," ").replace(/(\s\s+)/g," ").replace(/^\s\s*/,"").replace(/\s\s*$/,""));s?(t=St(s[4],s[3],s[2],s[5],s[6],s[7]),function(e,t,n){if(!e||Xe.indexOf(e)===new Date(t[0],t[1],t[2]).getDay())return 1;p(n).weekdayMismatch=!0,n._isValid=!1}(s[1],t,e)&&(e._a=t,e._tzm=(t=s[8],n=s[9],s=s[10],t?Dt[t]:n?0:60*(((t=parseInt(s,10))-(n=t%100))/100)+n),e._d=ze.apply(null,e._a),e._d.setUTCMinutes(e._d.getUTCMinutes()-e._tzm),p(e).rfc2822=!0)):e._isValid=!1}function bt(e,t,n){return null!=e?e:null!=t?t:n}function Tt(e){var t,n,s,i,r,a,o,u,l,d,h,c=[];if(!e._d){for(s=e,i=new Date(_.now()),n=s._useUTC?[i.getUTCFullYear(),i.getUTCMonth(),i.getUTCDate()]:[i.getFullYear(),i.getMonth(),i.getDate()],e._w&&null==e._a[S]&&null==e._a[Y]&&(null!=(i=(s=e)._w).GG||null!=i.W||null!=i.E?(u=1,l=4,r=bt(i.GG,s._a[D],Be(R(),1,4).year),a=bt(i.W,1),((o=bt(i.E,1))<1||7<o)&&(d=!0)):(u=s._locale._week.dow,l=s._locale._week.doy,h=Be(R(),u,l),r=bt(i.gg,s._a[D],h.year),a=bt(i.w,h.week),null!=i.d?((o=i.d)<0||6<o)&&(d=!0):null!=i.e?(o=i.e+u,(i.e<0||6<i.e)&&(d=!0)):o=u),a<1||a>N(r,u,l)?p(s)._overflowWeeks=!0:null!=d?p(s)._overflowWeekday=!0:(h=$e(r,a,o,u,l),s._a[D]=h.year,s._dayOfYear=h.dayOfYear)),null!=e._dayOfYear&&(i=bt(e._a[D],n[D]),(e._dayOfYear>We(i)||0===e._dayOfYear)&&(p(e)._overflowDayOfYear=!0),d=ze(i,0,e._dayOfYear),e._a[Y]=d.getUTCMonth(),e._a[S]=d.getUTCDate()),t=0;t<3&&null==e._a[t];++t)e._a[t]=c[t]=n[t];for(;t<7;t++)e._a[t]=c[t]=null==e._a[t]?2===t?1:0:e._a[t];24===e._a[O]&&0===e._a[b]&&0===e._a[T]&&0===e._a[Te]&&(e._nextDay=!0,e._a[O]=0),e._d=(e._useUTC?ze:Ze).apply(null,c),r=e._useUTC?e._d.getUTCDay():e._d.getDay(),null!=e._tzm&&e._d.setUTCMinutes(e._d.getUTCMinutes()-e._tzm),e._nextDay&&(e._a[O]=24),e._w&&void 0!==e._w.d&&e._w.d!==r&&(p(e).weekdayMismatch=!0)}}function xt(e){if(e._f===_.ISO_8601)Yt(e);else if(e._f===_.RFC_2822)Ot(e);else{e._a=[],p(e).empty=!0;for(var t,n,s,i,r,a=""+e._i,o=a.length,u=0,l=ae(e._f,e._locale).match(te)||[],d=l.length,h=0;h<d;h++)n=l[h],(t=(a.match(De(n,e))||[])[0])&&(0<(s=a.substr(0,a.indexOf(t))).length&&p(e).unusedInput.push(s),a=a.slice(a.indexOf(t)+t.length),u+=t.length),ie[n]?(t?p(e).empty=!1:p(e).unusedTokens.push(n),s=n,r=e,null!=(i=t)&&c(Se,s)&&Se[s](i,r._a,r,s)):e._strict&&!t&&p(e).unusedTokens.push(n);p(e).charsLeftOver=o-u,0<a.length&&p(e).unusedInput.push(a),e._a[O]<=12&&!0===p(e).bigHour&&0<e._a[O]&&(p(e).bigHour=void 0),p(e).parsedDateParts=e._a.slice(0),p(e).meridiem=e._meridiem,e._a[O]=function(e,t,n){if(null==n)return t;return null!=e.meridiemHour?e.meridiemHour(t,n):null!=e.isPM?((e=e.isPM(n))&&t<12&&(t+=12),t=e||12!==t?t:0):t}(e._locale,e._a[O],e._meridiem),null!==(o=p(e).era)&&(e._a[D]=e._locale.erasConvertYear(o,e._a[D])),Tt(e),_t(e)}}function Nt(e){var t,n,s,i=e._i,r=e._f;if(e._locale=e._locale||P(e._l),null===i||void 0===r&&""===i)return I({nullInput:!0});if("string"==typeof i&&(e._i=i=e._locale.preparse(i)),k(i))return new $(_t(i));if(V(i))e._d=i;else if(y(r)){var a,o,u,l,d,h,c=e,f=!1,m=c._f.length;if(0===m)p(c).invalidFormat=!0,c._d=new Date(NaN);else{for(l=0;l<m;l++)d=0,h=!1,a=q({},c),null!=c._useUTC&&(a._useUTC=c._useUTC),a._f=c._f[l],xt(a),A(a)&&(h=!0),d=(d+=p(a).charsLeftOver)+10*p(a).unusedTokens.length,p(a).score=d,f?d<u&&(u=d,o=a):(null==u||d<u||h)&&(u=d,o=a,h)&&(f=!0);E(c,o||a)}}else if(r)xt(e);else if(g(r=(i=e)._i))i._d=new Date(_.now());else V(r)?i._d=new Date(r.valueOf()):"string"==typeof r?(n=i,null!==(t=Mt.exec(n._i))?n._d=new Date(+t[1]):(Yt(n),!1===n._isValid&&(delete n._isValid,Ot(n),!1===n._isValid)&&(delete n._isValid,n._strict?n._isValid=!1:_.createFromInputFallback(n)))):y(r)?(i._a=G(r.slice(0),function(e){return parseInt(e,10)}),Tt(i)):F(r)?(t=i)._d||(s=void 0===(n=ue(t._i)).day?n.date:n.day,t._a=G([n.year,n.month,s,n.hour,n.minute,n.second,n.millisecond],function(e){return e&&parseInt(e,10)}),Tt(t)):w(r)?i._d=new Date(r):_.createFromInputFallback(i);return A(e)||(e._d=null),e}function Wt(e,t,n,s,i){var r={};return!0!==t&&!1!==t||(s=t,t=void 0),!0!==n&&!1!==n||(s=n,n=void 0),(F(e)&&L(e)||y(e)&&0===e.length)&&(e=void 0),r._isAMomentObject=!0,r._useUTC=r._isUTC=i,r._l=n,r._i=e,r._f=t,r._strict=s,(i=new $(_t(Nt(i=r))))._nextDay&&(i.add(1,"d"),i._nextDay=void 0),i}function R(e,t,n,s){return Wt(e,t,n,s,!1)}_.createFromInputFallback=e("value provided is not in a recognized RFC2822 or ISO format. moment construction falls back to js Date(), which is not reliable across all browsers and versions. Non RFC2822/ISO date formats are discouraged. Please refer to http://momentjs.com/guides/#/warnings/js-date/ for more info.",function(e){e._d=new Date(e._i+(e._useUTC?" UTC":""))}),_.ISO_8601=function(){},_.RFC_2822=function(){};me=e("moment().min is deprecated, use moment.max instead. http://momentjs.com/guides/#/warnings/min-max/",function(){var e=R.apply(null,arguments);return this.isValid()&&e.isValid()?e<this?this:e:I()}),_e=e("moment().max is deprecated, use moment.min instead. http://momentjs.com/guides/#/warnings/min-max/",function(){var e=R.apply(null,arguments);return this.isValid()&&e.isValid()?this<e?this:e:I()});function Pt(e,t){var n,s;if(!(t=1===t.length&&y(t[0])?t[0]:t).length)return R();for(n=t[0],s=1;s<t.length;++s)t[s].isValid()&&!t[s][e](n)||(n=t[s]);return n}var Rt=["year","quarter","month","week","day","hour","minute","second","millisecond"];function Ct(e){var e=ue(e),t=e.year||0,n=e.quarter||0,s=e.month||0,i=e.week||e.isoWeek||0,r=e.day||0,a=e.hour||0,o=e.minute||0,u=e.second||0,l=e.millisecond||0;this._isValid=function(e){var t,n,s=!1,i=Rt.length;for(t in e)if(c(e,t)&&(-1===x.call(Rt,t)||null!=e[t]&&isNaN(e[t])))return!1;for(n=0;n<i;++n)if(e[Rt[n]]){if(s)return!1;parseFloat(e[Rt[n]])!==M(e[Rt[n]])&&(s=!0)}return!0}(e),this._milliseconds=+l+1e3*u+6e4*o+1e3*a*60*60,this._days=+r+7*i,this._months=+s+3*n+12*t,this._data={},this._locale=P(),this._bubble()}function Ut(e){return e instanceof Ct}function Ht(e){return e<0?-1*Math.round(-1*e):Math.round(e)}function Ft(e,n){s(e,0,0,function(){var e=this.utcOffset(),t="+";return e<0&&(e=-e,t="-"),t+r(~~(e/60),2)+n+r(~~e%60,2)})}Ft("Z",":"),Ft("ZZ",""),h("Z",ve),h("ZZ",ve),v(["Z","ZZ"],function(e,t,n){n._useUTC=!0,n._tzm=Vt(ve,e)});var Lt=/([\+\-]|\d\d)/gi;function Vt(e,t){var t=(t||"").match(e);return null===t?null:0===(t=60*(e=((t[t.length-1]||[])+"").match(Lt)||["-",0,0])[1]+M(e[2]))?0:"+"===e[0]?t:-t}function Gt(e,t){var n;return t._isUTC?(t=t.clone(),n=(k(e)||V(e)?e:R(e)).valueOf()-t.valueOf(),t._d.setTime(t._d.valueOf()+n),_.updateOffset(t,!1),t):R(e).local()}function Et(e){return-Math.round(e._d.getTimezoneOffset())}function At(){return!!this.isValid()&&this._isUTC&&0===this._offset}_.updateOffset=function(){};var It=/^(-|\+)?(?:(\d*)[. ])?(\d+):(\d+)(?::(\d+)(\.\d*)?)?$/,jt=/^(-|\+)?P(?:([-+]?[0-9,.]*)Y)?(?:([-+]?[0-9,.]*)M)?(?:([-+]?[0-9,.]*)W)?(?:([-+]?[0-9,.]*)D)?(?:T(?:([-+]?[0-9,.]*)H)?(?:([-+]?[0-9,.]*)M)?(?:([-+]?[0-9,.]*)S)?)?$/;function C(e,t){var n,s=e;return Ut(e)?s={ms:e._milliseconds,d:e._days,M:e._months}:w(e)||!isNaN(+e)?(s={},t?s[t]=+e:s.milliseconds=+e):(t=It.exec(e))?(n="-"===t[1]?-1:1,s={y:0,d:M(t[S])*n,h:M(t[O])*n,m:M(t[b])*n,s:M(t[T])*n,ms:M(Ht(1e3*t[Te]))*n}):(t=jt.exec(e))?(n="-"===t[1]?-1:1,s={y:Zt(t[2],n),M:Zt(t[3],n),w:Zt(t[4],n),d:Zt(t[5],n),h:Zt(t[6],n),m:Zt(t[7],n),s:Zt(t[8],n)}):null==s?s={}:"object"==typeof s&&("from"in s||"to"in s)&&(t=function(e,t){var n;if(!e.isValid()||!t.isValid())return{milliseconds:0,months:0};t=Gt(t,e),e.isBefore(t)?n=zt(e,t):((n=zt(t,e)).milliseconds=-n.milliseconds,n.months=-n.months);return n}(R(s.from),R(s.to)),(s={}).ms=t.milliseconds,s.M=t.months),n=new Ct(s),Ut(e)&&c(e,"_locale")&&(n._locale=e._locale),Ut(e)&&c(e,"_isValid")&&(n._isValid=e._isValid),n}function Zt(e,t){e=e&&parseFloat(e.replace(",","."));return(isNaN(e)?0:e)*t}function zt(e,t){var n={};return n.months=t.month()-e.month()+12*(t.year()-e.year()),e.clone().add(n.months,"M").isAfter(t)&&--n.months,n.milliseconds=+t-+e.clone().add(n.months,"M"),n}function qt(s,i){return function(e,t){var n;return null===t||isNaN(+t)||(Q(i,"moment()."+i+"(period, number) is deprecated. Please use moment()."+i+"(number, period). See http://momentjs.com/guides/#/warnings/add-inverted-param/ for more info."),n=e,e=t,t=n),$t(this,C(e,t),s),this}}function $t(e,t,n,s){var i=t._milliseconds,r=Ht(t._days),t=Ht(t._months);e.isValid()&&(s=null==s||s,t&&Ae(e,Ce(e,"Month")+t*n),r&&Ue(e,"Date",Ce(e,"Date")+r*n),i&&e._d.setTime(e._d.valueOf()+i*n),s)&&_.updateOffset(e,r||t)}C.fn=Ct.prototype,C.invalid=function(){return C(NaN)};Fe=qt(1,"add"),Qe=qt(-1,"subtract");function Bt(e){return"string"==typeof e||e instanceof String}function Jt(e){return k(e)||V(e)||Bt(e)||w(e)||function(t){var e=y(t),n=!1;e&&(n=0===t.filter(function(e){return!w(e)&&Bt(t)}).length);return e&&n}(e)||function(e){var t,n,s=F(e)&&!L(e),i=!1,r=["years","year","y","months","month","M","days","day","d","dates","date","D","hours","hour","h","minutes","minute","m","seconds","second","s","milliseconds","millisecond","ms"],a=r.length;for(t=0;t<a;t+=1)n=r[t],i=i||c(e,n);return s&&i}(e)||null==e}function Qt(e,t){var n,s;return e.date()<t.date()?-Qt(t,e):-((n=12*(t.year()-e.year())+(t.month()-e.month()))+(t-(s=e.clone().add(n,"months"))<0?(t-s)/(s-e.clone().add(n-1,"months")):(t-s)/(e.clone().add(1+n,"months")-s)))||0}function Xt(e){return void 0===e?this._locale._abbr:(null!=(e=P(e))&&(this._locale=e),this)}_.defaultFormat="YYYY-MM-DDTHH:mm:ssZ",_.defaultFormatUtc="YYYY-MM-DDTHH:mm:ss[Z]";Ke=e("moment().lang() is deprecated. Instead, use moment().localeData() to get the language configuration. Use moment().locale() to change languages.",function(e){return void 0===e?this.localeData():this.locale(e)});function Kt(){return this._locale}var en=126227808e5;function tn(e,t){return(e%t+t)%t}function nn(e,t,n){return e<100&&0<=e?new Date(e+400,t,n)-en:new Date(e,t,n).valueOf()}function sn(e,t,n){return e<100&&0<=e?Date.UTC(e+400,t,n)-en:Date.UTC(e,t,n)}function rn(e,t){return t.erasAbbrRegex(e)}function an(){for(var e,t,n,s=[],i=[],r=[],a=[],o=this.eras(),u=0,l=o.length;u<l;++u)e=f(o[u].name),t=f(o[u].abbr),n=f(o[u].narrow),i.push(e),s.push(t),r.push(n),a.push(e),a.push(t),a.push(n);this._erasRegex=new RegExp("^("+a.join("|")+")","i"),this._erasNameRegex=new RegExp("^("+i.join("|")+")","i"),this._erasAbbrRegex=new RegExp("^("+s.join("|")+")","i"),this._erasNarrowRegex=new RegExp("^("+r.join("|")+")","i")}function on(e,t){s(0,[e,e.length],0,t)}function un(e,t,n,s,i){var r;return null==e?Be(this,s,i).year:(r=N(e,s,i),function(e,t,n,s,i){e=$e(e,t,n,s,i),t=ze(e.year,0,e.dayOfYear);return this.year(t.getUTCFullYear()),this.month(t.getUTCMonth()),this.date(t.getUTCDate()),this}.call(this,e,t=r<t?r:t,n,s,i))}s("N",0,0,"eraAbbr"),s("NN",0,0,"eraAbbr"),s("NNN",0,0,"eraAbbr"),s("NNNN",0,0,"eraName"),s("NNNNN",0,0,"eraNarrow"),s("y",["y",1],"yo","eraYear"),s("y",["yy",2],0,"eraYear"),s("y",["yyy",3],0,"eraYear"),s("y",["yyyy",4],0,"eraYear"),h("N",rn),h("NN",rn),h("NNN",rn),h("NNNN",function(e,t){return t.erasNameRegex(e)}),h("NNNNN",function(e,t){return t.erasNarrowRegex(e)}),v(["N","NN","NNN","NNNN","NNNNN"],function(e,t,n,s){s=n._locale.erasParse(e,s,n._strict);s?p(n).era=s:p(n).invalidEra=e}),h("y",pe),h("yy",pe),h("yyy",pe),h("yyyy",pe),h("yo",function(e,t){return t._eraYearOrdinalRegex||pe}),v(["y","yy","yyy","yyyy"],D),v(["yo"],function(e,t,n,s){var i;n._locale._eraYearOrdinalRegex&&(i=e.match(n._locale._eraYearOrdinalRegex)),n._locale.eraYearOrdinalParse?t[D]=n._locale.eraYearOrdinalParse(e,i):t[D]=parseInt(e,10)}),s(0,["gg",2],0,function(){return this.weekYear()%100}),s(0,["GG",2],0,function(){return this.isoWeekYear()%100}),on("gggg","weekYear"),on("ggggg","weekYear"),on("GGGG","isoWeekYear"),on("GGGGG","isoWeekYear"),h("G",ke),h("g",ke),h("GG",n,t),h("gg",n,t),h("GGGG",ge,ce),h("gggg",ge,ce),h("GGGGG",we,fe),h("ggggg",we,fe),Oe(["gggg","ggggg","GGGG","GGGGG"],function(e,t,n,s){t[s.substr(0,2)]=M(e)}),Oe(["gg","GG"],function(e,t,n,s){t[s]=_.parseTwoDigitYear(e)}),s("Q",0,"Qo","quarter"),h("Q",de),v("Q",function(e,t){t[Y]=3*(M(e)-1)}),s("D",["DD",2],"Do","date"),h("D",n,u),h("DD",n,t),h("Do",function(e,t){return e?t._dayOfMonthOrdinalParse||t._ordinalParse:t._dayOfMonthOrdinalParseLenient}),v(["D","DD"],S),v("Do",function(e,t){t[S]=M(e.match(n)[0])});ge=Re("Date",!0);s("DDD",["DDDD",3],"DDDo","dayOfYear"),h("DDD",ye),h("DDDD",he),v(["DDD","DDDD"],function(e,t,n){n._dayOfYear=M(e)}),s("m",["mm",2],0,"minute"),h("m",n,d),h("mm",n,t),v(["m","mm"],b);var ln,ce=Re("Minutes",!1),we=(s("s",["ss",2],0,"second"),h("s",n,d),h("ss",n,t),v(["s","ss"],T),Re("Seconds",!1));for(s("S",0,0,function(){return~~(this.millisecond()/100)}),s(0,["SS",2],0,function(){return~~(this.millisecond()/10)}),s(0,["SSS",3],0,"millisecond"),s(0,["SSSS",4],0,function(){return 10*this.millisecond()}),s(0,["SSSSS",5],0,function(){return 100*this.millisecond()}),s(0,["SSSSSS",6],0,function(){return 1e3*this.millisecond()}),s(0,["SSSSSSS",7],0,function(){return 1e4*this.millisecond()}),s(0,["SSSSSSSS",8],0,function(){return 1e5*this.millisecond()}),s(0,["SSSSSSSSS",9],0,function(){return 1e6*this.millisecond()}),h("S",ye,de),h("SS",ye,t),h("SSS",ye,he),ln="SSSS";ln.length<=9;ln+="S")h(ln,pe);function dn(e,t){t[Te]=M(1e3*("0."+e))}for(ln="S";ln.length<=9;ln+="S")v(ln,dn);fe=Re("Milliseconds",!1),s("z",0,0,"zoneAbbr"),s("zz",0,0,"zoneName");u=$.prototype;function hn(e){return e}u.add=Fe,u.calendar=function(e,t){1===arguments.length&&(arguments[0]?Jt(arguments[0])?(e=arguments[0],t=void 0):function(e){for(var t=F(e)&&!L(e),n=!1,s=["sameDay","nextDay","lastDay","nextWeek","lastWeek","sameElse"],i=0;i<s.length;i+=1)n=n||c(e,s[i]);return t&&n}(arguments[0])&&(t=arguments[0],e=void 0):t=e=void 0);var e=e||R(),n=Gt(e,this).startOf("day"),n=_.calendarFormat(this,n)||"sameElse",t=t&&(a(t[n])?t[n].call(this,e):t[n]);return this.format(t||this.localeData().calendar(n,this,R(e)))},u.clone=function(){return new $(this)},u.diff=function(e,t,n){var s,i,r;if(!this.isValid())return NaN;if(!(s=Gt(e,this)).isValid())return NaN;switch(i=6e4*(s.utcOffset()-this.utcOffset()),t=o(t)){case"year":r=Qt(this,s)/12;break;case"month":r=Qt(this,s);break;case"quarter":r=Qt(this,s)/3;break;case"second":r=(this-s)/1e3;break;case"minute":r=(this-s)/6e4;break;case"hour":r=(this-s)/36e5;break;case"day":r=(this-s-i)/864e5;break;case"week":r=(this-s-i)/6048e5;break;default:r=this-s}return n?r:m(r)},u.endOf=function(e){var t,n;if(void 0!==(e=o(e))&&"millisecond"!==e&&this.isValid()){switch(n=this._isUTC?sn:nn,e){case"year":t=n(this.year()+1,0,1)-1;break;case"quarter":t=n(this.year(),this.month()-this.month()%3+3,1)-1;break;case"month":t=n(this.year(),this.month()+1,1)-1;break;case"week":t=n(this.year(),this.month(),this.date()-this.weekday()+7)-1;break;case"isoWeek":t=n(this.year(),this.month(),this.date()-(this.isoWeekday()-1)+7)-1;break;case"day":case"date":t=n(this.year(),this.month(),this.date()+1)-1;break;case"hour":t=this._d.valueOf(),t+=36e5-tn(t+(this._isUTC?0:6e4*this.utcOffset()),36e5)-1;break;case"minute":t=this._d.valueOf(),t+=6e4-tn(t,6e4)-1;break;case"second":t=this._d.valueOf(),t+=1e3-tn(t,1e3)-1;break}this._d.setTime(t),_.updateOffset(this,!0)}return this},u.format=function(e){return e=e||(this.isUtc()?_.defaultFormatUtc:_.defaultFormat),e=re(this,e),this.localeData().postformat(e)},u.from=function(e,t){return this.isValid()&&(k(e)&&e.isValid()||R(e).isValid())?C({to:this,from:e}).locale(this.locale()).humanize(!t):this.localeData().invalidDate()},u.fromNow=function(e){return this.from(R(),e)},u.to=function(e,t){return this.isValid()&&(k(e)&&e.isValid()||R(e).isValid())?C({from:this,to:e}).locale(this.locale()).humanize(!t):this.localeData().invalidDate()},u.toNow=function(e){return this.to(R(),e)},u.get=function(e){return a(this[e=o(e)])?this[e]():this},u.invalidAt=function(){return p(this).overflow},u.isAfter=function(e,t){return e=k(e)?e:R(e),!(!this.isValid()||!e.isValid())&&("millisecond"===(t=o(t)||"millisecond")?this.valueOf()>e.valueOf():e.valueOf()<this.clone().startOf(t).valueOf())},u.isBefore=function(e,t){return e=k(e)?e:R(e),!(!this.isValid()||!e.isValid())&&("millisecond"===(t=o(t)||"millisecond")?this.valueOf()<e.valueOf():this.clone().endOf(t).valueOf()<e.valueOf())},u.isBetween=function(e,t,n,s){return e=k(e)?e:R(e),t=k(t)?t:R(t),!!(this.isValid()&&e.isValid()&&t.isValid())&&("("===(s=s||"()")[0]?this.isAfter(e,n):!this.isBefore(e,n))&&(")"===s[1]?this.isBefore(t,n):!this.isAfter(t,n))},u.isSame=function(e,t){var e=k(e)?e:R(e);return!(!this.isValid()||!e.isValid())&&("millisecond"===(t=o(t)||"millisecond")?this.valueOf()===e.valueOf():(e=e.valueOf(),this.clone().startOf(t).valueOf()<=e&&e<=this.clone().endOf(t).valueOf()))},u.isSameOrAfter=function(e,t){return this.isSame(e,t)||this.isAfter(e,t)},u.isSameOrBefore=function(e,t){return this.isSame(e,t)||this.isBefore(e,t)},u.isValid=function(){return A(this)},u.lang=Ke,u.locale=Xt,u.localeData=Kt,u.max=_e,u.min=me,u.parsingFlags=function(){return E({},p(this))},u.set=function(e,t){if("object"==typeof e)for(var n=function(e){var t,n=[];for(t in e)c(e,t)&&n.push({unit:t,priority:le[t]});return n.sort(function(e,t){return e.priority-t.priority}),n}(e=ue(e)),s=n.length,i=0;i<s;i++)this[n[i].unit](e[n[i].unit]);else if(a(this[e=o(e)]))return this[e](t);return this},u.startOf=function(e){var t,n;if(void 0!==(e=o(e))&&"millisecond"!==e&&this.isValid()){switch(n=this._isUTC?sn:nn,e){case"year":t=n(this.year(),0,1);break;case"quarter":t=n(this.year(),this.month()-this.month()%3,1);break;case"month":t=n(this.year(),this.month(),1);break;case"week":t=n(this.year(),this.month(),this.date()-this.weekday());break;case"isoWeek":t=n(this.year(),this.month(),this.date()-(this.isoWeekday()-1));break;case"day":case"date":t=n(this.year(),this.month(),this.date());break;case"hour":t=this._d.valueOf(),t-=tn(t+(this._isUTC?0:6e4*this.utcOffset()),36e5);break;case"minute":t=this._d.valueOf(),t-=tn(t,6e4);break;case"second":t=this._d.valueOf(),t-=tn(t,1e3);break}this._d.setTime(t),_.updateOffset(this,!0)}return this},u.subtract=Qe,u.toArray=function(){var e=this;return[e.year(),e.month(),e.date(),e.hour(),e.minute(),e.second(),e.millisecond()]},u.toObject=function(){var e=this;return{years:e.year(),months:e.month(),date:e.date(),hours:e.hours(),minutes:e.minutes(),seconds:e.seconds(),milliseconds:e.milliseconds()}},u.toDate=function(){return new Date(this.valueOf())},u.toISOString=function(e){var t;return this.isValid()?(t=(e=!0!==e)?this.clone().utc():this).year()<0||9999<t.year()?re(t,e?"YYYYYY-MM-DD[T]HH:mm:ss.SSS[Z]":"YYYYYY-MM-DD[T]HH:mm:ss.SSSZ"):a(Date.prototype.toISOString)?e?this.toDate().toISOString():new Date(this.valueOf()+60*this.utcOffset()*1e3).toISOString().replace("Z",re(t,"Z")):re(t,e?"YYYY-MM-DD[T]HH:mm:ss.SSS[Z]":"YYYY-MM-DD[T]HH:mm:ss.SSSZ"):null},u.inspect=function(){var e,t,n;return this.isValid()?(t="moment",e="",this.isLocal()||(t=0===this.utcOffset()?"moment.utc":"moment.parseZone",e="Z"),t="["+t+'("]',n=0<=this.year()&&this.year()<=9999?"YYYY":"YYYYYY",this.format(t+n+"-MM-DD[T]HH:mm:ss.SSS"+(e+'[")]'))):"moment.invalid(/* "+this._i+" */)"},"undefined"!=typeof Symbol&&null!=Symbol.for&&(u[Symbol.for("nodejs.util.inspect.custom")]=function(){return"Moment<"+this.format()+">"}),u.toJSON=function(){return this.isValid()?this.toISOString():null},u.toString=function(){return this.clone().locale("en").format("ddd MMM DD YYYY HH:mm:ss [GMT]ZZ")},u.unix=function(){return Math.floor(this.valueOf()/1e3)},u.valueOf=function(){return this._d.valueOf()-6e4*(this._offset||0)},u.creationData=function(){return{input:this._i,format:this._f,locale:this._locale,isUTC:this._isUTC,strict:this._strict}},u.eraName=function(){for(var e,t=this.localeData().eras(),n=0,s=t.length;n<s;++n){if(e=this.clone().startOf("day").valueOf(),t[n].since<=e&&e<=t[n].until)return t[n].name;if(t[n].until<=e&&e<=t[n].since)return t[n].name}return""},u.eraNarrow=function(){for(var e,t=this.localeData().eras(),n=0,s=t.length;n<s;++n){if(e=this.clone().startOf("day").valueOf(),t[n].since<=e&&e<=t[n].until)return t[n].narrow;if(t[n].until<=e&&e<=t[n].since)return t[n].narrow}return""},u.eraAbbr=function(){for(var e,t=this.localeData().eras(),n=0,s=t.length;n<s;++n){if(e=this.clone().startOf("day").valueOf(),t[n].since<=e&&e<=t[n].until)return t[n].abbr;if(t[n].until<=e&&e<=t[n].since)return t[n].abbr}return""},u.eraYear=function(){for(var e,t,n=this.localeData().eras(),s=0,i=n.length;s<i;++s)if(e=n[s].since<=n[s].until?1:-1,t=this.clone().startOf("day").valueOf(),n[s].since<=t&&t<=n[s].until||n[s].until<=t&&t<=n[s].since)return(this.year()-_(n[s].since).year())*e+n[s].offset;return this.year()},u.year=Pe,u.isLeapYear=function(){return be(this.year())},u.weekYear=function(e){return un.call(this,e,this.week(),this.weekday()+this.localeData()._week.dow,this.localeData()._week.dow,this.localeData()._week.doy)},u.isoWeekYear=function(e){return un.call(this,e,this.isoWeek(),this.isoWeekday(),1,4)},u.quarter=u.quarters=function(e){return null==e?Math.ceil((this.month()+1)/3):this.month(3*(e-1)+this.month()%3)},u.month=Ie,u.daysInMonth=function(){return He(this.year(),this.month())},u.week=u.weeks=function(e){var t=this.localeData().week(this);return null==e?t:this.add(7*(e-t),"d")},u.isoWeek=u.isoWeeks=function(e){var t=Be(this,1,4).week;return null==e?t:this.add(7*(e-t),"d")},u.weeksInYear=function(){var e=this.localeData()._week;return N(this.year(),e.dow,e.doy)},u.weeksInWeekYear=function(){var e=this.localeData()._week;return N(this.weekYear(),e.dow,e.doy)},u.isoWeeksInYear=function(){return N(this.year(),1,4)},u.isoWeeksInISOWeekYear=function(){return N(this.isoWeekYear(),1,4)},u.date=ge,u.day=u.days=function(e){var t,n,s;return this.isValid()?(t=Ce(this,"Day"),null!=e?(n=e,s=this.localeData(),e="string"!=typeof n?n:isNaN(n)?"number"==typeof(n=s.weekdaysParse(n))?n:null:parseInt(n,10),this.add(e-t,"d")):t):null!=e?this:NaN},u.weekday=function(e){var t;return this.isValid()?(t=(this.day()+7-this.localeData()._week.dow)%7,null==e?t:this.add(e-t,"d")):null!=e?this:NaN},u.isoWeekday=function(e){var t,n;return this.isValid()?null!=e?(t=e,n=this.localeData(),n="string"==typeof t?n.weekdaysParse(t)%7||7:isNaN(t)?null:t,this.day(this.day()%7?n:n-7)):this.day()||7:null!=e?this:NaN},u.dayOfYear=function(e){var t=Math.round((this.clone().startOf("day")-this.clone().startOf("year"))/864e5)+1;return null==e?t:this.add(e-t,"d")},u.hour=u.hours=i,u.minute=u.minutes=ce,u.second=u.seconds=we,u.millisecond=u.milliseconds=fe,u.utcOffset=function(e,t,n){var s,i=this._offset||0;if(!this.isValid())return null!=e?this:NaN;if(null==e)return this._isUTC?i:Et(this);if("string"==typeof e){if(null===(e=Vt(ve,e)))return this}else Math.abs(e)<16&&!n&&(e*=60);return!this._isUTC&&t&&(s=Et(this)),this._offset=e,this._isUTC=!0,null!=s&&this.add(s,"m"),i!==e&&(!t||this._changeInProgress?$t(this,C(e-i,"m"),1,!1):this._changeInProgress||(this._changeInProgress=!0,_.updateOffset(this,!0),this._changeInProgress=null)),this},u.utc=function(e){return this.utcOffset(0,e)},u.local=function(e){return this._isUTC&&(this.utcOffset(0,e),this._isUTC=!1,e)&&this.subtract(Et(this),"m"),this},u.parseZone=function(){var e;return null!=this._tzm?this.utcOffset(this._tzm,!1,!0):"string"==typeof this._i&&(null!=(e=Vt(Me,this._i))?this.utcOffset(e):this.utcOffset(0,!0)),this},u.hasAlignedHourOffset=function(e){return!!this.isValid()&&(e=e?R(e).utcOffset():0,(this.utcOffset()-e)%60==0)},u.isDST=function(){return this.utcOffset()>this.clone().month(0).utcOffset()||this.utcOffset()>this.clone().month(5).utcOffset()},u.isLocal=function(){return!!this.isValid()&&!this._isUTC},u.isUtcOffset=function(){return!!this.isValid()&&this._isUTC},u.isUtc=At,u.isUTC=At,u.zoneAbbr=function(){return this._isUTC?"UTC":""},u.zoneName=function(){return this._isUTC?"Coordinated Universal Time":""},u.dates=e("dates accessor is deprecated. Use date instead.",ge),u.months=e("months accessor is deprecated. Use month instead",Ie),u.years=e("years accessor is deprecated. Use year instead",Pe),u.zone=e("moment().zone is deprecated, use moment().utcOffset instead. http://momentjs.com/guides/#/warnings/zone/",function(e,t){return null!=e?(this.utcOffset(e="string"!=typeof e?-e:e,t),this):-this.utcOffset()}),u.isDSTShifted=e("isDSTShifted is deprecated. See http://momentjs.com/guides/#/warnings/dst-shifted/ for more information",function(){var e,t;return g(this._isDSTShifted)&&(q(e={},this),(e=Nt(e))._a?(t=(e._isUTC?l:R)(e._a),this._isDSTShifted=this.isValid()&&0<function(e,t,n){for(var s=Math.min(e.length,t.length),i=Math.abs(e.length-t.length),r=0,a=0;a<s;a++)(n&&e[a]!==t[a]||!n&&M(e[a])!==M(t[a]))&&r++;return r+i}(e._a,t.toArray())):this._isDSTShifted=!1),this._isDSTShifted});d=K.prototype;function cn(e,t,n,s){var i=P(),s=l().set(s,t);return i[n](s,e)}function fn(e,t,n){if(w(e)&&(t=e,e=void 0),e=e||"",null!=t)return cn(e,t,n,"month");for(var s=[],i=0;i<12;i++)s[i]=cn(e,i,n,"month");return s}function mn(e,t,n,s){t=("boolean"==typeof e?w(t)&&(n=t,t=void 0):(t=e,e=!1,w(n=t)&&(n=t,t=void 0)),t||"");var i,r=P(),a=e?r._week.dow:0,o=[];if(null!=n)return cn(t,(n+a)%7,s,"day");for(i=0;i<7;i++)o[i]=cn(t,(i+a)%7,s,"day");return o}d.calendar=function(e,t,n){return a(e=this._calendar[e]||this._calendar.sameElse)?e.call(t,n):e},d.longDateFormat=function(e){var t=this._longDateFormat[e],n=this._longDateFormat[e.toUpperCase()];return t||!n?t:(this._longDateFormat[e]=n.match(te).map(function(e){return"MMMM"===e||"MM"===e||"DD"===e||"dddd"===e?e.slice(1):e}).join(""),this._longDateFormat[e])},d.invalidDate=function(){return this._invalidDate},d.ordinal=function(e){return this._ordinal.replace("%d",e)},d.preparse=hn,d.postformat=hn,d.relativeTime=function(e,t,n,s){var i=this._relativeTime[n];return a(i)?i(e,t,n,s):i.replace(/%d/i,e)},d.pastFuture=function(e,t){return a(e=this._relativeTime[0<e?"future":"past"])?e(t):e.replace(/%s/i,t)},d.set=function(e){var t,n;for(n in e)c(e,n)&&(a(t=e[n])?this[n]=t:this["_"+n]=t);this._config=e,this._dayOfMonthOrdinalParseLenient=new RegExp((this._dayOfMonthOrdinalParse.source||this._ordinalParse.source)+"|"+/\d{1,2}/.source)},d.eras=function(e,t){for(var n,s=this._eras||P("en")._eras,i=0,r=s.length;i<r;++i){switch(typeof s[i].since){case"string":n=_(s[i].since).startOf("day"),s[i].since=n.valueOf();break}switch(typeof s[i].until){case"undefined":s[i].until=1/0;break;case"string":n=_(s[i].until).startOf("day").valueOf(),s[i].until=n.valueOf();break}}return s},d.erasParse=function(e,t,n){var s,i,r,a,o,u=this.eras();for(e=e.toUpperCase(),s=0,i=u.length;s<i;++s)if(r=u[s].name.toUpperCase(),a=u[s].abbr.toUpperCase(),o=u[s].narrow.toUpperCase(),n)switch(t){case"N":case"NN":case"NNN":if(a===e)return u[s];break;case"NNNN":if(r===e)return u[s];break;case"NNNNN":if(o===e)return u[s];break}else if(0<=[r,a,o].indexOf(e))return u[s]},d.erasConvertYear=function(e,t){var n=e.since<=e.until?1:-1;return void 0===t?_(e.since).year():_(e.since).year()+(t-e.offset)*n},d.erasAbbrRegex=function(e){return c(this,"_erasAbbrRegex")||an.call(this),e?this._erasAbbrRegex:this._erasRegex},d.erasNameRegex=function(e){return c(this,"_erasNameRegex")||an.call(this),e?this._erasNameRegex:this._erasRegex},d.erasNarrowRegex=function(e){return c(this,"_erasNarrowRegex")||an.call(this),e?this._erasNarrowRegex:this._erasRegex},d.months=function(e,t){return e?(y(this._months)?this._months:this._months[(this._months.isFormat||Ve).test(t)?"format":"standalone"])[e.month()]:y(this._months)?this._months:this._months.standalone},d.monthsShort=function(e,t){return e?(y(this._monthsShort)?this._monthsShort:this._monthsShort[Ve.test(t)?"format":"standalone"])[e.month()]:y(this._monthsShort)?this._monthsShort:this._monthsShort.standalone},d.monthsParse=function(e,t,n){var s,i;if(this._monthsParseExact)return function(e,t,n){var s,i,r,e=e.toLocaleLowerCase();if(!this._monthsParse)for(this._monthsParse=[],this._longMonthsParse=[],this._shortMonthsParse=[],s=0;s<12;++s)r=l([2e3,s]),this._shortMonthsParse[s]=this.monthsShort(r,"").toLocaleLowerCase(),this._longMonthsParse[s]=this.months(r,"").toLocaleLowerCase();return n?"MMM"===t?-1!==(i=x.call(this._shortMonthsParse,e))?i:null:-1!==(i=x.call(this._longMonthsParse,e))?i:null:"MMM"===t?-1!==(i=x.call(this._shortMonthsParse,e))||-1!==(i=x.call(this._longMonthsParse,e))?i:null:-1!==(i=x.call(this._longMonthsParse,e))||-1!==(i=x.call(this._shortMonthsParse,e))?i:null}.call(this,e,t,n);for(this._monthsParse||(this._monthsParse=[],this._longMonthsParse=[],this._shortMonthsParse=[]),s=0;s<12;s++){if(i=l([2e3,s]),n&&!this._longMonthsParse[s]&&(this._longMonthsParse[s]=new RegExp("^"+this.months(i,"").replace(".","")+"$","i"),this._shortMonthsParse[s]=new RegExp("^"+this.monthsShort(i,"").replace(".","")+"$","i")),n||this._monthsParse[s]||(i="^"+this.months(i,"")+"|^"+this.monthsShort(i,""),this._monthsParse[s]=new RegExp(i.replace(".",""),"i")),n&&"MMMM"===t&&this._longMonthsParse[s].test(e))return s;if(n&&"MMM"===t&&this._shortMonthsParse[s].test(e))return s;if(!n&&this._monthsParse[s].test(e))return s}},d.monthsRegex=function(e){return this._monthsParseExact?(c(this,"_monthsRegex")||je.call(this),e?this._monthsStrictRegex:this._monthsRegex):(c(this,"_monthsRegex")||(this._monthsRegex=Ee),this._monthsStrictRegex&&e?this._monthsStrictRegex:this._monthsRegex)},d.monthsShortRegex=function(e){return this._monthsParseExact?(c(this,"_monthsRegex")||je.call(this),e?this._monthsShortStrictRegex:this._monthsShortRegex):(c(this,"_monthsShortRegex")||(this._monthsShortRegex=Ge),this._monthsShortStrictRegex&&e?this._monthsShortStrictRegex:this._monthsShortRegex)},d.week=function(e){return Be(e,this._week.dow,this._week.doy).week},d.firstDayOfYear=function(){return this._week.doy},d.firstDayOfWeek=function(){return this._week.dow},d.weekdays=function(e,t){return t=y(this._weekdays)?this._weekdays:this._weekdays[e&&!0!==e&&this._weekdays.isFormat.test(t)?"format":"standalone"],!0===e?Je(t,this._week.dow):e?t[e.day()]:t},d.weekdaysMin=function(e){return!0===e?Je(this._weekdaysMin,this._week.dow):e?this._weekdaysMin[e.day()]:this._weekdaysMin},d.weekdaysShort=function(e){return!0===e?Je(this._weekdaysShort,this._week.dow):e?this._weekdaysShort[e.day()]:this._weekdaysShort},d.weekdaysParse=function(e,t,n){var s,i;if(this._weekdaysParseExact)return function(e,t,n){var s,i,r,e=e.toLocaleLowerCase();if(!this._weekdaysParse)for(this._weekdaysParse=[],this._shortWeekdaysParse=[],this._minWeekdaysParse=[],s=0;s<7;++s)r=l([2e3,1]).day(s),this._minWeekdaysParse[s]=this.weekdaysMin(r,"").toLocaleLowerCase(),this._shortWeekdaysParse[s]=this.weekdaysShort(r,"").toLocaleLowerCase(),this._weekdaysParse[s]=this.weekdays(r,"").toLocaleLowerCase();return n?"dddd"===t?-1!==(i=x.call(this._weekdaysParse,e))?i:null:"ddd"===t?-1!==(i=x.call(this._shortWeekdaysParse,e))?i:null:-1!==(i=x.call(this._minWeekdaysParse,e))?i:null:"dddd"===t?-1!==(i=x.call(this._weekdaysParse,e))||-1!==(i=x.call(this._shortWeekdaysParse,e))||-1!==(i=x.call(this._minWeekdaysParse,e))?i:null:"ddd"===t?-1!==(i=x.call(this._shortWeekdaysParse,e))||-1!==(i=x.call(this._weekdaysParse,e))||-1!==(i=x.call(this._minWeekdaysParse,e))?i:null:-1!==(i=x.call(this._minWeekdaysParse,e))||-1!==(i=x.call(this._weekdaysParse,e))||-1!==(i=x.call(this._shortWeekdaysParse,e))?i:null}.call(this,e,t,n);for(this._weekdaysParse||(this._weekdaysParse=[],this._minWeekdaysParse=[],this._shortWeekdaysParse=[],this._fullWeekdaysParse=[]),s=0;s<7;s++){if(i=l([2e3,1]).day(s),n&&!this._fullWeekdaysParse[s]&&(this._fullWeekdaysParse[s]=new RegExp("^"+this.weekdays(i,"").replace(".","\\.?")+"$","i"),this._shortWeekdaysParse[s]=new RegExp("^"+this.weekdaysShort(i,"").replace(".","\\.?")+"$","i"),this._minWeekdaysParse[s]=new RegExp("^"+this.weekdaysMin(i,"").replace(".","\\.?")+"$","i")),this._weekdaysParse[s]||(i="^"+this.weekdays(i,"")+"|^"+this.weekdaysShort(i,"")+"|^"+this.weekdaysMin(i,""),this._weekdaysParse[s]=new RegExp(i.replace(".",""),"i")),n&&"dddd"===t&&this._fullWeekdaysParse[s].test(e))return s;if(n&&"ddd"===t&&this._shortWeekdaysParse[s].test(e))return s;if(n&&"dd"===t&&this._minWeekdaysParse[s].test(e))return s;if(!n&&this._weekdaysParse[s].test(e))return s}},d.weekdaysRegex=function(e){return this._weekdaysParseExact?(c(this,"_weekdaysRegex")||st.call(this),e?this._weekdaysStrictRegex:this._weekdaysRegex):(c(this,"_weekdaysRegex")||(this._weekdaysRegex=et),this._weekdaysStrictRegex&&e?this._weekdaysStrictRegex:this._weekdaysRegex)},d.weekdaysShortRegex=function(e){return this._weekdaysParseExact?(c(this,"_weekdaysRegex")||st.call(this),e?this._weekdaysShortStrictRegex:this._weekdaysShortRegex):(c(this,"_weekdaysShortRegex")||(this._weekdaysShortRegex=tt),this._weekdaysShortStrictRegex&&e?this._weekdaysShortStrictRegex:this._weekdaysShortRegex)},d.weekdaysMinRegex=function(e){return this._weekdaysParseExact?(c(this,"_weekdaysRegex")||st.call(this),e?this._weekdaysMinStrictRegex:this._weekdaysMinRegex):(c(this,"_weekdaysMinRegex")||(this._weekdaysMinRegex=nt),this._weekdaysMinStrictRegex&&e?this._weekdaysMinStrictRegex:this._weekdaysMinRegex)},d.isPM=function(e){return"p"===(e+"").toLowerCase().charAt(0)},d.meridiem=function(e,t,n){return 11<e?n?"pm":"PM":n?"am":"AM"},ft("en",{eras:[{since:"0001-01-01",until:1/0,offset:1,name:"Anno Domini",narrow:"AD",abbr:"AD"},{since:"0000-12-31",until:-1/0,offset:1,name:"Before Christ",narrow:"BC",abbr:"BC"}],dayOfMonthOrdinalParse:/\d{1,2}(th|st|nd|rd)/,ordinal:function(e){var t=e%10;return e+(1===M(e%100/10)?"th":1==t?"st":2==t?"nd":3==t?"rd":"th")}}),_.lang=e("moment.lang is deprecated. Use moment.locale instead.",ft),_.langData=e("moment.langData is deprecated. Use moment.localeData instead.",P);var _n=Math.abs;function yn(e,t,n,s){t=C(t,n);return e._milliseconds+=s*t._milliseconds,e._days+=s*t._days,e._months+=s*t._months,e._bubble()}function gn(e){return e<0?Math.floor(e):Math.ceil(e)}function wn(e){return 4800*e/146097}function pn(e){return 146097*e/4800}function kn(e){return function(){return this.as(e)}}de=kn("ms"),t=kn("s"),ye=kn("m"),he=kn("h"),Fe=kn("d"),_e=kn("w"),me=kn("M"),Qe=kn("Q"),i=kn("y"),ce=de;function Mn(e){return function(){return this.isValid()?this._data[e]:NaN}}var we=Mn("milliseconds"),fe=Mn("seconds"),ge=Mn("minutes"),Pe=Mn("hours"),d=Mn("days"),vn=Mn("months"),Dn=Mn("years");var Yn=Math.round,Sn={ss:44,s:45,m:45,h:22,d:26,w:null,M:11};function On(e,t,n,s){var i=C(e).abs(),r=Yn(i.as("s")),a=Yn(i.as("m")),o=Yn(i.as("h")),u=Yn(i.as("d")),l=Yn(i.as("M")),d=Yn(i.as("w")),i=Yn(i.as("y")),r=(r<=n.ss?["s",r]:r<n.s&&["ss",r])||(a<=1?["m"]:a<n.m&&["mm",a])||(o<=1?["h"]:o<n.h&&["hh",o])||(u<=1?["d"]:u<n.d&&["dd",u]);return(r=(r=null!=n.w?r||(d<=1?["w"]:d<n.w&&["ww",d]):r)||(l<=1?["M"]:l<n.M&&["MM",l])||(i<=1?["y"]:["yy",i]))[2]=t,r[3]=0<+e,r[4]=s,function(e,t,n,s,i){return i.relativeTime(t||1,!!n,e,s)}.apply(null,r)}var bn=Math.abs;function Tn(e){return(0<e)-(e<0)||+e}function xn(){var e,t,n,s,i,r,a,o,u,l,d;return this.isValid()?(e=bn(this._milliseconds)/1e3,t=bn(this._days),n=bn(this._months),(o=this.asSeconds())?(s=m(e/60),i=m(s/60),e%=60,s%=60,r=m(n/12),n%=12,a=e?e.toFixed(3).replace(/\.?0+$/,""):"",u=Tn(this._months)!==Tn(o)?"-":"",l=Tn(this._days)!==Tn(o)?"-":"",d=Tn(this._milliseconds)!==Tn(o)?"-":"",(o<0?"-":"")+"P"+(r?u+r+"Y":"")+(n?u+n+"M":"")+(t?l+t+"D":"")+(i||s||e?"T":"")+(i?d+i+"H":"")+(s?d+s+"M":"")+(e?d+a+"S":"")):"P0D"):this.localeData().invalidDate()}var U=Ct.prototype;return U.isValid=function(){return this._isValid},U.abs=function(){var e=this._data;return this._milliseconds=_n(this._milliseconds),this._days=_n(this._days),this._months=_n(this._months),e.milliseconds=_n(e.milliseconds),e.seconds=_n(e.seconds),e.minutes=_n(e.minutes),e.hours=_n(e.hours),e.months=_n(e.months),e.years=_n(e.years),this},U.add=function(e,t){return yn(this,e,t,1)},U.subtract=function(e,t){return yn(this,e,t,-1)},U.as=function(e){if(!this.isValid())return NaN;var t,n,s=this._milliseconds;if("month"===(e=o(e))||"quarter"===e||"year"===e)switch(t=this._days+s/864e5,n=this._months+wn(t),e){case"month":return n;case"quarter":return n/3;case"year":return n/12}else switch(t=this._days+Math.round(pn(this._months)),e){case"week":return t/7+s/6048e5;case"day":return t+s/864e5;case"hour":return 24*t+s/36e5;case"minute":return 1440*t+s/6e4;case"second":return 86400*t+s/1e3;case"millisecond":return Math.floor(864e5*t)+s;default:throw new Error("Unknown unit "+e)}},U.asMilliseconds=de,U.asSeconds=t,U.asMinutes=ye,U.asHours=he,U.asDays=Fe,U.asWeeks=_e,U.asMonths=me,U.asQuarters=Qe,U.asYears=i,U.valueOf=ce,U._bubble=function(){var e=this._milliseconds,t=this._days,n=this._months,s=this._data;return 0<=e&&0<=t&&0<=n||e<=0&&t<=0&&n<=0||(e+=864e5*gn(pn(n)+t),n=t=0),s.milliseconds=e%1e3,e=m(e/1e3),s.seconds=e%60,e=m(e/60),s.minutes=e%60,e=m(e/60),s.hours=e%24,t+=m(e/24),n+=e=m(wn(t)),t-=gn(pn(e)),e=m(n/12),n%=12,s.days=t,s.months=n,s.years=e,this},U.clone=function(){return C(this)},U.get=function(e){return e=o(e),this.isValid()?this[e+"s"]():NaN},U.milliseconds=we,U.seconds=fe,U.minutes=ge,U.hours=Pe,U.days=d,U.weeks=function(){return m(this.days()/7)},U.months=vn,U.years=Dn,U.humanize=function(e,t){var n,s;return this.isValid()?(n=!1,s=Sn,"object"==typeof e&&(t=e,e=!1),"boolean"==typeof e&&(n=e),"object"==typeof t&&(s=Object.assign({},Sn,t),null!=t.s)&&null==t.ss&&(s.ss=t.s-1),e=this.localeData(),t=On(this,!n,s,e),n&&(t=e.pastFuture(+this,t)),e.postformat(t)):this.localeData().invalidDate()},U.toISOString=xn,U.toString=xn,U.toJSON=xn,U.locale=Xt,U.localeData=Kt,U.toIsoString=e("toIsoString() is deprecated. Please use toISOString() instead (notice the capitals)",xn),U.lang=Ke,s("X",0,0,"unix"),s("x",0,0,"valueOf"),h("x",ke),h("X",/[+-]?\d+(\.\d{1,3})?/),v("X",function(e,t,n){n._d=new Date(1e3*parseFloat(e))}),v("x",function(e,t,n){n._d=new Date(M(e))}),_.version="2.30.1",H=R,_.fn=u,_.min=function(){return Pt("isBefore",[].slice.call(arguments,0))},_.max=function(){return Pt("isAfter",[].slice.call(arguments,0))},_.now=function(){return Date.now?Date.now():+new Date},_.utc=l,_.unix=function(e){return R(1e3*e)},_.months=function(e,t){return fn(e,t,"months")},_.isDate=V,_.locale=ft,_.invalid=I,_.duration=C,_.isMoment=k,_.weekdays=function(e,t,n){return mn(e,t,n,"weekdays")},_.parseZone=function(){return R.apply(null,arguments).parseZone()},_.localeData=P,_.isDuration=Ut,_.monthsShort=function(e,t){return fn(e,t,"monthsShort")},_.weekdaysMin=function(e,t,n){return mn(e,t,n,"weekdaysMin")},_.defineLocale=mt,_.updateLocale=function(e,t){var n,s;return null!=t?(s=ut,null!=W[e]&&null!=W[e].parentLocale?W[e].set(X(W[e]._config,t)):(t=X(s=null!=(n=ct(e))?n._config:s,t),null==n&&(t.abbr=e),(s=new K(t)).parentLocale=W[e],W[e]=s),ft(e)):null!=W[e]&&(null!=W[e].parentLocale?(W[e]=W[e].parentLocale,e===ft()&&ft(e)):null!=W[e]&&delete W[e]),W[e]},_.locales=function(){return ee(W)},_.weekdaysShort=function(e,t,n){return mn(e,t,n,"weekdaysShort")},_.normalizeUnits=o,_.relativeTimeRounding=function(e){return void 0===e?Yn:"function"==typeof e&&(Yn=e,!0)},_.relativeTimeThreshold=function(e,t){return void 0!==Sn[e]&&(void 0===t?Sn[e]:(Sn[e]=t,"s"===e&&(Sn.ss=t-1),!0))},_.calendarFormat=function(e,t){return(e=e.diff(t,"days",!0))<-6?"sameElse":e<-1?"lastWeek":e<0?"lastDay":e<1?"sameDay":e<2?"nextDay":e<7?"nextWeek":"sameElse"},_.prototype=u,_.HTML5_FMT={DATETIME_LOCAL:"YYYY-MM-DDTHH:mm",DATETIME_LOCAL_SECONDS:"YYYY-MM-DDTHH:mm:ss",DATETIME_LOCAL_MS:"YYYY-MM-DDTHH:mm:ss.SSS",DATE:"YYYY-MM-DD",TIME:"HH:mm",TIME_SECONDS:"HH:mm:ss",TIME_MS:"HH:mm:ss.SSS",WEEK:"GGGG-[W]WW",MONTH:"YYYY-MM"},_});
//# sourceMappingURL=moment.min.js.map
typeof Object.create!="function"&&(Object.create=function(n){function t(){}return t.prototype=n,new t}),function(n){var t={init:function(t,i){var r=this;r.elem=i;r.$elem=n(i);r.imageSrc=r.$elem.data("zoom-image")?r.$elem.data("zoom-image"):r.$elem.attr("src");r.options=n.extend({},n.fn.elevateZoom.options,t);r.options.tint&&(r.options.lensColour="none",r.options.lensOpacity="1");r.options.zoomType==="inner"&&(r.options.showLens=!1);r.$elem.parent().removeAttr("title").removeAttr("alt");r.zoomImage=r.imageSrc;r.refresh(1);n("#"+r.options.gallery+" a").click(function(t){return r.options.galleryActiveClass&&(n("#"+r.options.gallery+" a").removeClass(r.options.galleryActiveClass),n(this).addClass(r.options.galleryActiveClass)),t.preventDefault(),r.zoomImagePre=n(this).data("zoom-image")?n(this).data("zoom-image"):n(this).data("image"),r.swaptheimage(n(this).data("image"),r.zoomImagePre),!1})},refresh:function(n){var t=this;setTimeout(function(){t.fetch(t.imageSrc)},n||t.options.refresh)},fetch:function(n){var t=this,i=new Image;i.onload=function(){t.largeWidth=i.width;t.largeHeight=i.height;t.startZoom();t.currentImage=t.imageSrc;t.options.onZoomedImageLoaded(t.$elem)};i.src=n;return},startZoom:function(){var t=this,i;t.nzWidth=t.$elem.width();t.nzHeight=t.$elem.height();t.isWindowActive=!1;t.isLensActive=!1;t.isTintActive=!1;t.overWindow=!1;t.options.imageCrossfade&&(t.zoomWrap=t.$elem.wrap('<div style="height:'+t.nzHeight+"px;width:"+t.nzWidth+'px;" class="zoomWrapper" />'),t.$elem.css("position","absolute"));t.zoomLock=1;t.scrollingLock=!1;t.changeBgSize=!1;t.currentZoomLevel=t.options.zoomLevel;t.nzOffset=t.$elem.offset();t.widthRatio=t.largeWidth/t.currentZoomLevel/t.nzWidth;t.heightRatio=t.largeHeight/t.currentZoomLevel/t.nzHeight;t.options.zoomType==="window"&&(t.zoomWindowStyle="overflow: hidden;background-position: 0px 0px;text-align:center;background-color: "+String(t.options.zoomWindowBgColour)+";width: "+String(t.options.zoomWindowWidth)+"px;height: "+String(t.options.zoomWindowHeight)+"px;float: left;background-size: "+t.largeWidth/t.currentZoomLevel+"px "+t.largeHeight/t.currentZoomLevel+"px;display: none;z-index:1000;border: "+String(t.options.borderSize)+"px solid "+t.options.borderColour+";background-repeat: no-repeat;position: absolute;");t.options.zoomType==="inner"&&(i=t.$elem.css("border-left-width"),t.zoomWindowStyle="overflow: hidden;margin-left: "+String(i)+";margin-top: "+String(i)+";background-position: 0px 0px;width: "+String(t.nzWidth)+"px;height: "+String(t.nzHeight)+"px;px;float: left;display: none;cursor:"+t.options.cursor+";px solid "+t.options.borderColour+";background-repeat: no-repeat;position: absolute;");t.options.zoomType==="window"&&(lensHeight=t.nzHeight<t.options.zoomWindowWidth/t.widthRatio?t.nzHeight:String(t.options.zoomWindowHeight/t.heightRatio),lensWidth=t.largeWidth<t.options.zoomWindowWidth?t.nzWidth:t.options.zoomWindowWidth/t.widthRatio,t.lensStyle="background-position: 0px 0px;width: "+String(t.options.zoomWindowWidth/t.widthRatio)+"px;height: "+String(t.options.zoomWindowHeight/t.heightRatio)+"px;float: right;display: none;overflow: hidden;z-index: 999;-webkit-transform: translateZ(0);opacity:"+t.options.lensOpacity+";filter: alpha(opacity = "+t.options.lensOpacity*100+"); zoom:1;width:"+lensWidth+"px;height:"+lensHeight+"px;background-color:"+t.options.lensColour+";cursor:"+t.options.cursor+";border: "+t.options.lensBorderSize+"px solid "+t.options.lensBorderColour+";background-repeat: no-repeat;position: absolute;");t.tintStyle="display: block;position: absolute;background-color: "+t.options.tintColour+";filter:alpha(opacity=0);opacity: 0;width: "+t.nzWidth+"px;height: "+t.nzHeight+"px;";t.lensRound="";t.options.zoomType==="lens"&&(t.lensStyle="background-position: 0px 0px;float: left;display: none;border: "+String(t.options.borderSize)+"px solid "+t.options.borderColour+";width:"+String(t.options.lensSize)+"px;height:"+String(t.options.lensSize)+"px;background-repeat: no-repeat;position: absolute;");t.options.lensShape==="round"&&(t.lensRound="border-top-left-radius: "+String(t.options.lensSize/2+t.options.borderSize)+"px;border-top-right-radius: "+String(t.options.lensSize/2+t.options.borderSize)+"px;border-bottom-left-radius: "+String(t.options.lensSize/2+t.options.borderSize)+"px;border-bottom-right-radius: "+String(t.options.lensSize/2+t.options.borderSize)+"px;");t.zoomContainer=n('<div class="zoomContainer" style="z-index: 1060;position:absolute;left:'+t.nzOffset.left+"px;top:"+t.nzOffset.top+"px;height:"+t.nzHeight+"px;width:"+t.nzWidth+'px;"><\/div>');n("body").append(t.zoomContainer);t.options.containLensZoom&&t.options.zoomType==="lens"&&t.zoomContainer.css("overflow","hidden");t.options.zoomType!=="inner"&&(t.zoomLens=n("<div class='zoomLens' style='"+t.lensStyle+t.lensRound+"'>&nbsp;<\/div>").appendTo(t.zoomContainer).click(function(){t.$elem.trigger("click")}),t.options.tint&&(t.tintContainer=n("<div/>").addClass("tintContainer"),t.zoomTint=n("<div class='zoomTint' style='"+t.tintStyle+"'><\/div>"),t.zoomLens.wrap(t.tintContainer),t.zoomTintcss=t.zoomLens.after(t.zoomTint),t.zoomTintImage=n('<img style="position: absolute; left: 0px; top: 0px; max-width: none; width: '+t.nzWidth+"px; height: "+t.nzHeight+'px;" src="'+t.imageSrc+'">').appendTo(t.zoomLens).click(function(){t.$elem.trigger("click")})));t.zoomWindow=isNaN(t.options.zoomWindowPosition)?n("<div style='z-index:1051;left:"+t.windowOffsetLeft+"px;top:"+t.windowOffsetTop+"px;"+t.zoomWindowStyle+"' class='zoomWindow'>&nbsp;<\/div>").appendTo("body").click(function(){t.$elem.trigger("click")}):n("<div style='z-index:1051;left:"+t.windowOffsetLeft+"px;top:"+t.windowOffsetTop+"px;"+t.zoomWindowStyle+"' class='zoomWindow'>&nbsp;<\/div>").appendTo(t.zoomContainer).click(function(){t.$elem.trigger("click")});t.zoomWindowContainer=n("<div/>").addClass("zoomWindowContainer").css("width",t.options.zoomWindowWidth);t.zoomWindow.wrap(t.zoomWindowContainer);t.options.zoomType==="lens"&&t.zoomLens.css({backgroundImage:"url('"+t.imageSrc+"')"});t.options.zoomType==="window"&&t.zoomWindow.css({backgroundImage:"url('"+t.imageSrc+"')"});t.options.zoomType==="inner"&&t.zoomWindow.css({backgroundImage:"url('"+t.imageSrc+"')"});t.$elem.bind("touchmove",function(n){n.preventDefault();var i=n.originalEvent.touches[0]||n.originalEvent.changedTouches[0];t.setPosition(i)});t.zoomContainer.bind("touchmove",function(n){t.options.zoomType==="inner"&&t.showHideWindow("show");n.preventDefault();var i=n.originalEvent.touches[0]||n.originalEvent.changedTouches[0];t.setPosition(i)});t.zoomContainer.bind("touchend",function(){t.showHideWindow("hide");t.options.showLens&&t.showHideLens("hide");t.options.tint&&t.options.zoomType!=="inner"&&t.showHideTint("hide")});t.$elem.bind("touchend",function(){t.showHideWindow("hide");t.options.showLens&&t.showHideLens("hide");t.options.tint&&t.options.zoomType!=="inner"&&t.showHideTint("hide")});t.options.showLens&&(t.zoomLens.bind("touchmove",function(n){n.preventDefault();var i=n.originalEvent.touches[0]||n.originalEvent.changedTouches[0];t.setPosition(i)}),t.zoomLens.bind("touchend",function(){t.showHideWindow("hide");t.options.showLens&&t.showHideLens("hide");t.options.tint&&t.options.zoomType!=="inner"&&t.showHideTint("hide")}));t.$elem.bind("mousemove",function(n){t.overWindow===!1&&t.setElements("show");(t.lastX!==n.clientX||t.lastY!==n.clientY)&&(t.setPosition(n),t.currentLoc=n);t.lastX=n.clientX;t.lastY=n.clientY});t.zoomContainer.bind("mousemove",function(n){t.overWindow===!1&&t.setElements("show");(t.lastX!==n.clientX||t.lastY!==n.clientY)&&(t.setPosition(n),t.currentLoc=n);t.lastX=n.clientX;t.lastY=n.clientY});t.options.zoomType!=="inner"&&t.zoomLens.bind("mousemove",function(n){(t.lastX!==n.clientX||t.lastY!==n.clientY)&&(t.setPosition(n),t.currentLoc=n);t.lastX=n.clientX;t.lastY=n.clientY});t.options.tint&&t.options.zoomType!=="inner"&&t.zoomTint.bind("mousemove",function(n){(t.lastX!==n.clientX||t.lastY!==n.clientY)&&(t.setPosition(n),t.currentLoc=n);t.lastX=n.clientX;t.lastY=n.clientY});t.options.zoomType==="inner"&&t.zoomWindow.bind("mousemove",function(n){(t.lastX!==n.clientX||t.lastY!==n.clientY)&&(t.setPosition(n),t.currentLoc=n);t.lastX=n.clientX;t.lastY=n.clientY});t.zoomContainer.add(t.$elem).mouseenter(function(){t.overWindow===!1&&t.setElements("show")}).mouseleave(function(){if(!t.scrollLock){t.setElements("hide");t.options.onDestroy(t.$elem)}});t.options.zoomType!=="inner"&&t.zoomWindow.mouseenter(function(){t.overWindow=!0;t.setElements("hide")}).mouseleave(function(){t.overWindow=!1});t.options.zoomLevel!==1;t.minZoomLevel=t.options.minZoomLevel?t.options.minZoomLevel:t.options.scrollZoomIncrement*2;t.options.scrollZoom&&t.zoomContainer.add(t.$elem).bind("mousewheel DOMMouseScroll MozMousePixelScroll",function(i){t.scrollLock=!0;clearTimeout(n.data(this,"timer"));n.data(this,"timer",setTimeout(function(){t.scrollLock=!1},250));var r=i.originalEvent.wheelDelta||i.originalEvent.detail*-1;return i.stopImmediatePropagation(),i.stopPropagation(),i.preventDefault(),r/120>0?t.currentZoomLevel>=t.minZoomLevel&&t.changeZoomLevel(t.currentZoomLevel-t.options.scrollZoomIncrement):t.options.maxZoomLevel?t.currentZoomLevel<=t.options.maxZoomLevel&&t.changeZoomLevel(parseFloat(t.currentZoomLevel)+t.options.scrollZoomIncrement):t.changeZoomLevel(parseFloat(t.currentZoomLevel)+t.options.scrollZoomIncrement),!1})},setElements:function(n){var t=this;if(!t.options.zoomEnabled)return!1;n==="show"&&t.isWindowSet&&(t.options.zoomType==="inner"&&t.showHideWindow("show"),t.options.zoomType==="window"&&t.showHideWindow("show"),t.options.showLens&&t.showHideLens("show"),t.options.tint&&t.options.zoomType!=="inner"&&t.showHideTint("show"));n==="hide"&&(t.options.zoomType==="window"&&t.showHideWindow("hide"),t.options.tint||t.showHideWindow("hide"),t.options.showLens&&t.showHideLens("hide"),t.options.tint&&t.showHideTint("hide"))},setPosition:function(n){var t=this;if(!t.options.zoomEnabled)return!1;if(t.nzHeight=t.$elem.height(),t.nzWidth=t.$elem.width(),t.nzOffset=t.$elem.offset(),t.options.tint&&t.options.zoomType!=="inner"&&(t.zoomTint.css({top:0}),t.zoomTint.css({left:0})),t.options.responsive&&!t.options.scrollZoom&&t.options.showLens&&(lensHeight=t.nzHeight<t.options.zoomWindowWidth/t.widthRatio?t.nzHeight:String(t.options.zoomWindowHeight/t.heightRatio),lensWidth=t.largeWidth<t.options.zoomWindowWidth?t.nzWidth:t.options.zoomWindowWidth/t.widthRatio,t.widthRatio=t.largeWidth/t.nzWidth,t.heightRatio=t.largeHeight/t.nzHeight,t.options.zoomType!=="lens"&&(lensHeight=t.nzHeight<t.options.zoomWindowWidth/t.widthRatio?t.nzHeight:String(t.options.zoomWindowHeight/t.heightRatio),lensWidth=t.nzWidth<t.options.zoomWindowHeight/t.heightRatio?t.nzWidth:String(t.options.zoomWindowWidth/t.widthRatio),t.zoomLens.css("width",lensWidth),t.zoomLens.css("height",lensHeight),t.options.tint&&(t.zoomTintImage.css("width",t.nzWidth),t.zoomTintImage.css("height",t.nzHeight))),t.options.zoomType==="lens"&&t.zoomLens.css({width:String(t.options.lensSize)+"px",height:String(t.options.lensSize)+"px"})),t.zoomContainer.css({top:t.nzOffset.top}),t.zoomContainer.css({left:t.nzOffset.left}),t.mouseLeft=parseInt(n.pageX-t.nzOffset.left),t.mouseTop=parseInt(n.pageY-t.nzOffset.top),t.options.zoomType==="window"&&(t.Etoppos=t.mouseTop<t.zoomLens.height()/2,t.Eboppos=t.mouseTop>t.nzHeight-t.zoomLens.height()/2-t.options.lensBorderSize*2,t.Eloppos=t.mouseLeft<0+t.zoomLens.width()/2,t.Eroppos=t.mouseLeft>t.nzWidth-t.zoomLens.width()/2-t.options.lensBorderSize*2),t.options.zoomType==="inner"&&(t.Etoppos=t.mouseTop<t.nzHeight/2/t.heightRatio,t.Eboppos=t.mouseTop>t.nzHeight-t.nzHeight/2/t.heightRatio,t.Eloppos=t.mouseLeft<0+t.nzWidth/2/t.widthRatio,t.Eroppos=t.mouseLeft>t.nzWidth-t.nzWidth/2/t.widthRatio-t.options.lensBorderSize*2),t.mouseLeft<0||t.mouseTop<0||t.mouseLeft>t.nzWidth||t.mouseTop>t.nzHeight){t.setElements("hide");return}t.options.showLens&&(t.lensLeftPos=String(Math.floor(t.mouseLeft-t.zoomLens.width()/2)),t.lensTopPos=String(Math.floor(t.mouseTop-t.zoomLens.height()/2)));t.Etoppos&&(t.lensTopPos=0);t.Eloppos&&(t.windowLeftPos=0,t.lensLeftPos=0,t.tintpos=0);t.options.zoomType==="window"&&(t.Eboppos&&(t.lensTopPos=Math.max(t.nzHeight-t.zoomLens.height()-t.options.lensBorderSize*2,0)),t.Eroppos&&(t.lensLeftPos=t.nzWidth-t.zoomLens.width()-t.options.lensBorderSize*2));t.options.zoomType==="inner"&&(t.Eboppos&&(t.lensTopPos=Math.max(t.nzHeight-t.options.lensBorderSize*2,0)),t.Eroppos&&(t.lensLeftPos=t.nzWidth-t.nzWidth-t.options.lensBorderSize*2));t.options.zoomType==="lens"&&(t.windowLeftPos=String(((n.pageX-t.nzOffset.left)*t.widthRatio-t.zoomLens.width()/2)*-1),t.windowTopPos=String(((n.pageY-t.nzOffset.top)*t.heightRatio-t.zoomLens.height()/2)*-1),t.zoomLens.css({backgroundPosition:t.windowLeftPos+"px "+t.windowTopPos+"px"}),t.changeBgSize&&(t.nzHeight>t.nzWidth?(t.options.zoomType==="lens"&&t.zoomLens.css({"background-size":t.largeWidth/t.newvalueheight+"px "+t.largeHeight/t.newvalueheight+"px"}),t.zoomWindow.css({"background-size":t.largeWidth/t.newvalueheight+"px "+t.largeHeight/t.newvalueheight+"px"})):(t.options.zoomType==="lens"&&t.zoomLens.css({"background-size":t.largeWidth/t.newvaluewidth+"px "+t.largeHeight/t.newvaluewidth+"px"}),t.zoomWindow.css({"background-size":t.largeWidth/t.newvaluewidth+"px "+t.largeHeight/t.newvaluewidth+"px"})),t.changeBgSize=!1),t.setWindowPostition(n));t.options.tint&&t.options.zoomType!=="inner"&&t.setTintPosition(n);t.options.zoomType==="window"&&t.setWindowPostition(n);t.options.zoomType==="inner"&&t.setWindowPostition(n);t.options.showLens&&(t.fullwidth&&t.options.zoomType!=="lens"&&(t.lensLeftPos=0),t.zoomLens.css({left:t.lensLeftPos+"px",top:t.lensTopPos+"px"}))},showHideWindow:function(n){var t=this;n==="show"&&(t.isWindowActive||(t.options.zoomWindowFadeIn?t.zoomWindow.stop(!0,!0,!1).fadeIn(t.options.zoomWindowFadeIn):t.zoomWindow.show(),t.isWindowActive=!0));n==="hide"&&t.isWindowActive&&(t.options.zoomWindowFadeOut?t.zoomWindow.stop(!0,!0).fadeOut(t.options.zoomWindowFadeOut,function(){t.loop&&(clearInterval(t.loop),t.loop=!1)}):t.zoomWindow.hide(),t.isWindowActive=!1)},showHideLens:function(n){var t=this;n==="show"&&(t.isLensActive||(t.options.lensFadeIn?t.zoomLens.stop(!0,!0,!1).fadeIn(t.options.lensFadeIn):t.zoomLens.show(),t.isLensActive=!0));n==="hide"&&t.isLensActive&&(t.options.lensFadeOut?t.zoomLens.stop(!0,!0).fadeOut(t.options.lensFadeOut):t.zoomLens.hide(),t.isLensActive=!1)},showHideTint:function(n){var t=this;n==="show"&&(t.isTintActive||(t.options.zoomTintFadeIn?t.zoomTint.css({opacity:t.options.tintOpacity}).animate().stop(!0,!0).fadeIn("slow"):(t.zoomTint.css({opacity:t.options.tintOpacity}).animate(),t.zoomTint.show()),t.isTintActive=!0));n==="hide"&&t.isTintActive&&(t.options.zoomTintFadeOut?t.zoomTint.stop(!0,!0).fadeOut(t.options.zoomTintFadeOut):t.zoomTint.hide(),t.isTintActive=!1)},setLensPostition:function(){},setWindowPostition:function(t){var i=this;if(isNaN(i.options.zoomWindowPosition))i.externalContainer=n("#"+i.options.zoomWindowPosition),i.externalContainerWidth=i.externalContainer.width(),i.externalContainerHeight=i.externalContainer.height(),i.externalContainerOffset=i.externalContainer.offset(),i.windowOffsetTop=i.externalContainerOffset.top,i.windowOffsetLeft=i.externalContainerOffset.left;else switch(i.options.zoomWindowPosition){case 1:i.windowOffsetTop=i.options.zoomWindowOffety;i.windowOffsetLeft=+i.nzWidth;break;case 2:i.options.zoomWindowHeight>i.nzHeight&&(i.windowOffsetTop=(i.options.zoomWindowHeight/2-i.nzHeight/2)*-1,i.windowOffsetLeft=i.nzWidth);break;case 3:i.windowOffsetTop=i.nzHeight-i.zoomWindow.height()-i.options.borderSize*2;i.windowOffsetLeft=i.nzWidth;break;case 4:i.windowOffsetTop=i.nzHeight;i.windowOffsetLeft=i.nzWidth;break;case 5:i.windowOffsetTop=i.nzHeight;i.windowOffsetLeft=i.nzWidth-i.zoomWindow.width()-i.options.borderSize*2;break;case 6:i.options.zoomWindowHeight>i.nzHeight&&(i.windowOffsetTop=i.nzHeight,i.windowOffsetLeft=(i.options.zoomWindowWidth/2-i.nzWidth/2+i.options.borderSize*2)*-1);break;case 7:i.windowOffsetTop=i.nzHeight;i.windowOffsetLeft=0;break;case 8:i.windowOffsetTop=i.nzHeight;i.windowOffsetLeft=(i.zoomWindow.width()+i.options.borderSize*2)*-1;break;case 9:i.windowOffsetTop=i.nzHeight-i.zoomWindow.height()-i.options.borderSize*2;i.windowOffsetLeft=(i.zoomWindow.width()+i.options.borderSize*2)*-1;break;case 10:i.options.zoomWindowHeight>i.nzHeight&&(i.windowOffsetTop=(i.options.zoomWindowHeight/2-i.nzHeight/2)*-1,i.windowOffsetLeft=(i.zoomWindow.width()+i.options.borderSize*2)*-1);break;case 11:i.windowOffsetTop=i.options.zoomWindowOffety;i.windowOffsetLeft=(i.zoomWindow.width()+i.options.borderSize*2)*-1;break;case 12:i.windowOffsetTop=(i.zoomWindow.height()+i.options.borderSize*2)*-1;i.windowOffsetLeft=(i.zoomWindow.width()+i.options.borderSize*2)*-1;break;case 13:i.windowOffsetTop=(i.zoomWindow.height()+i.options.borderSize*2)*-1;i.windowOffsetLeft=0;break;case 14:i.options.zoomWindowHeight>i.nzHeight&&(i.windowOffsetTop=(i.zoomWindow.height()+i.options.borderSize*2)*-1,i.windowOffsetLeft=(i.options.zoomWindowWidth/2-i.nzWidth/2+i.options.borderSize*2)*-1);break;case 15:i.windowOffsetTop=(i.zoomWindow.height()+i.options.borderSize*2)*-1;i.windowOffsetLeft=i.nzWidth-i.zoomWindow.width()-i.options.borderSize*2;break;case 16:i.windowOffsetTop=(i.zoomWindow.height()+i.options.borderSize*2)*-1;i.windowOffsetLeft=i.nzWidth;break;default:i.windowOffsetTop=i.options.zoomWindowOffety;i.windowOffsetLeft=i.nzWidth}i.isWindowSet=!0;i.windowOffsetTop=i.windowOffsetTop+i.options.zoomWindowOffety;i.windowOffsetLeft=i.windowOffsetLeft+i.options.zoomWindowOffetx;i.zoomWindow.css({top:i.windowOffsetTop});i.zoomWindow.css({left:i.windowOffsetLeft});i.options.zoomType==="inner"&&(i.zoomWindow.css({top:0}),i.zoomWindow.css({left:0}));i.windowLeftPos=String(((t.pageX-i.nzOffset.left)*i.widthRatio-i.zoomWindow.width()/2)*-1);i.windowTopPos=String(((t.pageY-i.nzOffset.top)*i.heightRatio-i.zoomWindow.height()/2)*-1);i.Etoppos&&(i.windowTopPos=0);i.Eloppos&&(i.windowLeftPos=0);i.Eboppos&&(i.windowTopPos=(i.largeHeight/i.currentZoomLevel-i.zoomWindow.height())*-1);i.Eroppos&&(i.windowLeftPos=(i.largeWidth/i.currentZoomLevel-i.zoomWindow.width())*-1);i.fullheight&&(i.windowTopPos=0);i.fullwidth&&(i.windowLeftPos=0);(i.options.zoomType==="window"||i.options.zoomType==="inner")&&(i.zoomLock===1&&(i.widthRatio<=1&&(i.windowLeftPos=0),i.heightRatio<=1&&(i.windowTopPos=0)),i.options.zoomType==="window"&&(i.largeHeight<i.options.zoomWindowHeight&&(i.windowTopPos=0),i.largeWidth<i.options.zoomWindowWidth&&(i.windowLeftPos=0)),i.options.easing?(i.xp||(i.xp=0),i.yp||(i.yp=0),i.loop||(i.loop=setInterval(function(){i.xp+=(i.windowLeftPos-i.xp)/i.options.easingAmount;i.yp+=(i.windowTopPos-i.yp)/i.options.easingAmount;i.scrollingLock?(clearInterval(i.loop),i.xp=i.windowLeftPos,i.yp=i.windowTopPos,i.xp=((t.pageX-i.nzOffset.left)*i.widthRatio-i.zoomWindow.width()/2)*-1,i.yp=((t.pageY-i.nzOffset.top)*i.heightRatio-i.zoomWindow.height()/2)*-1,i.changeBgSize&&(i.nzHeight>i.nzWidth?(i.options.zoomType==="lens"&&i.zoomLens.css({"background-size":i.largeWidth/i.newvalueheight+"px "+i.largeHeight/i.newvalueheight+"px"}),i.zoomWindow.css({"background-size":i.largeWidth/i.newvalueheight+"px "+i.largeHeight/i.newvalueheight+"px"})):(i.options.zoomType!=="lens"&&i.zoomLens.css({"background-size":i.largeWidth/i.newvaluewidth+"px "+i.largeHeight/i.newvalueheight+"px"}),i.zoomWindow.css({"background-size":i.largeWidth/i.newvaluewidth+"px "+i.largeHeight/i.newvaluewidth+"px"})),i.changeBgSize=!1),i.zoomWindow.css({backgroundPosition:i.windowLeftPos+"px "+i.windowTopPos+"px"}),i.scrollingLock=!1,i.loop=!1):Math.round(Math.abs(i.xp-i.windowLeftPos)+Math.abs(i.yp-i.windowTopPos))<1?(clearInterval(i.loop),i.zoomWindow.css({backgroundPosition:i.windowLeftPos+"px "+i.windowTopPos+"px"}),i.loop=!1):(i.changeBgSize&&(i.nzHeight>i.nzWidth?(i.options.zoomType==="lens"&&i.zoomLens.css({"background-size":i.largeWidth/i.newvalueheight+"px "+i.largeHeight/i.newvalueheight+"px"}),i.zoomWindow.css({"background-size":i.largeWidth/i.newvalueheight+"px "+i.largeHeight/i.newvalueheight+"px"})):(i.options.zoomType!=="lens"&&i.zoomLens.css({"background-size":i.largeWidth/i.newvaluewidth+"px "+i.largeHeight/i.newvaluewidth+"px"}),i.zoomWindow.css({"background-size":i.largeWidth/i.newvaluewidth+"px "+i.largeHeight/i.newvaluewidth+"px"})),i.changeBgSize=!1),i.zoomWindow.css({backgroundPosition:i.xp+"px "+i.yp+"px"}))},16))):(i.changeBgSize&&(i.nzHeight>i.nzWidth?(i.options.zoomType==="lens"&&i.zoomLens.css({"background-size":i.largeWidth/i.newvalueheight+"px "+i.largeHeight/i.newvalueheight+"px"}),i.zoomWindow.css({"background-size":i.largeWidth/i.newvalueheight+"px "+i.largeHeight/i.newvalueheight+"px"})):(i.options.zoomType==="lens"&&i.zoomLens.css({"background-size":i.largeWidth/i.newvaluewidth+"px "+i.largeHeight/i.newvaluewidth+"px"}),i.largeHeight/i.newvaluewidth<i.options.zoomWindowHeight?i.zoomWindow.css({"background-size":i.largeWidth/i.newvaluewidth+"px "+i.largeHeight/i.newvaluewidth+"px"}):i.zoomWindow.css({"background-size":i.largeWidth/i.newvalueheight+"px "+i.largeHeight/i.newvalueheight+"px"})),i.changeBgSize=!1),i.zoomWindow.css({backgroundPosition:i.windowLeftPos+"px "+i.windowTopPos+"px"})))},setTintPosition:function(n){var t=this;t.nzOffset=t.$elem.offset();t.tintpos=String((n.pageX-t.nzOffset.left-t.zoomLens.width()/2)*-1);t.tintposy=String((n.pageY-t.nzOffset.top-t.zoomLens.height()/2)*-1);t.Etoppos&&(t.tintposy=0);t.Eloppos&&(t.tintpos=0);t.Eboppos&&(t.tintposy=(t.nzHeight-t.zoomLens.height()-t.options.lensBorderSize*2)*-1);t.Eroppos&&(t.tintpos=(t.nzWidth-t.zoomLens.width()-t.options.lensBorderSize*2)*-1);t.options.tint&&(t.fullheight&&(t.tintposy=0),t.fullwidth&&(t.tintpos=0),t.zoomTintImage.css({left:t.tintpos+"px"}),t.zoomTintImage.css({top:t.tintposy+"px"}))},swaptheimage:function(t,i){var r=this,u=new Image;r.options.loadingIcon&&(r.spinner=n("<div style=\"background: url('"+r.options.loadingIcon+"') no-repeat center;height:"+r.nzHeight+"px;width:"+r.nzWidth+'px;z-index: 2000;position: absolute; background-position: center center;"><\/div>'),r.$elem.after(r.spinner));r.options.onImageSwap(r.$elem);u.onload=function(){r.largeWidth=u.width;r.largeHeight=u.height;r.zoomImage=i;r.zoomWindow.css({"background-size":r.largeWidth+"px "+r.largeHeight+"px"});r.swapAction(t,i);return};u.src=i},swapAction:function(t,i){var r=this,u=new Image,f,e,o,s;u.onload=function(){r.nzHeight=u.height;r.nzWidth=u.width;r.options.onImageSwapComplete(r.$elem);r.doneCallback();return};u.src=t;r.currentZoomLevel=r.options.zoomLevel;r.options.maxZoomLevel=!1;r.options.zoomType==="lens"&&r.zoomLens.css({backgroundImage:"url('"+i+"')"});r.options.zoomType==="window"&&r.zoomWindow.css({backgroundImage:"url('"+i+"')"});r.options.zoomType==="inner"&&r.zoomWindow.css({backgroundImage:"url('"+i+"')"});r.currentImage=i;r.options.imageCrossfade?(f=r.$elem,e=f.clone(),r.$elem.attr("src",t),r.$elem.after(e),e.stop(!0).fadeOut(r.options.imageCrossfade,function(){n(this).remove()}),r.$elem.width("auto").removeAttr("width"),r.$elem.height("auto").removeAttr("height"),f.fadeIn(r.options.imageCrossfade),r.options.tint&&r.options.zoomType!=="inner"&&(o=r.zoomTintImage,s=o.clone(),r.zoomTintImage.attr("src",i),r.zoomTintImage.after(s),s.stop(!0).fadeOut(r.options.imageCrossfade,function(){n(this).remove()}),o.fadeIn(r.options.imageCrossfade),r.zoomTint.css({height:r.$elem.height()}),r.zoomTint.css({width:r.$elem.width()})),r.zoomContainer.css("height",r.$elem.height()),r.zoomContainer.css("width",r.$elem.width()),r.options.zoomType==="inner"&&(r.options.constrainType||(r.zoomWrap.parent().css("height",r.$elem.height()),r.zoomWrap.parent().css("width",r.$elem.width()),r.zoomWindow.css("height",r.$elem.height()),r.zoomWindow.css("width",r.$elem.width()))),r.options.imageCrossfade&&(r.zoomWrap.css("height",r.$elem.height()),r.zoomWrap.css("width",r.$elem.width()))):(r.$elem.attr("src",t),r.options.tint&&(r.zoomTintImage.attr("src",i),r.zoomTintImage.attr("height",r.$elem.height()),r.zoomTintImage.css({height:r.$elem.height()}),r.zoomTint.css({height:r.$elem.height()})),r.zoomContainer.css("height",r.$elem.height()),r.zoomContainer.css("width",r.$elem.width()),r.options.imageCrossfade&&(r.zoomWrap.css("height",r.$elem.height()),r.zoomWrap.css("width",r.$elem.width())));r.options.constrainType&&(r.options.constrainType==="height"&&(r.zoomContainer.css("height",r.options.constrainSize),r.zoomContainer.css("width","auto"),r.options.imageCrossfade?(r.zoomWrap.css("height",r.options.constrainSize),r.zoomWrap.css("width","auto"),r.constwidth=r.zoomWrap.width()):(r.$elem.css("height",r.options.constrainSize),r.$elem.css("width","auto"),r.constwidth=r.$elem.width()),r.options.zoomType==="inner"&&(r.zoomWrap.parent().css("height",r.options.constrainSize),r.zoomWrap.parent().css("width",r.constwidth),r.zoomWindow.css("height",r.options.constrainSize),r.zoomWindow.css("width",r.constwidth)),r.options.tint&&(r.tintContainer.css("height",r.options.constrainSize),r.tintContainer.css("width",r.constwidth),r.zoomTint.css("height",r.options.constrainSize),r.zoomTint.css("width",r.constwidth),r.zoomTintImage.css("height",r.options.constrainSize),r.zoomTintImage.css("width",r.constwidth))),r.options.constrainType==="width"&&(r.zoomContainer.css("height","auto"),r.zoomContainer.css("width",r.options.constrainSize),r.options.imageCrossfade?(r.zoomWrap.css("height","auto"),r.zoomWrap.css("width",r.options.constrainSize),r.constheight=r.zoomWrap.height()):(r.$elem.css("height","auto"),r.$elem.css("width",r.options.constrainSize),r.constheight=r.$elem.height()),r.options.zoomType==="inner"&&(r.zoomWrap.parent().css("height",r.constheight),r.zoomWrap.parent().css("width",r.options.constrainSize),r.zoomWindow.css("height",r.constheight),r.zoomWindow.css("width",r.options.constrainSize)),r.options.tint&&(r.tintContainer.css("height",r.constheight),r.tintContainer.css("width",r.options.constrainSize),r.zoomTint.css("height",r.constheight),r.zoomTint.css("width",r.options.constrainSize),r.zoomTintImage.css("height",r.constheight),r.zoomTintImage.css("width",r.options.constrainSize))))},doneCallback:function(){var n=this;n.options.loadingIcon&&n.spinner.hide();n.nzOffset=n.$elem.offset();n.nzWidth=n.$elem.width();n.nzHeight=n.$elem.height();n.currentZoomLevel=n.options.zoomLevel;n.widthRatio=n.largeWidth/n.nzWidth;n.heightRatio=n.largeHeight/n.nzHeight;n.options.zoomType==="window"&&(lensHeight=n.nzHeight<n.options.zoomWindowWidth/n.widthRatio?n.nzHeight:String(n.options.zoomWindowHeight/n.heightRatio),lensWidth=n.options.zoomWindowWidth<n.options.zoomWindowWidth?n.nzWidth:n.options.zoomWindowWidth/n.widthRatio,n.zoomLens&&(n.zoomLens.css("width",lensWidth),n.zoomLens.css("height",lensHeight)))},getCurrentImage:function(){var n=this;return n.zoomImage},getGalleryList:function(){var t=this;return t.gallerylist=[],t.options.gallery?n("#"+t.options.gallery+" a").each(function(){var i="";n(this).data("zoom-image")?i=n(this).data("zoom-image"):n(this).data("image")&&(i=n(this).data("image"));i===t.zoomImage?t.gallerylist.unshift({href:""+i+"",title:n(this).find("img").attr("title")}):t.gallerylist.push({href:""+i+"",title:n(this).find("img").attr("title")})}):t.gallerylist.push({href:""+t.zoomImage+"",title:n(this).find("img").attr("title")}),t.gallerylist},changeZoomLevel:function(n){var t=this;t.scrollingLock=!0;t.newvalue=parseFloat(n).toFixed(2);newvalue=parseFloat(n).toFixed(2);maxheightnewvalue=t.largeHeight/(t.options.zoomWindowHeight/t.nzHeight*t.nzHeight);maxwidthtnewvalue=t.largeWidth/(t.options.zoomWindowWidth/t.nzWidth*t.nzWidth);t.options.zoomType!=="inner"&&(maxheightnewvalue<=newvalue?(t.heightRatio=t.largeHeight/maxheightnewvalue/t.nzHeight,t.newvalueheight=maxheightnewvalue,t.fullheight=!0):(t.heightRatio=t.largeHeight/newvalue/t.nzHeight,t.newvalueheight=newvalue,t.fullheight=!1),maxwidthtnewvalue<=newvalue?(t.widthRatio=t.largeWidth/maxwidthtnewvalue/t.nzWidth,t.newvaluewidth=maxwidthtnewvalue,t.fullwidth=!0):(t.widthRatio=t.largeWidth/newvalue/t.nzWidth,t.newvaluewidth=newvalue,t.fullwidth=!1),t.options.zoomType==="lens"&&(maxheightnewvalue<=newvalue?(t.fullwidth=!0,t.newvaluewidth=maxheightnewvalue):(t.widthRatio=t.largeWidth/newvalue/t.nzWidth,t.newvaluewidth=newvalue,t.fullwidth=!1)));t.options.zoomType==="inner"&&(maxheightnewvalue=parseFloat(t.largeHeight/t.nzHeight).toFixed(2),maxwidthtnewvalue=parseFloat(t.largeWidth/t.nzWidth).toFixed(2),newvalue>maxheightnewvalue&&(newvalue=maxheightnewvalue),newvalue>maxwidthtnewvalue&&(newvalue=maxwidthtnewvalue),maxheightnewvalue<=newvalue?(t.heightRatio=t.largeHeight/newvalue/t.nzHeight,t.newvalueheight=newvalue>maxheightnewvalue?maxheightnewvalue:newvalue,t.fullheight=!0):(t.heightRatio=t.largeHeight/newvalue/t.nzHeight,t.newvalueheight=newvalue>maxheightnewvalue?maxheightnewvalue:newvalue,t.fullheight=!1),maxwidthtnewvalue<=newvalue?(t.widthRatio=t.largeWidth/newvalue/t.nzWidth,t.newvaluewidth=newvalue>maxwidthtnewvalue?maxwidthtnewvalue:newvalue,t.fullwidth=!0):(t.widthRatio=t.largeWidth/newvalue/t.nzWidth,t.newvaluewidth=newvalue,t.fullwidth=!1));scrcontinue=!1;t.options.zoomType==="inner"&&(t.nzWidth>=t.nzHeight&&(t.newvaluewidth<=maxwidthtnewvalue?scrcontinue=!0:(scrcontinue=!1,t.fullheight=!0,t.fullwidth=!0)),t.nzHeight>t.nzWidth&&(t.newvaluewidth<=maxwidthtnewvalue?scrcontinue=!0:(scrcontinue=!1,t.fullheight=!0,t.fullwidth=!0)));t.options.zoomType!=="inner"&&(scrcontinue=!0);scrcontinue&&(t.zoomLock=0,t.changeZoom=!0,t.options.zoomWindowHeight/t.heightRatio<=t.nzHeight&&(t.currentZoomLevel=t.newvalueheight,t.options.zoomType!=="lens"&&t.options.zoomType!=="inner"&&(t.changeBgSize=!0,t.zoomLens.css({height:String(t.options.zoomWindowHeight/t.heightRatio)+"px"})),(t.options.zoomType==="lens"||t.options.zoomType==="inner")&&(t.changeBgSize=!0)),t.options.zoomWindowWidth/t.widthRatio<=t.nzWidth&&(t.options.zoomType!=="inner"&&t.newvaluewidth>t.newvalueheight&&(t.currentZoomLevel=t.newvaluewidth),t.options.zoomType!=="lens"&&t.options.zoomType!=="inner"&&(t.changeBgSize=!0,t.zoomLens.css({width:String(t.options.zoomWindowWidth/t.widthRatio)+"px"})),(t.options.zoomType==="lens"||t.options.zoomType==="inner")&&(t.changeBgSize=!0)),t.options.zoomType==="inner"&&(t.changeBgSize=!0,t.nzWidth>t.nzHeight&&(t.currentZoomLevel=t.newvaluewidth),t.nzHeight>t.nzWidth&&(t.currentZoomLevel=t.newvaluewidth)));t.setPosition(t.currentLoc)},closeAll:function(){self.zoomWindow&&self.zoomWindow.hide();self.zoomLens&&self.zoomLens.hide();self.zoomTint&&self.zoomTint.hide()},changeState:function(n){var t=this;n==="enable"&&(t.options.zoomEnabled=!0);n==="disable"&&(t.options.zoomEnabled=!1)}};n.fn.elevateZoom=function(i){return this.each(function(){var r=Object.create(t);r.init(i,this);n.data(this,"elevateZoom",r)})};n.fn.elevateZoom.options={zoomActivation:"hover",zoomEnabled:!0,preloading:1,zoomLevel:1,scrollZoom:!1,scrollZoomIncrement:.1,minZoomLevel:!1,maxZoomLevel:!1,easing:!1,easingAmount:12,lensSize:200,zoomWindowWidth:400,zoomWindowHeight:400,zoomWindowOffetx:0,zoomWindowOffety:0,zoomWindowPosition:1,zoomWindowBgColour:"#fff",lensFadeIn:!1,lensFadeOut:!1,debug:!1,zoomWindowFadeIn:!1,zoomWindowFadeOut:!1,zoomWindowAlwaysShow:!1,zoomTintFadeIn:!1,zoomTintFadeOut:!1,borderSize:4,showLens:!0,borderColour:"#888",lensBorderSize:1,lensBorderColour:"#000",lensShape:"square",zoomType:"window",containLensZoom:!1,lensColour:"white",lensOpacity:.4,lenszoom:!1,tint:!1,tintColour:"#333",tintOpacity:.4,gallery:!1,galleryActiveClass:"zoomGalleryActive",imageCrossfade:!1,constrainType:!1,constrainSize:!1,loadingIcon:!1,cursor:"default",responsive:!0,onComplete:n.noop,onDestroy:function(){},onZoomedImageLoaded:function(){},onImageSwap:n.noop,onImageSwapComplete:n.noop}}(jQuery,window,document);
(function(n){"use strict";n("#sidebarToggle").on("click",function(t){t.preventDefault();document.body.classList.contains("sidebar-toggled")?(n("body").toggleClass("sidebar-toggled"),n(".sidebar").toggleClass("toggled")):(n("body").toggleClass("sidebar-toggled"),n(".sidebar").toggleClass("toggled"),n("#accountSidebar").hasClass("active-account")&&(n("#collapseAPIs").toggle(),n("#accountSidebar").removeClass("active-account")))});n("#accountSidebar").on("click",function(t){t.preventDefault();n("#accountSidebar").toggleClass("active-account");document.body.classList.contains("sidebar-toggled")&&(n("body").toggleClass("sidebar-toggled"),n(".sidebar").toggleClass("toggled"));n("#collapseAPIs").toggle()});n("body.fixed-nav .sidebar").on("mousewheel DOMMouseScroll wheel",function(t){if(n(window).width()>768){var i=t.originalEvent,r=i.wheelDelta||-i.detail;this.scrollTop+=(r<0?1:-1)*30;t.preventDefault()}});n(document).on("scroll",function(){var t=n(this).scrollTop();t>100?n(".scroll-to-top").fadeIn():n(".scroll-to-top").fadeOut()});n(document).on("click","a.scroll-to-top",function(t){var i=n(this);n("html, body").stop().animate({scrollTop:n(i.attr("href")).offset().top},1e3,"easeInOutExpo");t.preventDefault()})})(jQuery);
!function (t) { "function" == typeof define && define.amd ? define(t) : t() }(function () {
    "use strict";
/** @license
   * jsPDF - PDF Document creation from JavaScript
   * Version 1.5.3 Built on 2018-12-27T14:11:42.696Z
   *                      CommitID d93d28db14
   *
   * Copyright (c) 2010-2016 James Hall <james@parall.ax>, https://github.com/MrRio/jsPDF
   *               2010 Aaron Spike, https://github.com/acspike
   *               2012 Willow Systems Corporation, willow-systems.com
   *               2012 Pablo Hess, https://github.com/pablohess
   *               2012 Florian Jenett, https://github.com/fjenett
   *               2013 Warren Weckesser, https://github.com/warrenweckesser
   *               2013 Youssef Beddad, https://github.com/lifof
   *               2013 Lee Driscoll, https://github.com/lsdriscoll
   *               2013 Stefan Slonevskiy, https://github.com/stefslon
   *               2013 Jeremy Morel, https://github.com/jmorel
   *               2013 Christoph Hartmann, https://github.com/chris-rock
   *               2014 Juan Pablo Gaviria, https://github.com/juanpgaviria
   *               2014 James Makes, https://github.com/dollaruw
   *               2014 Diego Casorran, https://github.com/diegocr
   *               2014 Steven Spungin, https://github.com/Flamenco
   *               2014 Kenneth Glassey, https://github.com/Gavvers
   *
   * Licensed under the MIT License
   *
   * Contributor(s):
   *    siefkenj, ahwolf, rickygu, Midnith, saintclair, eaparango,
   *    kim3er, mfo, alnorth, Flamenco
   */function se(t) { return (se = "function" == typeof Symbol && "symbol" == typeof Symbol.iterator ? function (t) { return typeof t } : function (t) { return t && "function" == typeof Symbol && t.constructor === Symbol && t !== Symbol.prototype ? "symbol" : typeof t })(t) } !function (t) { if ("object" !== se(t.console)) { t.console = {}; for (var e, n, r = t.console, i = function () { }, o = ["memory"], a = "assert,clear,count,debug,dir,dirxml,error,exception,group,groupCollapsed,groupEnd,info,log,markTimeline,profile,profiles,profileEnd,show,table,time,timeEnd,timeline,timelineEnd,timeStamp,trace,warn".split(","); e = o.pop();)r[e] || (r[e] = {}); for (; n = a.pop();)r[n] || (r[n] = i) } var s, l, h, u, c = "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/="; void 0 === t.btoa && (t.btoa = function (t) { var e, n, r, i, o, a = 0, s = 0, l = "", h = []; if (!t) return t; for (; e = (o = t.charCodeAt(a++) << 16 | t.charCodeAt(a++) << 8 | t.charCodeAt(a++)) >> 18 & 63, n = o >> 12 & 63, r = o >> 6 & 63, i = 63 & o, h[s++] = c.charAt(e) + c.charAt(n) + c.charAt(r) + c.charAt(i), a < t.length;); l = h.join(""); var u = t.length % 3; return (u ? l.slice(0, u - 3) : l) + "===".slice(u || 3) }), void 0 === t.atob && (t.atob = function (t) { var e, n, r, i, o, a, s = 0, l = 0, h = []; if (!t) return t; for (t += ""; e = (a = c.indexOf(t.charAt(s++)) << 18 | c.indexOf(t.charAt(s++)) << 12 | (i = c.indexOf(t.charAt(s++))) << 6 | (o = c.indexOf(t.charAt(s++)))) >> 16 & 255, n = a >> 8 & 255, r = 255 & a, h[l++] = 64 == i ? String.fromCharCode(e) : 64 == o ? String.fromCharCode(e, n) : String.fromCharCode(e, n, r), s < t.length;); return h.join("") }), Array.prototype.map || (Array.prototype.map = function (t) { if (null == this || "function" != typeof t) throw new TypeError; for (var e = Object(this), n = e.length >>> 0, r = new Array(n), i = 1 < arguments.length ? arguments[1] : void 0, o = 0; o < n; o++)o in e && (r[o] = t.call(i, e[o], o, e)); return r }), Array.isArray || (Array.isArray = function (t) { return "[object Array]" === Object.prototype.toString.call(t) }), Array.prototype.forEach || (Array.prototype.forEach = function (t, e) { if (null == this || "function" != typeof t) throw new TypeError; for (var n = Object(this), r = n.length >>> 0, i = 0; i < r; i++)i in n && t.call(e, n[i], i, n) }), Array.prototype.find || Object.defineProperty(Array.prototype, "find", { value: function (t) { if (null == this) throw new TypeError('"this" is null or not defined'); var e = Object(this), n = e.length >>> 0; if ("function" != typeof t) throw new TypeError("predicate must be a function"); for (var r = arguments[1], i = 0; i < n;) { var o = e[i]; if (t.call(r, o, i, e)) return o; i++ } }, configurable: !0, writable: !0 }), Object.keys || (Object.keys = (s = Object.prototype.hasOwnProperty, l = !{ toString: null }.propertyIsEnumerable("toString"), u = (h = ["toString", "toLocaleString", "valueOf", "hasOwnProperty", "isPrototypeOf", "propertyIsEnumerable", "constructor"]).length, function (t) { if ("object" !== se(t) && ("function" != typeof t || null === t)) throw new TypeError; var e, n, r = []; for (e in t) s.call(t, e) && r.push(e); if (l) for (n = 0; n < u; n++)s.call(t, h[n]) && r.push(h[n]); return r })), "function" != typeof Object.assign && (Object.assign = function (t) { if (null == t) throw new TypeError("Cannot convert undefined or null to object"); t = Object(t); for (var e = 1; e < arguments.length; e++) { var n = arguments[e]; if (null != n) for (var r in n) Object.prototype.hasOwnProperty.call(n, r) && (t[r] = n[r]) } return t }), String.prototype.trim || (String.prototype.trim = function () { return this.replace(/^\s+|\s+$/g, "") }), String.prototype.trimLeft || (String.prototype.trimLeft = function () { return this.replace(/^\s+/g, "") }), String.prototype.trimRight || (String.prototype.trimRight = function () { return this.replace(/\s+$/g, "") }), Number.isInteger = Number.isInteger || function (t) { return "number" == typeof t && isFinite(t) && Math.floor(t) === t } }("undefined" != typeof self && self || "undefined" != typeof window && window || "undefined" != typeof global && global || Function('return typeof this === "object" && this.content')() || Function("return this")()); var t, e, n, _, l, F, P, p, d, k, a, o, s, h, u, c, r, i, f, g, m, y, v, w, b, x, I, C, B, N, L, A, S, j, E, M, O, q, T, R, D, U, z, H, W, V, G, Y, J, X, K, Z, Q, $, tt, et, nt, rt, it, ot, at, st, lt = function (ie) { function oe(o) { if ("object" !== se(o)) throw new Error("Invalid Context passed to initialize PubSub (jsPDF-module)"); var a = {}; this.subscribe = function (t, e, n) { if (n = n || !1, "string" != typeof t || "function" != typeof e || "boolean" != typeof n) throw new Error("Invalid arguments passed to PubSub.subscribe (jsPDF-module)"); a.hasOwnProperty(t) || (a[t] = {}); var r = Math.random().toString(35); return a[t][r] = [e, !!n], r }, this.unsubscribe = function (t) { for (var e in a) if (a[e][t]) return delete a[e][t], 0 === Object.keys(a[e]).length && delete a[e], !0; return !1 }, this.publish = function (t) { if (a.hasOwnProperty(t)) { var e = Array.prototype.slice.call(arguments, 1), n = []; for (var r in a[t]) { var i = a[t][r]; try { i[0].apply(o, e) } catch (t) { ie.console && console.error("jsPDF PubSub Error", t.message, t) } i[1] && n.push(r) } n.length && n.forEach(this.unsubscribe) } }, this.getTopics = function () { return a } } function ae(t, e, i, n) { var r = {}, o = [], a = 1; "object" === se(t) && (t = (r = t).orientation, e = r.unit || e, i = r.format || i, n = r.compress || r.compressPdf || n, o = r.filters || (!0 === n ? ["FlateEncode"] : o), a = "number" == typeof r.userUnit ? Math.abs(r.userUnit) : 1), e = e || "mm", t = ("" + (t || "P")).toLowerCase(); var s = r.putOnlyUsedFonts || !0, K = {}, l = { internal: {}, __private__: {} }; l.__private__.PubSub = oe; var h = "1.3", u = l.__private__.getPdfVersion = function () { return h }, c = (l.__private__.setPdfVersion = function (t) { h = t }, { a0: [2383.94, 3370.39], a1: [1683.78, 2383.94], a2: [1190.55, 1683.78], a3: [841.89, 1190.55], a4: [595.28, 841.89], a5: [419.53, 595.28], a6: [297.64, 419.53], a7: [209.76, 297.64], a8: [147.4, 209.76], a9: [104.88, 147.4], a10: [73.7, 104.88], b0: [2834.65, 4008.19], b1: [2004.09, 2834.65], b2: [1417.32, 2004.09], b3: [1000.63, 1417.32], b4: [708.66, 1000.63], b5: [498.9, 708.66], b6: [354.33, 498.9], b7: [249.45, 354.33], b8: [175.75, 249.45], b9: [124.72, 175.75], b10: [87.87, 124.72], c0: [2599.37, 3676.54], c1: [1836.85, 2599.37], c2: [1298.27, 1836.85], c3: [918.43, 1298.27], c4: [649.13, 918.43], c5: [459.21, 649.13], c6: [323.15, 459.21], c7: [229.61, 323.15], c8: [161.57, 229.61], c9: [113.39, 161.57], c10: [79.37, 113.39], dl: [311.81, 623.62], letter: [612, 792], "government-letter": [576, 756], legal: [612, 1008], "junior-legal": [576, 360], ledger: [1224, 792], tabloid: [792, 1224], "credit-card": [153, 243] }), f = (l.__private__.getPageFormats = function () { return c }, l.__private__.getPageFormat = function (t) { return c[t] }); "string" == typeof i && (i = f(i)), i = i || f("a4"); var p, Z = l.f2 = l.__private__.f2 = function (t) { if (isNaN(t)) throw new Error("Invalid argument passed to jsPDF.f2"); return t.toFixed(2) }, Q = l.__private__.f3 = function (t) { if (isNaN(t)) throw new Error("Invalid argument passed to jsPDF.f3"); return t.toFixed(3) }, d = "00000000000000000000000000000000", g = l.__private__.getFileId = function () { return d }, m = l.__private__.setFileId = function (t) { return t = t || "12345678901234567890123456789012".split("").map(function () { return "ABCDEF0123456789".charAt(Math.floor(16 * Math.random())) }).join(""), d = t }; l.setFileId = function (t) { return m(t), this }, l.getFileId = function () { return g() }; var y = l.__private__.convertDateToPDFDate = function (t) { var e = t.getTimezoneOffset(), n = e < 0 ? "+" : "-", r = Math.floor(Math.abs(e / 60)), i = Math.abs(e % 60), o = [n, P(r), "'", P(i), "'"].join(""); return ["D:", t.getFullYear(), P(t.getMonth() + 1), P(t.getDate()), P(t.getHours()), P(t.getMinutes()), P(t.getSeconds()), o].join("") }, v = l.__private__.convertPDFDateToDate = function (t) { var e = parseInt(t.substr(2, 4), 10), n = parseInt(t.substr(6, 2), 10) - 1, r = parseInt(t.substr(8, 2), 10), i = parseInt(t.substr(10, 2), 10), o = parseInt(t.substr(12, 2), 10), a = parseInt(t.substr(14, 2), 10); parseInt(t.substr(16, 2), 10), parseInt(t.substr(20, 2), 10); return new Date(e, n, r, i, o, a, 0) }, w = l.__private__.setCreationDate = function (t) { var e; if (void 0 === t && (t = new Date), "object" === se(t) && "[object Date]" === Object.prototype.toString.call(t)) e = y(t); else { if (!/^D:(20[0-2][0-9]|203[0-7]|19[7-9][0-9])(0[0-9]|1[0-2])([0-2][0-9]|3[0-1])(0[0-9]|1[0-9]|2[0-3])(0[0-9]|[1-5][0-9])(0[0-9]|[1-5][0-9])(\+0[0-9]|\+1[0-4]|\-0[0-9]|\-1[0-1])\'(0[0-9]|[1-5][0-9])\'?$/.test(t)) throw new Error("Invalid argument passed to jsPDF.setCreationDate"); e = t } return p = e }, b = l.__private__.getCreationDate = function (t) { var e = p; return "jsDate" === t && (e = v(p)), e }; l.setCreationDate = function (t) { return w(t), this }, l.getCreationDate = function (t) { return b(t) }; var x, N, L, A, S, $, _, F, P = l.__private__.padd2 = function (t) { return ("0" + parseInt(t)).slice(-2) }, k = !1, I = [], C = [], B = 0, tt = (l.__private__.setCustomOutputDestination = function (t) { N = t }, l.__private__.resetCustomOutputDestination = function (t) { N = void 0 }, l.__private__.out = function (t) { var e; return t = "string" == typeof t ? t : t.toString(), (e = void 0 === N ? k ? I[x] : C : N).push(t), k || (B += t.length + 1), e }), j = l.__private__.write = function (t) { return tt(1 === arguments.length ? t.toString() : Array.prototype.join.call(arguments, " ")) }, E = l.__private__.getArrayBuffer = function (t) { for (var e = t.length, n = new ArrayBuffer(e), r = new Uint8Array(n); e--;)r[e] = t.charCodeAt(e); return n }, M = [["Helvetica", "helvetica", "normal", "WinAnsiEncoding"], ["Helvetica-Bold", "helvetica", "bold", "WinAnsiEncoding"], ["Helvetica-Oblique", "helvetica", "italic", "WinAnsiEncoding"], ["Helvetica-BoldOblique", "helvetica", "bolditalic", "WinAnsiEncoding"], ["Courier", "courier", "normal", "WinAnsiEncoding"], ["Courier-Bold", "courier", "bold", "WinAnsiEncoding"], ["Courier-Oblique", "courier", "italic", "WinAnsiEncoding"], ["Courier-BoldOblique", "courier", "bolditalic", "WinAnsiEncoding"], ["Times-Roman", "times", "normal", "WinAnsiEncoding"], ["Times-Bold", "times", "bold", "WinAnsiEncoding"], ["Times-Italic", "times", "italic", "WinAnsiEncoding"], ["Times-BoldItalic", "times", "bolditalic", "WinAnsiEncoding"], ["ZapfDingbats", "zapfdingbats", "normal", null], ["Symbol", "symbol", "normal", null]], et = (l.__private__.getStandardFonts = function (t) { return M }, r.fontSize || 16), O = (l.__private__.setFontSize = l.setFontSize = function (t) { return et = t, this }, l.__private__.getFontSize = l.getFontSize = function () { return et }), nt = r.R2L || !1, q = (l.__private__.setR2L = l.setR2L = function (t) { return nt = t, this }, l.__private__.getR2L = l.getR2L = function (t) { return nt }, l.__private__.setZoomMode = function (t) { var e = [void 0, null, "fullwidth", "fullheight", "fullpage", "original"]; if (/^\d*\.?\d*\%$/.test(t)) L = t; else if (isNaN(t)) { if (-1 === e.indexOf(t)) throw new Error('zoom must be Integer (e.g. 2), a percentage Value (e.g. 300%) or fullwidth, fullheight, fullpage, original. "' + t + '" is not recognized.'); L = t } else L = parseInt(t, 10) }), T = (l.__private__.getZoomMode = function () { return L }, l.__private__.setPageMode = function (t) { if (-1 == [void 0, null, "UseNone", "UseOutlines", "UseThumbs", "FullScreen"].indexOf(t)) throw new Error('Page mode must be one of UseNone, UseOutlines, UseThumbs, or FullScreen. "' + t + '" is not recognized.'); A = t }), R = (l.__private__.getPageMode = function () { return A }, l.__private__.setLayoutMode = function (t) { if (-1 == [void 0, null, "continuous", "single", "twoleft", "tworight", "two"].indexOf(t)) throw new Error('Layout mode must be one of continuous, single, twoleft, tworight. "' + t + '" is not recognized.'); S = t }), D = (l.__private__.getLayoutMode = function () { return S }, l.__private__.setDisplayMode = l.setDisplayMode = function (t, e, n) { return q(t), R(e), T(n), this }, { title: "", subject: "", author: "", keywords: "", creator: "" }), U = (l.__private__.getDocumentProperty = function (t) { if (-1 === Object.keys(D).indexOf(t)) throw new Error("Invalid argument passed to jsPDF.getDocumentProperty"); return D[t] }, l.__private__.getDocumentProperties = function (t) { return D }, l.__private__.setDocumentProperties = l.setProperties = l.setDocumentProperties = function (t) { for (var e in D) D.hasOwnProperty(e) && t[e] && (D[e] = t[e]); return this }, l.__private__.setDocumentProperty = function (t, e) { if (-1 === Object.keys(D).indexOf(t)) throw new Error("Invalid arguments passed to jsPDF.setDocumentProperty"); return D[t] = e }, 0), z = [], rt = {}, H = {}, W = 0, V = [], G = [], it = new oe(l), Y = r.hotfixes || [], J = l.__private__.newObject = function () { var t = X(); return ot(t, !0), t }, X = l.__private__.newObjectDeferred = function () { return z[++U] = function () { return B }, U }, ot = function (t, e) { return e = "boolean" == typeof e && e, z[t] = B, e && tt(t + " 0 obj"), t }, at = l.__private__.newAdditionalObject = function () { var t = { objId: X(), content: "" }; return G.push(t), t }, st = X(), lt = X(), ht = l.__private__.decodeColorString = function (t) { var e = t.split(" "); if (2 === e.length && ("g" === e[1] || "G" === e[1])) { var n = parseFloat(e[0]); e = [n, n, n, "r"] } for (var r = "#", i = 0; i < 3; i++)r += ("0" + Math.floor(255 * parseFloat(e[i])).toString(16)).slice(-2); return r }, ut = l.__private__.encodeColorString = function (t) { var e; "string" == typeof t && (t = { ch1: t }); var n = t.ch1, r = t.ch2, i = t.ch3, o = t.ch4, a = (t.precision, "draw" === t.pdfColorType ? ["G", "RG", "K"] : ["g", "rg", "k"]); if ("string" == typeof n && "#" !== n.charAt(0)) { var s = new RGBColor(n); if (s.ok) n = s.toHex(); else if (!/^\d*\.?\d*$/.test(n)) throw new Error('Invalid color "' + n + '" passed to jsPDF.encodeColorString.') } if ("string" == typeof n && /^#[0-9A-Fa-f]{3}$/.test(n) && (n = "#" + n[1] + n[1] + n[2] + n[2] + n[3] + n[3]), "string" == typeof n && /^#[0-9A-Fa-f]{6}$/.test(n)) { var l = parseInt(n.substr(1), 16); n = l >> 16 & 255, r = l >> 8 & 255, i = 255 & l } if (void 0 === r || void 0 === o && n === r && r === i) if ("string" == typeof n) e = n + " " + a[0]; else switch (t.precision) { case 2: e = Z(n / 255) + " " + a[0]; break; case 3: default: e = Q(n / 255) + " " + a[0] } else if (void 0 === o || "object" === se(o)) { if (o && !isNaN(o.a) && 0 === o.a) return e = ["1.000", "1.000", "1.000", a[1]].join(" "); if ("string" == typeof n) e = [n, r, i, a[1]].join(" "); else switch (t.precision) { case 2: e = [Z(n / 255), Z(r / 255), Z(i / 255), a[1]].join(" "); break; default: case 3: e = [Q(n / 255), Q(r / 255), Q(i / 255), a[1]].join(" ") } } else if ("string" == typeof n) e = [n, r, i, o, a[2]].join(" "); else switch (t.precision) { case 2: e = [Z(n / 255), Z(r / 255), Z(i / 255), Z(o / 255), a[2]].join(" "); break; case 3: default: e = [Q(n / 255), Q(r / 255), Q(i / 255), Q(o / 255), a[2]].join(" ") }return e }, ct = l.__private__.getFilters = function () { return o }, ft = l.__private__.putStream = function (t) { var e = (t = t || {}).data || "", n = t.filters || ct(), r = t.alreadyAppliedFilters || [], i = t.addLength1 || !1, o = e.length, a = {}; !0 === n && (n = ["FlateEncode"]); var s = t.additionalKeyValues || [], l = (a = void 0 !== ae.API.processDataByFilters ? ae.API.processDataByFilters(e, n) : { data: e, reverseChain: [] }).reverseChain + (Array.isArray(r) ? r.join(" ") : r.toString()); 0 !== a.data.length && (s.push({ key: "Length", value: a.data.length }), !0 === i && s.push({ key: "Length1", value: o })), 0 != l.length && (l.split("/").length - 1 == 1 ? s.push({ key: "Filter", value: l }) : s.push({ key: "Filter", value: "[" + l + "]" })), tt("<<"); for (var h = 0; h < s.length; h++)tt("/" + s[h].key + " " + s[h].value); tt(">>"), 0 !== a.data.length && (tt("stream"), tt(a.data), tt("endstream")) }, pt = l.__private__.putPage = function (t) { t.mediaBox; var e = t.number, n = t.data, r = t.objId, i = t.contentsObjId; ot(r, !0); V[x].mediaBox.topRightX, V[x].mediaBox.bottomLeftX, V[x].mediaBox.topRightY, V[x].mediaBox.bottomLeftY; tt("<</Type /Page"), tt("/Parent " + t.rootDictionaryObjId + " 0 R"), tt("/Resources " + t.resourceDictionaryObjId + " 0 R"), tt("/MediaBox [" + parseFloat(Z(t.mediaBox.bottomLeftX)) + " " + parseFloat(Z(t.mediaBox.bottomLeftY)) + " " + Z(t.mediaBox.topRightX) + " " + Z(t.mediaBox.topRightY) + "]"), null !== t.cropBox && tt("/CropBox [" + Z(t.cropBox.bottomLeftX) + " " + Z(t.cropBox.bottomLeftY) + " " + Z(t.cropBox.topRightX) + " " + Z(t.cropBox.topRightY) + "]"), null !== t.bleedBox && tt("/BleedBox [" + Z(t.bleedBox.bottomLeftX) + " " + Z(t.bleedBox.bottomLeftY) + " " + Z(t.bleedBox.topRightX) + " " + Z(t.bleedBox.topRightY) + "]"), null !== t.trimBox && tt("/TrimBox [" + Z(t.trimBox.bottomLeftX) + " " + Z(t.trimBox.bottomLeftY) + " " + Z(t.trimBox.topRightX) + " " + Z(t.trimBox.topRightY) + "]"), null !== t.artBox && tt("/ArtBox [" + Z(t.artBox.bottomLeftX) + " " + Z(t.artBox.bottomLeftY) + " " + Z(t.artBox.topRightX) + " " + Z(t.artBox.topRightY) + "]"), "number" == typeof t.userUnit && 1 !== t.userUnit && tt("/UserUnit " + t.userUnit), it.publish("putPage", { objId: r, pageContext: V[e], pageNumber: e, page: n }), tt("/Contents " + i + " 0 R"), tt(">>"), tt("endobj"); var o = n.join("\n"); return ot(i, !0), ft({ data: o, filters: ct() }), tt("endobj"), r }, dt = l.__private__.putPages = function () { var t, e, n = []; for (t = 1; t <= W; t++)V[t].objId = X(), V[t].contentsObjId = X(); for (t = 1; t <= W; t++)n.push(pt({ number: t, data: I[t], objId: V[t].objId, contentsObjId: V[t].contentsObjId, mediaBox: V[t].mediaBox, cropBox: V[t].cropBox, bleedBox: V[t].bleedBox, trimBox: V[t].trimBox, artBox: V[t].artBox, userUnit: V[t].userUnit, rootDictionaryObjId: st, resourceDictionaryObjId: lt })); ot(st, !0), tt("<</Type /Pages"); var r = "/Kids ["; for (e = 0; e < W; e++)r += n[e] + " 0 R "; tt(r + "]"), tt("/Count " + W), tt(">>"), tt("endobj"), it.publish("postPutPages") }, gt = function () { !function () { for (var t in rt) rt.hasOwnProperty(t) && (!1 === s || !0 === s && K.hasOwnProperty(t)) && (e = rt[t], it.publish("putFont", { font: e, out: tt, newObject: J, putStream: ft }), !0 !== e.isAlreadyPutted && (e.objectNumber = J(), tt("<<"), tt("/Type /Font"), tt("/BaseFont /" + e.postScriptName), tt("/Subtype /Type1"), "string" == typeof e.encoding && tt("/Encoding /" + e.encoding), tt("/FirstChar 32"), tt("/LastChar 255"), tt(">>"), tt("endobj"))); var e }(), it.publish("putResources"), ot(lt, !0), tt("<<"), function () { for (var t in tt("/ProcSet [/PDF /Text /ImageB /ImageC /ImageI]"), tt("/Font <<"), rt) rt.hasOwnProperty(t) && (!1 === s || !0 === s && K.hasOwnProperty(t)) && tt("/" + t + " " + rt[t].objectNumber + " 0 R"); tt(">>"), tt("/XObject <<"), it.publish("putXobjectDict"), tt(">>") }(), tt(">>"), tt("endobj"), it.publish("postPutResources") }, mt = function (t, e, n) { H.hasOwnProperty(e) || (H[e] = {}), H[e][n] = t }, yt = function (t, e, n, r, i) { i = i || !1; var o = "F" + (Object.keys(rt).length + 1).toString(10), a = { id: o, postScriptName: t, fontName: e, fontStyle: n, encoding: r, isStandardFont: i, metadata: {} }; return it.publish("addFont", { font: a, instance: this }), void 0 !== o && (rt[o] = a, mt(o, e, n)), o }, vt = l.__private__.pdfEscape = l.pdfEscape = function (t, e) { return function (t, e) { var n, r, i, o, a, s, l, h, u; if (i = (e = e || {}).sourceEncoding || "Unicode", a = e.outputEncoding, (e.autoencode || a) && rt[$].metadata && rt[$].metadata[i] && rt[$].metadata[i].encoding && (o = rt[$].metadata[i].encoding, !a && rt[$].encoding && (a = rt[$].encoding), !a && o.codePages && (a = o.codePages[0]), "string" == typeof a && (a = o[a]), a)) { for (l = !1, s = [], n = 0, r = t.length; n < r; n++)(h = a[t.charCodeAt(n)]) ? s.push(String.fromCharCode(h)) : s.push(t[n]), s[n].charCodeAt(0) >> 8 && (l = !0); t = s.join("") } for (n = t.length; void 0 === l && 0 !== n;)t.charCodeAt(n - 1) >> 8 && (l = !0), n--; if (!l) return t; for (s = e.noBOM ? [] : [254, 255], n = 0, r = t.length; n < r; n++) { if ((u = (h = t.charCodeAt(n)) >> 8) >> 8) throw new Error("Character at position " + n + " of string '" + t + "' exceeds 16bits. Cannot be encoded into UCS-2 BE"); s.push(u), s.push(h - (u << 8)) } return String.fromCharCode.apply(void 0, s) }(t, e).replace(/\\/g, "\\\\").replace(/\(/g, "\\(").replace(/\)/g, "\\)") }, wt = l.__private__.beginPage = function (t, e) { var n, r = "string" == typeof e && e.toLowerCase(); if ("string" == typeof t && (n = f(t.toLowerCase())) && (t = n[0], e = n[1]), Array.isArray(t) && (e = t[1], t = t[0]), (isNaN(t) || isNaN(e)) && (t = i[0], e = i[1]), r) { switch (r.substr(0, 1)) { case "l": t < e && (r = "s"); break; case "p": e < t && (r = "s") }"s" === r && (n = t, t = e, e = n) } (14400 < t || 14400 < e) && (console.warn("A page in a PDF can not be wider or taller than 14400 userUnit. jsPDF limits the width/height to 14400"), t = Math.min(14400, t), e = Math.min(14400, e)), i = [t, e], k = !0, I[++W] = [], V[W] = { objId: 0, contentsObjId: 0, userUnit: Number(a), artBox: null, bleedBox: null, cropBox: null, trimBox: null, mediaBox: { bottomLeftX: 0, bottomLeftY: 0, topRightX: Number(t), topRightY: Number(e) } }, xt(W) }, bt = function () { wt.apply(this, arguments), Dt(Rt), tt(Jt), 0 !== te && tt(te + " J"), 0 !== ne && tt(ne + " j"), it.publish("addPage", { pageNumber: W }) }, xt = function (t) { 0 < t && t <= W && (x = t) }, Nt = l.__private__.getNumberOfPages = l.getNumberOfPages = function () { return I.length - 1 }, Lt = function (t, e, n) { var r, i = void 0; return n = n || {}, t = void 0 !== t ? t : rt[$].fontName, e = void 0 !== e ? e : rt[$].fontStyle, r = t.toLowerCase(), void 0 !== H[r] && void 0 !== H[r][e] ? i = H[r][e] : void 0 !== H[t] && void 0 !== H[t][e] ? i = H[t][e] : !1 === n.disableWarning && console.warn("Unable to look up font label for font '" + t + "', '" + e + "'. Refer to getFontList() for available fonts."), i || n.noFallback || null == (i = H.times[e]) && (i = H.times.normal), i }, At = l.__private__.putInfo = function () { for (var t in J(), tt("<<"), tt("/Producer (jsPDF " + ae.version + ")"), D) D.hasOwnProperty(t) && D[t] && tt("/" + t.substr(0, 1).toUpperCase() + t.substr(1) + " (" + vt(D[t]) + ")"); tt("/CreationDate (" + p + ")"), tt(">>"), tt("endobj") }, St = l.__private__.putCatalog = function (t) { var e = (t = t || {}).rootDictionaryObjId || st; switch (J(), tt("<<"), tt("/Type /Catalog"), tt("/Pages " + e + " 0 R"), L || (L = "fullwidth"), L) { case "fullwidth": tt("/OpenAction [3 0 R /FitH null]"); break; case "fullheight": tt("/OpenAction [3 0 R /FitV null]"); break; case "fullpage": tt("/OpenAction [3 0 R /Fit]"); break; case "original": tt("/OpenAction [3 0 R /XYZ null null 1]"); break; default: var n = "" + L; "%" === n.substr(n.length - 1) && (L = parseInt(L) / 100), "number" == typeof L && tt("/OpenAction [3 0 R /XYZ null null " + Z(L) + "]") }switch (S || (S = "continuous"), S) { case "continuous": tt("/PageLayout /OneColumn"); break; case "single": tt("/PageLayout /SinglePage"); break; case "two": case "twoleft": tt("/PageLayout /TwoColumnLeft"); break; case "tworight": tt("/PageLayout /TwoColumnRight") }A && tt("/PageMode /" + A), it.publish("putCatalog"), tt(">>"), tt("endobj") }, _t = l.__private__.putTrailer = function () { tt("trailer"), tt("<<"), tt("/Size " + (U + 1)), tt("/Root " + U + " 0 R"), tt("/Info " + (U - 1) + " 0 R"), tt("/ID [ <" + d + "> <" + d + "> ]"), tt(">>") }, Ft = l.__private__.putHeader = function () { tt("%PDF-" + h), tt("%ºß¬à") }, Pt = l.__private__.putXRef = function () { var t = 1, e = "0000000000"; for (tt("xref"), tt("0 " + (U + 1)), tt("0000000000 65535 f "), t = 1; t <= U; t++) { "function" == typeof z[t] ? tt((e + z[t]()).slice(-10) + " 00000 n ") : void 0 !== z[t] ? tt((e + z[t]).slice(-10) + " 00000 n ") : tt("0000000000 00000 n ") } }, kt = l.__private__.buildDocument = function () { k = !1, B = U = 0, C = [], z = [], G = [], st = X(), lt = X(), it.publish("buildDocument"), Ft(), dt(), function () { it.publish("putAdditionalObjects"); for (var t = 0; t < G.length; t++) { var e = G[t]; ot(e.objId, !0), tt(e.content), tt("endobj") } it.publish("postPutAdditionalObjects") }(), gt(), At(), St(); var t = B; return Pt(), _t(), tt("startxref"), tt("" + t), tt("%%EOF"), k = !0, C.join("\n") }, It = l.__private__.getBlob = function (t) { return new Blob([E(t)], { type: "application/pdf" }) }, Ct = l.output = l.__private__.output = ((F = function (t, e) { e = e || {}; var n = kt(); switch ("string" == typeof e ? e = { filename: e } : e.filename = e.filename || "generated.pdf", t) { case void 0: return n; case "save": l.save(e.filename); break; case "arraybuffer": return E(n); case "blob": return It(n); case "bloburi": case "bloburl": if (void 0 !== ie.URL && "function" == typeof ie.URL.createObjectURL) return ie.URL && ie.URL.createObjectURL(It(n)) || void 0; console.warn("bloburl is not supported by your system, because URL.createObjectURL is not supported by your browser."); break; case "datauristring": case "dataurlstring": return "data:application/pdf;filename=" + e.filename + ";base64," + btoa(n); case "dataurlnewwindow": var r = '<html><style>html, body { padding: 0; margin: 0; } iframe { width: 100%; height: 100%; border: 0;}  </style><body><iframe src="' + this.output("datauristring") + '"></iframe></body></html>', i = ie.open(); if (null !== i && i.document.write(r), i || "undefined" == typeof safari) return i; case "datauri": case "dataurl": return ie.document.location.href = "data:application/pdf;filename=" + e.filename + ";base64," + btoa(n); default: return null } }).foo = function () { try { return F.apply(this, arguments) } catch (t) { var e = t.stack || ""; ~e.indexOf(" at ") && (e = e.split(" at ")[1]); var n = "Error in function " + e.split("\n")[0].split("<")[0] + ": " + t.message; if (!ie.console) throw new Error(n); ie.console.error(n, t), ie.alert && alert(n) } }, (F.foo.bar = F).foo), Bt = function (t) { return !0 === Array.isArray(Y) && -1 < Y.indexOf(t) }; switch (e) { case "pt": _ = 1; break; case "mm": _ = 72 / 25.4; break; case "cm": _ = 72 / 2.54; break; case "in": _ = 72; break; case "px": _ = 1 == Bt("px_scaling") ? .75 : 96 / 72; break; case "pc": case "em": _ = 12; break; case "ex": _ = 6; break; default: throw new Error("Invalid unit: " + e) }w(), m(); var jt = l.__private__.getPageInfo = function (t) { if (isNaN(t) || t % 1 != 0) throw new Error("Invalid argument passed to jsPDF.getPageInfo"); return { objId: V[t].objId, pageNumber: t, pageContext: V[t] } }, Et = l.__private__.getPageInfoByObjId = function (t) { for (var e in V) if (V[e].objId === t) break; if (isNaN(t) || t % 1 != 0) throw new Error("Invalid argument passed to jsPDF.getPageInfoByObjId"); return jt(e) }, Mt = l.__private__.getCurrentPageInfo = function () { return { objId: V[x].objId, pageNumber: x, pageContext: V[x] } }; l.addPage = function () { return bt.apply(this, arguments), this }, l.setPage = function () { return xt.apply(this, arguments), this }, l.insertPage = function (t) { return this.addPage(), this.movePage(x, t), this }, l.movePage = function (t, e) { if (e < t) { for (var n = I[t], r = V[t], i = t; e < i; i--)I[i] = I[i - 1], V[i] = V[i - 1]; I[e] = n, V[e] = r, this.setPage(e) } else if (t < e) { for (n = I[t], r = V[t], i = t; i < e; i++)I[i] = I[i + 1], V[i] = V[i + 1]; I[e] = n, V[e] = r, this.setPage(e) } return this }, l.deletePage = function () { return function (t) { 0 < t && t <= W && (I.splice(t, 1), --W < x && (x = W), this.setPage(x)) }.apply(this, arguments), this }; l.__private__.text = l.text = function (t, e, n, i) { var r; "number" != typeof t || "number" != typeof e || "string" != typeof n && !Array.isArray(n) || (r = n, n = e, e = t, t = r); var o = arguments[3], a = arguments[4], s = arguments[5]; if ("object" === se(o) && null !== o || ("string" == typeof a && (s = a, a = null), "string" == typeof o && (s = o, o = null), "number" == typeof o && (a = o, o = null), i = { flags: o, angle: a, align: s }), (o = o || {}).noBOM = o.noBOM || !0, o.autoencode = o.autoencode || !0, isNaN(e) || isNaN(n) || null == t) throw new Error("Invalid arguments passed to jsPDF.text"); if (0 === t.length) return c; var l, h = "", u = "number" == typeof i.lineHeightFactor ? i.lineHeightFactor : Tt, c = i.scope || this; function f(t) { for (var e, n = t.concat(), r = [], i = n.length; i--;)"string" == typeof (e = n.shift()) ? r.push(e) : Array.isArray(t) && 1 === e.length ? r.push(e[0]) : r.push([e[0], e[1], e[2]]); return r } function p(t, e) { var n; if ("string" == typeof t) n = e(t)[0]; else if (Array.isArray(t)) { for (var r, i, o = t.concat(), a = [], s = o.length; s--;)"string" == typeof (r = o.shift()) ? a.push(e(r)[0]) : Array.isArray(r) && "string" === r[0] && (i = e(r[0], r[1], r[2]), a.push([i[0], i[1], i[2]])); n = a } return n } var d = !1, g = !0; if ("string" == typeof t) d = !0; else if (Array.isArray(t)) { for (var m, y = t.concat(), v = [], w = y.length; w--;)("string" != typeof (m = y.shift()) || Array.isArray(m) && "string" != typeof m[0]) && (g = !1); d = g } if (!1 === d) throw new Error('Type of text must be string or Array. "' + t + '" is not recognized.'); var b = rt[$].encoding; "WinAnsiEncoding" !== b && "StandardEncoding" !== b || (t = p(t, function (t, e, n) { return [(r = t, r = r.split("\t").join(Array(i.TabLen || 9).join(" ")), vt(r, o)), e, n]; var r })), "string" == typeof t && (t = t.match(/[\r?\n]/) ? t.split(/\r\n|\r|\n/g) : [t]); var x = et / c.internal.scaleFactor, N = x * (Tt - 1); switch (i.baseline) { case "bottom": n -= N; break; case "top": n += x - N; break; case "hanging": n += x - 2 * N; break; case "middle": n += x / 2 - N }0 < (O = i.maxWidth || 0) && ("string" == typeof t ? t = c.splitTextToSize(t, O) : "[object Array]" === Object.prototype.toString.call(t) && (t = c.splitTextToSize(t.join(" "), O))); var L = { text: t, x: e, y: n, options: i, mutex: { pdfEscape: vt, activeFontKey: $, fonts: rt, activeFontSize: et } }; it.publish("preProcessText", L), t = L.text; a = (i = L.options).angle; var A = c.internal.scaleFactor, S = []; if (a) { a *= Math.PI / 180; var _ = Math.cos(a), F = Math.sin(a); S = [Z(_), Z(F), Z(-1 * F), Z(_)] } void 0 !== (M = i.charSpace) && (h += Q(M * A) + " Tc\n"); i.lang; var P = -1, k = void 0 !== i.renderingMode ? i.renderingMode : i.stroke, I = c.internal.getCurrentPageInfo().pageContext; switch (k) { case 0: case !1: case "fill": P = 0; break; case 1: case !0: case "stroke": P = 1; break; case 2: case "fillThenStroke": P = 2; break; case 3: case "invisible": P = 3; break; case 4: case "fillAndAddForClipping": P = 4; break; case 5: case "strokeAndAddPathForClipping": P = 5; break; case 6: case "fillThenStrokeAndAddToPathForClipping": P = 6; break; case 7: case "addToPathForClipping": P = 7 }var C = void 0 !== I.usedRenderingMode ? I.usedRenderingMode : -1; -1 !== P ? h += P + " Tr\n" : -1 !== C && (h += "0 Tr\n"), -1 !== P && (I.usedRenderingMode = P); s = i.align || "left"; var B = et * u, j = c.internal.pageSize.getWidth(), E = (A = c.internal.scaleFactor, rt[$]), M = i.charSpace || Qt, O = i.maxWidth || 0, q = (o = {}, []); if ("[object Array]" === Object.prototype.toString.call(t)) { var T, R; v = f(t); "left" !== s && (R = v.map(function (t) { return c.getStringUnitWidth(t, { font: E, charSpace: M, fontSize: et }) * et / A })); var D, U = Math.max.apply(Math, R), z = 0; if ("right" === s) { e -= R[0], t = []; var H = 0; for (w = v.length; H < w; H++)U - R[H], T = 0 === H ? (D = Wt(e), Vt(n)) : (D = (z - R[H]) * A, -B), t.push([v[H], D, T]), z = R[H] } else if ("center" === s) { e -= R[0] / 2, t = []; for (H = 0, w = v.length; H < w; H++)(U - R[H]) / 2, T = 0 === H ? (D = Wt(e), Vt(n)) : (D = (z - R[H]) / 2 * A, -B), t.push([v[H], D, T]), z = R[H] } else if ("left" === s) { t = []; for (H = 0, w = v.length; H < w; H++)T = 0 === H ? Vt(n) : -B, D = 0 === H ? Wt(e) : 0, t.push(v[H]) } else { if ("justify" !== s) throw new Error('Unrecognized alignment option, use "left", "center", "right" or "justify".'); t = []; for (O = 0 !== O ? O : j, H = 0, w = v.length; H < w; H++)T = 0 === H ? Vt(n) : -B, D = 0 === H ? Wt(e) : 0, H < w - 1 && q.push(((O - R[H]) / (v[H].split(" ").length - 1) * A).toFixed(2)), t.push([v[H], D, T]) } } !0 === ("boolean" == typeof i.R2L ? i.R2L : nt) && (t = p(t, function (t, e, n) { return [t.split("").reverse().join(""), e, n] })); L = { text: t, x: e, y: n, options: i, mutex: { pdfEscape: vt, activeFontKey: $, fonts: rt, activeFontSize: et } }; it.publish("postProcessText", L), t = L.text, l = L.mutex.isHex; v = f(t); t = []; var W, V, G, Y = 0, J = (w = v.length, ""); for (H = 0; H < w; H++)J = "", Array.isArray(v[H]) ? (W = parseFloat(v[H][1]), V = parseFloat(v[H][2]), G = (l ? "<" : "(") + v[H][0] + (l ? ">" : ")"), Y = 1) : (W = Wt(e), V = Vt(n), G = (l ? "<" : "(") + v[H] + (l ? ">" : ")")), void 0 !== q && void 0 !== q[H] && (J = q[H] + " Tw\n"), 0 !== S.length && 0 === H ? t.push(J + S.join(" ") + " " + W.toFixed(2) + " " + V.toFixed(2) + " Tm\n" + G) : 1 === Y || 0 === Y && 0 === H ? t.push(J + W.toFixed(2) + " " + V.toFixed(2) + " Td\n" + G) : t.push(J + G); t = 0 === Y ? t.join(" Tj\nT* ") : t.join(" Tj\n"), t += " Tj\n"; var X = "BT\n/" + $ + " " + et + " Tf\n" + (et * u).toFixed(2) + " TL\n" + Kt + "\n"; return X += h, X += t, tt(X += "ET"), K[$] = !0, c }, l.__private__.lstext = l.lstext = function (t, e, n, r) { return console.warn("jsPDF.lstext is deprecated"), this.text(t, e, n, { charSpace: r }) }, l.__private__.clip = l.clip = function (t) { tt("evenodd" === t ? "W*" : "W"), tt("n") }, l.__private__.clip_fixed = l.clip_fixed = function (t) { console.log("clip_fixed is deprecated"), l.clip(t) }; var Ot = l.__private__.isValidStyle = function (t) { var e = !1; return -1 !== [void 0, null, "S", "F", "DF", "FD", "f", "f*", "B", "B*"].indexOf(t) && (e = !0), e }, qt = l.__private__.getStyle = function (t) { var e = "S"; return "F" === t ? e = "f" : "FD" === t || "DF" === t ? e = "B" : "f" !== t && "f*" !== t && "B" !== t && "B*" !== t || (e = t), e }; l.__private__.line = l.line = function (t, e, n, r) { if (isNaN(t) || isNaN(e) || isNaN(n) || isNaN(r)) throw new Error("Invalid arguments passed to jsPDF.line"); return this.lines([[n - t, r - e]], t, e) }, l.__private__.lines = l.lines = function (t, e, n, r, i, o) { var a, s, l, h, u, c, f, p, d, g, m, y; if ("number" == typeof t && (y = n, n = e, e = t, t = y), r = r || [1, 1], o = o || !1, isNaN(e) || isNaN(n) || !Array.isArray(t) || !Array.isArray(r) || !Ot(i) || "boolean" != typeof o) throw new Error("Invalid arguments passed to jsPDF.lines"); for (tt(Q(Wt(e)) + " " + Q(Vt(n)) + " m "), a = r[0], s = r[1], h = t.length, g = e, m = n, l = 0; l < h; l++)2 === (u = t[l]).length ? (g = u[0] * a + g, m = u[1] * s + m, tt(Q(Wt(g)) + " " + Q(Vt(m)) + " l")) : (c = u[0] * a + g, f = u[1] * s + m, p = u[2] * a + g, d = u[3] * s + m, g = u[4] * a + g, m = u[5] * s + m, tt(Q(Wt(c)) + " " + Q(Vt(f)) + " " + Q(Wt(p)) + " " + Q(Vt(d)) + " " + Q(Wt(g)) + " " + Q(Vt(m)) + " c")); return o && tt(" h"), null !== i && tt(qt(i)), this }, l.__private__.rect = l.rect = function (t, e, n, r, i) { if (isNaN(t) || isNaN(e) || isNaN(n) || isNaN(r) || !Ot(i)) throw new Error("Invalid arguments passed to jsPDF.rect"); return tt([Z(Wt(t)), Z(Vt(e)), Z(n * _), Z(-r * _), "re"].join(" ")), null !== i && tt(qt(i)), this }, l.__private__.triangle = l.triangle = function (t, e, n, r, i, o, a) { if (isNaN(t) || isNaN(e) || isNaN(n) || isNaN(r) || isNaN(i) || isNaN(o) || !Ot(a)) throw new Error("Invalid arguments passed to jsPDF.triangle"); return this.lines([[n - t, r - e], [i - n, o - r], [t - i, e - o]], t, e, [1, 1], a, !0), this }, l.__private__.roundedRect = l.roundedRect = function (t, e, n, r, i, o, a) { if (isNaN(t) || isNaN(e) || isNaN(n) || isNaN(r) || isNaN(i) || isNaN(o) || !Ot(a)) throw new Error("Invalid arguments passed to jsPDF.roundedRect"); var s = 4 / 3 * (Math.SQRT2 - 1); return this.lines([[n - 2 * i, 0], [i * s, 0, i, o - o * s, i, o], [0, r - 2 * o], [0, o * s, -i * s, o, -i, o], [2 * i - n, 0], [-i * s, 0, -i, -o * s, -i, -o], [0, 2 * o - r], [0, -o * s, i * s, -o, i, -o]], t + i, e, [1, 1], a), this }, l.__private__.ellipse = l.ellipse = function (t, e, n, r, i) { if (isNaN(t) || isNaN(e) || isNaN(n) || isNaN(r) || !Ot(i)) throw new Error("Invalid arguments passed to jsPDF.ellipse"); var o = 4 / 3 * (Math.SQRT2 - 1) * n, a = 4 / 3 * (Math.SQRT2 - 1) * r; return tt([Z(Wt(t + n)), Z(Vt(e)), "m", Z(Wt(t + n)), Z(Vt(e - a)), Z(Wt(t + o)), Z(Vt(e - r)), Z(Wt(t)), Z(Vt(e - r)), "c"].join(" ")), tt([Z(Wt(t - o)), Z(Vt(e - r)), Z(Wt(t - n)), Z(Vt(e - a)), Z(Wt(t - n)), Z(Vt(e)), "c"].join(" ")), tt([Z(Wt(t - n)), Z(Vt(e + a)), Z(Wt(t - o)), Z(Vt(e + r)), Z(Wt(t)), Z(Vt(e + r)), "c"].join(" ")), tt([Z(Wt(t + o)), Z(Vt(e + r)), Z(Wt(t + n)), Z(Vt(e + a)), Z(Wt(t + n)), Z(Vt(e)), "c"].join(" ")), null !== i && tt(qt(i)), this }, l.__private__.circle = l.circle = function (t, e, n, r) { if (isNaN(t) || isNaN(e) || isNaN(n) || !Ot(r)) throw new Error("Invalid arguments passed to jsPDF.circle"); return this.ellipse(t, e, n, n, r) }; l.setFont = function (t, e) { return $ = Lt(t, e, { disableWarning: !1 }), this }, l.setFontStyle = l.setFontType = function (t) { return $ = Lt(void 0, t), this }; l.__private__.getFontList = l.getFontList = function () { var t, e, n, r = {}; for (t in H) if (H.hasOwnProperty(t)) for (e in r[t] = n = [], H[t]) H[t].hasOwnProperty(e) && n.push(e); return r }; l.addFont = function (t, e, n, r) { yt.call(this, t, e, n, r = r || "Identity-H") }; var Tt, Rt = r.lineWidth || .200025, Dt = l.__private__.setLineWidth = l.setLineWidth = function (t) { return tt((t * _).toFixed(2) + " w"), this }, Ut = (l.__private__.setLineDash = ae.API.setLineDash = function (t, e) { if (t = t || [], e = e || 0, isNaN(e) || !Array.isArray(t)) throw new Error("Invalid arguments passed to jsPDF.setLineDash"); return t = t.map(function (t) { return (t * _).toFixed(3) }).join(" "), e = parseFloat((e * _).toFixed(3)), tt("[" + t + "] " + e + " d"), this }, l.__private__.getLineHeight = l.getLineHeight = function () { return et * Tt }), zt = (Ut = l.__private__.getLineHeight = l.getLineHeight = function () { return et * Tt }, l.__private__.setLineHeightFactor = l.setLineHeightFactor = function (t) { return "number" == typeof (t = t || 1.15) && (Tt = t), this }), Ht = l.__private__.getLineHeightFactor = l.getLineHeightFactor = function () { return Tt }; zt(r.lineHeight); var Wt = l.__private__.getHorizontalCoordinate = function (t) { return t * _ }, Vt = l.__private__.getVerticalCoordinate = function (t) { return V[x].mediaBox.topRightY - V[x].mediaBox.bottomLeftY - t * _ }, Gt = l.__private__.getHorizontalCoordinateString = function (t) { return Z(t * _) }, Yt = l.__private__.getVerticalCoordinateString = function (t) { return Z(V[x].mediaBox.topRightY - V[x].mediaBox.bottomLeftY - t * _) }, Jt = r.strokeColor || "0 G", Xt = (l.__private__.getStrokeColor = l.getDrawColor = function () { return ht(Jt) }, l.__private__.setStrokeColor = l.setDrawColor = function (t, e, n, r) { return Jt = ut({ ch1: t, ch2: e, ch3: n, ch4: r, pdfColorType: "draw", precision: 2 }), tt(Jt), this }, r.fillColor || "0 g"), Kt = (l.__private__.getFillColor = l.getFillColor = function () { return ht(Xt) }, l.__private__.setFillColor = l.setFillColor = function (t, e, n, r) { return Xt = ut({ ch1: t, ch2: e, ch3: n, ch4: r, pdfColorType: "fill", precision: 2 }), tt(Xt), this }, r.textColor || "0 g"), Zt = l.__private__.getTextColor = l.getTextColor = function () { return ht(Kt) }, Qt = (l.__private__.setTextColor = l.setTextColor = function (t, e, n, r) { return Kt = ut({ ch1: t, ch2: e, ch3: n, ch4: r, pdfColorType: "text", precision: 3 }), this }, r.charSpace || 0), $t = l.__private__.getCharSpace = l.getCharSpace = function () { return Qt }, te = (l.__private__.setCharSpace = l.setCharSpace = function (t) { if (isNaN(t)) throw new Error("Invalid argument passed to jsPDF.setCharSpace"); return Qt = t, this }, 0); l.CapJoinStyles = { 0: 0, butt: 0, but: 0, miter: 0, 1: 1, round: 1, rounded: 1, circle: 1, 2: 2, projecting: 2, project: 2, square: 2, bevel: 2 }; l.__private__.setLineCap = l.setLineCap = function (t) { var e = l.CapJoinStyles[t]; if (void 0 === e) throw new Error("Line cap style of '" + t + "' is not recognized. See or extend .CapJoinStyles property for valid styles"); return tt((te = e) + " J"), this }; var ee, ne = 0; l.__private__.setLineJoin = l.setLineJoin = function (t) { var e = l.CapJoinStyles[t]; if (void 0 === e) throw new Error("Line join style of '" + t + "' is not recognized. See or extend .CapJoinStyles property for valid styles"); return tt((ne = e) + " j"), this }, l.__private__.setMiterLimit = l.setMiterLimit = function (t) { if (t = t || 0, isNaN(t)) throw new Error("Invalid argument passed to jsPDF.setMiterLimit"); return ee = parseFloat(Z(t * _)), tt(ee + " M"), this }; for (var re in l.save = function (r, t) { if (r = r || "generated.pdf", (t = t || {}).returnPromise = t.returnPromise || !1, !1 !== t.returnPromise) return new Promise(function (t, e) { try { var n = le(It(kt()), r); "function" == typeof le.unload && ie.setTimeout && setTimeout(le.unload, 911), t(n) } catch (t) { e(t.message) } }); le(It(kt()), r), "function" == typeof le.unload && ie.setTimeout && setTimeout(le.unload, 911) }, ae.API) ae.API.hasOwnProperty(re) && ("events" === re && ae.API.events.length ? function (t, e) { var n, r, i; for (i = e.length - 1; -1 !== i; i--)n = e[i][0], r = e[i][1], t.subscribe.apply(t, [n].concat("function" == typeof r ? [r] : r)) }(it, ae.API.events) : l[re] = ae.API[re]); return l.internal = { pdfEscape: vt, getStyle: qt, getFont: function () { return rt[Lt.apply(l, arguments)] }, getFontSize: O, getCharSpace: $t, getTextColor: Zt, getLineHeight: Ut, getLineHeightFactor: Ht, write: j, getHorizontalCoordinate: Wt, getVerticalCoordinate: Vt, getCoordinateString: Gt, getVerticalCoordinateString: Yt, collections: {}, newObject: J, newAdditionalObject: at, newObjectDeferred: X, newObjectDeferredBegin: ot, getFilters: ct, putStream: ft, events: it, scaleFactor: _, pageSize: { getWidth: function () { return (V[x].mediaBox.topRightX - V[x].mediaBox.bottomLeftX) / _ }, setWidth: function (t) { V[x].mediaBox.topRightX = t * _ + V[x].mediaBox.bottomLeftX }, getHeight: function () { return (V[x].mediaBox.topRightY - V[x].mediaBox.bottomLeftY) / _ }, setHeight: function (t) { V[x].mediaBox.topRightY = t * _ + V[x].mediaBox.bottomLeftY } }, output: Ct, getNumberOfPages: Nt, pages: I, out: tt, f2: Z, f3: Q, getPageInfo: jt, getPageInfoByObjId: Et, getCurrentPageInfo: Mt, getPDFVersion: u, hasHotfix: Bt }, Object.defineProperty(l.internal.pageSize, "width", { get: function () { return (V[x].mediaBox.topRightX - V[x].mediaBox.bottomLeftX) / _ }, set: function (t) { V[x].mediaBox.topRightX = t * _ + V[x].mediaBox.bottomLeftX }, enumerable: !0, configurable: !0 }), Object.defineProperty(l.internal.pageSize, "height", { get: function () { return (V[x].mediaBox.topRightY - V[x].mediaBox.bottomLeftY) / _ }, set: function (t) { V[x].mediaBox.topRightY = t * _ + V[x].mediaBox.bottomLeftY }, enumerable: !0, configurable: !0 }), function (t) { for (var e = 0, n = M.length; e < n; e++) { var r = yt(t[e][0], t[e][1], t[e][2], M[e][3], !0); K[r] = !0; var i = t[e][0].split("-"); mt(r, i[0], i[1] || "") } it.publish("addFonts", { fonts: rt, dictionary: H }) }(M), $ = "F1", bt(i, t), it.publish("initialized"), l } return ae.API = { events: [] }, ae.version = "1.5.3", "function" == typeof define && define.amd ? define("jsPDF", function () { return ae }) : "undefined" != typeof module && module.exports ? (module.exports = ae, module.exports.jsPDF = ae) : ie.jsPDF = ae, ae }("undefined" != typeof self && self || "undefined" != typeof window && window || "undefined" != typeof global && global || Function('return typeof this === "object" && this.content')() || Function("return this")());
    /**
       * @license
       * Copyright (c) 2016 Alexander Weidt,
       * https://github.com/BiggA94
       * 
       * Licensed under the MIT License. http://opensource.org/licenses/mit-license
       */
    (function (t, e) { var A, n = 1, S = function (t) { return t.replace(/\\/g, "\\\\").replace(/\(/g, "\\(").replace(/\)/g, "\\)") }, y = function (t) { return t.replace(/\\\\/g, "\\").replace(/\\\(/g, "(").replace(/\\\)/g, ")") }, _ = function (t) { if (isNaN(t)) throw new Error("Invalid argument passed to jsPDF.f2"); return t.toFixed(2) }, s = function (t) { if (isNaN(t)) throw new Error("Invalid argument passed to jsPDF.f2"); return t.toFixed(5) }; t.__acroform__ = {}; var r = function (t, e) { t.prototype = Object.create(e.prototype), t.prototype.constructor = t }, v = function (t) { return t * n }, w = function (t) { return t / n }, l = function (t) { var e = new j, n = Y.internal.getHeight(t) || 0, r = Y.internal.getWidth(t) || 0; return e.BBox = [0, 0, Number(_(r)), Number(_(n))], e }, i = t.__acroform__.setBit = function (t, e) { if (t = t || 0, e = e || 0, isNaN(t) || isNaN(e)) throw new Error("Invalid arguments passed to jsPDF.API.__acroform__.setBit"); return t |= 1 << e }, o = t.__acroform__.clearBit = function (t, e) { if (t = t || 0, e = e || 0, isNaN(t) || isNaN(e)) throw new Error("Invalid arguments passed to jsPDF.API.__acroform__.clearBit"); return t &= ~(1 << e) }, a = t.__acroform__.getBit = function (t, e) { if (isNaN(t) || isNaN(e)) throw new Error("Invalid arguments passed to jsPDF.API.__acroform__.getBit"); return 0 == (t & 1 << e) ? 0 : 1 }, b = t.__acroform__.getBitForPdf = function (t, e) { if (isNaN(t) || isNaN(e)) throw new Error("Invalid arguments passed to jsPDF.API.__acroform__.getBitForPdf"); return a(t, e - 1) }, x = t.__acroform__.setBitForPdf = function (t, e) { if (isNaN(t) || isNaN(e)) throw new Error("Invalid arguments passed to jsPDF.API.__acroform__.setBitForPdf"); return i(t, e - 1) }, N = t.__acroform__.clearBitForPdf = function (t, e, n) { if (isNaN(t) || isNaN(e)) throw new Error("Invalid arguments passed to jsPDF.API.__acroform__.clearBitForPdf"); return o(t, e - 1) }, c = t.__acroform__.calculateCoordinates = function (t) { var e = this.internal.getHorizontalCoordinate, n = this.internal.getVerticalCoordinate, r = t[0], i = t[1], o = t[2], a = t[3], s = {}; return s.lowerLeft_X = e(r) || 0, s.lowerLeft_Y = n(i + a) || 0, s.upperRight_X = e(r + o) || 0, s.upperRight_Y = n(i) || 0, [Number(_(s.lowerLeft_X)), Number(_(s.lowerLeft_Y)), Number(_(s.upperRight_X)), Number(_(s.upperRight_Y))] }, f = function (t) { if (t.appearanceStreamContent) return t.appearanceStreamContent; if (t.V || t.DV) { var e = [], n = t.V || t.DV, r = h(t, n), i = A.internal.getFont(t.fontName, t.fontStyle).id; e.push("/Tx BMC"), e.push("q"), e.push("BT"), e.push(A.__private__.encodeColorString(t.color)), e.push("/" + i + " " + _(r.fontSize) + " Tf"), e.push("1 0 0 1 0 0 Tm"), e.push(r.text), e.push("ET"), e.push("Q"), e.push("EMC"); var o = new l(t); return o.stream = e.join("\n"), o } }, h = function (i, t) { var e = i.maxFontSize || 12, n = (i.fontName, { text: "", fontSize: "" }), o = (t = ")" == (t = "(" == t.substr(0, 1) ? t.substr(1) : t).substr(t.length - 1) ? t.substr(0, t.length - 1) : t).split(" "), r = (A.__private__.encodeColorString(i.color), e), a = Y.internal.getHeight(i) || 0; a = a < 0 ? -a : a; var s = Y.internal.getWidth(i) || 0; s = s < 0 ? -s : s; var l = function (t, e, n) { if (t + 1 < o.length) { var r = e + " " + o[t + 1]; return F(r, i, n).width <= s - 4 } return !1 }; r++; t: for (; ;) { t = ""; var h = F("3", i, --r).height, u = i.multiline ? a - r : (a - h) / 2, c = -2, f = u += 2, p = 0, d = 0, g = 0; if (r <= 0) { t = "(...) Tj\n", t += "% Width of Text: " + F(t, i, r = 12).width + ", FieldWidth:" + s + "\n"; break } g = F(o[0] + " ", i, r).width; var m = "", y = 0; for (var v in o) if (o.hasOwnProperty(v)) { m = " " == (m += o[v] + " ").substr(m.length - 1) ? m.substr(0, m.length - 1) : m; var w = parseInt(v); g = F(m + " ", i, r).width; var b = l(w, m, r), x = v >= o.length - 1; if (b && !x) { m += " "; continue } if (b || x) { if (x) d = w; else if (i.multiline && a < (h + 2) * (y + 2) + 2) continue t } else { if (!i.multiline) continue t; if (a < (h + 2) * (y + 2) + 2) continue t; d = w } for (var N = "", L = p; L <= d; L++)N += o[L] + " "; switch (N = " " == N.substr(N.length - 1) ? N.substr(0, N.length - 1) : N, g = F(N, i, r).width, i.textAlign) { case "right": c = s - g - 2; break; case "center": c = (s - g) / 2; break; case "left": default: c = 2 }t += _(c) + " " + _(f) + " Td\n", t += "(" + S(N) + ") Tj\n", t += -_(c) + " 0 Td\n", f = -(r + 2), g = 0, p = d + 1, y++ , m = "" } else; break } return n.text = t, n.fontSize = r, n }, F = function (t, e, n) { var r = A.internal.getFont(e.fontName, e.fontStyle), i = A.getStringUnitWidth(t, { font: r, fontSize: parseFloat(n), charSpace: 0 }) * parseFloat(n); return { height: A.getStringUnitWidth("3", { font: r, fontSize: parseFloat(n), charSpace: 0 }) * parseFloat(n) * 1.5, width: i } }, u = { fields: [], xForms: [], acroFormDictionaryRoot: null, printedOut: !1, internal: null, isInitialized: !1 }, p = function () { A.internal.acroformPlugin.acroFormDictionaryRoot.objId = void 0; var t = A.internal.acroformPlugin.acroFormDictionaryRoot.Fields; for (var e in t) if (t.hasOwnProperty(e)) { var n = t[e]; n.objId = void 0, n.hasAnnotation && d.call(A, n) } }, d = function (t) { var e = { type: "reference", object: t }; void 0 === A.internal.getPageInfo(t.page).pageContext.annotations.find(function (t) { return t.type === e.type && t.object === e.object }) && A.internal.getPageInfo(t.page).pageContext.annotations.push(e) }, g = function () { if (void 0 === A.internal.acroformPlugin.acroFormDictionaryRoot) throw new Error("putCatalogCallback: Root missing."); A.internal.write("/AcroForm " + A.internal.acroformPlugin.acroFormDictionaryRoot.objId + " 0 R") }, m = function () { A.internal.events.unsubscribe(A.internal.acroformPlugin.acroFormDictionaryRoot._eventID), delete A.internal.acroformPlugin.acroFormDictionaryRoot._eventID, A.internal.acroformPlugin.printedOut = !0 }, L = function (t) { var e = !t; t || (A.internal.newObjectDeferredBegin(A.internal.acroformPlugin.acroFormDictionaryRoot.objId, !0), A.internal.acroformPlugin.acroFormDictionaryRoot.putStream()); t = t || A.internal.acroformPlugin.acroFormDictionaryRoot.Kids; for (var n in t) if (t.hasOwnProperty(n)) { var r = t[n], i = [], o = r.Rect; if (r.Rect && (r.Rect = c.call(this, r.Rect)), A.internal.newObjectDeferredBegin(r.objId, !0), r.DA = Y.createDefaultAppearanceStream(r), "object" === se(r) && "function" == typeof r.getKeyValueListForStream && (i = r.getKeyValueListForStream()), r.Rect = o, r.hasAppearanceStream && !r.appearanceStreamContent) { var a = f.call(this, r); i.push({ key: "AP", value: "<</N " + a + ">>" }), A.internal.acroformPlugin.xForms.push(a) } if (r.appearanceStreamContent) { var s = ""; for (var l in r.appearanceStreamContent) if (r.appearanceStreamContent.hasOwnProperty(l)) { var h = r.appearanceStreamContent[l]; if (s += "/" + l + " ", s += "<<", 1 <= Object.keys(h).length || Array.isArray(h)) for (var n in h) { var u; if (h.hasOwnProperty(n)) "function" == typeof (u = h[n]) && (u = u.call(this, r)), s += "/" + n + " " + u + " ", 0 <= A.internal.acroformPlugin.xForms.indexOf(u) || A.internal.acroformPlugin.xForms.push(u) } else "function" == typeof (u = h) && (u = u.call(this, r)), s += "/" + n + " " + u, 0 <= A.internal.acroformPlugin.xForms.indexOf(u) || A.internal.acroformPlugin.xForms.push(u); s += ">>" } i.push({ key: "AP", value: "<<\n" + s + ">>" }) } A.internal.putStream({ additionalKeyValues: i }), A.internal.out("endobj") } e && P.call(this, A.internal.acroformPlugin.xForms) }, P = function (t) { for (var e in t) if (t.hasOwnProperty(e)) { var n = e, r = t[e]; A.internal.newObjectDeferredBegin(r && r.objId, !0), "object" === se(r) && "function" == typeof r.putStream && r.putStream(), delete t[n] } }, k = function () { if (void 0 !== this.internal && (void 0 === this.internal.acroformPlugin || !1 === this.internal.acroformPlugin.isInitialized)) { if (A = this, M.FieldNum = 0, this.internal.acroformPlugin = JSON.parse(JSON.stringify(u)), this.internal.acroformPlugin.acroFormDictionaryRoot) throw new Error("Exception while creating AcroformDictionary"); n = A.internal.scaleFactor, A.internal.acroformPlugin.acroFormDictionaryRoot = new E, A.internal.acroformPlugin.acroFormDictionaryRoot._eventID = A.internal.events.subscribe("postPutResources", m), A.internal.events.subscribe("buildDocument", p), A.internal.events.subscribe("putCatalog", g), A.internal.events.subscribe("postPutPages", L), A.internal.acroformPlugin.isInitialized = !0 } }, I = t.__acroform__.arrayToPdfArray = function (t) { if (Array.isArray(t)) { for (var e = "[", n = 0; n < t.length; n++)switch (0 !== n && (e += " "), se(t[n])) { case "boolean": case "number": case "object": e += t[n].toString(); break; case "string": "/" !== t[n].substr(0, 1) ? e += "(" + S(t[n].toString()) + ")" : e += t[n].toString() }return e += "]" } throw new Error("Invalid argument passed to jsPDF.__acroform__.arrayToPdfArray") }; var C = function (t) { return (t = t || "").toString(), t = "(" + S(t) + ")" }, B = function () { var e; Object.defineProperty(this, "objId", { configurable: !0, get: function () { if (e || (e = A.internal.newObjectDeferred()), !e) throw new Error("AcroFormPDFObject: Couldn't create Object ID"); return e }, set: function (t) { e = t } }) }; B.prototype.toString = function () { return this.objId + " 0 R" }, B.prototype.putStream = function () { var t = this.getKeyValueListForStream(); A.internal.putStream({ data: this.stream, additionalKeyValues: t }), A.internal.out("endobj") }, B.prototype.getKeyValueListForStream = function () { return function (t) { var e = [], n = Object.getOwnPropertyNames(t).filter(function (t) { return "content" != t && "appearanceStreamContent" != t && "_" != t.substring(0, 1) }); for (var r in n) if (!1 === Object.getOwnPropertyDescriptor(t, n[r]).configurable) { var i = n[r], o = t[i]; o && (Array.isArray(o) ? e.push({ key: i, value: I(o) }) : o instanceof B ? e.push({ key: i, value: o.objId + " 0 R" }) : "function" != typeof o && e.push({ key: i, value: o })) } return e }(this) }; var j = function () { B.call(this), Object.defineProperty(this, "Type", { value: "/XObject", configurable: !1, writeable: !0 }), Object.defineProperty(this, "Subtype", { value: "/Form", configurable: !1, writeable: !0 }), Object.defineProperty(this, "FormType", { value: 1, configurable: !1, writeable: !0 }); var e, n = []; Object.defineProperty(this, "BBox", { configurable: !1, writeable: !0, get: function () { return n }, set: function (t) { n = t } }), Object.defineProperty(this, "Resources", { value: "2 0 R", configurable: !1, writeable: !0 }), Object.defineProperty(this, "stream", { enumerable: !1, configurable: !0, set: function (t) { e = t.trim() }, get: function () { return e || null } }) }; r(j, B); var E = function () { B.call(this); var e, t = []; Object.defineProperty(this, "Kids", { enumerable: !1, configurable: !0, get: function () { return 0 < t.length ? t : void 0 } }), Object.defineProperty(this, "Fields", { enumerable: !1, configurable: !1, get: function () { return t } }), Object.defineProperty(this, "DA", { enumerable: !1, configurable: !1, get: function () { if (e) return "(" + e + ")" }, set: function (t) { e = t } }) }; r(E, B); var M = function t() { B.call(this); var e = 4; Object.defineProperty(this, "F", { enumerable: !1, configurable: !1, get: function () { return e }, set: function (t) { if (isNaN(t)) throw new Error('Invalid value "' + t + '" for attribute F supplied.'); e = t } }), Object.defineProperty(this, "showWhenPrinted", { enumerable: !0, configurable: !0, get: function () { return Boolean(b(e, 3)) }, set: function (t) { !0 === Boolean(t) ? this.F = x(e, 3) : this.F = N(e, 3) } }); var n = 0; Object.defineProperty(this, "Ff", { enumerable: !1, configurable: !1, get: function () { return n }, set: function (t) { if (isNaN(t)) throw new Error('Invalid value "' + t + '" for attribute Ff supplied.'); n = t } }); var r = []; Object.defineProperty(this, "Rect", { enumerable: !1, configurable: !1, get: function () { if (0 !== r.length) return r }, set: function (t) { r = void 0 !== t ? t : [] } }), Object.defineProperty(this, "x", { enumerable: !0, configurable: !0, get: function () { return !r || isNaN(r[0]) ? 0 : w(r[0]) }, set: function (t) { r[0] = v(t) } }), Object.defineProperty(this, "y", { enumerable: !0, configurable: !0, get: function () { return !r || isNaN(r[1]) ? 0 : w(r[1]) }, set: function (t) { r[1] = v(t) } }), Object.defineProperty(this, "width", { enumerable: !0, configurable: !0, get: function () { return !r || isNaN(r[2]) ? 0 : w(r[2]) }, set: function (t) { r[2] = v(t) } }), Object.defineProperty(this, "height", { enumerable: !0, configurable: !0, get: function () { return !r || isNaN(r[3]) ? 0 : w(r[3]) }, set: function (t) { r[3] = v(t) } }); var i = ""; Object.defineProperty(this, "FT", { enumerable: !0, configurable: !1, get: function () { return i }, set: function (t) { switch (t) { case "/Btn": case "/Tx": case "/Ch": case "/Sig": i = t; break; default: throw new Error('Invalid value "' + t + '" for attribute FT supplied.') } } }); var o = null; Object.defineProperty(this, "T", { enumerable: !0, configurable: !1, get: function () { if (!o || o.length < 1) { if (this instanceof H) return; o = "FieldObject" + t.FieldNum++ } return "(" + S(o) + ")" }, set: function (t) { o = t.toString() } }), Object.defineProperty(this, "fieldName", { configurable: !0, enumerable: !0, get: function () { return o }, set: function (t) { o = t } }); var a = "helvetica"; Object.defineProperty(this, "fontName", { enumerable: !0, configurable: !0, get: function () { return a }, set: function (t) { a = t } }); var s = "normal"; Object.defineProperty(this, "fontStyle", { enumerable: !0, configurable: !0, get: function () { return s }, set: function (t) { s = t } }); var l = 0; Object.defineProperty(this, "fontSize", { enumerable: !0, configurable: !0, get: function () { return w(l) }, set: function (t) { l = v(t) } }); var h = 50; Object.defineProperty(this, "maxFontSize", { enumerable: !0, configurable: !0, get: function () { return w(h) }, set: function (t) { h = v(t) } }); var u = "black"; Object.defineProperty(this, "color", { enumerable: !0, configurable: !0, get: function () { return u }, set: function (t) { u = t } }); var c = "/F1 0 Tf 0 g"; Object.defineProperty(this, "DA", { enumerable: !0, configurable: !1, get: function () { if (!(!c || this instanceof H || this instanceof V)) return C(c) }, set: function (t) { t = t.toString(), c = t } }); var f = null; Object.defineProperty(this, "DV", { enumerable: !1, configurable: !1, get: function () { if (f) return this instanceof D == !1 ? C(f) : f }, set: function (t) { t = t.toString(), f = this instanceof D == !1 ? "(" === t.substr(0, 1) ? y(t.substr(1, t.length - 2)) : y(t) : t } }), Object.defineProperty(this, "defaultValue", { enumerable: !0, configurable: !0, get: function () { return this instanceof D == !0 ? y(f.substr(1, f.length - 1)) : f }, set: function (t) { t = t.toString(), f = this instanceof D == !0 ? "/" + t : t } }); var p = null; Object.defineProperty(this, "V", { enumerable: !1, configurable: !1, get: function () { if (p) return this instanceof D == !1 ? C(p) : p }, set: function (t) { t = t.toString(), p = this instanceof D == !1 ? "(" === t.substr(0, 1) ? y(t.substr(1, t.length - 2)) : y(t) : t } }), Object.defineProperty(this, "value", { enumerable: !0, configurable: !0, get: function () { return this instanceof D == !0 ? y(p.substr(1, p.length - 1)) : p }, set: function (t) { t = t.toString(), p = this instanceof D == !0 ? "/" + t : t } }), Object.defineProperty(this, "hasAnnotation", { enumerable: !0, configurable: !0, get: function () { return this.Rect } }), Object.defineProperty(this, "Type", { enumerable: !0, configurable: !1, get: function () { return this.hasAnnotation ? "/Annot" : null } }), Object.defineProperty(this, "Subtype", { enumerable: !0, configurable: !1, get: function () { return this.hasAnnotation ? "/Widget" : null } }); var d, g = !1; Object.defineProperty(this, "hasAppearanceStream", { enumerable: !0, configurable: !0, writeable: !0, get: function () { return g }, set: function (t) { t = Boolean(t), g = t } }), Object.defineProperty(this, "page", { enumerable: !0, configurable: !0, writeable: !0, get: function () { if (d) return d }, set: function (t) { d = t } }), Object.defineProperty(this, "readOnly", { enumerable: !0, configurable: !0, get: function () { return Boolean(b(this.Ff, 1)) }, set: function (t) { !0 === Boolean(t) ? this.Ff = x(this.Ff, 1) : this.Ff = N(this.Ff, 1) } }), Object.defineProperty(this, "required", { enumerable: !0, configurable: !0, get: function () { return Boolean(b(this.Ff, 2)) }, set: function (t) { !0 === Boolean(t) ? this.Ff = x(this.Ff, 2) : this.Ff = N(this.Ff, 2) } }), Object.defineProperty(this, "noExport", { enumerable: !0, configurable: !0, get: function () { return Boolean(b(this.Ff, 3)) }, set: function (t) { !0 === Boolean(t) ? this.Ff = x(this.Ff, 3) : this.Ff = N(this.Ff, 3) } }); var m = null; Object.defineProperty(this, "Q", { enumerable: !0, configurable: !1, get: function () { if (null !== m) return m }, set: function (t) { if (-1 === [0, 1, 2].indexOf(t)) throw new Error('Invalid value "' + t + '" for attribute Q supplied.'); m = t } }), Object.defineProperty(this, "textAlign", { get: function () { var t = "left"; switch (m) { case 0: default: t = "left"; break; case 1: t = "center"; break; case 2: t = "right" }return t }, configurable: !0, enumerable: !0, set: function (t) { switch (t) { case "right": case 2: m = 2; break; case "center": case 1: m = 1; break; case "left": case 0: default: m = 0 } } }) }; r(M, B); var O = function () { M.call(this), this.FT = "/Ch", this.V = "()", this.fontName = "zapfdingbats"; var e = 0; Object.defineProperty(this, "TI", { enumerable: !0, configurable: !1, get: function () { return e }, set: function (t) { e = t } }), Object.defineProperty(this, "topIndex", { enumerable: !0, configurable: !0, get: function () { return e }, set: function (t) { e = t } }); var r = []; Object.defineProperty(this, "Opt", { enumerable: !0, configurable: !1, get: function () { return I(r) }, set: function (t) { var e, n; n = [], "string" == typeof (e = t) && (n = function (t, e, n) { n || (n = 1); for (var r, i = []; r = e.exec(t);)i.push(r[n]); return i }(e, /\((.*?)\)/g)), r = n } }), this.getOptions = function () { return r }, this.setOptions = function (t) { r = t, this.sort && r.sort() }, this.addOption = function (t) { t = (t = t || "").toString(), r.push(t), this.sort && r.sort() }, this.removeOption = function (t, e) { for (e = e || !1, t = (t = t || "").toString(); -1 !== r.indexOf(t) && (r.splice(r.indexOf(t), 1), !1 !== e);); }, Object.defineProperty(this, "combo", { enumerable: !0, configurable: !0, get: function () { return Boolean(b(this.Ff, 18)) }, set: function (t) { !0 === Boolean(t) ? this.Ff = x(this.Ff, 18) : this.Ff = N(this.Ff, 18) } }), Object.defineProperty(this, "edit", { enumerable: !0, configurable: !0, get: function () { return Boolean(b(this.Ff, 19)) }, set: function (t) { !0 === this.combo && (!0 === Boolean(t) ? this.Ff = x(this.Ff, 19) : this.Ff = N(this.Ff, 19)) } }), Object.defineProperty(this, "sort", { enumerable: !0, configurable: !0, get: function () { return Boolean(b(this.Ff, 20)) }, set: function (t) { !0 === Boolean(t) ? (this.Ff = x(this.Ff, 20), r.sort()) : this.Ff = N(this.Ff, 20) } }), Object.defineProperty(this, "multiSelect", { enumerable: !0, configurable: !0, get: function () { return Boolean(b(this.Ff, 22)) }, set: function (t) { !0 === Boolean(t) ? this.Ff = x(this.Ff, 22) : this.Ff = N(this.Ff, 22) } }), Object.defineProperty(this, "doNotSpellCheck", { enumerable: !0, configurable: !0, get: function () { return Boolean(b(this.Ff, 23)) }, set: function (t) { !0 === Boolean(t) ? this.Ff = x(this.Ff, 23) : this.Ff = N(this.Ff, 23) } }), Object.defineProperty(this, "commitOnSelChange", { enumerable: !0, configurable: !0, get: function () { return Boolean(b(this.Ff, 27)) }, set: function (t) { !0 === Boolean(t) ? this.Ff = x(this.Ff, 27) : this.Ff = N(this.Ff, 27) } }), this.hasAppearanceStream = !1 }; r(O, M); var q = function () { O.call(this), this.fontName = "helvetica", this.combo = !1 }; r(q, O); var T = function () { q.call(this), this.combo = !0 }; r(T, q); var R = function () { T.call(this), this.edit = !0 }; r(R, T); var D = function () { M.call(this), this.FT = "/Btn", Object.defineProperty(this, "noToggleToOff", { enumerable: !0, configurable: !0, get: function () { return Boolean(b(this.Ff, 15)) }, set: function (t) { !0 === Boolean(t) ? this.Ff = x(this.Ff, 15) : this.Ff = N(this.Ff, 15) } }), Object.defineProperty(this, "radio", { enumerable: !0, configurable: !0, get: function () { return Boolean(b(this.Ff, 16)) }, set: function (t) { !0 === Boolean(t) ? this.Ff = x(this.Ff, 16) : this.Ff = N(this.Ff, 16) } }), Object.defineProperty(this, "pushButton", { enumerable: !0, configurable: !0, get: function () { return Boolean(b(this.Ff, 17)) }, set: function (t) { !0 === Boolean(t) ? this.Ff = x(this.Ff, 17) : this.Ff = N(this.Ff, 17) } }), Object.defineProperty(this, "radioIsUnison", { enumerable: !0, configurable: !0, get: function () { return Boolean(b(this.Ff, 26)) }, set: function (t) { !0 === Boolean(t) ? this.Ff = x(this.Ff, 26) : this.Ff = N(this.Ff, 26) } }); var e, n = {}; Object.defineProperty(this, "MK", { enumerable: !1, configurable: !1, get: function () { if (0 !== Object.keys(n).length) { var t, e = []; for (t in e.push("<<"), n) e.push("/" + t + " (" + n[t] + ")"); return e.push(">>"), e.join("\n") } }, set: function (t) { "object" === se(t) && (n = t) } }), Object.defineProperty(this, "caption", { enumerable: !0, configurable: !0, get: function () { return n.CA || "" }, set: function (t) { "string" == typeof t && (n.CA = t) } }), Object.defineProperty(this, "AS", { enumerable: !1, configurable: !1, get: function () { return e }, set: function (t) { e = t } }), Object.defineProperty(this, "appearanceState", { enumerable: !0, configurable: !0, get: function () { return e.substr(1, e.length - 1) }, set: function (t) { e = "/" + t } }) }; r(D, M); var U = function () { D.call(this), this.pushButton = !0 }; r(U, D); var z = function () { D.call(this), this.radio = !0, this.pushButton = !1; var e = []; Object.defineProperty(this, "Kids", { enumerable: !0, configurable: !1, get: function () { return e }, set: function (t) { e = void 0 !== t ? t : [] } }) }; r(z, D); var H = function () { var e, n; M.call(this), Object.defineProperty(this, "Parent", { enumerable: !1, configurable: !1, get: function () { return e }, set: function (t) { e = t } }), Object.defineProperty(this, "optionName", { enumerable: !1, configurable: !0, get: function () { return n }, set: function (t) { n = t } }); var r, i = {}; Object.defineProperty(this, "MK", { enumerable: !1, configurable: !1, get: function () { var t, e = []; for (t in e.push("<<"), i) e.push("/" + t + " (" + i[t] + ")"); return e.push(">>"), e.join("\n") }, set: function (t) { "object" === se(t) && (i = t) } }), Object.defineProperty(this, "caption", { enumerable: !0, configurable: !0, get: function () { return i.CA || "" }, set: function (t) { "string" == typeof t && (i.CA = t) } }), Object.defineProperty(this, "AS", { enumerable: !1, configurable: !1, get: function () { return r }, set: function (t) { r = t } }), Object.defineProperty(this, "appearanceState", { enumerable: !0, configurable: !0, get: function () { return r.substr(1, r.length - 1) }, set: function (t) { r = "/" + t } }), this.optionName = name, this.caption = "l", this.appearanceState = "Off", this._AppearanceType = Y.RadioButton.Circle, this.appearanceStreamContent = this._AppearanceType.createAppearanceStream(name) }; r(H, M), z.prototype.setAppearance = function (t) { if (!("createAppearanceStream" in t && "getCA" in t)) throw new Error("Couldn't assign Appearance to RadioButton. Appearance was Invalid!"); for (var e in this.Kids) if (this.Kids.hasOwnProperty(e)) { var n = this.Kids[e]; n.appearanceStreamContent = t.createAppearanceStream(n.optionName), n.caption = t.getCA() } }, z.prototype.createOption = function (t) { this.Kids.length; var e = new H; return e.Parent = this, e.optionName = t, this.Kids.push(e), J.call(this, e), e }; var W = function () { D.call(this), this.fontName = "zapfdingbats", this.caption = "3", this.appearanceState = "On", this.value = "On", this.textAlign = "center", this.appearanceStreamContent = Y.CheckBox.createAppearanceStream() }; r(W, D); var V = function () { M.call(this), this.FT = "/Tx", Object.defineProperty(this, "multiline", { enumerable: !0, configurable: !0, get: function () { return Boolean(b(this.Ff, 13)) }, set: function (t) { !0 === Boolean(t) ? this.Ff = x(this.Ff, 13) : this.Ff = N(this.Ff, 13) } }), Object.defineProperty(this, "fileSelect", { enumerable: !0, configurable: !0, get: function () { return Boolean(b(this.Ff, 21)) }, set: function (t) { !0 === Boolean(t) ? this.Ff = x(this.Ff, 21) : this.Ff = N(this.Ff, 21) } }), Object.defineProperty(this, "doNotSpellCheck", { enumerable: !0, configurable: !0, get: function () { return Boolean(b(this.Ff, 23)) }, set: function (t) { !0 === Boolean(t) ? this.Ff = x(this.Ff, 23) : this.Ff = N(this.Ff, 23) } }), Object.defineProperty(this, "doNotScroll", { enumerable: !0, configurable: !0, get: function () { return Boolean(b(this.Ff, 24)) }, set: function (t) { !0 === Boolean(t) ? this.Ff = x(this.Ff, 24) : this.Ff = N(this.Ff, 24) } }), Object.defineProperty(this, "comb", { enumerable: !0, configurable: !0, get: function () { return Boolean(b(this.Ff, 25)) }, set: function (t) { !0 === Boolean(t) ? this.Ff = x(this.Ff, 25) : this.Ff = N(this.Ff, 25) } }), Object.defineProperty(this, "richText", { enumerable: !0, configurable: !0, get: function () { return Boolean(b(this.Ff, 26)) }, set: function (t) { !0 === Boolean(t) ? this.Ff = x(this.Ff, 26) : this.Ff = N(this.Ff, 26) } }); var e = null; Object.defineProperty(this, "MaxLen", { enumerable: !0, configurable: !1, get: function () { return e }, set: function (t) { e = t } }), Object.defineProperty(this, "maxLength", { enumerable: !0, configurable: !0, get: function () { return e }, set: function (t) { Number.isInteger(t) && (e = t) } }), Object.defineProperty(this, "hasAppearanceStream", { enumerable: !0, configurable: !0, get: function () { return this.V || this.DV } }) }; r(V, M); var G = function () { V.call(this), Object.defineProperty(this, "password", { enumerable: !0, configurable: !0, get: function () { return Boolean(b(this.Ff, 14)) }, set: function (t) { !0 === Boolean(t) ? this.Ff = x(this.Ff, 14) : this.Ff = N(this.Ff, 14) } }), this.password = !0 }; r(G, V); var Y = { CheckBox: { createAppearanceStream: function () { return { N: { On: Y.CheckBox.YesNormal }, D: { On: Y.CheckBox.YesPushDown, Off: Y.CheckBox.OffPushDown } } }, YesPushDown: function (t) { var e = l(t), n = [], r = A.internal.getFont(t.fontName, t.fontStyle).id, i = A.__private__.encodeColorString(t.color), o = h(t, t.caption); return n.push("0.749023 g"), n.push("0 0 " + _(Y.internal.getWidth(t)) + " " + _(Y.internal.getHeight(t)) + " re"), n.push("f"), n.push("BMC"), n.push("q"), n.push("0 0 1 rg"), n.push("/" + r + " " + _(o.fontSize) + " Tf " + i), n.push("BT"), n.push(o.text), n.push("ET"), n.push("Q"), n.push("EMC"), e.stream = n.join("\n"), e }, YesNormal: function (t) { var e = l(t), n = A.internal.getFont(t.fontName, t.fontStyle).id, r = A.__private__.encodeColorString(t.color), i = [], o = Y.internal.getHeight(t), a = Y.internal.getWidth(t), s = h(t, t.caption); return i.push("1 g"), i.push("0 0 " + _(a) + " " + _(o) + " re"), i.push("f"), i.push("q"), i.push("0 0 1 rg"), i.push("0 0 " + _(a - 1) + " " + _(o - 1) + " re"), i.push("W"), i.push("n"), i.push("0 g"), i.push("BT"), i.push("/" + n + " " + _(s.fontSize) + " Tf " + r), i.push(s.text), i.push("ET"), i.push("Q"), e.stream = i.join("\n"), e }, OffPushDown: function (t) { var e = l(t), n = []; return n.push("0.749023 g"), n.push("0 0 " + _(Y.internal.getWidth(t)) + " " + _(Y.internal.getHeight(t)) + " re"), n.push("f"), e.stream = n.join("\n"), e } }, RadioButton: { Circle: { createAppearanceStream: function (t) { var e = { D: { Off: Y.RadioButton.Circle.OffPushDown }, N: {} }; return e.N[t] = Y.RadioButton.Circle.YesNormal, e.D[t] = Y.RadioButton.Circle.YesPushDown, e }, getCA: function () { return "l" }, YesNormal: function (t) { var e = l(t), n = [], r = Y.internal.getWidth(t) <= Y.internal.getHeight(t) ? Y.internal.getWidth(t) / 4 : Y.internal.getHeight(t) / 4; r = Number((.9 * r).toFixed(5)); var i = Y.internal.Bezier_C, o = Number((r * i).toFixed(5)); return n.push("q"), n.push("1 0 0 1 " + s(Y.internal.getWidth(t) / 2) + " " + s(Y.internal.getHeight(t) / 2) + " cm"), n.push(r + " 0 m"), n.push(r + " " + o + " " + o + " " + r + " 0 " + r + " c"), n.push("-" + o + " " + r + " -" + r + " " + o + " -" + r + " 0 c"), n.push("-" + r + " -" + o + " -" + o + " -" + r + " 0 -" + r + " c"), n.push(o + " -" + r + " " + r + " -" + o + " " + r + " 0 c"), n.push("f"), n.push("Q"), e.stream = n.join("\n"), e }, YesPushDown: function (t) { var e = l(t), n = [], r = Y.internal.getWidth(t) <= Y.internal.getHeight(t) ? Y.internal.getWidth(t) / 4 : Y.internal.getHeight(t) / 4, i = (r = Number((.9 * r).toFixed(5)), Number((2 * r).toFixed(5))), o = Number((i * Y.internal.Bezier_C).toFixed(5)), a = Number((r * Y.internal.Bezier_C).toFixed(5)); return n.push("0.749023 g"), n.push("q"), n.push("1 0 0 1 " + s(Y.internal.getWidth(t) / 2) + " " + s(Y.internal.getHeight(t) / 2) + " cm"), n.push(i + " 0 m"), n.push(i + " " + o + " " + o + " " + i + " 0 " + i + " c"), n.push("-" + o + " " + i + " -" + i + " " + o + " -" + i + " 0 c"), n.push("-" + i + " -" + o + " -" + o + " -" + i + " 0 -" + i + " c"), n.push(o + " -" + i + " " + i + " -" + o + " " + i + " 0 c"), n.push("f"), n.push("Q"), n.push("0 g"), n.push("q"), n.push("1 0 0 1 " + s(Y.internal.getWidth(t) / 2) + " " + s(Y.internal.getHeight(t) / 2) + " cm"), n.push(r + " 0 m"), n.push(r + " " + a + " " + a + " " + r + " 0 " + r + " c"), n.push("-" + a + " " + r + " -" + r + " " + a + " -" + r + " 0 c"), n.push("-" + r + " -" + a + " -" + a + " -" + r + " 0 -" + r + " c"), n.push(a + " -" + r + " " + r + " -" + a + " " + r + " 0 c"), n.push("f"), n.push("Q"), e.stream = n.join("\n"), e }, OffPushDown: function (t) { var e = l(t), n = [], r = Y.internal.getWidth(t) <= Y.internal.getHeight(t) ? Y.internal.getWidth(t) / 4 : Y.internal.getHeight(t) / 4, i = (r = Number((.9 * r).toFixed(5)), Number((2 * r).toFixed(5))), o = Number((i * Y.internal.Bezier_C).toFixed(5)); return n.push("0.749023 g"), n.push("q"), n.push("1 0 0 1 " + s(Y.internal.getWidth(t) / 2) + " " + s(Y.internal.getHeight(t) / 2) + " cm"), n.push(i + " 0 m"), n.push(i + " " + o + " " + o + " " + i + " 0 " + i + " c"), n.push("-" + o + " " + i + " -" + i + " " + o + " -" + i + " 0 c"), n.push("-" + i + " -" + o + " -" + o + " -" + i + " 0 -" + i + " c"), n.push(o + " -" + i + " " + i + " -" + o + " " + i + " 0 c"), n.push("f"), n.push("Q"), e.stream = n.join("\n"), e } }, Cross: { createAppearanceStream: function (t) { var e = { D: { Off: Y.RadioButton.Cross.OffPushDown }, N: {} }; return e.N[t] = Y.RadioButton.Cross.YesNormal, e.D[t] = Y.RadioButton.Cross.YesPushDown, e }, getCA: function () { return "8" }, YesNormal: function (t) { var e = l(t), n = [], r = Y.internal.calculateCross(t); return n.push("q"), n.push("1 1 " + _(Y.internal.getWidth(t) - 2) + " " + _(Y.internal.getHeight(t) - 2) + " re"), n.push("W"), n.push("n"), n.push(_(r.x1.x) + " " + _(r.x1.y) + " m"), n.push(_(r.x2.x) + " " + _(r.x2.y) + " l"), n.push(_(r.x4.x) + " " + _(r.x4.y) + " m"), n.push(_(r.x3.x) + " " + _(r.x3.y) + " l"), n.push("s"), n.push("Q"), e.stream = n.join("\n"), e }, YesPushDown: function (t) { var e = l(t), n = Y.internal.calculateCross(t), r = []; return r.push("0.749023 g"), r.push("0 0 " + _(Y.internal.getWidth(t)) + " " + _(Y.internal.getHeight(t)) + " re"), r.push("f"), r.push("q"), r.push("1 1 " + _(Y.internal.getWidth(t) - 2) + " " + _(Y.internal.getHeight(t) - 2) + " re"), r.push("W"), r.push("n"), r.push(_(n.x1.x) + " " + _(n.x1.y) + " m"), r.push(_(n.x2.x) + " " + _(n.x2.y) + " l"), r.push(_(n.x4.x) + " " + _(n.x4.y) + " m"), r.push(_(n.x3.x) + " " + _(n.x3.y) + " l"), r.push("s"), r.push("Q"), e.stream = r.join("\n"), e }, OffPushDown: function (t) { var e = l(t), n = []; return n.push("0.749023 g"), n.push("0 0 " + _(Y.internal.getWidth(t)) + " " + _(Y.internal.getHeight(t)) + " re"), n.push("f"), e.stream = n.join("\n"), e } } }, createDefaultAppearanceStream: function (t) { var e = A.internal.getFont(t.fontName, t.fontStyle).id, n = A.__private__.encodeColorString(t.color); return "/" + e + " " + t.fontSize + " Tf " + n } }; Y.internal = { Bezier_C: .551915024494, calculateCross: function (t) { var e = Y.internal.getWidth(t), n = Y.internal.getHeight(t), r = Math.min(e, n); return { x1: { x: (e - r) / 2, y: (n - r) / 2 + r }, x2: { x: (e - r) / 2 + r, y: (n - r) / 2 }, x3: { x: (e - r) / 2, y: (n - r) / 2 }, x4: { x: (e - r) / 2 + r, y: (n - r) / 2 + r } } } }, Y.internal.getWidth = function (t) { var e = 0; return "object" === se(t) && (e = v(t.Rect[2])), e }, Y.internal.getHeight = function (t) { var e = 0; return "object" === se(t) && (e = v(t.Rect[3])), e }; var J = t.addField = function (t) { if (k.call(this), !(t instanceof M)) throw new Error("Invalid argument passed to jsPDF.addField."); return function (t) { A.internal.acroformPlugin.printedOut && (A.internal.acroformPlugin.printedOut = !1, A.internal.acroformPlugin.acroFormDictionaryRoot = null), A.internal.acroformPlugin.acroFormDictionaryRoot || k.call(A), A.internal.acroformPlugin.acroFormDictionaryRoot.Fields.push(t) }.call(this, t), t.page = A.internal.getCurrentPageInfo().pageNumber, this }; t.addButton = function (t) { if (t instanceof D == !1) throw new Error("Invalid argument passed to jsPDF.addButton."); return J.call(this, t) }, t.addTextField = function (t) { if (t instanceof V == !1) throw new Error("Invalid argument passed to jsPDF.addTextField."); return J.call(this, t) }, t.addChoiceField = function (t) { if (t instanceof O == !1) throw new Error("Invalid argument passed to jsPDF.addChoiceField."); return J.call(this, t) }; "object" == se(e) && void 0 === e.ChoiceField && void 0 === e.ListBox && void 0 === e.ComboBox && void 0 === e.EditBox && void 0 === e.Button && void 0 === e.PushButton && void 0 === e.RadioButton && void 0 === e.CheckBox && void 0 === e.TextField && void 0 === e.PasswordField ? (e.ChoiceField = O, e.ListBox = q, e.ComboBox = T, e.EditBox = R, e.Button = D, e.PushButton = U, e.RadioButton = z, e.CheckBox = W, e.TextField = V, e.PasswordField = G, e.AcroForm = { Appearance: Y }) : console.warn("AcroForm-Classes are not populated into global-namespace, because the class-Names exist already."), t.AcroFormChoiceField = O, t.AcroFormListBox = q, t.AcroFormComboBox = T, t.AcroFormEditBox = R, t.AcroFormButton = D, t.AcroFormPushButton = U, t.AcroFormRadioButton = z, t.AcroFormCheckBox = W, t.AcroFormTextField = V, t.AcroFormPasswordField = G, t.AcroFormAppearance = Y, t.AcroForm = { ChoiceField: O, ListBox: q, ComboBox: T, EditBox: R, Button: D, PushButton: U, RadioButton: z, CheckBox: W, TextField: V, PasswordField: G, Appearance: Y } })((window.tmp = lt).API, "undefined" != typeof window && window || "undefined" != typeof global && global),
        /** @license
           * jsPDF addImage plugin
           * Copyright (c) 2012 Jason Siefken, https://github.com/siefkenj/
           *               2013 Chris Dowling, https://github.com/gingerchris
           *               2013 Trinh Ho, https://github.com/ineedfat
           *               2013 Edwin Alejandro Perez, https://github.com/eaparango
           *               2013 Norah Smith, https://github.com/burnburnrocket
           *               2014 Diego Casorran, https://github.com/diegocr
           *               2014 James Robb, https://github.com/jamesbrobb
           *
           * 
           */
        function (x) { var N = "addImage_", l = { PNG: [[137, 80, 78, 71]], TIFF: [[77, 77, 0, 42], [73, 73, 42, 0]], JPEG: [[255, 216, 255, 224, void 0, void 0, 74, 70, 73, 70, 0], [255, 216, 255, 225, void 0, void 0, 69, 120, 105, 102, 0, 0]], JPEG2000: [[0, 0, 0, 12, 106, 80, 32, 32]], GIF87a: [[71, 73, 70, 56, 55, 97]], GIF89a: [[71, 73, 70, 56, 57, 97]], BMP: [[66, 77], [66, 65], [67, 73], [67, 80], [73, 67], [80, 84]] }, h = x.getImageFileTypeByImageData = function (t, e) { var n, r; e = e || "UNKNOWN"; var i, o, a, s = "UNKNOWN"; for (a in x.isArrayBufferView(t) && (t = x.arrayBufferToBinaryString(t)), l) for (i = l[a], n = 0; n < i.length; n += 1) { for (o = !0, r = 0; r < i[n].length; r += 1)if (void 0 !== i[n][r] && i[n][r] !== t.charCodeAt(r)) { o = !1; break } if (!0 === o) { s = a; break } } return "UNKNOWN" === s && "UNKNOWN" !== e && (console.warn('FileType of Image not recognized. Processing image as "' + e + '".'), s = e), s }, n = function t(e) { for (var n = this.internal.newObject(), r = this.internal.write, i = this.internal.putStream, o = (0, this.internal.getFilters)(); -1 !== o.indexOf("FlateEncode");)o.splice(o.indexOf("FlateEncode"), 1); e.n = n; var a = []; if (a.push({ key: "Type", value: "/XObject" }), a.push({ key: "Subtype", value: "/Image" }), a.push({ key: "Width", value: e.w }), a.push({ key: "Height", value: e.h }), e.cs === this.color_spaces.INDEXED ? a.push({ key: "ColorSpace", value: "[/Indexed /DeviceRGB " + (e.pal.length / 3 - 1) + " " + ("smask" in e ? n + 2 : n + 1) + " 0 R]" }) : (a.push({ key: "ColorSpace", value: "/" + e.cs }), e.cs === this.color_spaces.DEVICE_CMYK && a.push({ key: "Decode", value: "[1 0 1 0 1 0 1 0]" })), a.push({ key: "BitsPerComponent", value: e.bpc }), "dp" in e && a.push({ key: "DecodeParms", value: "<<" + e.dp + ">>" }), "trns" in e && e.trns.constructor == Array) { for (var s = "", l = 0, h = e.trns.length; l < h; l++)s += e.trns[l] + " " + e.trns[l] + " "; a.push({ key: "Mask", value: "[" + s + "]" }) } "smask" in e && a.push({ key: "SMask", value: n + 1 + " 0 R" }); var u = void 0 !== e.f ? ["/" + e.f] : void 0; if (i({ data: e.data, additionalKeyValues: a, alreadyAppliedFilters: u }), r("endobj"), "smask" in e) { var c = "/Predictor " + e.p + " /Colors 1 /BitsPerComponent " + e.bpc + " /Columns " + e.w, f = { w: e.w, h: e.h, cs: "DeviceGray", bpc: e.bpc, dp: c, data: e.smask }; "f" in e && (f.f = e.f), t.call(this, f) } e.cs === this.color_spaces.INDEXED && (this.internal.newObject(), i({ data: this.arrayBufferToBinaryString(new Uint8Array(e.pal)) }), r("endobj")) }, L = function () { var t = this.internal.collections[N + "images"]; for (var e in t) n.call(this, t[e]) }, A = function () { var t, e = this.internal.collections[N + "images"], n = this.internal.write; for (var r in e) n("/I" + (t = e[r]).i, t.n, "0", "R") }, S = function (t) { return "function" == typeof x["process" + t.toUpperCase()] }, _ = function (t) { return "object" === se(t) && 1 === t.nodeType }, F = function (t, e) { if ("IMG" === t.nodeName && t.hasAttribute("src")) { var n = "" + t.getAttribute("src"); if (0 === n.indexOf("data:image/")) return unescape(n); var r = x.loadFile(n); if (void 0 !== r) return btoa(r) } if ("CANVAS" === t.nodeName) { var i = t; return t.toDataURL("image/jpeg", 1) } (i = document.createElement("canvas")).width = t.clientWidth || t.width, i.height = t.clientHeight || t.height; var o = i.getContext("2d"); if (!o) throw "addImage requires canvas to be supported by browser."; return o.drawImage(t, 0, 0, i.width, i.height), i.toDataURL("png" == ("" + e).toLowerCase() ? "image/png" : "image/jpeg") }, P = function (t, e) { var n; if (e) for (var r in e) if (t === e[r].alias) { n = e[r]; break } return n }; x.color_spaces = { DEVICE_RGB: "DeviceRGB", DEVICE_GRAY: "DeviceGray", DEVICE_CMYK: "DeviceCMYK", CAL_GREY: "CalGray", CAL_RGB: "CalRGB", LAB: "Lab", ICC_BASED: "ICCBased", INDEXED: "Indexed", PATTERN: "Pattern", SEPARATION: "Separation", DEVICE_N: "DeviceN" }, x.decode = { DCT_DECODE: "DCTDecode", FLATE_DECODE: "FlateDecode", LZW_DECODE: "LZWDecode", JPX_DECODE: "JPXDecode", JBIG2_DECODE: "JBIG2Decode", ASCII85_DECODE: "ASCII85Decode", ASCII_HEX_DECODE: "ASCIIHexDecode", RUN_LENGTH_DECODE: "RunLengthDecode", CCITT_FAX_DECODE: "CCITTFaxDecode" }, x.image_compression = { NONE: "NONE", FAST: "FAST", MEDIUM: "MEDIUM", SLOW: "SLOW" }, x.sHashCode = function (t) { var e, n = 0; if (0 === (t = t || "").length) return n; for (e = 0; e < t.length; e++)n = (n << 5) - n + t.charCodeAt(e), n |= 0; return n }, x.isString = function (t) { return "string" == typeof t }, x.validateStringAsBase64 = function (t) { (t = t || "").toString().trim(); var e = !0; return 0 === t.length && (e = !1), t.length % 4 != 0 && (e = !1), !1 === /^[A-Za-z0-9+\/]+$/.test(t.substr(0, t.length - 2)) && (e = !1), !1 === /^[A-Za-z0-9\/][A-Za-z0-9+\/]|[A-Za-z0-9+\/]=|==$/.test(t.substr(-2)) && (e = !1), e }, x.extractInfoFromBase64DataURI = function (t) { return /^data:([\w]+?\/([\w]+?));\S*;*base64,(.+)$/g.exec(t) }, x.extractImageFromDataUrl = function (t) { var e = (t = t || "").split("base64,"), n = null; if (2 === e.length) { var r = /^data:(\w*\/\w*);*(charset=[\w=-]*)*;*$/.exec(e[0]); Array.isArray(r) && (n = { mimeType: r[1], charset: r[2], data: e[1] }) } return n }, x.supportsArrayBuffer = function () { return "undefined" != typeof ArrayBuffer && "undefined" != typeof Uint8Array }, x.isArrayBuffer = function (t) { return !!this.supportsArrayBuffer() && t instanceof ArrayBuffer }, x.isArrayBufferView = function (t) { return !!this.supportsArrayBuffer() && ("undefined" != typeof Uint32Array && (t instanceof Int8Array || t instanceof Uint8Array || "undefined" != typeof Uint8ClampedArray && t instanceof Uint8ClampedArray || t instanceof Int16Array || t instanceof Uint16Array || t instanceof Int32Array || t instanceof Uint32Array || t instanceof Float32Array || t instanceof Float64Array)) }, x.binaryStringToUint8Array = function (t) { for (var e = t.length, n = new Uint8Array(e), r = 0; r < e; r++)n[r] = t.charCodeAt(r); return n }, x.arrayBufferToBinaryString = function (t) { if ("function" == typeof atob) return atob(this.arrayBufferToBase64(t)) }, x.arrayBufferToBase64 = function (t) { for (var e, n = "", r = "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/", i = new Uint8Array(t), o = i.byteLength, a = o % 3, s = o - a, l = 0; l < s; l += 3)n += r[(16515072 & (e = i[l] << 16 | i[l + 1] << 8 | i[l + 2])) >> 18] + r[(258048 & e) >> 12] + r[(4032 & e) >> 6] + r[63 & e]; return 1 == a ? n += r[(252 & (e = i[s])) >> 2] + r[(3 & e) << 4] + "==" : 2 == a && (n += r[(64512 & (e = i[s] << 8 | i[s + 1])) >> 10] + r[(1008 & e) >> 4] + r[(15 & e) << 2] + "="), n }, x.createImageInfo = function (t, e, n, r, i, o, a, s, l, h, u, c, f) { var p = { alias: s, w: e, h: n, cs: r, bpc: i, i: a, data: t }; return o && (p.f = o), l && (p.dp = l), h && (p.trns = h), u && (p.pal = u), c && (p.smask = c), f && (p.p = f), p }, x.addImage = function (t, e, n, r, i, o, a, s, l) { var h = ""; if ("string" != typeof e) { var u = o; o = i, i = r, r = n, n = e, e = u } if ("object" === se(t) && !_(t) && "imageData" in t) { var c = t; t = c.imageData, e = c.format || e || "UNKNOWN", n = c.x || n || 0, r = c.y || r || 0, i = c.w || i, o = c.h || o, a = c.alias || a, s = c.compression || s, l = c.rotation || c.angle || l } var f = this.internal.getFilters(); if (void 0 === s && -1 !== f.indexOf("FlateEncode") && (s = "SLOW"), "string" == typeof t && (t = unescape(t)), isNaN(n) || isNaN(r)) throw console.error("jsPDF.addImage: Invalid coordinates", arguments), new Error("Invalid coordinates passed to jsPDF.addImage"); var p, d, g, m, y, v, w, b = function () { var t = this.internal.collections[N + "images"]; return t || (this.internal.collections[N + "images"] = t = {}, this.internal.events.subscribe("putResources", L), this.internal.events.subscribe("putXobjectDict", A)), t }.call(this); if (!((p = P(t, b)) || (_(t) && (t = F(t, e)), (null == (w = a) || 0 === w.length) && (a = "string" == typeof (v = t) ? x.sHashCode(v) : x.isArrayBufferView(v) ? x.sHashCode(x.arrayBufferToBinaryString(v)) : null), p = P(a, b)))) { if (this.isString(t) && ("" !== (h = this.convertStringToImageData(t)) ? t = h : void 0 !== (h = x.loadFile(t)) && (t = h)), e = this.getImageFileTypeByImageData(t, e), !S(e)) throw new Error("addImage does not support files of type '" + e + "', please ensure that a plugin for '" + e + "' support is added."); if (this.supportsArrayBuffer() && (t instanceof Uint8Array || (d = t, t = this.binaryStringToUint8Array(t))), !(p = this["process" + e.toUpperCase()](t, (y = 0, (m = b) && (y = Object.keys ? Object.keys(m).length : function (t) { var e = 0; for (var n in t) t.hasOwnProperty(n) && e++; return e }(m)), y), a, ((g = s) && "string" == typeof g && (g = g.toUpperCase()), g in x.image_compression ? g : x.image_compression.NONE), d))) throw new Error("An unknown error occurred whilst processing the image") } return function (t, e, n, r, i, o, a, s) { var l = function (t, e, n) { return t || e || (e = t = -96), t < 0 && (t = -1 * n.w * 72 / t / this.internal.scaleFactor), e < 0 && (e = -1 * n.h * 72 / e / this.internal.scaleFactor), 0 === t && (t = e * n.w / n.h), 0 === e && (e = t * n.h / n.w), [t, e] }.call(this, n, r, i), h = this.internal.getCoordinateString, u = this.internal.getVerticalCoordinateString; if (n = l[0], r = l[1], a[o] = i, s) { s *= Math.PI / 180; var c = Math.cos(s), f = Math.sin(s), p = function (t) { return t.toFixed(4) }, d = [p(c), p(f), p(-1 * f), p(c), 0, 0, "cm"] } this.internal.write("q"), s ? (this.internal.write([1, "0", "0", 1, h(t), u(e + r), "cm"].join(" ")), this.internal.write(d.join(" ")), this.internal.write([h(n), "0", "0", h(r), "0", "0", "cm"].join(" "))) : this.internal.write([h(n), "0", "0", h(r), h(t), u(e + r), "cm"].join(" ")), this.internal.write("/I" + i.i + " Do"), this.internal.write("Q") }.call(this, n, r, i, o, p, p.i, b, l), this }, x.convertStringToImageData = function (t) { var e, n = ""; if (this.isString(t)) { var r; e = null !== (r = this.extractImageFromDataUrl(t)) ? r.data : t; try { n = atob(e) } catch (t) { throw x.validateStringAsBase64(e) ? new Error("atob-Error in jsPDF.convertStringToImageData " + t.message) : new Error("Supplied Data is not a valid base64-String jsPDF.convertStringToImageData ") } } return n }; var u = function (t, e) { return t.subarray(e, e + 5) }; x.processJPEG = function (t, e, n, r, i, o) { var a, s = this.decode.DCT_DECODE; if (!this.isString(t) && !this.isArrayBuffer(t) && !this.isArrayBufferView(t)) return null; if (this.isString(t) && (a = function (t) { var e; if ("JPEG" !== h(t)) throw new Error("getJpegSize requires a binary string jpeg file"); for (var n = 256 * t.charCodeAt(4) + t.charCodeAt(5), r = 4, i = t.length; r < i;) { if (r += n, 255 !== t.charCodeAt(r)) throw new Error("getJpegSize could not find the size of the image"); if (192 === t.charCodeAt(r + 1) || 193 === t.charCodeAt(r + 1) || 194 === t.charCodeAt(r + 1) || 195 === t.charCodeAt(r + 1) || 196 === t.charCodeAt(r + 1) || 197 === t.charCodeAt(r + 1) || 198 === t.charCodeAt(r + 1) || 199 === t.charCodeAt(r + 1)) return e = 256 * t.charCodeAt(r + 5) + t.charCodeAt(r + 6), [256 * t.charCodeAt(r + 7) + t.charCodeAt(r + 8), e, t.charCodeAt(r + 9)]; r += 2, n = 256 * t.charCodeAt(r) + t.charCodeAt(r + 1) } }(t)), this.isArrayBuffer(t) && (t = new Uint8Array(t)), this.isArrayBufferView(t) && (a = function (t) { if (65496 != (t[0] << 8 | t[1])) throw new Error("Supplied data is not a JPEG"); for (var e, n = t.length, r = (t[4] << 8) + t[5], i = 4; i < n;) { if (r = ((e = u(t, i += r))[2] << 8) + e[3], (192 === e[1] || 194 === e[1]) && 255 === e[0] && 7 < r) return { width: ((e = u(t, i + 5))[2] << 8) + e[3], height: (e[0] << 8) + e[1], numcomponents: e[4] }; i += 2 } throw new Error("getJpegSizeFromBytes could not find the size of the image") }(t), t = i || this.arrayBufferToBinaryString(t)), void 0 === o) switch (a.numcomponents) { case 1: o = this.color_spaces.DEVICE_GRAY; break; case 4: o = this.color_spaces.DEVICE_CMYK; break; default: case 3: o = this.color_spaces.DEVICE_RGB }return this.createImageInfo(t, a.width, a.height, o, 8, s, e, n) }, x.processJPG = function () { return this.processJPEG.apply(this, arguments) }, x.getImageProperties = function (t) { var e, n, r = ""; if (_(t) && (t = F(t)), this.isString(t) && ("" !== (r = this.convertStringToImageData(t)) ? t = r : void 0 !== (r = x.loadFile(t)) && (t = r)), n = this.getImageFileTypeByImageData(t), !S(n)) throw new Error("addImage does not support files of type '" + n + "', please ensure that a plugin for '" + n + "' support is added."); if (this.supportsArrayBuffer() && (t instanceof Uint8Array || (t = this.binaryStringToUint8Array(t))), !(e = this["process" + n.toUpperCase()](t))) throw new Error("An unknown error occurred whilst processing the image"); return { fileType: n, width: e.w, height: e.h, colorSpace: e.cs, compressionMode: e.f, bitsPerComponent: e.bpc } } }(lt.API),
        /**
           * @license
           * Copyright (c) 2014 Steven Spungin (TwelveTone LLC)  steven@twelvetone.tv
           *
           * Licensed under the MIT License.
           * http://opensource.org/licenses/mit-license
           */
        t = lt.API, lt.API.events.push(["addPage", function (t) { this.internal.getPageInfo(t.pageNumber).pageContext.annotations = [] }]), t.events.push(["putPage", function (t) { for (var e = this.internal.getPageInfoByObjId(t.objId), n = t.pageContext.annotations, r = function (t) { if (void 0 !== t && "" != t) return !0 }, i = !1, o = 0; o < n.length && !i; o++)switch ((l = n[o]).type) { case "link": if (r(l.options.url) || r(l.options.pageNumber)) { i = !0; break } case "reference": case "text": case "freetext": i = !0 }if (0 != i) { this.internal.write("/Annots ["), this.internal.pageSize.height; var a = this.internal.getCoordinateString, s = this.internal.getVerticalCoordinateString; for (o = 0; o < n.length; o++) { var l; switch ((l = n[o]).type) { case "reference": this.internal.write(" " + l.object.objId + " 0 R "); break; case "text": var h = this.internal.newAdditionalObject(), u = this.internal.newAdditionalObject(), c = l.title || "Note"; m = "<</Type /Annot /Subtype /Text " + (p = "/Rect [" + a(l.bounds.x) + " " + s(l.bounds.y + l.bounds.h) + " " + a(l.bounds.x + l.bounds.w) + " " + s(l.bounds.y) + "] ") + "/Contents (" + l.contents + ")", m += " /Popup " + u.objId + " 0 R", m += " /P " + e.objId + " 0 R", m += " /T (" + c + ") >>", h.content = m; var f = h.objId + " 0 R"; m = "<</Type /Annot /Subtype /Popup " + (p = "/Rect [" + a(l.bounds.x + 30) + " " + s(l.bounds.y + l.bounds.h) + " " + a(l.bounds.x + l.bounds.w + 30) + " " + s(l.bounds.y) + "] ") + " /Parent " + f, l.open && (m += " /Open true"), m += " >>", u.content = m, this.internal.write(h.objId, "0 R", u.objId, "0 R"); break; case "freetext": var p = "/Rect [" + a(l.bounds.x) + " " + s(l.bounds.y) + " " + a(l.bounds.x + l.bounds.w) + " " + s(l.bounds.y + l.bounds.h) + "] ", d = l.color || "#000000"; m = "<</Type /Annot /Subtype /FreeText " + p + "/Contents (" + l.contents + ")", m += " /DS(font: Helvetica,sans-serif 12.0pt; text-align:left; color:#" + d + ")", m += " /Border [0 0 0]", m += " >>", this.internal.write(m); break; case "link": if (l.options.name) { var g = this.annotations._nameMap[l.options.name]; l.options.pageNumber = g.page, l.options.top = g.y } else l.options.top || (l.options.top = 0); p = "/Rect [" + a(l.x) + " " + s(l.y) + " " + a(l.x + l.w) + " " + s(l.y + l.h) + "] "; var m = ""; if (l.options.url) m = "<</Type /Annot /Subtype /Link " + p + "/Border [0 0 0] /A <</S /URI /URI (" + l.options.url + ") >>"; else if (l.options.pageNumber) switch (m = "<</Type /Annot /Subtype /Link " + p + "/Border [0 0 0] /Dest [" + this.internal.getPageInfo(l.options.pageNumber).objId + " 0 R", l.options.magFactor = l.options.magFactor || "XYZ", l.options.magFactor) { case "Fit": m += " /Fit]"; break; case "FitH": m += " /FitH " + l.options.top + "]"; break; case "FitV": l.options.left = l.options.left || 0, m += " /FitV " + l.options.left + "]"; break; case "XYZ": default: var y = s(l.options.top); l.options.left = l.options.left || 0, void 0 === l.options.zoom && (l.options.zoom = 0), m += " /XYZ " + l.options.left + " " + y + " " + l.options.zoom + "]" }"" != m && (m += " >>", this.internal.write(m)) } } this.internal.write("]") } }]), t.createAnnotation = function (t) { var e = this.internal.getCurrentPageInfo(); switch (t.type) { case "link": this.link(t.bounds.x, t.bounds.y, t.bounds.w, t.bounds.h, t); break; case "text": case "freetext": e.pageContext.annotations.push(t) } }, t.link = function (t, e, n, r, i) { this.internal.getCurrentPageInfo().pageContext.annotations.push({ x: t, y: e, w: n, h: r, options: i, type: "link" }) }, t.textWithLink = function (t, e, n, r) { var i = this.getTextWidth(t), o = this.internal.getLineHeight() / this.internal.scaleFactor; return this.text(t, e, n), n += .2 * o, this.link(e, n - o, i, o, r), i }, t.getTextWidth = function (t) { var e = this.internal.getFontSize(); return this.getStringUnitWidth(t) * e / this.internal.scaleFactor },
        /**
           * @license
           * Copyright (c) 2017 Aras Abbasi 
           *
           * Licensed under the MIT License.
           * http://opensource.org/licenses/mit-license
           */
        function (t) { var h = { 1569: [65152], 1570: [65153, 65154], 1571: [65155, 65156], 1572: [65157, 65158], 1573: [65159, 65160], 1574: [65161, 65162, 65163, 65164], 1575: [65165, 65166], 1576: [65167, 65168, 65169, 65170], 1577: [65171, 65172], 1578: [65173, 65174, 65175, 65176], 1579: [65177, 65178, 65179, 65180], 1580: [65181, 65182, 65183, 65184], 1581: [65185, 65186, 65187, 65188], 1582: [65189, 65190, 65191, 65192], 1583: [65193, 65194], 1584: [65195, 65196], 1585: [65197, 65198], 1586: [65199, 65200], 1587: [65201, 65202, 65203, 65204], 1588: [65205, 65206, 65207, 65208], 1589: [65209, 65210, 65211, 65212], 1590: [65213, 65214, 65215, 65216], 1591: [65217, 65218, 65219, 65220], 1592: [65221, 65222, 65223, 65224], 1593: [65225, 65226, 65227, 65228], 1594: [65229, 65230, 65231, 65232], 1601: [65233, 65234, 65235, 65236], 1602: [65237, 65238, 65239, 65240], 1603: [65241, 65242, 65243, 65244], 1604: [65245, 65246, 65247, 65248], 1605: [65249, 65250, 65251, 65252], 1606: [65253, 65254, 65255, 65256], 1607: [65257, 65258, 65259, 65260], 1608: [65261, 65262], 1609: [65263, 65264, 64488, 64489], 1610: [65265, 65266, 65267, 65268], 1649: [64336, 64337], 1655: [64477], 1657: [64358, 64359, 64360, 64361], 1658: [64350, 64351, 64352, 64353], 1659: [64338, 64339, 64340, 64341], 1662: [64342, 64343, 64344, 64345], 1663: [64354, 64355, 64356, 64357], 1664: [64346, 64347, 64348, 64349], 1667: [64374, 64375, 64376, 64377], 1668: [64370, 64371, 64372, 64373], 1670: [64378, 64379, 64380, 64381], 1671: [64382, 64383, 64384, 64385], 1672: [64392, 64393], 1676: [64388, 64389], 1677: [64386, 64387], 1678: [64390, 64391], 1681: [64396, 64397], 1688: [64394, 64395], 1700: [64362, 64363, 64364, 64365], 1702: [64366, 64367, 64368, 64369], 1705: [64398, 64399, 64400, 64401], 1709: [64467, 64468, 64469, 64470], 1711: [64402, 64403, 64404, 64405], 1713: [64410, 64411, 64412, 64413], 1715: [64406, 64407, 64408, 64409], 1722: [64414, 64415], 1723: [64416, 64417, 64418, 64419], 1726: [64426, 64427, 64428, 64429], 1728: [64420, 64421], 1729: [64422, 64423, 64424, 64425], 1733: [64480, 64481], 1734: [64473, 64474], 1735: [64471, 64472], 1736: [64475, 64476], 1737: [64482, 64483], 1739: [64478, 64479], 1740: [64508, 64509, 64510, 64511], 1744: [64484, 64485, 64486, 64487], 1746: [64430, 64431], 1747: [64432, 64433] }, a = { 65247: { 65154: 65269, 65156: 65271, 65160: 65273, 65166: 65275 }, 65248: { 65154: 65270, 65156: 65272, 65160: 65274, 65166: 65276 }, 65165: { 65247: { 65248: { 65258: 65010 } } }, 1617: { 1612: 64606, 1613: 64607, 1614: 64608, 1615: 64609, 1616: 64610 } }, e = { 1612: 64606, 1613: 64607, 1614: 64608, 1615: 64609, 1616: 64610 }, n = [1570, 1571, 1573, 1575]; t.__arabicParser__ = {}; var r = t.__arabicParser__.isInArabicSubstitutionA = function (t) { return void 0 !== h[t.charCodeAt(0)] }, u = t.__arabicParser__.isArabicLetter = function (t) { return "string" == typeof t && /^[\u0600-\u06FF\u0750-\u077F\u08A0-\u08FF\uFB50-\uFDFF\uFE70-\uFEFF]+$/.test(t) }, i = t.__arabicParser__.isArabicEndLetter = function (t) { return u(t) && r(t) && h[t.charCodeAt(0)].length <= 2 }, o = t.__arabicParser__.isArabicAlfLetter = function (t) { return u(t) && 0 <= n.indexOf(t.charCodeAt(0)) }, s = (t.__arabicParser__.arabicLetterHasIsolatedForm = function (t) { return u(t) && r(t) && 1 <= h[t.charCodeAt(0)].length }, t.__arabicParser__.arabicLetterHasFinalForm = function (t) { return u(t) && r(t) && 2 <= h[t.charCodeAt(0)].length }), l = (t.__arabicParser__.arabicLetterHasInitialForm = function (t) { return u(t) && r(t) && 3 <= h[t.charCodeAt(0)].length }, t.__arabicParser__.arabicLetterHasMedialForm = function (t) { return u(t) && r(t) && 4 == h[t.charCodeAt(0)].length }), c = t.__arabicParser__.resolveLigatures = function (t) { var e = 0, n = a, r = 0, i = "", o = 0; for (e = 0; e < t.length; e += 1)void 0 !== n[t.charCodeAt(e)] ? (o++ , "number" == typeof (n = n[t.charCodeAt(e)]) && (r = -1 !== (r = f(t.charAt(e), t.charAt(e - o), t.charAt(e + 1))) ? r : 0, i += String.fromCharCode(n), n = a, o = 0), e === t.length - 1 && (n = a, i += t.charAt(e - (o - 1)), e -= o - 1, o = 0)) : (n = a, i += t.charAt(e - o), e -= o, o = 0); return i }, f = (t.__arabicParser__.isArabicDiacritic = function (t) { return void 0 !== t && void 0 !== e[t.charCodeAt(0)] }, t.__arabicParser__.getCorrectForm = function (t, e, n) { return u(t) ? !1 === r(t) ? -1 : !s(t) || !u(e) && !u(n) || !u(n) && i(e) || i(t) && !u(e) || i(t) && o(e) || i(t) && i(e) ? 0 : l(t) && u(e) && !i(e) && u(n) && s(n) ? 3 : i(t) || !u(n) ? 1 : 2 : -1 }), p = t.__arabicParser__.processArabic = t.processArabic = function (t) { var e = 0, n = 0, r = 0, i = "", o = "", a = "", s = (t = t || "").split("\\s+"), l = []; for (e = 0; e < s.length; e += 1) { for (l.push(""), n = 0; n < s[e].length; n += 1)i = s[e][n], o = s[e][n - 1], a = s[e][n + 1], u(i) ? (r = f(i, o, a), l[e] += -1 !== r ? String.fromCharCode(h[i.charCodeAt(0)][r]) : i) : l[e] += i; l[e] = c(l[e]) } return l.join(" ") }; t.events.push(["preProcessText", function (t) { var e = t.text, n = (t.x, t.y, t.options || {}), r = (t.mutex, n.lang, []); if ("[object Array]" === Object.prototype.toString.call(e)) { var i = 0; for (r = [], i = 0; i < e.length; i += 1)"[object Array]" === Object.prototype.toString.call(e[i]) ? r.push([p(e[i][0]), e[i][1], e[i][2]]) : r.push([p(e[i])]); t.text = r } else t.text = p(e) }]) }(lt.API), lt.API.autoPrint = function (t) { var e; switch ((t = t || {}).variant = t.variant || "non-conform", t.variant) { case "javascript": this.addJS("print({});"); break; case "non-conform": default: this.internal.events.subscribe("postPutResources", function () { e = this.internal.newObject(), this.internal.out("<<"), this.internal.out("/S /Named"), this.internal.out("/Type /Action"), this.internal.out("/N /Print"), this.internal.out(">>"), this.internal.out("endobj") }), this.internal.events.subscribe("putCatalog", function () { this.internal.out("/OpenAction " + e + " 0 R") }) }return this },
        /**
           * @license
           * Copyright (c) 2014 Steven Spungin (TwelveTone LLC)  steven@twelvetone.tv
           *
           * Licensed under the MIT License.
           * http://opensource.org/licenses/mit-license
           */
        e = lt.API, (n = function () { var e = void 0; Object.defineProperty(this, "pdf", { get: function () { return e }, set: function (t) { e = t } }); var n = 150; Object.defineProperty(this, "width", { get: function () { return n }, set: function (t) { n = isNaN(t) || !1 === Number.isInteger(t) || t < 0 ? 150 : t, this.getContext("2d").pageWrapXEnabled && (this.getContext("2d").pageWrapX = n + 1) } }); var r = 300; Object.defineProperty(this, "height", { get: function () { return r }, set: function (t) { r = isNaN(t) || !1 === Number.isInteger(t) || t < 0 ? 300 : t, this.getContext("2d").pageWrapYEnabled && (this.getContext("2d").pageWrapY = r + 1) } }); var i = []; Object.defineProperty(this, "childNodes", { get: function () { return i }, set: function (t) { i = t } }); var o = {}; Object.defineProperty(this, "style", { get: function () { return o }, set: function (t) { o = t } }), Object.defineProperty(this, "parentNode", { get: function () { return !1 } }) }).prototype.getContext = function (t, e) { var n; if ("2d" !== (t = t || "2d")) return null; for (n in e) this.pdf.context2d.hasOwnProperty(n) && (this.pdf.context2d[n] = e[n]); return (this.pdf.context2d._canvas = this).pdf.context2d }, n.prototype.toDataURL = function () { throw new Error("toDataURL is not implemented.") }, e.events.push(["initialized", function () { this.canvas = new n, this.canvas.pdf = this }]),
        /** 
           * @license
           * ====================================================================
           * Copyright (c) 2013 Youssef Beddad, youssef.beddad@gmail.com
           *               2013 Eduardo Menezes de Morais, eduardo.morais@usp.br
           *               2013 Lee Driscoll, https://github.com/lsdriscoll
           *               2014 Juan Pablo Gaviria, https://github.com/juanpgaviria
           *               2014 James Hall, james@parall.ax
           *               2014 Diego Casorran, https://github.com/diegocr
           *
           * 
           * ====================================================================
           */
        _ = lt.API, F = { x: void 0, y: void 0, w: void 0, h: void 0, ln: void 0 }, P = 1, p = function (t, e, n, r, i) { F = { x: t, y: e, w: n, h: r, ln: i } }, d = function () { return F }, k = { left: 0, top: 0, bottom: 0 }, _.setHeaderFunction = function (t) { l = t }, _.getTextDimensions = function (t, e) { var n = this.table_font_size || this.internal.getFontSize(), r = (this.internal.getFont().fontStyle, (e = e || {}).scaleFactor || this.internal.scaleFactor), i = 0, o = 0, a = 0; if ("string" == typeof t) 0 != (i = this.getStringUnitWidth(t) * n) && (o = 1); else { if ("[object Array]" !== Object.prototype.toString.call(t)) throw new Error("getTextDimensions expects text-parameter to be of type String or an Array of Strings."); for (var s = 0; s < t.length; s++)i < (a = this.getStringUnitWidth(t[s]) * n) && (i = a); 0 !== i && (o = t.length) } return { w: i /= r, h: Math.max((o * n * this.getLineHeightFactor() - n * (this.getLineHeightFactor() - 1)) / r, 0) } }, _.cellAddPage = function () { var t = this.margins || k; this.addPage(), p(t.left, t.top, void 0, void 0), P += 1 }, _.cellInitialize = function () { F = { x: void 0, y: void 0, w: void 0, h: void 0, ln: void 0 }, P = 1 }, _.cell = function (t, e, n, r, i, o, a) { var s = d(), l = !1; if (void 0 !== s.ln) if (s.ln === o) t = s.x + s.w, e = s.y; else { var h = this.margins || k; s.y + s.h + r + 13 >= this.internal.pageSize.getHeight() - h.bottom && (this.cellAddPage(), l = !0, this.printHeaders && this.tableHeaderRow && this.printHeaderRow(o, !0)), e = d().y + d().h, l && (e = 23) } if (void 0 !== i[0]) if (this.printingHeaderRow ? this.rect(t, e, n, r, "FD") : this.rect(t, e, n, r), "right" === a) { i instanceof Array || (i = [i]); for (var u = 0; u < i.length; u++) { var c = i[u], f = this.getStringUnitWidth(c) * this.internal.getFontSize() / this.internal.scaleFactor; this.text(c, t + n - f - 3, e + this.internal.getLineHeight() * (u + 1)) } } else this.text(i, t + 3, e + this.internal.getLineHeight()); return p(t, e, n, r, o), this }, _.arrayMax = function (t, e) { var n, r, i, o = t[0]; for (n = 0, r = t.length; n < r; n += 1)i = t[n], e ? -1 === e(o, i) && (o = i) : o < i && (o = i); return o }, _.table = function (t, e, n, r, i) { if (!n) throw "No data for PDF table"; var o, a, s, l, h, u, c, f, p, d, g = [], m = [], y = {}, v = {}, w = [], b = [], x = !1, N = !0, L = 12, A = k; if (A.width = this.internal.pageSize.getWidth(), i && (!0 === i.autoSize && (x = !0), !1 === i.printHeaders && (N = !1), i.fontSize && (L = i.fontSize), i.css && void 0 !== i.css["font-size"] && (L = 16 * i.css["font-size"]), i.margins && (A = i.margins)), this.lnMod = 0, F = { x: void 0, y: void 0, w: void 0, h: void 0, ln: void 0 }, P = 1, this.printHeaders = N, this.margins = A, this.setFontSize(L), this.table_font_size = L, null == r) g = Object.keys(n[0]); else if (r[0] && "string" != typeof r[0]) for (a = 0, s = r.length; a < s; a += 1)o = r[a], g.push(o.name), m.push(o.prompt), v[o.name] = o.width * (19.049976 / 25.4); else g = r; if (x) for (d = function (t) { return t[o] }, a = 0, s = g.length; a < s; a += 1) { for (y[o = g[a]] = n.map(d), w.push(this.getTextDimensions(m[a] || o, { scaleFactor: 1 }).w), c = 0, l = (u = y[o]).length; c < l; c += 1)h = u[c], w.push(this.getTextDimensions(h, { scaleFactor: 1 }).w); v[o] = _.arrayMax(w), w = [] } if (N) { var S = this.calculateLineHeight(g, v, m.length ? m : g); for (a = 0, s = g.length; a < s; a += 1)o = g[a], b.push([t, e, v[o], S, String(m.length ? m[a] : o)]); this.setTableHeaderRow(b), this.printHeaderRow(1, !1) } for (a = 0, s = n.length; a < s; a += 1)for (f = n[a], S = this.calculateLineHeight(g, v, f), c = 0, p = g.length; c < p; c += 1)o = g[c], this.cell(t, e, v[o], S, f[o], a + 2, o.align); return this.lastCellPos = F, this.table_x = t, this.table_y = e, this }, _.calculateLineHeight = function (t, e, n) { for (var r, i = 0, o = 0; o < t.length; o++) { n[r = t[o]] = this.splitTextToSize(String(n[r]), e[r] - 3); var a = this.internal.getLineHeight() * n[r].length + 3; i < a && (i = a) } return i }, _.setTableHeaderRow = function (t) { this.tableHeaderRow = t }, _.printHeaderRow = function (t, e) { if (!this.tableHeaderRow) throw "Property tableHeaderRow does not exist."; var n, r, i, o; if (this.printingHeaderRow = !0, void 0 !== l) { var a = l(this, P); p(a[0], a[1], a[2], a[3], -1) } this.setFontStyle("bold"); var s = []; for (i = 0, o = this.tableHeaderRow.length; i < o; i += 1)this.setFillColor(200, 200, 200), n = this.tableHeaderRow[i], e && (this.margins.top = 13, n[1] = this.margins && this.margins.top || 0, s.push(n)), r = [].concat(n), this.cell.apply(this, r.concat(t)); 0 < s.length && this.setTableHeaderRow(s), this.setFontStyle("normal"), this.printingHeaderRow = !1 },
        /**
           * jsPDF Context2D PlugIn Copyright (c) 2014 Steven Spungin (TwelveTone LLC) steven@twelvetone.tv
           *
           * Licensed under the MIT License. http://opensource.org/licenses/mit-license
           */
        function (t, e) { var l, i, o, h, u, c = function (t) { return t = t || {}, this.isStrokeTransparent = t.isStrokeTransparent || !1, this.strokeOpacity = t.strokeOpacity || 1, this.strokeStyle = t.strokeStyle || "#000000", this.fillStyle = t.fillStyle || "#000000", this.isFillTransparent = t.isFillTransparent || !1, this.fillOpacity = t.fillOpacity || 1, this.font = t.font || "10px sans-serif", this.textBaseline = t.textBaseline || "alphabetic", this.textAlign = t.textAlign || "left", this.lineWidth = t.lineWidth || 1, this.lineJoin = t.lineJoin || "miter", this.lineCap = t.lineCap || "butt", this.path = t.path || [], this.transform = void 0 !== t.transform ? t.transform.clone() : new M, this.globalCompositeOperation = t.globalCompositeOperation || "normal", this.globalAlpha = t.globalAlpha || 1, this.clip_path = t.clip_path || [], this.currentPoint = t.currentPoint || new j, this.miterLimit = t.miterLimit || 10, this.lastPoint = t.lastPoint || new j, this.ignoreClearRect = "boolean" != typeof t.ignoreClearRect || t.ignoreClearRect, this }; t.events.push(["initialized", function () { this.context2d = new n(this), l = this.internal.f2, this.internal.f3, i = this.internal.getCoordinateString, o = this.internal.getVerticalCoordinateString, h = this.internal.getHorizontalCoordinate, u = this.internal.getVerticalCoordinate }]); var n = function (t) { Object.defineProperty(this, "canvas", { get: function () { return { parentNode: !1, style: !1 } } }), Object.defineProperty(this, "pdf", { get: function () { return t } }); var e = !1; Object.defineProperty(this, "pageWrapXEnabled", { get: function () { return e }, set: function (t) { e = Boolean(t) } }); var n = !1; Object.defineProperty(this, "pageWrapYEnabled", { get: function () { return n }, set: function (t) { n = Boolean(t) } }); var r = 0; Object.defineProperty(this, "posX", { get: function () { return r }, set: function (t) { isNaN(t) || (r = t) } }); var i = 0; Object.defineProperty(this, "posY", { get: function () { return i }, set: function (t) { isNaN(t) || (i = t) } }); var o = !1; Object.defineProperty(this, "autoPaging", { get: function () { return o }, set: function (t) { o = Boolean(t) } }); var a = 0; Object.defineProperty(this, "lastBreak", { get: function () { return a }, set: function (t) { a = t } }); var s = []; Object.defineProperty(this, "pageBreaks", { get: function () { return s }, set: function (t) { s = t } }); var l = new c; Object.defineProperty(this, "ctx", { get: function () { return l }, set: function (t) { t instanceof c && (l = t) } }), Object.defineProperty(this, "path", { get: function () { return l.path }, set: function (t) { l.path = t } }); var h = []; Object.defineProperty(this, "ctxStack", { get: function () { return h }, set: function (t) { h = t } }), Object.defineProperty(this, "fillStyle", { get: function () { return this.ctx.fillStyle }, set: function (t) { var e; e = f(t), this.ctx.fillStyle = e.style, this.ctx.isFillTransparent = 0 === e.a, this.ctx.fillOpacity = e.a, this.pdf.setFillColor(e.r, e.g, e.b, { a: e.a }), this.pdf.setTextColor(e.r, e.g, e.b, { a: e.a }) } }), Object.defineProperty(this, "strokeStyle", { get: function () { return this.ctx.strokeStyle }, set: function (t) { var e = f(t); this.ctx.strokeStyle = e.style, this.ctx.isStrokeTransparent = 0 === e.a, this.ctx.strokeOpacity = e.a, 0 === e.a ? this.pdf.setDrawColor(255, 255, 255) : (e.a, this.pdf.setDrawColor(e.r, e.g, e.b)) } }), Object.defineProperty(this, "lineCap", { get: function () { return this.ctx.lineCap }, set: function (t) { -1 !== ["butt", "round", "square"].indexOf(t) && (this.ctx.lineCap = t, this.pdf.setLineCap(t)) } }), Object.defineProperty(this, "lineWidth", { get: function () { return this.ctx.lineWidth }, set: function (t) { isNaN(t) || (this.ctx.lineWidth = t, this.pdf.setLineWidth(t)) } }), Object.defineProperty(this, "lineJoin", { get: function () { return this.ctx.lineJoin }, set: function (t) { -1 !== ["bevel", "round", "miter"].indexOf(t) && (this.ctx.lineJoin = t, this.pdf.setLineJoin(t)) } }), Object.defineProperty(this, "miterLimit", { get: function () { return this.ctx.miterLimit }, set: function (t) { isNaN(t) || (this.ctx.miterLimit = t, this.pdf.setMiterLimit(t)) } }), Object.defineProperty(this, "textBaseline", { get: function () { return this.ctx.textBaseline }, set: function (t) { this.ctx.textBaseline = t } }), Object.defineProperty(this, "textAlign", { get: function () { return this.ctx.textAlign }, set: function (t) { -1 !== ["right", "end", "center", "left", "start"].indexOf(t) && (this.ctx.textAlign = t) } }), Object.defineProperty(this, "font", { get: function () { return this.ctx.font }, set: function (t) { var e; if (this.ctx.font = t, null !== (e = /^\s*(?=(?:(?:[-a-z]+\s*){0,2}(italic|oblique))?)(?=(?:(?:[-a-z]+\s*){0,2}(small-caps))?)(?=(?:(?:[-a-z]+\s*){0,2}(bold(?:er)?|lighter|[1-9]00))?)(?:(?:normal|\1|\2|\3)\s*){0,3}((?:xx?-)?(?:small|large)|medium|smaller|larger|[.\d]+(?:\%|in|[cem]m|ex|p[ctx]))(?:\s*\/\s*(normal|[.\d]+(?:\%|in|[cem]m|ex|p[ctx])))?\s*([-_,\"\'\sa-z]+?)\s*$/i.exec(t))) { var n = e[1], r = (e[2], e[3]), i = e[4], o = e[5], a = e[6]; i = "px" === o ? Math.floor(parseFloat(i)) : "em" === o ? Math.floor(parseFloat(i) * this.pdf.getFontSize()) : Math.floor(parseFloat(i)), this.pdf.setFontSize(i); var s = ""; ("bold" === r || 700 <= parseInt(r, 10) || "bold" === n) && (s = "bold"), "italic" === n && (s += "italic"), 0 === s.length && (s = "normal"); for (var l = "", h = a.toLowerCase().replace(/"|'/g, "").split(/\s*,\s*/), u = { arial: "Helvetica", verdana: "Helvetica", helvetica: "Helvetica", "sans-serif": "Helvetica", fixed: "Courier", monospace: "Courier", terminal: "Courier", courier: "Courier", times: "Times", cursive: "Times", fantasy: "Times", serif: "Times" }, c = 0; c < h.length; c++) { if (void 0 !== this.pdf.internal.getFont(h[c], s, { noFallback: !0, disableWarning: !0 })) { l = h[c]; break } if ("bolditalic" === s && void 0 !== this.pdf.internal.getFont(h[c], "bold", { noFallback: !0, disableWarning: !0 })) l = h[c], s = "bold"; else if (void 0 !== this.pdf.internal.getFont(h[c], "normal", { noFallback: !0, disableWarning: !0 })) { l = h[c], s = "normal"; break } } if ("" === l) for (c = 0; c < h.length; c++)if (u[h[c]]) { l = u[h[c]]; break } l = "" === l ? "Times" : l, this.pdf.setFont(l, s) } } }), Object.defineProperty(this, "globalCompositeOperation", { get: function () { return this.ctx.globalCompositeOperation }, set: function (t) { this.ctx.globalCompositeOperation = t } }), Object.defineProperty(this, "globalAlpha", { get: function () { return this.ctx.globalAlpha }, set: function (t) { this.ctx.globalAlpha = t } }), Object.defineProperty(this, "ignoreClearRect", { get: function () { return this.ctx.ignoreClearRect }, set: function (t) { this.ctx.ignoreClearRect = Boolean(t) } }) }; n.prototype.fill = function () { r.call(this, "fill", !1) }, n.prototype.stroke = function () { r.call(this, "stroke", !1) }, n.prototype.beginPath = function () { this.path = [{ type: "begin" }] }, n.prototype.moveTo = function (t, e) { if (isNaN(t) || isNaN(e)) throw console.error("jsPDF.context2d.moveTo: Invalid arguments", arguments), new Error("Invalid arguments passed to jsPDF.context2d.moveTo"); var n = this.ctx.transform.applyToPoint(new j(t, e)); this.path.push({ type: "mt", x: n.x, y: n.y }), this.ctx.lastPoint = new j(t, e) }, n.prototype.closePath = function () { var t = new j(0, 0), e = 0; for (e = this.path.length - 1; -1 !== e; e--)if ("begin" === this.path[e].type && "object" === se(this.path[e + 1]) && "number" == typeof this.path[e + 1].x) { t = new j(this.path[e + 1].x, this.path[e + 1].y), this.path.push({ type: "lt", x: t.x, y: t.y }); break } "object" === se(this.path[e + 2]) && "number" == typeof this.path[e + 2].x && this.path.push(JSON.parse(JSON.stringify(this.path[e + 2]))), this.path.push({ type: "close" }), this.ctx.lastPoint = new j(t.x, t.y) }, n.prototype.lineTo = function (t, e) { if (isNaN(t) || isNaN(e)) throw console.error("jsPDF.context2d.lineTo: Invalid arguments", arguments), new Error("Invalid arguments passed to jsPDF.context2d.lineTo"); var n = this.ctx.transform.applyToPoint(new j(t, e)); this.path.push({ type: "lt", x: n.x, y: n.y }), this.ctx.lastPoint = new j(n.x, n.y) }, n.prototype.clip = function () { this.ctx.clip_path = JSON.parse(JSON.stringify(this.path)), r.call(this, null, !0) }, n.prototype.quadraticCurveTo = function (t, e, n, r) { if (isNaN(n) || isNaN(r) || isNaN(t) || isNaN(e)) throw console.error("jsPDF.context2d.quadraticCurveTo: Invalid arguments", arguments), new Error("Invalid arguments passed to jsPDF.context2d.quadraticCurveTo"); var i = this.ctx.transform.applyToPoint(new j(n, r)), o = this.ctx.transform.applyToPoint(new j(t, e)); this.path.push({ type: "qct", x1: o.x, y1: o.y, x: i.x, y: i.y }), this.ctx.lastPoint = new j(i.x, i.y) }, n.prototype.bezierCurveTo = function (t, e, n, r, i, o) { if (isNaN(i) || isNaN(o) || isNaN(t) || isNaN(e) || isNaN(n) || isNaN(r)) throw console.error("jsPDF.context2d.bezierCurveTo: Invalid arguments", arguments), new Error("Invalid arguments passed to jsPDF.context2d.bezierCurveTo"); var a = this.ctx.transform.applyToPoint(new j(i, o)), s = this.ctx.transform.applyToPoint(new j(t, e)), l = this.ctx.transform.applyToPoint(new j(n, r)); this.path.push({ type: "bct", x1: s.x, y1: s.y, x2: l.x, y2: l.y, x: a.x, y: a.y }), this.ctx.lastPoint = new j(a.x, a.y) }, n.prototype.arc = function (t, e, n, r, i, o) { if (isNaN(t) || isNaN(e) || isNaN(n) || isNaN(r) || isNaN(i)) throw console.error("jsPDF.context2d.arc: Invalid arguments", arguments), new Error("Invalid arguments passed to jsPDF.context2d.arc"); if (o = Boolean(o), !this.ctx.transform.isIdentity) { var a = this.ctx.transform.applyToPoint(new j(t, e)); t = a.x, e = a.y; var s = this.ctx.transform.applyToPoint(new j(0, n)), l = this.ctx.transform.applyToPoint(new j(0, 0)); n = Math.sqrt(Math.pow(s.x - l.x, 2) + Math.pow(s.y - l.y, 2)) } Math.abs(i - r) >= 2 * Math.PI && (r = 0, i = 2 * Math.PI), this.path.push({ type: "arc", x: t, y: e, radius: n, startAngle: r, endAngle: i, counterclockwise: o }) }, n.prototype.arcTo = function (t, e, n, r, i) { throw new Error("arcTo not implemented.") }, n.prototype.rect = function (t, e, n, r) { if (isNaN(t) || isNaN(e) || isNaN(n) || isNaN(r)) throw console.error("jsPDF.context2d.rect: Invalid arguments", arguments), new Error("Invalid arguments passed to jsPDF.context2d.rect"); this.moveTo(t, e), this.lineTo(t + n, e), this.lineTo(t + n, e + r), this.lineTo(t, e + r), this.lineTo(t, e), this.lineTo(t + n, e), this.lineTo(t, e) }, n.prototype.fillRect = function (t, e, n, r) { if (isNaN(t) || isNaN(e) || isNaN(n) || isNaN(r)) throw console.error("jsPDF.context2d.fillRect: Invalid arguments", arguments), new Error("Invalid arguments passed to jsPDF.context2d.fillRect"); if (!N.call(this)) { var i = {}; "butt" !== this.lineCap && (i.lineCap = this.lineCap, this.lineCap = "butt"), "miter" !== this.lineJoin && (i.lineJoin = this.lineJoin, this.lineJoin = "miter"), this.beginPath(), this.rect(t, e, n, r), this.fill(), i.hasOwnProperty("lineCap") && (this.lineCap = i.lineCap), i.hasOwnProperty("lineJoin") && (this.lineJoin = i.lineJoin) } }, n.prototype.strokeRect = function (t, e, n, r) { if (isNaN(t) || isNaN(e) || isNaN(n) || isNaN(r)) throw console.error("jsPDF.context2d.strokeRect: Invalid arguments", arguments), new Error("Invalid arguments passed to jsPDF.context2d.strokeRect"); L.call(this) || (this.beginPath(), this.rect(t, e, n, r), this.stroke()) }, n.prototype.clearRect = function (t, e, n, r) { if (isNaN(t) || isNaN(e) || isNaN(n) || isNaN(r)) throw console.error("jsPDF.context2d.clearRect: Invalid arguments", arguments), new Error("Invalid arguments passed to jsPDF.context2d.clearRect"); this.ignoreClearRect || (this.fillStyle = "#ffffff", this.fillRect(t, e, n, r)) }, n.prototype.save = function (t) { t = "boolean" != typeof t || t; for (var e = this.pdf.internal.getCurrentPageInfo().pageNumber, n = 0; n < this.pdf.internal.getNumberOfPages(); n++)this.pdf.setPage(n + 1), this.pdf.internal.out("q"); if (this.pdf.setPage(e), t) { this.ctx.fontSize = this.pdf.internal.getFontSize(); var r = new c(this.ctx); this.ctxStack.push(this.ctx), this.ctx = r } }, n.prototype.restore = function (t) { t = "boolean" != typeof t || t; for (var e = this.pdf.internal.getCurrentPageInfo().pageNumber, n = 0; n < this.pdf.internal.getNumberOfPages(); n++)this.pdf.setPage(n + 1), this.pdf.internal.out("Q"); this.pdf.setPage(e), t && 0 !== this.ctxStack.length && (this.ctx = this.ctxStack.pop(), this.fillStyle = this.ctx.fillStyle, this.strokeStyle = this.ctx.strokeStyle, this.font = this.ctx.font, this.lineCap = this.ctx.lineCap, this.lineWidth = this.ctx.lineWidth, this.lineJoin = this.ctx.lineJoin) }, n.prototype.toDataURL = function () { throw new Error("toDataUrl not implemented.") }; var f = function (t) { var e, n, r, i; if (!0 === t.isCanvasGradient && (t = t.getColor()), !t) return { r: 0, g: 0, b: 0, a: 0, style: t }; if (/transparent|rgba\s*\(\s*(\d+)\s*,\s*(\d+)\s*,\s*(\d+)\s*,\s*0+\s*\)/.test(t)) i = r = n = e = 0; else { var o = /rgb\s*\(\s*(\d+)\s*,\s*(\d+)\s*,\s*(\d+)\s*\)/.exec(t); if (null !== o) e = parseInt(o[1]), n = parseInt(o[2]), r = parseInt(o[3]), i = 1; else if (null !== (o = /rgba\s*\(\s*(\d+)\s*,\s*(\d+)\s*,\s*(\d+)\s*,\s*([\d\.]+)\s*\)/.exec(t))) e = parseInt(o[1]), n = parseInt(o[2]), r = parseInt(o[3]), i = parseFloat(o[4]); else { if (i = 1, "string" == typeof t && "#" !== t.charAt(0)) { var a = new RGBColor(t); t = a.ok ? a.toHex() : "#000000" } 4 === t.length ? (e = t.substring(1, 2), e += e, n = t.substring(2, 3), n += n, r = t.substring(3, 4), r += r) : (e = t.substring(1, 3), n = t.substring(3, 5), r = t.substring(5, 7)), e = parseInt(e, 16), n = parseInt(n, 16), r = parseInt(r, 16) } } return { r: e, g: n, b: r, a: i, style: t } }, N = function () { return this.ctx.isFillTransparent || 0 == this.globalAlpha }, L = function () { return Boolean(this.ctx.isStrokeTransparent || 0 == this.globalAlpha) }; n.prototype.fillText = function (t, e, n, r) { if (isNaN(e) || isNaN(n) || "string" != typeof t) throw console.error("jsPDF.context2d.fillText: Invalid arguments", arguments), new Error("Invalid arguments passed to jsPDF.context2d.fillText"); if (r = isNaN(r) ? void 0 : r, !N.call(this)) { n = a.call(this, n); var i = B(this.ctx.transform.rotation), o = this.ctx.transform.scaleX; s.call(this, { text: t, x: e, y: n, scale: o, angle: i, align: this.textAlign, maxWidth: r }) } }, n.prototype.strokeText = function (t, e, n, r) { if (isNaN(e) || isNaN(n) || "string" != typeof t) throw console.error("jsPDF.context2d.strokeText: Invalid arguments", arguments), new Error("Invalid arguments passed to jsPDF.context2d.strokeText"); if (!L.call(this)) { r = isNaN(r) ? void 0 : r, n = a.call(this, n); var i = B(this.ctx.transform.rotation), o = this.ctx.transform.scaleX; s.call(this, { text: t, x: e, y: n, scale: o, renderingMode: "stroke", angle: i, align: this.textAlign, maxWidth: r }) } }, n.prototype.measureText = function (t) { if ("string" != typeof t) throw console.error("jsPDF.context2d.measureText: Invalid arguments", arguments), new Error("Invalid arguments passed to jsPDF.context2d.measureText"); var e = this.pdf, n = this.pdf.internal.scaleFactor, r = e.internal.getFontSize(), i = e.getStringUnitWidth(t) * r / e.internal.scaleFactor; return new function (t) { var e = (t = t || {}).width || 0; return Object.defineProperty(this, "width", { get: function () { return e } }), this }({ width: i *= Math.round(96 * n / 72 * 1e4) / 1e4 }) }, n.prototype.scale = function (t, e) { if (isNaN(t) || isNaN(e)) throw console.error("jsPDF.context2d.scale: Invalid arguments", arguments), new Error("Invalid arguments passed to jsPDF.context2d.scale"); var n = new M(t, 0, 0, e, 0, 0); this.ctx.transform = this.ctx.transform.multiply(n) }, n.prototype.rotate = function (t) { if (isNaN(t)) throw console.error("jsPDF.context2d.rotate: Invalid arguments", arguments), new Error("Invalid arguments passed to jsPDF.context2d.rotate"); var e = new M(Math.cos(t), Math.sin(t), -Math.sin(t), Math.cos(t), 0, 0); this.ctx.transform = this.ctx.transform.multiply(e) }, n.prototype.translate = function (t, e) { if (isNaN(t) || isNaN(e)) throw console.error("jsPDF.context2d.translate: Invalid arguments", arguments), new Error("Invalid arguments passed to jsPDF.context2d.translate"); var n = new M(1, 0, 0, 1, t, e); this.ctx.transform = this.ctx.transform.multiply(n) }, n.prototype.transform = function (t, e, n, r, i, o) { if (isNaN(t) || isNaN(e) || isNaN(n) || isNaN(r) || isNaN(i) || isNaN(o)) throw console.error("jsPDF.context2d.transform: Invalid arguments", arguments), new Error("Invalid arguments passed to jsPDF.context2d.transform"); var a = new M(t, e, n, r, i, o); this.ctx.transform = this.ctx.transform.multiply(a) }, n.prototype.setTransform = function (t, e, n, r, i, o) { t = isNaN(t) ? 1 : t, e = isNaN(e) ? 0 : e, n = isNaN(n) ? 0 : n, r = isNaN(r) ? 1 : r, i = isNaN(i) ? 0 : i, o = isNaN(o) ? 0 : o, this.ctx.transform = new M(t, e, n, r, i, o) }, n.prototype.drawImage = function (t, e, n, r, i, o, a, s, l) { var h = this.pdf.getImageProperties(t), u = 1, c = 1, f = 1, p = 1; void 0 !== r && void 0 !== s && (f = s / r, p = l / i, u = h.width / r * s / r, c = h.height / i * l / i), void 0 === o && (o = e, a = n, n = e = 0), void 0 !== r && void 0 === s && (s = r, l = i), void 0 === r && void 0 === s && (s = h.width, l = h.height); var d = this.ctx.transform.decompose(), g = B(d.rotate.shx); d.scale.sx, d.scale.sy; for (var m, y = new M, v = ((y = (y = (y = y.multiply(d.translate)).multiply(d.skew)).multiply(d.scale)).applyToPoint(new j(s, l)), y.applyToRectangle(new E(o - e * f, a - n * p, r * u, i * c))), w = F.call(this, v), b = [], x = 0; x < w.length; x += 1)-1 === b.indexOf(w[x]) && b.push(w[x]); if (b.sort(), this.autoPaging) for (var N = b[0], L = b[b.length - 1], A = N; A < L + 1; A++) { if (this.pdf.setPage(A), 0 !== this.ctx.clip_path.length) { var S = this.path; m = JSON.parse(JSON.stringify(this.ctx.clip_path)), this.path = P(m, this.posX, -1 * this.pdf.internal.pageSize.height * (A - 1) + this.posY), k.call(this, "fill", !0), this.path = S } var _ = JSON.parse(JSON.stringify(v)); _ = P([_], this.posX, -1 * this.pdf.internal.pageSize.height * (A - 1) + this.posY)[0], this.pdf.addImage(t, "jpg", _.x, _.y, _.w, _.h, null, null, g) } else this.pdf.addImage(t, "jpg", v.x, v.y, v.w, v.h, null, null, g) }; var F = function (t, e, n) { var r = []; switch (e = e || this.pdf.internal.pageSize.width, n = n || this.pdf.internal.pageSize.height, t.type) { default: case "mt": case "lt": r.push(Math.floor((t.y + this.posY) / n) + 1); break; case "arc": r.push(Math.floor((t.y + this.posY - t.radius) / n) + 1), r.push(Math.floor((t.y + this.posY + t.radius) / n) + 1); break; case "qct": var i = w(this.ctx.lastPoint.x, this.ctx.lastPoint.y, t.x1, t.y1, t.x, t.y); r.push(Math.floor(i.y / n) + 1), r.push(Math.floor((i.y + i.h) / n) + 1); break; case "bct": var o = b(this.ctx.lastPoint.x, this.ctx.lastPoint.y, t.x1, t.y1, t.x2, t.y2, t.x, t.y); r.push(Math.floor(o.y / n) + 1), r.push(Math.floor((o.y + o.h) / n) + 1); break; case "rect": r.push(Math.floor((t.y + this.posY) / n) + 1), r.push(Math.floor((t.y + t.h + this.posY) / n) + 1) }for (var a = 0; a < r.length; a += 1)for (; this.pdf.internal.getNumberOfPages() < r[a];)v.call(this); return r }, v = function () { var t = this.fillStyle, e = this.strokeStyle, n = this.font, r = this.lineCap, i = this.lineWidth, o = this.lineJoin; this.pdf.addPage(), this.fillStyle = t, this.strokeStyle = e, this.font = n, this.lineCap = r, this.lineWidth = i, this.lineJoin = o }, P = function (t, e, n) { for (var r = 0; r < t.length; r++)switch (t[r].type) { case "bct": t[r].x2 += e, t[r].y2 += n; case "qct": t[r].x1 += e, t[r].y1 += n; case "mt": case "lt": case "arc": default: t[r].x += e, t[r].y += n }return t }, r = function (t, e) { for (var n, r, i = this.fillStyle, o = this.strokeStyle, a = (this.font, this.lineCap), s = this.lineWidth, l = this.lineJoin, h = JSON.parse(JSON.stringify(this.path)), u = JSON.parse(JSON.stringify(this.path)), c = [], f = 0; f < u.length; f++)if (void 0 !== u[f].x) for (var p = F.call(this, u[f]), d = 0; d < p.length; d += 1)-1 === c.indexOf(p[d]) && c.push(p[d]); for (f = 0; f < c.length; f++)for (; this.pdf.internal.getNumberOfPages() < c[f];)v.call(this); if (c.sort(), this.autoPaging) { var g = c[0], m = c[c.length - 1]; for (f = g; f < m + 1; f++) { if (this.pdf.setPage(f), this.fillStyle = i, this.strokeStyle = o, this.lineCap = a, this.lineWidth = s, this.lineJoin = l, 0 !== this.ctx.clip_path.length) { var y = this.path; n = JSON.parse(JSON.stringify(this.ctx.clip_path)), this.path = P(n, this.posX, -1 * this.pdf.internal.pageSize.height * (f - 1) + this.posY), k.call(this, t, !0), this.path = y } r = JSON.parse(JSON.stringify(h)), this.path = P(r, this.posX, -1 * this.pdf.internal.pageSize.height * (f - 1) + this.posY), !1 !== e && 0 !== f || k.call(this, t, e) } } else k.call(this, t, e); this.path = h }, k = function (t, e) { if (("stroke" !== t || e || !L.call(this)) && ("stroke" === t || e || !N.call(this))) { var n = []; this.ctx.globalAlpha; this.ctx.fillOpacity < 1 && this.ctx.fillOpacity; for (var r, i = this.path, o = 0; o < i.length; o++) { var a = i[o]; switch (a.type) { case "begin": n.push({ begin: !0 }); break; case "close": n.push({ close: !0 }); break; case "mt": n.push({ start: a, deltas: [], abs: [] }); break; case "lt": var s = n.length; if (!isNaN(i[o - 1].x)) { var l = [a.x - i[o - 1].x, a.y - i[o - 1].y]; if (0 < s) for (; 0 <= s; s--)if (!0 !== n[s - 1].close && !0 !== n[s - 1].begin) { n[s - 1].deltas.push(l), n[s - 1].abs.push(a); break } } break; case "bct": l = [a.x1 - i[o - 1].x, a.y1 - i[o - 1].y, a.x2 - i[o - 1].x, a.y2 - i[o - 1].y, a.x - i[o - 1].x, a.y - i[o - 1].y]; n[n.length - 1].deltas.push(l); break; case "qct": var h = i[o - 1].x + 2 / 3 * (a.x1 - i[o - 1].x), u = i[o - 1].y + 2 / 3 * (a.y1 - i[o - 1].y), c = a.x + 2 / 3 * (a.x1 - a.x), f = a.y + 2 / 3 * (a.y1 - a.y), p = a.x, d = a.y; l = [h - i[o - 1].x, u - i[o - 1].y, c - i[o - 1].x, f - i[o - 1].y, p - i[o - 1].x, d - i[o - 1].y]; n[n.length - 1].deltas.push(l); break; case "arc": n.push({ deltas: [], abs: [], arc: !0 }), Array.isArray(n[n.length - 1].abs) && n[n.length - 1].abs.push(a) } } r = e ? null : "stroke" === t ? "stroke" : "fill"; for (o = 0; o < n.length; o++) { if (n[o].arc) for (var g = n[o].abs, m = 0; m < g.length; m++) { var y = g[m]; if (void 0 !== y.startAngle) { var v = B(y.startAngle), w = B(y.endAngle), b = y.x, x = y.y; A.call(this, b, x, y.radius, v, w, y.counterclockwise, r, e) } else I.call(this, y.x, y.y) } if (!n[o].arc && !0 !== n[o].close && !0 !== n[o].begin) { b = n[o].start.x, x = n[o].start.y; C.call(this, n[o].deltas, b, x, null, null) } } r && S.call(this, r), e && _.call(this) } }, a = function (t) { var e = this.pdf.internal.getFontSize() / this.pdf.internal.scaleFactor, n = e * (this.pdf.internal.getLineHeightFactor() - 1); switch (this.ctx.textBaseline) { case "bottom": return t - n; case "top": return t + e - n; case "hanging": return t + e - 2 * n; case "middle": return t + e / 2 - n; case "ideographic": return t; case "alphabetic": default: return t } }; n.prototype.createLinearGradient = function () { var t = function () { }; return t.colorStops = [], t.addColorStop = function (t, e) { this.colorStops.push([t, e]) }, t.getColor = function () { return 0 === this.colorStops.length ? "#000000" : this.colorStops[0][1] }, t.isCanvasGradient = !0, t }, n.prototype.createPattern = function () { return this.createLinearGradient() }, n.prototype.createRadialGradient = function () { return this.createLinearGradient() }; var A = function (t, e, n, r, i, o, a, s) { this.pdf.internal.scaleFactor; for (var l = y(r), h = y(i), u = g.call(this, n, l, h, o), c = 0; c < u.length; c++) { var f = u[c]; 0 === c && p.call(this, f.x1 + t, f.y1 + e), d.call(this, t, e, f.x2, f.y2, f.x3, f.y3, f.x4, f.y4) } s ? _.call(this) : S.call(this, a) }, S = function (t) { switch (t) { case "stroke": this.pdf.internal.out("S"); break; case "fill": this.pdf.internal.out("f") } }, _ = function () { this.pdf.clip() }, p = function (t, e) { this.pdf.internal.out(i(t) + " " + o(e) + " m") }, s = function (t) { var e; switch (t.align) { case "right": case "end": e = "right"; break; case "center": e = "center"; break; case "left": case "start": default: e = "left" }var n = this.ctx.transform.applyToPoint(new j(t.x, t.y)), r = this.ctx.transform.decompose(), i = new M; i = (i = (i = i.multiply(r.translate)).multiply(r.skew)).multiply(r.scale); for (var o, a = this.pdf.getTextDimensions(t.text), s = this.ctx.transform.applyToRectangle(new E(t.x, t.y, a.w, a.h)), l = i.applyToRectangle(new E(t.x, t.y - a.h, a.w, a.h)), h = F.call(this, l), u = [], c = 0; c < h.length; c += 1)-1 === u.indexOf(h[c]) && u.push(h[c]); if (u.sort(), !0 === this.autoPaging) for (var f = u[0], p = u[u.length - 1], d = f; d < p + 1; d++) { if (this.pdf.setPage(d), 0 !== this.ctx.clip_path.length) { var g = this.path; o = JSON.parse(JSON.stringify(this.ctx.clip_path)), this.path = P(o, this.posX, -1 * this.pdf.internal.pageSize.height * (d - 1) + this.posY), k.call(this, "fill", !0), this.path = g } var m = JSON.parse(JSON.stringify(s)); if (m = P([m], this.posX, -1 * this.pdf.internal.pageSize.height * (d - 1) + this.posY)[0], .01 <= t.scale) { var y = this.pdf.internal.getFontSize(); this.pdf.setFontSize(y * t.scale) } this.pdf.text(t.text, m.x, m.y, { angle: t.angle, align: e, renderingMode: t.renderingMode, maxWidth: t.maxWidth }), .01 <= t.scale && this.pdf.setFontSize(y) } else { if (.01 <= t.scale) { y = this.pdf.internal.getFontSize(); this.pdf.setFontSize(y * t.scale) } this.pdf.text(t.text, n.x + this.posX, n.y + this.posY, { angle: t.angle, align: e, renderingMode: t.renderingMode, maxWidth: t.maxWidth }), .01 <= t.scale && this.pdf.setFontSize(y) } }, I = function (t, e, n, r) { n = n || 0, r = r || 0, this.pdf.internal.out(i(t + n) + " " + o(e + r) + " l") }, C = function (t, e, n) { return this.pdf.lines(t, e, n, null, null) }, d = function (t, e, n, r, i, o, a, s) { this.pdf.internal.out([l(h(n + t)), l(u(r + e)), l(h(i + t)), l(u(o + e)), l(h(a + t)), l(u(s + e)), "c"].join(" ")) }, g = function (t, e, n, r) { var i = 2 * Math.PI, o = e; (o < i || i < o) && (o %= i); var a = n; (a < i || i < a) && (a %= i); for (var s = [], l = Math.PI / 2, h = r ? -1 : 1, u = e, c = Math.min(i, Math.abs(a - o)); 1e-5 < c;) { var f = u + h * Math.min(c, l); s.push(m.call(this, t, u, f)), c -= Math.abs(f - u), u = f } return s }, m = function (t, e, n) { var r = (n - e) / 2, i = t * Math.cos(r), o = t * Math.sin(r), a = i, s = -o, l = a * a + s * s, h = l + a * i + s * o, u = 4 / 3 * (Math.sqrt(2 * l * h) - h) / (a * o - s * i), c = a - u * s, f = s + u * a, p = c, d = -f, g = r + e, m = Math.cos(g), y = Math.sin(g); return { x1: t * Math.cos(e), y1: t * Math.sin(e), x2: c * m - f * y, y2: c * y + f * m, x3: p * m - d * y, y3: p * y + d * m, x4: t * Math.cos(n), y4: t * Math.sin(n) } }, B = function (t) { return 180 * t / Math.PI }, y = function (t) { return t * Math.PI / 180 }, w = function (t, e, n, r, i, o) { var a = t + .5 * (n - t), s = e + .5 * (r - e), l = i + .5 * (n - i), h = o + .5 * (r - o), u = Math.min(t, i, a, l), c = Math.max(t, i, a, l), f = Math.min(e, o, s, h), p = Math.max(e, o, s, h); return new E(u, f, c - u, p - f) }, b = function (t, e, n, r, i, o, a, s) { for (var l, h, u, c, f, p, d, g, m, y, v, w, b, x = n - t, N = r - e, L = i - n, A = o - r, S = a - i, _ = s - o, F = 0; F < 41; F++)g = (p = (h = t + (l = F / 40) * x) + l * ((c = n + l * L) - h)) + l * (c + l * (i + l * S - c) - p), m = (d = (u = e + l * N) + l * ((f = r + l * A) - u)) + l * (f + l * (o + l * _ - f) - d), b = 0 == F ? (w = y = g, v = m) : (y = Math.min(y, g), v = Math.min(v, m), w = Math.max(w, g), Math.max(b, m)); return new E(Math.round(y), Math.round(v), Math.round(w - y), Math.round(b - v)) }, j = function (t, e) { var n = t || 0; Object.defineProperty(this, "x", { enumerable: !0, get: function () { return n }, set: function (t) { isNaN(t) || (n = parseFloat(t)) } }); var r = e || 0; Object.defineProperty(this, "y", { enumerable: !0, get: function () { return r }, set: function (t) { isNaN(t) || (r = parseFloat(t)) } }); var i = "pt"; return Object.defineProperty(this, "type", { enumerable: !0, get: function () { return i }, set: function (t) { i = t.toString() } }), this }, E = function (t, e, n, r) { j.call(this, t, e), this.type = "rect"; var i = n || 0; Object.defineProperty(this, "w", { enumerable: !0, get: function () { return i }, set: function (t) { isNaN(t) || (i = parseFloat(t)) } }); var o = r || 0; return Object.defineProperty(this, "h", { enumerable: !0, get: function () { return o }, set: function (t) { isNaN(t) || (o = parseFloat(t)) } }), this }, M = function (t, e, n, r, i, o) { var a = []; return Object.defineProperty(this, "sx", { get: function () { return a[0] }, set: function (t) { a[0] = Math.round(1e5 * t) / 1e5 } }), Object.defineProperty(this, "shy", { get: function () { return a[1] }, set: function (t) { a[1] = Math.round(1e5 * t) / 1e5 } }), Object.defineProperty(this, "shx", { get: function () { return a[2] }, set: function (t) { a[2] = Math.round(1e5 * t) / 1e5 } }), Object.defineProperty(this, "sy", { get: function () { return a[3] }, set: function (t) { a[3] = Math.round(1e5 * t) / 1e5 } }), Object.defineProperty(this, "tx", { get: function () { return a[4] }, set: function (t) { a[4] = Math.round(1e5 * t) / 1e5 } }), Object.defineProperty(this, "ty", { get: function () { return a[5] }, set: function (t) { a[5] = Math.round(1e5 * t) / 1e5 } }), Object.defineProperty(this, "rotation", { get: function () { return Math.atan2(this.shx, this.sx) } }), Object.defineProperty(this, "scaleX", { get: function () { return this.decompose().scale.sx } }), Object.defineProperty(this, "scaleY", { get: function () { return this.decompose().scale.sy } }), Object.defineProperty(this, "isIdentity", { get: function () { return 1 === this.sx && (0 === this.shy && (0 === this.shx && (1 === this.sy && (0 === this.tx && 0 === this.ty)))) } }), this.sx = isNaN(t) ? 1 : t, this.shy = isNaN(e) ? 0 : e, this.shx = isNaN(n) ? 0 : n, this.sy = isNaN(r) ? 1 : r, this.tx = isNaN(i) ? 0 : i, this.ty = isNaN(o) ? 0 : o, this }; M.prototype.multiply = function (t) { var e = t.sx * this.sx + t.shy * this.shx, n = t.sx * this.shy + t.shy * this.sy, r = t.shx * this.sx + t.sy * this.shx, i = t.shx * this.shy + t.sy * this.sy, o = t.tx * this.sx + t.ty * this.shx + this.tx, a = t.tx * this.shy + t.ty * this.sy + this.ty; return new M(e, n, r, i, o, a) }, M.prototype.decompose = function () { var t = this.sx, e = this.shy, n = this.shx, r = this.sy, i = this.tx, o = this.ty, a = Math.sqrt(t * t + e * e), s = (t /= a) * n + (e /= a) * r; n -= t * s, r -= e * s; var l = Math.sqrt(n * n + r * r); return s /= l, t * (r /= l) < e * (n /= l) && (t = -t, e = -e, s = -s, a = -a), { scale: new M(a, 0, 0, l, 0, 0), translate: new M(1, 0, 0, 1, i, o), rotate: new M(t, e, -e, t, 0, 0), skew: new M(1, 0, s, 1, 0, 0) } }, M.prototype.applyToPoint = function (t) { var e = t.x * this.sx + t.y * this.shx + this.tx, n = t.x * this.shy + t.y * this.sy + this.ty; return new j(e, n) }, M.prototype.applyToRectangle = function (t) { var e = this.applyToPoint(t), n = this.applyToPoint(new j(t.x + t.w, t.y + t.h)); return new E(e.x, e.y, n.x - e.x, n.y - e.y) }, M.prototype.clone = function () { var t = this.sx, e = this.shy, n = this.shx, r = this.sy, i = this.tx, o = this.ty; return new M(t, e, n, r, i, o) } }(lt.API, "undefined" != typeof self && self || "undefined" != typeof window && window || "undefined" != typeof global && global || Function('return typeof this === "object" && this.content')() || Function("return this")()),
        /**
           * jsPDF filters PlugIn
           * Copyright (c) 2014 Aras Abbasi 
           *
           * Licensed under the MIT License.
           * http://opensource.org/licenses/mit-license
           */
        a = lt.API, o = function (t) { var r, e, n, i, o, a, s, l, h, u; for (/[^\x00-\xFF]/.test(t), e = [], n = 0, i = (t += r = "\0\0\0\0".slice(t.length % 4 || 4)).length; n < i; n += 4)0 !== (o = (t.charCodeAt(n) << 24) + (t.charCodeAt(n + 1) << 16) + (t.charCodeAt(n + 2) << 8) + t.charCodeAt(n + 3)) ? (a = (o = ((o = ((o = ((o = (o - (u = o % 85)) / 85) - (h = o % 85)) / 85) - (l = o % 85)) / 85) - (s = o % 85)) / 85) % 85, e.push(a + 33, s + 33, l + 33, h + 33, u + 33)) : e.push(122); return function (t, e) { for (var n = r.length; 0 < n; n--)t.pop() }(e), String.fromCharCode.apply(String, e) + "~>" }, s = function (t) { var r, e, n, i, o, a = String, s = "length", l = "charCodeAt", h = "slice", u = "replace"; for (t[h](-2), t = t[h](0, -2)[u](/\s/g, "")[u]("z", "!!!!!"), n = [], i = 0, o = (t += r = "uuuuu"[h](t[s] % 5 || 5))[s]; i < o; i += 5)e = 52200625 * (t[l](i) - 33) + 614125 * (t[l](i + 1) - 33) + 7225 * (t[l](i + 2) - 33) + 85 * (t[l](i + 3) - 33) + (t[l](i + 4) - 33), n.push(255 & e >> 24, 255 & e >> 16, 255 & e >> 8, 255 & e); return function (t, e) { for (var n = r[s]; 0 < n; n--)t.pop() }(n), a.fromCharCode.apply(a, n) }, h = function (t) { for (var e = "", n = 0; n < t.length; n += 1)e += ("0" + t.charCodeAt(n).toString(16)).slice(-2); return e += ">" }, u = function (t) { var e = new RegExp(/^([0-9A-Fa-f]{2})+$/); if (-1 !== (t = t.replace(/\s/g, "")).indexOf(">") && (t = t.substr(0, t.indexOf(">"))), t.length % 2 && (t += "0"), !1 === e.test(t)) return ""; for (var n = "", r = 0; r < t.length; r += 2)n += String.fromCharCode("0x" + (t[r] + t[r + 1])); return n }, c = function (t, e) { e = Object.assign({ predictor: 1, colors: 1, bitsPerComponent: 8, columns: 1 }, e); for (var n, r, i = [], o = t.length; o--;)i[o] = t.charCodeAt(o); return n = a.adler32cs.from(t), (r = new Deflater(6)).append(new Uint8Array(i)), t = r.flush(), (i = new Uint8Array(t.length + 6)).set(new Uint8Array([120, 156])), i.set(t, 2), i.set(new Uint8Array([255 & n, n >> 8 & 255, n >> 16 & 255, n >> 24 & 255]), t.length + 2), t = String.fromCharCode.apply(null, i) }, a.processDataByFilters = function (t, e) { var n = 0, r = t || "", i = []; for ("string" == typeof (e = e || []) && (e = [e]), n = 0; n < e.length; n += 1)switch (e[n]) { case "ASCII85Decode": case "/ASCII85Decode": r = s(r), i.push("/ASCII85Encode"); break; case "ASCII85Encode": case "/ASCII85Encode": r = o(r), i.push("/ASCII85Decode"); break; case "ASCIIHexDecode": case "/ASCIIHexDecode": r = u(r), i.push("/ASCIIHexEncode"); break; case "ASCIIHexEncode": case "/ASCIIHexEncode": r = h(r), i.push("/ASCIIHexDecode"); break; case "FlateEncode": case "/FlateEncode": r = c(r), i.push("/FlateDecode"); break; default: throw 'The filter: "' + e[n] + '" is not implemented' }return { data: r, reverseChain: i.reverse().join(" ") } }, (
            /**
               * jsPDF fileloading PlugIn
               * Copyright (c) 2018 Aras Abbasi (aras.abbasi@gmail.com)
               *
               * Licensed under the MIT License.
               * http://opensource.org/licenses/mit-license
               */
            r = lt.API).loadFile = function (t, e, n) { var r; e = e || !0, n = n || function () { }; try { r = function (t, e, n) { var r = new XMLHttpRequest, i = [], o = 0, a = function (t) { var e = t.length, n = String.fromCharCode; for (o = 0; o < e; o += 1)i.push(n(255 & t.charCodeAt(o))); return i.join("") }; if (r.open("GET", t, !e), r.overrideMimeType("text/plain; charset=x-user-defined"), !1 === e && (r.onload = function () { return a(this.responseText) }), r.send(null), 200 === r.status) return e ? a(r.responseText) : void 0; console.warn('Unable to load file "' + t + '"') }(t, e) } catch (t) { r = void 0 } return r }, r.loadImageFile = r.loadFile,
        /**
           * Copyright (c) 2018 Erik Koopmans
           * Released under the MIT License.
           *
           * Licensed under the MIT License.
           * http://opensource.org/licenses/mit-license
           */
        i = lt.API, f = "undefined" != typeof window && window || "undefined" != typeof global && global, g = function (t) { var e = se(t); return "undefined" === e ? "undefined" : "string" === e || t instanceof String ? "string" : "number" === e || t instanceof Number ? "number" : "function" === e || t instanceof Function ? "function" : t && t.constructor === Array ? "array" : t && 1 === t.nodeType ? "element" : "object" === e ? "object" : "unknown" }, m = function (t, e) { var n = document.createElement(t); if (e.className && (n.className = e.className), e.innerHTML) { n.innerHTML = e.innerHTML; for (var r = n.getElementsByTagName("script"), i = r.length; 0 < i--; null)r[i].parentNode.removeChild(r[i]) } for (var o in e.style) n.style[o] = e.style[o]; return n }, (((y = function t(e) { var n = Object.assign(t.convert(Promise.resolve()), JSON.parse(JSON.stringify(t.template))), r = t.convert(Promise.resolve(), n); return r = (r = r.setProgress(1, t, 1, [t])).set(e) }).prototype = Object.create(Promise.prototype)).constructor = y).convert = function (t, e) { return t.__proto__ = e || y.prototype, t }, y.template = { prop: { src: null, container: null, overlay: null, canvas: null, img: null, pdf: null, pageSize: null, callback: function () { } }, progress: { val: 0, state: null, n: 0, stack: [] }, opt: { filename: "file.pdf", margin: [0, 0, 0, 0], enableLinks: !0, x: 0, y: 0, html2canvas: {}, jsPDF: {} } }, y.prototype.from = function (t, e) { return this.then(function () { switch (e = e || function (t) { switch (g(t)) { case "string": return "string"; case "element": return "canvas" === t.nodeName.toLowerCase ? "canvas" : "element"; default: return "unknown" } }(t)) { case "string": return this.set({ src: m("div", { innerHTML: t }) }); case "element": return this.set({ src: t }); case "canvas": return this.set({ canvas: t }); case "img": return this.set({ img: t }); default: return this.error("Unknown source type.") } }) }, y.prototype.to = function (t) { switch (t) { case "container": return this.toContainer(); case "canvas": return this.toCanvas(); case "img": return this.toImg(); case "pdf": return this.toPdf(); default: return this.error("Invalid target.") } }, y.prototype.toContainer = function () { return this.thenList([function () { return this.prop.src || this.error("Cannot duplicate - no source HTML.") }, function () { return this.prop.pageSize || this.setPageSize() }]).then(function () { var t = { position: "relative", display: "inline-block", width: Math.max(this.prop.src.clientWidth, this.prop.src.scrollWidth, this.prop.src.offsetWidth) + "px", left: 0, right: 0, top: 0, margin: "auto", backgroundColor: "white" }, e = function t(e, n) { for (var r = 3 === e.nodeType ? document.createTextNode(e.nodeValue) : e.cloneNode(!1), i = e.firstChild; i; i = i.nextSibling)!0 !== n && 1 === i.nodeType && "SCRIPT" === i.nodeName || r.appendChild(t(i, n)); return 1 === e.nodeType && ("CANVAS" === e.nodeName ? (r.width = e.width, r.height = e.height, r.getContext("2d").drawImage(e, 0, 0)) : "TEXTAREA" !== e.nodeName && "SELECT" !== e.nodeName || (r.value = e.value), r.addEventListener("load", function () { r.scrollTop = e.scrollTop, r.scrollLeft = e.scrollLeft }, !0)), r }(this.prop.src, this.opt.html2canvas.javascriptEnabled); "BODY" === e.tagName && (t.height = Math.max(document.body.scrollHeight, document.body.offsetHeight, document.documentElement.clientHeight, document.documentElement.scrollHeight, document.documentElement.offsetHeight) + "px"), this.prop.overlay = m("div", { className: "html2pdf__overlay", style: { position: "fixed", overflow: "hidden", zIndex: 1e3, left: "-100000px", right: 0, bottom: 0, top: 0 } }), this.prop.container = m("div", { className: "html2pdf__container", style: t }), this.prop.container.appendChild(e), this.prop.container.firstChild.appendChild(m("div", { style: { clear: "both", border: "0 none transparent", margin: 0, padding: 0, height: 0 } })), this.prop.container.style.float = "none", this.prop.overlay.appendChild(this.prop.container), document.body.appendChild(this.prop.overlay), this.prop.container.firstChild.style.position = "relative", this.prop.container.height = Math.max(this.prop.container.firstChild.clientHeight, this.prop.container.firstChild.scrollHeight, this.prop.container.firstChild.offsetHeight) + "px" }) }, y.prototype.toCanvas = function () { var t = [function () { return document.body.contains(this.prop.container) || this.toContainer() }]; return this.thenList(t).then(function () { var t = Object.assign({}, this.opt.html2canvas); if (delete t.onrendered, this.isHtml2CanvasLoaded()) return html2canvas(this.prop.container, t) }).then(function (t) { (this.opt.html2canvas.onrendered || function () { })(t), this.prop.canvas = t, document.body.removeChild(this.prop.overlay) }) }, y.prototype.toContext2d = function () { var t = [function () { return document.body.contains(this.prop.container) || this.toContainer() }]; return this.thenList(t).then(function () { var t = this.opt.jsPDF, e = Object.assign({ async: !0, allowTaint: !0, backgroundColor: "#ffffff", imageTimeout: 15e3, logging: !0, proxy: null, removeContainer: !0, foreignObjectRendering: !1, useCORS: !1 }, this.opt.html2canvas); if (delete e.onrendered, t.context2d.autoPaging = !0, t.context2d.posX = this.opt.x, t.context2d.posY = this.opt.y, e.windowHeight = e.windowHeight || 0, e.windowHeight = 0 == e.windowHeight ? Math.max(this.prop.container.clientHeight, this.prop.container.scrollHeight, this.prop.container.offsetHeight) : e.windowHeight, this.isHtml2CanvasLoaded()) return html2canvas(this.prop.container, e) }).then(function (t) { (this.opt.html2canvas.onrendered || function () { })(t), this.prop.canvas = t, document.body.removeChild(this.prop.overlay) }) }, y.prototype.toImg = function () { return this.thenList([function () { return this.prop.canvas || this.toCanvas() }]).then(function () { var t = this.prop.canvas.toDataURL("image/" + this.opt.image.type, this.opt.image.quality); this.prop.img = document.createElement("img"), this.prop.img.src = t }) }, y.prototype.toPdf = function () { return this.thenList([function () { return this.toContext2d() }]).then(function () { this.prop.pdf = this.prop.pdf || this.opt.jsPDF }) }, y.prototype.output = function (t, e, n) { return "img" === (n = n || "pdf").toLowerCase() || "image" === n.toLowerCase() ? this.outputImg(t, e) : this.outputPdf(t, e) }, y.prototype.outputPdf = function (t, e) { return this.thenList([function () { return this.prop.pdf || this.toPdf() }]).then(function () { return this.prop.pdf.output(t, e) }) }, y.prototype.outputImg = function (t, e) { return this.thenList([function () { return this.prop.img || this.toImg() }]).then(function () { switch (t) { case void 0: case "img": return this.prop.img; case "datauristring": case "dataurlstring": return this.prop.img.src; case "datauri": case "dataurl": return document.location.href = this.prop.img.src; default: throw 'Image output type "' + t + '" is not supported.' } }) }, y.prototype.isHtml2CanvasLoaded = function () { var t = void 0 !== f.html2canvas; return t || console.error("html2canvas not loaded."), t }, y.prototype.save = function (t) { if (this.isHtml2CanvasLoaded()) return this.thenList([function () { return this.prop.pdf || this.toPdf() }]).set(t ? { filename: t } : null).then(function () { this.prop.pdf.save(this.opt.filename) }) }, y.prototype.doCallback = function (t) { if (this.isHtml2CanvasLoaded()) return this.thenList([function () { return this.prop.pdf || this.toPdf() }]).then(function () { this.prop.callback(this.prop.pdf) }) }, y.prototype.set = function (e) { if ("object" !== g(e)) return this; var t = Object.keys(e || {}).map(function (t) { if (t in y.template.prop) return function () { this.prop[t] = e[t] }; switch (t) { case "margin": return this.setMargin.bind(this, e.margin); case "jsPDF": return function () { return this.opt.jsPDF = e.jsPDF, this.setPageSize() }; case "pageSize": return this.setPageSize.bind(this, e.pageSize); default: return function () { this.opt[t] = e[t] } } }, this); return this.then(function () { return this.thenList(t) }) }, y.prototype.get = function (e, n) { return this.then(function () { var t = e in y.template.prop ? this.prop[e] : this.opt[e]; return n ? n(t) : t }) }, y.prototype.setMargin = function (t) { return this.then(function () { switch (g(t)) { case "number": t = [t, t, t, t]; case "array": if (2 === t.length && (t = [t[0], t[1], t[0], t[1]]), 4 === t.length) break; default: return this.error("Invalid margin array.") }this.opt.margin = t }).then(this.setPageSize) }, y.prototype.setPageSize = function (t) { function e(t, e) { return Math.floor(t * e / 72 * 96) } return this.then(function () { (t = t || lt.getPageSize(this.opt.jsPDF)).hasOwnProperty("inner") || (t.inner = { width: t.width - this.opt.margin[1] - this.opt.margin[3], height: t.height - this.opt.margin[0] - this.opt.margin[2] }, t.inner.px = { width: e(t.inner.width, t.k), height: e(t.inner.height, t.k) }, t.inner.ratio = t.inner.height / t.inner.width), this.prop.pageSize = t }) }, y.prototype.setProgress = function (t, e, n, r) { return null != t && (this.progress.val = t), null != e && (this.progress.state = e), null != n && (this.progress.n = n), null != r && (this.progress.stack = r), this.progress.ratio = this.progress.val / this.progress.state, this }, y.prototype.updateProgress = function (t, e, n, r) { return this.setProgress(t ? this.progress.val + t : null, e || null, n ? this.progress.n + n : null, r ? this.progress.stack.concat(r) : null) }, y.prototype.then = function (t, e) { var n = this; return this.thenCore(t, e, function (e, t) { return n.updateProgress(null, null, 1, [e]), Promise.prototype.then.call(this, function (t) { return n.updateProgress(null, e), t }).then(e, t).then(function (t) { return n.updateProgress(1), t }) }) }, y.prototype.thenCore = function (t, e, n) { n = n || Promise.prototype.then; var r = this; t && (t = t.bind(r)), e && (e = e.bind(r)); var i = -1 !== Promise.toString().indexOf("[native code]") && "Promise" === Promise.name ? r : y.convert(Object.assign({}, r), Promise.prototype), o = n.call(i, t, e); return y.convert(o, r.__proto__) }, y.prototype.thenExternal = function (t, e) { return Promise.prototype.then.call(this, t, e) }, y.prototype.thenList = function (t) { var e = this; return t.forEach(function (t) { e = e.thenCore(t) }), e }, y.prototype.catch = function (t) { t && (t = t.bind(this)); var e = Promise.prototype.catch.call(this, t); return y.convert(e, this) }, y.prototype.catchExternal = function (t) { return Promise.prototype.catch.call(this, t) }, y.prototype.error = function (t) { return this.then(function () { throw new Error(t) }) }, y.prototype.using = y.prototype.set, y.prototype.saveAs = y.prototype.save, y.prototype.export = y.prototype.output, y.prototype.run = y.prototype.then, lt.getPageSize = function (t, e, n) { if ("object" === se(t)) { var r = t; t = r.orientation, e = r.unit || e, n = r.format || n } e = e || "mm", n = n || "a4", t = ("" + (t || "P")).toLowerCase(); var i = ("" + n).toLowerCase(), o = { a0: [2383.94, 3370.39], a1: [1683.78, 2383.94], a2: [1190.55, 1683.78], a3: [841.89, 1190.55], a4: [595.28, 841.89], a5: [419.53, 595.28], a6: [297.64, 419.53], a7: [209.76, 297.64], a8: [147.4, 209.76], a9: [104.88, 147.4], a10: [73.7, 104.88], b0: [2834.65, 4008.19], b1: [2004.09, 2834.65], b2: [1417.32, 2004.09], b3: [1000.63, 1417.32], b4: [708.66, 1000.63], b5: [498.9, 708.66], b6: [354.33, 498.9], b7: [249.45, 354.33], b8: [175.75, 249.45], b9: [124.72, 175.75], b10: [87.87, 124.72], c0: [2599.37, 3676.54], c1: [1836.85, 2599.37], c2: [1298.27, 1836.85], c3: [918.43, 1298.27], c4: [649.13, 918.43], c5: [459.21, 649.13], c6: [323.15, 459.21], c7: [229.61, 323.15], c8: [161.57, 229.61], c9: [113.39, 161.57], c10: [79.37, 113.39], dl: [311.81, 623.62], letter: [612, 792], "government-letter": [576, 756], legal: [612, 1008], "junior-legal": [576, 360], ledger: [1224, 792], tabloid: [792, 1224], "credit-card": [153, 243] }; switch (e) { case "pt": var a = 1; break; case "mm": a = 72 / 25.4; break; case "cm": a = 72 / 2.54; break; case "in": a = 72; break; case "px": a = .75; break; case "pc": case "em": a = 12; break; case "ex": a = 6; break; default: throw "Invalid unit: " + e }if (o.hasOwnProperty(i)) var s = o[i][1] / a, l = o[i][0] / a; else try { s = n[1], l = n[0] } catch (t) { throw new Error("Invalid format: " + n) } if ("p" === t || "portrait" === t) { if (t = "p", s < l) { var h = l; l = s, s = h } } else { if ("l" !== t && "landscape" !== t) throw "Invalid orientation: " + t; t = "l", l < s && (h = l, l = s, s = h) } return { width: l, height: s, unit: e, k: a } }, i.html = function (t, e) { (e = e || {}).callback = e.callback || function () { }, e.html2canvas = e.html2canvas || {}, e.html2canvas.canvas = e.html2canvas.canvas || this.canvas, e.jsPDF = e.jsPDF || this, e.jsPDF; var n = new y(e); return e.worker ? n : n.from(t).doCallback() }, lt.API.addJS = function (t) { return b = t, this.internal.events.subscribe("postPutResources", function (t) { v = this.internal.newObject(), this.internal.out("<<"), this.internal.out("/Names [(EmbeddedJS) " + (v + 1) + " 0 R]"), this.internal.out(">>"), this.internal.out("endobj"), w = this.internal.newObject(), this.internal.out("<<"), this.internal.out("/S /JavaScript"), this.internal.out("/JS (" + b + ")"), this.internal.out(">>"), this.internal.out("endobj") }), this.internal.events.subscribe("putCatalog", function () { void 0 !== v && void 0 !== w && this.internal.out("/Names <</JavaScript " + v + " 0 R>>") }), this }, (
            /**
               * @license
               * Copyright (c) 2014 Steven Spungin (TwelveTone LLC)  steven@twelvetone.tv
               *
               * Licensed under the MIT License.
               * http://opensource.org/licenses/mit-license
               */
            x = lt.API).events.push(["postPutResources", function () { var t = this, e = /^(\d+) 0 obj$/; if (0 < this.outline.root.children.length) for (var n = t.outline.render().split(/\r\n/), r = 0; r < n.length; r++) { var i = n[r], o = e.exec(i); if (null != o) { var a = o[1]; t.internal.newObjectDeferredBegin(a, !1) } t.internal.write(i) } if (this.outline.createNamedDestinations) { var s = this.internal.pages.length, l = []; for (r = 0; r < s; r++) { var h = t.internal.newObject(); l.push(h); var u = t.internal.getPageInfo(r + 1); t.internal.write("<< /D[" + u.objId + " 0 R /XYZ null null null]>> endobj") } var c = t.internal.newObject(); for (t.internal.write("<< /Names [ "), r = 0; r < l.length; r++)t.internal.write("(page_" + (r + 1) + ")" + l[r] + " 0 R"); t.internal.write(" ] >>", "endobj"), t.internal.newObject(), t.internal.write("<< /Dests " + c + " 0 R"), t.internal.write(">>", "endobj") } }]), x.events.push(["putCatalog", function () { 0 < this.outline.root.children.length && (this.internal.write("/Outlines", this.outline.makeRef(this.outline.root)), this.outline.createNamedDestinations && this.internal.write("/Names " + namesOid + " 0 R")) }]), x.events.push(["initialized", function () { var a = this; a.outline = { createNamedDestinations: !1, root: { children: [] } }, a.outline.add = function (t, e, n) { var r = { title: e, options: n, children: [] }; return null == t && (t = this.root), t.children.push(r), r }, a.outline.render = function () { return this.ctx = {}, this.ctx.val = "", this.ctx.pdf = a, this.genIds_r(this.root), this.renderRoot(this.root), this.renderItems(this.root), this.ctx.val }, a.outline.genIds_r = function (t) { t.id = a.internal.newObjectDeferred(); for (var e = 0; e < t.children.length; e++)this.genIds_r(t.children[e]) }, a.outline.renderRoot = function (t) { this.objStart(t), this.line("/Type /Outlines"), 0 < t.children.length && (this.line("/First " + this.makeRef(t.children[0])), this.line("/Last " + this.makeRef(t.children[t.children.length - 1]))), this.line("/Count " + this.count_r({ count: 0 }, t)), this.objEnd() }, a.outline.renderItems = function (t) { this.ctx.pdf.internal.getCoordinateString; for (var e = this.ctx.pdf.internal.getVerticalCoordinateString, n = 0; n < t.children.length; n++) { var r = t.children[n]; this.objStart(r), this.line("/Title " + this.makeString(r.title)), this.line("/Parent " + this.makeRef(t)), 0 < n && this.line("/Prev " + this.makeRef(t.children[n - 1])), n < t.children.length - 1 && this.line("/Next " + this.makeRef(t.children[n + 1])), 0 < r.children.length && (this.line("/First " + this.makeRef(r.children[0])), this.line("/Last " + this.makeRef(r.children[r.children.length - 1]))); var i = this.count = this.count_r({ count: 0 }, r); if (0 < i && this.line("/Count " + i), r.options && r.options.pageNumber) { var o = a.internal.getPageInfo(r.options.pageNumber); this.line("/Dest [" + o.objId + " 0 R /XYZ 0 " + e(0) + " 0]") } this.objEnd() } for (n = 0; n < t.children.length; n++)r = t.children[n], this.renderItems(r) }, a.outline.line = function (t) { this.ctx.val += t + "\r\n" }, a.outline.makeRef = function (t) { return t.id + " 0 R" }, a.outline.makeString = function (t) { return "(" + a.internal.pdfEscape(t) + ")" }, a.outline.objStart = function (t) { this.ctx.val += "\r\n" + t.id + " 0 obj\r\n<<\r\n" }, a.outline.objEnd = function (t) { this.ctx.val += ">> \r\nendobj\r\n" }, a.outline.count_r = function (t, e) { for (var n = 0; n < e.children.length; n++)t.count++ , this.count_r(t, e.children[n]); return t.count } }]),
        /**
           * @license
           * 
           * Copyright (c) 2014 James Robb, https://github.com/jamesbrobb
           *
           * 
           * ====================================================================
           */
        I = lt.API, C = function () { var t = "function" == typeof Deflater; if (!t) throw new Error("requires deflate.js for compression"); return t }, B = function (t, e, n, r) { var i = 5, o = E; switch (r) { case I.image_compression.FAST: i = 3, o = j; break; case I.image_compression.MEDIUM: i = 6, o = M; break; case I.image_compression.SLOW: i = 9, o = O }t = A(t, e, n, o); var a = new Uint8Array(N(i)), s = L(t), l = new Deflater(i), h = l.append(t), u = l.flush(), c = a.length + h.length + u.length, f = new Uint8Array(c + 4); return f.set(a), f.set(h, a.length), f.set(u, a.length + h.length), f[c++] = s >>> 24 & 255, f[c++] = s >>> 16 & 255, f[c++] = s >>> 8 & 255, f[c++] = 255 & s, I.arrayBufferToBinaryString(f) }, N = function (t, e) { var n = Math.LOG2E * Math.log(32768) - 8 << 4 | 8, r = n << 8; return r |= Math.min(3, (e - 1 & 255) >> 1) << 6, r |= 0, [n, 255 & (r += 31 - r % 31)] }, L = function (t, e) { for (var n, r = 1, i = 0, o = t.length, a = 0; 0 < o;) { for (o -= n = e < o ? e : o; i += r += t[a++], --n;); r %= 65521, i %= 65521 } return (i << 16 | r) >>> 0 }, A = function (t, e, n, r) { for (var i, o, a, s = t.length / e, l = new Uint8Array(t.length + s), h = T(), u = 0; u < s; u++) { if (a = u * e, i = t.subarray(a, a + e), r) l.set(r(i, n, o), a + u); else { for (var c = 0, f = h.length, p = []; c < f; c++)p[c] = h[c](i, n, o); var d = R(p.concat()); l.set(p[d], a + u) } o = i } return l }, S = function (t, e, n) { var r = Array.apply([], t); return r.unshift(0), r }, j = function (t, e, n) { var r, i = [], o = 0, a = t.length; for (i[0] = 1; o < a; o++)r = t[o - e] || 0, i[o + 1] = t[o] - r + 256 & 255; return i }, E = function (t, e, n) { var r, i = [], o = 0, a = t.length; for (i[0] = 2; o < a; o++)r = n && n[o] || 0, i[o + 1] = t[o] - r + 256 & 255; return i }, M = function (t, e, n) { var r, i, o = [], a = 0, s = t.length; for (o[0] = 3; a < s; a++)r = t[a - e] || 0, i = n && n[a] || 0, o[a + 1] = t[a] + 256 - (r + i >>> 1) & 255; return o }, O = function (t, e, n) { var r, i, o, a, s = [], l = 0, h = t.length; for (s[0] = 4; l < h; l++)r = t[l - e] || 0, i = n && n[l] || 0, o = n && n[l - e] || 0, a = q(r, i, o), s[l + 1] = t[l] - a + 256 & 255; return s }, q = function (t, e, n) { var r = t + e - n, i = Math.abs(r - t), o = Math.abs(r - e), a = Math.abs(r - n); return i <= o && i <= a ? t : o <= a ? e : n }, T = function () { return [S, j, E, M, O] }, R = function (t) { for (var e, n, r, i = 0, o = t.length; i < o;)((e = D(t[i].slice(1))) < n || !n) && (n = e, r = i), i++; return r }, D = function (t) { for (var e = 0, n = t.length, r = 0; e < n;)r += Math.abs(t[e++]); return r }, I.processPNG = function (t, e, n, r, i) { var o, a, s, l, h, u, c = this.color_spaces.DEVICE_RGB, f = this.decode.FLATE_DECODE, p = 8; if (this.isArrayBuffer(t) && (t = new Uint8Array(t)), this.isArrayBufferView(t)) { if ("function" != typeof PNG || "function" != typeof kt) throw new Error("PNG support requires png.js and zlib.js"); if (t = (o = new PNG(t)).imgData, p = o.bits, c = o.colorSpace, l = o.colors, -1 !== [4, 6].indexOf(o.colorType)) { if (8 === o.bits) for (var d, g = (_ = 32 == o.pixelBitlength ? new Uint32Array(o.decodePixels().buffer) : 16 == o.pixelBitlength ? new Uint16Array(o.decodePixels().buffer) : new Uint8Array(o.decodePixels().buffer)).length, m = new Uint8Array(g * o.colors), y = new Uint8Array(g), v = o.pixelBitlength - o.bits, w = 0, b = 0; w < g; w++) { for (x = _[w], d = 0; d < v;)m[b++] = x >>> d & 255, d += o.bits; y[w] = x >>> d & 255 } if (16 === o.bits) { g = (_ = new Uint32Array(o.decodePixels().buffer)).length, m = new Uint8Array(g * (32 / o.pixelBitlength) * o.colors), y = new Uint8Array(g * (32 / o.pixelBitlength)); for (var x, N = 1 < o.colors, L = b = w = 0; w < g;)x = _[w++], m[b++] = x >>> 0 & 255, N && (m[b++] = x >>> 16 & 255, x = _[w++], m[b++] = x >>> 0 & 255), y[L++] = x >>> 16 & 255; p = 8 } r !== I.image_compression.NONE && C() ? (t = B(m, o.width * o.colors, o.colors, r), u = B(y, o.width, 1, r)) : (t = m, u = y, f = null) } if (3 === o.colorType && (c = this.color_spaces.INDEXED, h = o.palette, o.transparency.indexed)) { var A = o.transparency.indexed, S = 0; for (w = 0, g = A.length; w < g; ++w)S += A[w]; if ((S /= 255) == g - 1 && -1 !== A.indexOf(0)) s = [A.indexOf(0)]; else if (S !== g) { var _ = o.decodePixels(); for (y = new Uint8Array(_.length), w = 0, g = _.length; w < g; w++)y[w] = A[_[w]]; u = B(y, o.width, 1) } } var F = function (t) { var e; switch (t) { case I.image_compression.FAST: e = 11; break; case I.image_compression.MEDIUM: e = 13; break; case I.image_compression.SLOW: e = 14; break; default: e = 12 }return e }(r); return a = f === this.decode.FLATE_DECODE ? "/Predictor " + F + " /Colors " + l + " /BitsPerComponent " + p + " /Columns " + o.width : "/Colors " + l + " /BitsPerComponent " + p + " /Columns " + o.width, (this.isArrayBuffer(t) || this.isArrayBufferView(t)) && (t = this.arrayBufferToBinaryString(t)), (u && this.isArrayBuffer(u) || this.isArrayBufferView(u)) && (u = this.arrayBufferToBinaryString(u)), this.createImageInfo(t, o.width, o.height, c, p, f, e, n, a, s, h, u, F) } throw new Error("Unsupported PNG image data, try using JPEG instead.") }, (
            /**
               * @license
               * Copyright (c) 2017 Aras Abbasi 
               *
               * Licensed under the MIT License.
               * http://opensource.org/licenses/mit-license
               */
            U = lt.API).processGIF89A = function (t, e, n, r, i) { var o = new At(t), a = o.width, s = o.height, l = []; o.decodeAndBlitFrameRGBA(0, l); var h = { data: l, width: a, height: s }, u = new _t(100).encode(h, 100); return U.processJPEG.call(this, u, e, n, r) }, U.processGIF87A = U.processGIF89A, (
                /**
                   * Copyright (c) 2018 Aras Abbasi 
                   *
                   * Licensed under the MIT License.
                   * http://opensource.org/licenses/mit-license
                   */
                z = lt.API).processBMP = function (t, e, n, r, i) { var o = new Ft(t, !1), a = o.width, s = o.height, l = { data: o.getData(), width: a, height: s }, h = new _t(100).encode(l, 100); return z.processJPEG.call(this, h, e, n, r) }, lt.API.setLanguage = function (t) { return void 0 === this.internal.languageSettings && (this.internal.languageSettings = {}, this.internal.languageSettings.isSubscribed = !1), void 0 !== { af: "Afrikaans", sq: "Albanian", ar: "Arabic (Standard)", "ar-DZ": "Arabic (Algeria)", "ar-BH": "Arabic (Bahrain)", "ar-EG": "Arabic (Egypt)", "ar-IQ": "Arabic (Iraq)", "ar-JO": "Arabic (Jordan)", "ar-KW": "Arabic (Kuwait)", "ar-LB": "Arabic (Lebanon)", "ar-LY": "Arabic (Libya)", "ar-MA": "Arabic (Morocco)", "ar-OM": "Arabic (Oman)", "ar-QA": "Arabic (Qatar)", "ar-SA": "Arabic (Saudi Arabia)", "ar-SY": "Arabic (Syria)", "ar-TN": "Arabic (Tunisia)", "ar-AE": "Arabic (U.A.E.)", "ar-YE": "Arabic (Yemen)", an: "Aragonese", hy: "Armenian", as: "Assamese", ast: "Asturian", az: "Azerbaijani", eu: "Basque", be: "Belarusian", bn: "Bengali", bs: "Bosnian", br: "Breton", bg: "Bulgarian", my: "Burmese", ca: "Catalan", ch: "Chamorro", ce: "Chechen", zh: "Chinese", "zh-HK": "Chinese (Hong Kong)", "zh-CN": "Chinese (PRC)", "zh-SG": "Chinese (Singapore)", "zh-TW": "Chinese (Taiwan)", cv: "Chuvash", co: "Corsican", cr: "Cree", hr: "Croatian", cs: "Czech", da: "Danish", nl: "Dutch (Standard)", "nl-BE": "Dutch (Belgian)", en: "English", "en-AU": "English (Australia)", "en-BZ": "English (Belize)", "en-CA": "English (Canada)", "en-IE": "English (Ireland)", "en-JM": "English (Jamaica)", "en-NZ": "English (New Zealand)", "en-PH": "English (Philippines)", "en-ZA": "English (South Africa)", "en-TT": "English (Trinidad & Tobago)", "en-GB": "English (United Kingdom)", "en-US": "English (United States)", "en-ZW": "English (Zimbabwe)", eo: "Esperanto", et: "Estonian", fo: "Faeroese", fj: "Fijian", fi: "Finnish", fr: "French (Standard)", "fr-BE": "French (Belgium)", "fr-CA": "French (Canada)", "fr-FR": "French (France)", "fr-LU": "French (Luxembourg)", "fr-MC": "French (Monaco)", "fr-CH": "French (Switzerland)", fy: "Frisian", fur: "Friulian", gd: "Gaelic (Scots)", "gd-IE": "Gaelic (Irish)", gl: "Galacian", ka: "Georgian", de: "German (Standard)", "de-AT": "German (Austria)", "de-DE": "German (Germany)", "de-LI": "German (Liechtenstein)", "de-LU": "German (Luxembourg)", "de-CH": "German (Switzerland)", el: "Greek", gu: "Gujurati", ht: "Haitian", he: "Hebrew", hi: "Hindi", hu: "Hungarian", is: "Icelandic", id: "Indonesian", iu: "Inuktitut", ga: "Irish", it: "Italian (Standard)", "it-CH": "Italian (Switzerland)", ja: "Japanese", kn: "Kannada", ks: "Kashmiri", kk: "Kazakh", km: "Khmer", ky: "Kirghiz", tlh: "Klingon", ko: "Korean", "ko-KP": "Korean (North Korea)", "ko-KR": "Korean (South Korea)", la: "Latin", lv: "Latvian", lt: "Lithuanian", lb: "Luxembourgish", mk: "FYRO Macedonian", ms: "Malay", ml: "Malayalam", mt: "Maltese", mi: "Maori", mr: "Marathi", mo: "Moldavian", nv: "Navajo", ng: "Ndonga", ne: "Nepali", no: "Norwegian", nb: "Norwegian (Bokmal)", nn: "Norwegian (Nynorsk)", oc: "Occitan", or: "Oriya", om: "Oromo", fa: "Persian", "fa-IR": "Persian/Iran", pl: "Polish", pt: "Portuguese", "pt-BR": "Portuguese (Brazil)", pa: "Punjabi", "pa-IN": "Punjabi (India)", "pa-PK": "Punjabi (Pakistan)", qu: "Quechua", rm: "Rhaeto-Romanic", ro: "Romanian", "ro-MO": "Romanian (Moldavia)", ru: "Russian", "ru-MO": "Russian (Moldavia)", sz: "Sami (Lappish)", sg: "Sango", sa: "Sanskrit", sc: "Sardinian", sd: "Sindhi", si: "Singhalese", sr: "Serbian", sk: "Slovak", sl: "Slovenian", so: "Somani", sb: "Sorbian", es: "Spanish", "es-AR": "Spanish (Argentina)", "es-BO": "Spanish (Bolivia)", "es-CL": "Spanish (Chile)", "es-CO": "Spanish (Colombia)", "es-CR": "Spanish (Costa Rica)", "es-DO": "Spanish (Dominican Republic)", "es-EC": "Spanish (Ecuador)", "es-SV": "Spanish (El Salvador)", "es-GT": "Spanish (Guatemala)", "es-HN": "Spanish (Honduras)", "es-MX": "Spanish (Mexico)", "es-NI": "Spanish (Nicaragua)", "es-PA": "Spanish (Panama)", "es-PY": "Spanish (Paraguay)", "es-PE": "Spanish (Peru)", "es-PR": "Spanish (Puerto Rico)", "es-ES": "Spanish (Spain)", "es-UY": "Spanish (Uruguay)", "es-VE": "Spanish (Venezuela)", sx: "Sutu", sw: "Swahili", sv: "Swedish", "sv-FI": "Swedish (Finland)", "sv-SV": "Swedish (Sweden)", ta: "Tamil", tt: "Tatar", te: "Teluga", th: "Thai", tig: "Tigre", ts: "Tsonga", tn: "Tswana", tr: "Turkish", tk: "Turkmen", uk: "Ukrainian", hsb: "Upper Sorbian", ur: "Urdu", ve: "Venda", vi: "Vietnamese", vo: "Volapuk", wa: "Walloon", cy: "Welsh", xh: "Xhosa", ji: "Yiddish", zu: "Zulu" }[t] && (this.internal.languageSettings.languageCode = t, !1 === this.internal.languageSettings.isSubscribed && (this.internal.events.subscribe("putCatalog", function () { this.internal.write("/Lang (" + this.internal.languageSettings.languageCode + ")") }), this.internal.languageSettings.isSubscribed = !0)), this },
        /** @license
           * MIT license.
           * Copyright (c) 2012 Willow Systems Corporation, willow-systems.com
           *               2014 Diego Casorran, https://github.com/diegocr
           *
           * 
           * ====================================================================
           */
        H = lt.API, W = H.getCharWidthsArray = function (t, e) { var n, r, i, o = (e = e || {}).font || this.internal.getFont(), a = e.fontSize || this.internal.getFontSize(), s = e.charSpace || this.internal.getCharSpace(), l = e.widths ? e.widths : o.metadata.Unicode.widths, h = l.fof ? l.fof : 1, u = e.kerning ? e.kerning : o.metadata.Unicode.kerning, c = u.fof ? u.fof : 1, f = 0, p = l[0] || h, d = []; for (n = 0, r = t.length; n < r; n++)i = t.charCodeAt(n), "function" == typeof o.metadata.widthOfString ? d.push((o.metadata.widthOfGlyph(o.metadata.characterToGlyph(i)) + s * (1e3 / a) || 0) / 1e3) : d.push((l[i] || p) / h + (u[i] && u[i][f] || 0) / c), f = i; return d }, V = H.getArraySum = function (t) { for (var e = t.length, n = 0; e;)n += t[--e]; return n }, G = H.getStringUnitWidth = function (t, e) { var n = (e = e || {}).fontSize || this.internal.getFontSize(), r = e.font || this.internal.getFont(), i = e.charSpace || this.internal.getCharSpace(); return "function" == typeof r.metadata.widthOfString ? r.metadata.widthOfString(t, n, i) / n : V(W.apply(this, arguments)) }, Y = function (t, e, n, r) { for (var i = [], o = 0, a = t.length, s = 0; o !== a && s + e[o] < n;)s += e[o], o++; i.push(t.slice(0, o)); var l = o; for (s = 0; o !== a;)s + e[o] > r && (i.push(t.slice(l, o)), s = 0, l = o), s += e[o], o++; return l !== o && i.push(t.slice(l, o)), i }, J = function (t, e, n) { n || (n = {}); var r, i, o, a, s, l, h = [], u = [h], c = n.textIndent || 0, f = 0, p = 0, d = t.split(" "), g = W.apply(this, [" ", n])[0]; if (l = -1 === n.lineIndent ? d[0].length + 2 : n.lineIndent || 0) { var m = Array(l).join(" "), y = []; d.map(function (t) { 1 < (t = t.split(/\s*\n/)).length ? y = y.concat(t.map(function (t, e) { return (e && t.length ? "\n" : "") + t })) : y.push(t[0]) }), d = y, l = G.apply(this, [m, n]) } for (o = 0, a = d.length; o < a; o++) { var v = 0; if (r = d[o], l && "\n" == r[0] && (r = r.substr(1), v = 1), i = W.apply(this, [r, n]), e < c + f + (p = V(i)) || v) { if (e < p) { for (s = Y.apply(this, [r, i, e - (c + f), e]), h.push(s.shift()), h = [s.pop()]; s.length;)u.push([s.shift()]); p = V(i.slice(r.length - (h[0] ? h[0].length : 0))) } else h = [r]; u.push(h), c = p + l, f = g } else h.push(r), c += f + p, f = g } if (l) var w = function (t, e) { return (e ? m : "") + t.join(" ") }; else w = function (t) { return t.join(" ") }; return u.map(w) }, H.splitTextToSize = function (t, e, n) { var r, i = (n = n || {}).fontSize || this.internal.getFontSize(), o = function (t) { var e = { 0: 1 }, n = {}; if (t.widths && t.kerning) return { widths: t.widths, kerning: t.kerning }; var r = this.internal.getFont(t.fontName, t.fontStyle), i = "Unicode"; return r.metadata[i] ? { widths: r.metadata[i].widths || e, kerning: r.metadata[i].kerning || n } : { font: r.metadata, fontSize: this.internal.getFontSize(), charSpace: this.internal.getCharSpace() } }.call(this, n); r = Array.isArray(t) ? t : t.split(/\r?\n/); var a = 1 * this.internal.scaleFactor * e / i; o.textIndent = n.textIndent ? 1 * n.textIndent * this.internal.scaleFactor / i : 0, o.lineIndent = n.lineIndent; var s, l, h = []; for (s = 0, l = r.length; s < l; s++)h = h.concat(J.apply(this, [r[s], a, o])); return h },
        /** @license
           jsPDF standard_fonts_metrics plugin
           * Copyright (c) 2012 Willow Systems Corporation, willow-systems.com
           * MIT license.
           * 
           * ====================================================================
           */
        X = lt.API, Z = { codePages: ["WinAnsiEncoding"], WinAnsiEncoding: (K = function (t) { for (var e = "klmnopqrstuvwxyz", n = {}, r = 0; r < e.length; r++)n[e[r]] = "0123456789abcdef"[r]; var i, o, a, s, l, h = {}, u = 1, c = h, f = [], p = "", d = "", g = t.length - 1; for (r = 1; r != g;)l = t[r], r += 1, "'" == l ? o = o ? (s = o.join(""), i) : [] : o ? o.push(l) : "{" == l ? (f.push([c, s]), c = {}, s = i) : "}" == l ? ((a = f.pop())[0][a[1]] = c, s = i, c = a[0]) : "-" == l ? u = -1 : s === i ? n.hasOwnProperty(l) ? (p += n[l], s = parseInt(p, 16) * u, u = 1, p = "") : p += l : n.hasOwnProperty(l) ? (d += n[l], c[s] = parseInt(d, 16) * u, u = 1, s = i, d = "") : d += l; return h })("{19m8n201n9q201o9r201s9l201t9m201u8m201w9n201x9o201y8o202k8q202l8r202m9p202q8p20aw8k203k8t203t8v203u9v2cq8s212m9t15m8w15n9w2dw9s16k8u16l9u17s9z17x8y17y9y}") }, Q = { Unicode: { Courier: Z, "Courier-Bold": Z, "Courier-BoldOblique": Z, "Courier-Oblique": Z, Helvetica: Z, "Helvetica-Bold": Z, "Helvetica-BoldOblique": Z, "Helvetica-Oblique": Z, "Times-Roman": Z, "Times-Bold": Z, "Times-BoldItalic": Z, "Times-Italic": Z } }, $ = { Unicode: { "Courier-Oblique": K("{'widths'{k3w'fof'6o}'kerning'{'fof'-6o}}"), "Times-BoldItalic": K("{'widths'{k3o2q4ycx2r201n3m201o6o201s2l201t2l201u2l201w3m201x3m201y3m2k1t2l2r202m2n2n3m2o3m2p5n202q6o2r1w2s2l2t2l2u3m2v3t2w1t2x2l2y1t2z1w3k3m3l3m3m3m3n3m3o3m3p3m3q3m3r3m3s3m203t2l203u2l3v2l3w3t3x3t3y3t3z3m4k5n4l4m4m4m4n4m4o4s4p4m4q4m4r4s4s4y4t2r4u3m4v4m4w3x4x5t4y4s4z4s5k3x5l4s5m4m5n3r5o3x5p4s5q4m5r5t5s4m5t3x5u3x5v2l5w1w5x2l5y3t5z3m6k2l6l3m6m3m6n2w6o3m6p2w6q2l6r3m6s3r6t1w6u1w6v3m6w1w6x4y6y3r6z3m7k3m7l3m7m2r7n2r7o1w7p3r7q2w7r4m7s3m7t2w7u2r7v2n7w1q7x2n7y3t202l3mcl4mal2ram3man3mao3map3mar3mas2lat4uau1uav3maw3way4uaz2lbk2sbl3t'fof'6obo2lbp3tbq3mbr1tbs2lbu1ybv3mbz3mck4m202k3mcm4mcn4mco4mcp4mcq5ycr4mcs4mct4mcu4mcv4mcw2r2m3rcy2rcz2rdl4sdm4sdn4sdo4sdp4sdq4sds4sdt4sdu4sdv4sdw4sdz3mek3mel3mem3men3meo3mep3meq4ser2wes2wet2weu2wev2wew1wex1wey1wez1wfl3rfm3mfn3mfo3mfp3mfq3mfr3tfs3mft3rfu3rfv3rfw3rfz2w203k6o212m6o2dw2l2cq2l3t3m3u2l17s3x19m3m}'kerning'{cl{4qu5kt5qt5rs17ss5ts}201s{201ss}201t{cks4lscmscnscoscpscls2wu2yu201ts}201x{2wu2yu}2k{201ts}2w{4qx5kx5ou5qx5rs17su5tu}2x{17su5tu5ou}2y{4qx5kx5ou5qx5rs17ss5ts}'fof'-6ofn{17sw5tw5ou5qw5rs}7t{cksclscmscnscoscps4ls}3u{17su5tu5os5qs}3v{17su5tu5os5qs}7p{17su5tu}ck{4qu5kt5qt5rs17ss5ts}4l{4qu5kt5qt5rs17ss5ts}cm{4qu5kt5qt5rs17ss5ts}cn{4qu5kt5qt5rs17ss5ts}co{4qu5kt5qt5rs17ss5ts}cp{4qu5kt5qt5rs17ss5ts}6l{4qu5ou5qw5rt17su5tu}5q{ckuclucmucnucoucpu4lu}5r{ckuclucmucnucoucpu4lu}7q{cksclscmscnscoscps4ls}6p{4qu5ou5qw5rt17sw5tw}ek{4qu5ou5qw5rt17su5tu}el{4qu5ou5qw5rt17su5tu}em{4qu5ou5qw5rt17su5tu}en{4qu5ou5qw5rt17su5tu}eo{4qu5ou5qw5rt17su5tu}ep{4qu5ou5qw5rt17su5tu}es{17ss5ts5qs4qu}et{4qu5ou5qw5rt17sw5tw}eu{4qu5ou5qw5rt17ss5ts}ev{17ss5ts5qs4qu}6z{17sw5tw5ou5qw5rs}fm{17sw5tw5ou5qw5rs}7n{201ts}fo{17sw5tw5ou5qw5rs}fp{17sw5tw5ou5qw5rs}fq{17sw5tw5ou5qw5rs}7r{cksclscmscnscoscps4ls}fs{17sw5tw5ou5qw5rs}ft{17su5tu}fu{17su5tu}fv{17su5tu}fw{17su5tu}fz{cksclscmscnscoscps4ls}}}"), "Helvetica-Bold": K("{'widths'{k3s2q4scx1w201n3r201o6o201s1w201t1w201u1w201w3m201x3m201y3m2k1w2l2l202m2n2n3r2o3r2p5t202q6o2r1s2s2l2t2l2u2r2v3u2w1w2x2l2y1w2z1w3k3r3l3r3m3r3n3r3o3r3p3r3q3r3r3r3s3r203t2l203u2l3v2l3w3u3x3u3y3u3z3x4k6l4l4s4m4s4n4s4o4s4p4m4q3x4r4y4s4s4t1w4u3r4v4s4w3x4x5n4y4s4z4y5k4m5l4y5m4s5n4m5o3x5p4s5q4m5r5y5s4m5t4m5u3x5v2l5w1w5x2l5y3u5z3r6k2l6l3r6m3x6n3r6o3x6p3r6q2l6r3x6s3x6t1w6u1w6v3r6w1w6x5t6y3x6z3x7k3x7l3x7m2r7n3r7o2l7p3x7q3r7r4y7s3r7t3r7u3m7v2r7w1w7x2r7y3u202l3rcl4sal2lam3ran3rao3rap3rar3ras2lat4tau2pav3raw3uay4taz2lbk2sbl3u'fof'6obo2lbp3xbq3rbr1wbs2lbu2obv3rbz3xck4s202k3rcm4scn4sco4scp4scq6ocr4scs4mct4mcu4mcv4mcw1w2m2zcy1wcz1wdl4sdm4ydn4ydo4ydp4ydq4yds4ydt4sdu4sdv4sdw4sdz3xek3rel3rem3ren3reo3rep3req5ter3res3ret3reu3rev3rew1wex1wey1wez1wfl3xfm3xfn3xfo3xfp3xfq3xfr3ufs3xft3xfu3xfv3xfw3xfz3r203k6o212m6o2dw2l2cq2l3t3r3u2l17s4m19m3r}'kerning'{cl{4qs5ku5ot5qs17sv5tv}201t{2ww4wy2yw}201w{2ks}201x{2ww4wy2yw}2k{201ts201xs}2w{7qs4qu5kw5os5qw5rs17su5tu7tsfzs}2x{5ow5qs}2y{7qs4qu5kw5os5qw5rs17su5tu7tsfzs}'fof'-6o7p{17su5tu5ot}ck{4qs5ku5ot5qs17sv5tv}4l{4qs5ku5ot5qs17sv5tv}cm{4qs5ku5ot5qs17sv5tv}cn{4qs5ku5ot5qs17sv5tv}co{4qs5ku5ot5qs17sv5tv}cp{4qs5ku5ot5qs17sv5tv}6l{17st5tt5os}17s{2kwclvcmvcnvcovcpv4lv4wwckv}5o{2kucltcmtcntcotcpt4lt4wtckt}5q{2ksclscmscnscoscps4ls4wvcks}5r{2ks4ws}5t{2kwclvcmvcnvcovcpv4lv4wwckv}eo{17st5tt5os}fu{17su5tu5ot}6p{17ss5ts}ek{17st5tt5os}el{17st5tt5os}em{17st5tt5os}en{17st5tt5os}6o{201ts}ep{17st5tt5os}es{17ss5ts}et{17ss5ts}eu{17ss5ts}ev{17ss5ts}6z{17su5tu5os5qt}fm{17su5tu5os5qt}fn{17su5tu5os5qt}fo{17su5tu5os5qt}fp{17su5tu5os5qt}fq{17su5tu5os5qt}fs{17su5tu5os5qt}ft{17su5tu5ot}7m{5os}fv{17su5tu5ot}fw{17su5tu5ot}}}"), Courier: K("{'widths'{k3w'fof'6o}'kerning'{'fof'-6o}}"), "Courier-BoldOblique": K("{'widths'{k3w'fof'6o}'kerning'{'fof'-6o}}"), "Times-Bold": K("{'widths'{k3q2q5ncx2r201n3m201o6o201s2l201t2l201u2l201w3m201x3m201y3m2k1t2l2l202m2n2n3m2o3m2p6o202q6o2r1w2s2l2t2l2u3m2v3t2w1t2x2l2y1t2z1w3k3m3l3m3m3m3n3m3o3m3p3m3q3m3r3m3s3m203t2l203u2l3v2l3w3t3x3t3y3t3z3m4k5x4l4s4m4m4n4s4o4s4p4m4q3x4r4y4s4y4t2r4u3m4v4y4w4m4x5y4y4s4z4y5k3x5l4y5m4s5n3r5o4m5p4s5q4s5r6o5s4s5t4s5u4m5v2l5w1w5x2l5y3u5z3m6k2l6l3m6m3r6n2w6o3r6p2w6q2l6r3m6s3r6t1w6u2l6v3r6w1w6x5n6y3r6z3m7k3r7l3r7m2w7n2r7o2l7p3r7q3m7r4s7s3m7t3m7u2w7v2r7w1q7x2r7y3o202l3mcl4sal2lam3man3mao3map3mar3mas2lat4uau1yav3maw3tay4uaz2lbk2sbl3t'fof'6obo2lbp3rbr1tbs2lbu2lbv3mbz3mck4s202k3mcm4scn4sco4scp4scq6ocr4scs4mct4mcu4mcv4mcw2r2m3rcy2rcz2rdl4sdm4ydn4ydo4ydp4ydq4yds4ydt4sdu4sdv4sdw4sdz3rek3mel3mem3men3meo3mep3meq4ser2wes2wet2weu2wev2wew1wex1wey1wez1wfl3rfm3mfn3mfo3mfp3mfq3mfr3tfs3mft3rfu3rfv3rfw3rfz3m203k6o212m6o2dw2l2cq2l3t3m3u2l17s4s19m3m}'kerning'{cl{4qt5ks5ot5qy5rw17sv5tv}201t{cks4lscmscnscoscpscls4wv}2k{201ts}2w{4qu5ku7mu5os5qx5ru17su5tu}2x{17su5tu5ou5qs}2y{4qv5kv7mu5ot5qz5ru17su5tu}'fof'-6o7t{cksclscmscnscoscps4ls}3u{17su5tu5os5qu}3v{17su5tu5os5qu}fu{17su5tu5ou5qu}7p{17su5tu5ou5qu}ck{4qt5ks5ot5qy5rw17sv5tv}4l{4qt5ks5ot5qy5rw17sv5tv}cm{4qt5ks5ot5qy5rw17sv5tv}cn{4qt5ks5ot5qy5rw17sv5tv}co{4qt5ks5ot5qy5rw17sv5tv}cp{4qt5ks5ot5qy5rw17sv5tv}6l{17st5tt5ou5qu}17s{ckuclucmucnucoucpu4lu4wu}5o{ckuclucmucnucoucpu4lu4wu}5q{ckzclzcmzcnzcozcpz4lz4wu}5r{ckxclxcmxcnxcoxcpx4lx4wu}5t{ckuclucmucnucoucpu4lu4wu}7q{ckuclucmucnucoucpu4lu}6p{17sw5tw5ou5qu}ek{17st5tt5qu}el{17st5tt5ou5qu}em{17st5tt5qu}en{17st5tt5qu}eo{17st5tt5qu}ep{17st5tt5ou5qu}es{17ss5ts5qu}et{17sw5tw5ou5qu}eu{17sw5tw5ou5qu}ev{17ss5ts5qu}6z{17sw5tw5ou5qu5rs}fm{17sw5tw5ou5qu5rs}fn{17sw5tw5ou5qu5rs}fo{17sw5tw5ou5qu5rs}fp{17sw5tw5ou5qu5rs}fq{17sw5tw5ou5qu5rs}7r{cktcltcmtcntcotcpt4lt5os}fs{17sw5tw5ou5qu5rs}ft{17su5tu5ou5qu}7m{5os}fv{17su5tu5ou5qu}fw{17su5tu5ou5qu}fz{cksclscmscnscoscps4ls}}}"), Symbol: K("{'widths'{k3uaw4r19m3m2k1t2l2l202m2y2n3m2p5n202q6o3k3m2s2l2t2l2v3r2w1t3m3m2y1t2z1wbk2sbl3r'fof'6o3n3m3o3m3p3m3q3m3r3m3s3m3t3m3u1w3v1w3w3r3x3r3y3r3z2wbp3t3l3m5v2l5x2l5z3m2q4yfr3r7v3k7w1o7x3k}'kerning'{'fof'-6o}}"), Helvetica: K("{'widths'{k3p2q4mcx1w201n3r201o6o201s1q201t1q201u1q201w2l201x2l201y2l2k1w2l1w202m2n2n3r2o3r2p5t202q6o2r1n2s2l2t2l2u2r2v3u2w1w2x2l2y1w2z1w3k3r3l3r3m3r3n3r3o3r3p3r3q3r3r3r3s3r203t2l203u2l3v1w3w3u3x3u3y3u3z3r4k6p4l4m4m4m4n4s4o4s4p4m4q3x4r4y4s4s4t1w4u3m4v4m4w3r4x5n4y4s4z4y5k4m5l4y5m4s5n4m5o3x5p4s5q4m5r5y5s4m5t4m5u3x5v1w5w1w5x1w5y2z5z3r6k2l6l3r6m3r6n3m6o3r6p3r6q1w6r3r6s3r6t1q6u1q6v3m6w1q6x5n6y3r6z3r7k3r7l3r7m2l7n3m7o1w7p3r7q3m7r4s7s3m7t3m7u3m7v2l7w1u7x2l7y3u202l3rcl4mal2lam3ran3rao3rap3rar3ras2lat4tau2pav3raw3uay4taz2lbk2sbl3u'fof'6obo2lbp3rbr1wbs2lbu2obv3rbz3xck4m202k3rcm4mcn4mco4mcp4mcq6ocr4scs4mct4mcu4mcv4mcw1w2m2ncy1wcz1wdl4sdm4ydn4ydo4ydp4ydq4yds4ydt4sdu4sdv4sdw4sdz3xek3rel3rem3ren3reo3rep3req5ter3mes3ret3reu3rev3rew1wex1wey1wez1wfl3rfm3rfn3rfo3rfp3rfq3rfr3ufs3xft3rfu3rfv3rfw3rfz3m203k6o212m6o2dw2l2cq2l3t3r3u1w17s4m19m3r}'kerning'{5q{4wv}cl{4qs5kw5ow5qs17sv5tv}201t{2wu4w1k2yu}201x{2wu4wy2yu}17s{2ktclucmucnu4otcpu4lu4wycoucku}2w{7qs4qz5k1m17sy5ow5qx5rsfsu5ty7tufzu}2x{17sy5ty5oy5qs}2y{7qs4qz5k1m17sy5ow5qx5rsfsu5ty7tufzu}'fof'-6o7p{17sv5tv5ow}ck{4qs5kw5ow5qs17sv5tv}4l{4qs5kw5ow5qs17sv5tv}cm{4qs5kw5ow5qs17sv5tv}cn{4qs5kw5ow5qs17sv5tv}co{4qs5kw5ow5qs17sv5tv}cp{4qs5kw5ow5qs17sv5tv}6l{17sy5ty5ow}do{17st5tt}4z{17st5tt}7s{fst}dm{17st5tt}dn{17st5tt}5o{ckwclwcmwcnwcowcpw4lw4wv}dp{17st5tt}dq{17st5tt}7t{5ow}ds{17st5tt}5t{2ktclucmucnu4otcpu4lu4wycoucku}fu{17sv5tv5ow}6p{17sy5ty5ow5qs}ek{17sy5ty5ow}el{17sy5ty5ow}em{17sy5ty5ow}en{5ty}eo{17sy5ty5ow}ep{17sy5ty5ow}es{17sy5ty5qs}et{17sy5ty5ow5qs}eu{17sy5ty5ow5qs}ev{17sy5ty5ow5qs}6z{17sy5ty5ow5qs}fm{17sy5ty5ow5qs}fn{17sy5ty5ow5qs}fo{17sy5ty5ow5qs}fp{17sy5ty5qs}fq{17sy5ty5ow5qs}7r{5ow}fs{17sy5ty5ow5qs}ft{17sv5tv5ow}7m{5ow}fv{17sv5tv5ow}fw{17sv5tv5ow}}}"), "Helvetica-BoldOblique": K("{'widths'{k3s2q4scx1w201n3r201o6o201s1w201t1w201u1w201w3m201x3m201y3m2k1w2l2l202m2n2n3r2o3r2p5t202q6o2r1s2s2l2t2l2u2r2v3u2w1w2x2l2y1w2z1w3k3r3l3r3m3r3n3r3o3r3p3r3q3r3r3r3s3r203t2l203u2l3v2l3w3u3x3u3y3u3z3x4k6l4l4s4m4s4n4s4o4s4p4m4q3x4r4y4s4s4t1w4u3r4v4s4w3x4x5n4y4s4z4y5k4m5l4y5m4s5n4m5o3x5p4s5q4m5r5y5s4m5t4m5u3x5v2l5w1w5x2l5y3u5z3r6k2l6l3r6m3x6n3r6o3x6p3r6q2l6r3x6s3x6t1w6u1w6v3r6w1w6x5t6y3x6z3x7k3x7l3x7m2r7n3r7o2l7p3x7q3r7r4y7s3r7t3r7u3m7v2r7w1w7x2r7y3u202l3rcl4sal2lam3ran3rao3rap3rar3ras2lat4tau2pav3raw3uay4taz2lbk2sbl3u'fof'6obo2lbp3xbq3rbr1wbs2lbu2obv3rbz3xck4s202k3rcm4scn4sco4scp4scq6ocr4scs4mct4mcu4mcv4mcw1w2m2zcy1wcz1wdl4sdm4ydn4ydo4ydp4ydq4yds4ydt4sdu4sdv4sdw4sdz3xek3rel3rem3ren3reo3rep3req5ter3res3ret3reu3rev3rew1wex1wey1wez1wfl3xfm3xfn3xfo3xfp3xfq3xfr3ufs3xft3xfu3xfv3xfw3xfz3r203k6o212m6o2dw2l2cq2l3t3r3u2l17s4m19m3r}'kerning'{cl{4qs5ku5ot5qs17sv5tv}201t{2ww4wy2yw}201w{2ks}201x{2ww4wy2yw}2k{201ts201xs}2w{7qs4qu5kw5os5qw5rs17su5tu7tsfzs}2x{5ow5qs}2y{7qs4qu5kw5os5qw5rs17su5tu7tsfzs}'fof'-6o7p{17su5tu5ot}ck{4qs5ku5ot5qs17sv5tv}4l{4qs5ku5ot5qs17sv5tv}cm{4qs5ku5ot5qs17sv5tv}cn{4qs5ku5ot5qs17sv5tv}co{4qs5ku5ot5qs17sv5tv}cp{4qs5ku5ot5qs17sv5tv}6l{17st5tt5os}17s{2kwclvcmvcnvcovcpv4lv4wwckv}5o{2kucltcmtcntcotcpt4lt4wtckt}5q{2ksclscmscnscoscps4ls4wvcks}5r{2ks4ws}5t{2kwclvcmvcnvcovcpv4lv4wwckv}eo{17st5tt5os}fu{17su5tu5ot}6p{17ss5ts}ek{17st5tt5os}el{17st5tt5os}em{17st5tt5os}en{17st5tt5os}6o{201ts}ep{17st5tt5os}es{17ss5ts}et{17ss5ts}eu{17ss5ts}ev{17ss5ts}6z{17su5tu5os5qt}fm{17su5tu5os5qt}fn{17su5tu5os5qt}fo{17su5tu5os5qt}fp{17su5tu5os5qt}fq{17su5tu5os5qt}fs{17su5tu5os5qt}ft{17su5tu5ot}7m{5os}fv{17su5tu5ot}fw{17su5tu5ot}}}"), ZapfDingbats: K("{'widths'{k4u2k1w'fof'6o}'kerning'{'fof'-6o}}"), "Courier-Bold": K("{'widths'{k3w'fof'6o}'kerning'{'fof'-6o}}"), "Times-Italic": K("{'widths'{k3n2q4ycx2l201n3m201o5t201s2l201t2l201u2l201w3r201x3r201y3r2k1t2l2l202m2n2n3m2o3m2p5n202q5t2r1p2s2l2t2l2u3m2v4n2w1t2x2l2y1t2z1w3k3m3l3m3m3m3n3m3o3m3p3m3q3m3r3m3s3m203t2l203u2l3v2l3w4n3x4n3y4n3z3m4k5w4l3x4m3x4n4m4o4s4p3x4q3x4r4s4s4s4t2l4u2w4v4m4w3r4x5n4y4m4z4s5k3x5l4s5m3x5n3m5o3r5p4s5q3x5r5n5s3x5t3r5u3r5v2r5w1w5x2r5y2u5z3m6k2l6l3m6m3m6n2w6o3m6p2w6q1w6r3m6s3m6t1w6u1w6v2w6w1w6x4s6y3m6z3m7k3m7l3m7m2r7n2r7o1w7p3m7q2w7r4m7s2w7t2w7u2r7v2s7w1v7x2s7y3q202l3mcl3xal2ram3man3mao3map3mar3mas2lat4wau1vav3maw4nay4waz2lbk2sbl4n'fof'6obo2lbp3mbq3obr1tbs2lbu1zbv3mbz3mck3x202k3mcm3xcn3xco3xcp3xcq5tcr4mcs3xct3xcu3xcv3xcw2l2m2ucy2lcz2ldl4mdm4sdn4sdo4sdp4sdq4sds4sdt4sdu4sdv4sdw4sdz3mek3mel3mem3men3meo3mep3meq4mer2wes2wet2weu2wev2wew1wex1wey1wez1wfl3mfm3mfn3mfo3mfp3mfq3mfr4nfs3mft3mfu3mfv3mfw3mfz2w203k6o212m6m2dw2l2cq2l3t3m3u2l17s3r19m3m}'kerning'{cl{5kt4qw}201s{201sw}201t{201tw2wy2yy6q-t}201x{2wy2yy}2k{201tw}2w{7qs4qy7rs5ky7mw5os5qx5ru17su5tu}2x{17ss5ts5os}2y{7qs4qy7rs5ky7mw5os5qx5ru17su5tu}'fof'-6o6t{17ss5ts5qs}7t{5os}3v{5qs}7p{17su5tu5qs}ck{5kt4qw}4l{5kt4qw}cm{5kt4qw}cn{5kt4qw}co{5kt4qw}cp{5kt4qw}6l{4qs5ks5ou5qw5ru17su5tu}17s{2ks}5q{ckvclvcmvcnvcovcpv4lv}5r{ckuclucmucnucoucpu4lu}5t{2ks}6p{4qs5ks5ou5qw5ru17su5tu}ek{4qs5ks5ou5qw5ru17su5tu}el{4qs5ks5ou5qw5ru17su5tu}em{4qs5ks5ou5qw5ru17su5tu}en{4qs5ks5ou5qw5ru17su5tu}eo{4qs5ks5ou5qw5ru17su5tu}ep{4qs5ks5ou5qw5ru17su5tu}es{5ks5qs4qs}et{4qs5ks5ou5qw5ru17su5tu}eu{4qs5ks5qw5ru17su5tu}ev{5ks5qs4qs}ex{17ss5ts5qs}6z{4qv5ks5ou5qw5ru17su5tu}fm{4qv5ks5ou5qw5ru17su5tu}fn{4qv5ks5ou5qw5ru17su5tu}fo{4qv5ks5ou5qw5ru17su5tu}fp{4qv5ks5ou5qw5ru17su5tu}fq{4qv5ks5ou5qw5ru17su5tu}7r{5os}fs{4qv5ks5ou5qw5ru17su5tu}ft{17su5tu5qs}fu{17su5tu5qs}fv{17su5tu5qs}fw{17su5tu5qs}}}"), "Times-Roman": K("{'widths'{k3n2q4ycx2l201n3m201o6o201s2l201t2l201u2l201w2w201x2w201y2w2k1t2l2l202m2n2n3m2o3m2p5n202q6o2r1m2s2l2t2l2u3m2v3s2w1t2x2l2y1t2z1w3k3m3l3m3m3m3n3m3o3m3p3m3q3m3r3m3s3m203t2l203u2l3v1w3w3s3x3s3y3s3z2w4k5w4l4s4m4m4n4m4o4s4p3x4q3r4r4s4s4s4t2l4u2r4v4s4w3x4x5t4y4s4z4s5k3r5l4s5m4m5n3r5o3x5p4s5q4s5r5y5s4s5t4s5u3x5v2l5w1w5x2l5y2z5z3m6k2l6l2w6m3m6n2w6o3m6p2w6q2l6r3m6s3m6t1w6u1w6v3m6w1w6x4y6y3m6z3m7k3m7l3m7m2l7n2r7o1w7p3m7q3m7r4s7s3m7t3m7u2w7v3k7w1o7x3k7y3q202l3mcl4sal2lam3man3mao3map3mar3mas2lat4wau1vav3maw3say4waz2lbk2sbl3s'fof'6obo2lbp3mbq2xbr1tbs2lbu1zbv3mbz2wck4s202k3mcm4scn4sco4scp4scq5tcr4mcs3xct3xcu3xcv3xcw2l2m2tcy2lcz2ldl4sdm4sdn4sdo4sdp4sdq4sds4sdt4sdu4sdv4sdw4sdz3mek2wel2wem2wen2weo2wep2weq4mer2wes2wet2weu2wev2wew1wex1wey1wez1wfl3mfm3mfn3mfo3mfp3mfq3mfr3sfs3mft3mfu3mfv3mfw3mfz3m203k6o212m6m2dw2l2cq2l3t3m3u1w17s4s19m3m}'kerning'{cl{4qs5ku17sw5ou5qy5rw201ss5tw201ws}201s{201ss}201t{ckw4lwcmwcnwcowcpwclw4wu201ts}2k{201ts}2w{4qs5kw5os5qx5ru17sx5tx}2x{17sw5tw5ou5qu}2y{4qs5kw5os5qx5ru17sx5tx}'fof'-6o7t{ckuclucmucnucoucpu4lu5os5rs}3u{17su5tu5qs}3v{17su5tu5qs}7p{17sw5tw5qs}ck{4qs5ku17sw5ou5qy5rw201ss5tw201ws}4l{4qs5ku17sw5ou5qy5rw201ss5tw201ws}cm{4qs5ku17sw5ou5qy5rw201ss5tw201ws}cn{4qs5ku17sw5ou5qy5rw201ss5tw201ws}co{4qs5ku17sw5ou5qy5rw201ss5tw201ws}cp{4qs5ku17sw5ou5qy5rw201ss5tw201ws}6l{17su5tu5os5qw5rs}17s{2ktclvcmvcnvcovcpv4lv4wuckv}5o{ckwclwcmwcnwcowcpw4lw4wu}5q{ckyclycmycnycoycpy4ly4wu5ms}5r{cktcltcmtcntcotcpt4lt4ws}5t{2ktclvcmvcnvcovcpv4lv4wuckv}7q{cksclscmscnscoscps4ls}6p{17su5tu5qw5rs}ek{5qs5rs}el{17su5tu5os5qw5rs}em{17su5tu5os5qs5rs}en{17su5qs5rs}eo{5qs5rs}ep{17su5tu5os5qw5rs}es{5qs}et{17su5tu5qw5rs}eu{17su5tu5qs5rs}ev{5qs}6z{17sv5tv5os5qx5rs}fm{5os5qt5rs}fn{17sv5tv5os5qx5rs}fo{17sv5tv5os5qx5rs}fp{5os5qt5rs}fq{5os5qt5rs}7r{ckuclucmucnucoucpu4lu5os}fs{17sv5tv5os5qx5rs}ft{17ss5ts5qs}fu{17sw5tw5qs}fv{17sw5tw5qs}fw{17ss5ts5qs}fz{ckuclucmucnucoucpu4lu5os5rs}}}"), "Helvetica-Oblique": K("{'widths'{k3p2q4mcx1w201n3r201o6o201s1q201t1q201u1q201w2l201x2l201y2l2k1w2l1w202m2n2n3r2o3r2p5t202q6o2r1n2s2l2t2l2u2r2v3u2w1w2x2l2y1w2z1w3k3r3l3r3m3r3n3r3o3r3p3r3q3r3r3r3s3r203t2l203u2l3v1w3w3u3x3u3y3u3z3r4k6p4l4m4m4m4n4s4o4s4p4m4q3x4r4y4s4s4t1w4u3m4v4m4w3r4x5n4y4s4z4y5k4m5l4y5m4s5n4m5o3x5p4s5q4m5r5y5s4m5t4m5u3x5v1w5w1w5x1w5y2z5z3r6k2l6l3r6m3r6n3m6o3r6p3r6q1w6r3r6s3r6t1q6u1q6v3m6w1q6x5n6y3r6z3r7k3r7l3r7m2l7n3m7o1w7p3r7q3m7r4s7s3m7t3m7u3m7v2l7w1u7x2l7y3u202l3rcl4mal2lam3ran3rao3rap3rar3ras2lat4tau2pav3raw3uay4taz2lbk2sbl3u'fof'6obo2lbp3rbr1wbs2lbu2obv3rbz3xck4m202k3rcm4mcn4mco4mcp4mcq6ocr4scs4mct4mcu4mcv4mcw1w2m2ncy1wcz1wdl4sdm4ydn4ydo4ydp4ydq4yds4ydt4sdu4sdv4sdw4sdz3xek3rel3rem3ren3reo3rep3req5ter3mes3ret3reu3rev3rew1wex1wey1wez1wfl3rfm3rfn3rfo3rfp3rfq3rfr3ufs3xft3rfu3rfv3rfw3rfz3m203k6o212m6o2dw2l2cq2l3t3r3u1w17s4m19m3r}'kerning'{5q{4wv}cl{4qs5kw5ow5qs17sv5tv}201t{2wu4w1k2yu}201x{2wu4wy2yu}17s{2ktclucmucnu4otcpu4lu4wycoucku}2w{7qs4qz5k1m17sy5ow5qx5rsfsu5ty7tufzu}2x{17sy5ty5oy5qs}2y{7qs4qz5k1m17sy5ow5qx5rsfsu5ty7tufzu}'fof'-6o7p{17sv5tv5ow}ck{4qs5kw5ow5qs17sv5tv}4l{4qs5kw5ow5qs17sv5tv}cm{4qs5kw5ow5qs17sv5tv}cn{4qs5kw5ow5qs17sv5tv}co{4qs5kw5ow5qs17sv5tv}cp{4qs5kw5ow5qs17sv5tv}6l{17sy5ty5ow}do{17st5tt}4z{17st5tt}7s{fst}dm{17st5tt}dn{17st5tt}5o{ckwclwcmwcnwcowcpw4lw4wv}dp{17st5tt}dq{17st5tt}7t{5ow}ds{17st5tt}5t{2ktclucmucnu4otcpu4lu4wycoucku}fu{17sv5tv5ow}6p{17sy5ty5ow5qs}ek{17sy5ty5ow}el{17sy5ty5ow}em{17sy5ty5ow}en{5ty}eo{17sy5ty5ow}ep{17sy5ty5ow}es{17sy5ty5qs}et{17sy5ty5ow5qs}eu{17sy5ty5ow5qs}ev{17sy5ty5ow5qs}6z{17sy5ty5ow5qs}fm{17sy5ty5ow5qs}fn{17sy5ty5ow5qs}fo{17sy5ty5ow5qs}fp{17sy5ty5qs}fq{17sy5ty5ow5qs}7r{5ow}fs{17sy5ty5ow5qs}ft{17sv5tv5ow}7m{5ow}fv{17sv5tv5ow}fw{17sv5tv5ow}}}") } }, X.events.push(["addFont", function (t) { var e, n, r, i = t.font, o = "Unicode"; (e = $[o][i.postScriptName]) && ((n = i.metadata[o] ? i.metadata[o] : i.metadata[o] = {}).widths = e.widths, n.kerning = e.kerning), (r = Q[o][i.postScriptName]) && ((n = i.metadata[o] ? i.metadata[o] : i.metadata[o] = {}).encoding = r).codePages && r.codePages.length && (i.encoding = r.codePages[0]) }]),
        /**
           * @license
           * Licensed under the MIT License.
           * http://opensource.org/licenses/mit-license
           */
        tt = lt, "undefined" != typeof self && self || "undefined" != typeof global && global || "undefined" != typeof window && window || Function("return this")(), tt.API.events.push(["addFont", function (t) { var e = t.font, n = t.instance; if (void 0 !== n && n.existsFileInVFS(e.postScriptName)) { var r = n.getFileFromVFS(e.postScriptName); if ("string" != typeof r) throw new Error("Font is not stored as string-data in vFS, import fonts or remove declaration doc.addFont('" + e.postScriptName + "')."); e.metadata = tt.API.TTFFont.open(e.postScriptName, e.fontName, r, e.encoding), e.metadata.Unicode = e.metadata.Unicode || { encoding: {}, kerning: {}, widths: [] }, e.metadata.glyIdsUsed = [0] } else if (!1 === e.isStandardFont) throw new Error("Font does not exist in vFS, import fonts or remove declaration doc.addFont('" + e.postScriptName + "').") }]), (
            /** @license
               * Copyright (c) 2012 Willow Systems Corporation, willow-systems.com
               * 
               * 
               * ====================================================================
               */
            et = lt.API).addSvg = function (t, e, n, r, i) { if (void 0 === e || void 0 === n) throw new Error("addSVG needs values for 'x' and 'y'"); function o(t) { for (var e = parseFloat(t[1]), n = parseFloat(t[2]), r = [], i = 3, o = t.length; i < o;)"c" === t[i] ? (r.push([parseFloat(t[i + 1]), parseFloat(t[i + 2]), parseFloat(t[i + 3]), parseFloat(t[i + 4]), parseFloat(t[i + 5]), parseFloat(t[i + 6])]), i += 7) : "l" === t[i] ? (r.push([parseFloat(t[i + 1]), parseFloat(t[i + 2])]), i += 3) : i += 1; return [e, n, r] } var a, s, l, h, u, c, f, p, d = (h = document, p = h.createElement("iframe"), u = ".jsPDF_sillysvg_iframe {display:none;position:absolute;}", (f = (c = h).createElement("style")).type = "text/css", f.styleSheet ? f.styleSheet.cssText = u : f.appendChild(c.createTextNode(u)), c.getElementsByTagName("head")[0].appendChild(f), p.name = "childframe", p.setAttribute("width", 0), p.setAttribute("height", 0), p.setAttribute("frameborder", "0"), p.setAttribute("scrolling", "no"), p.setAttribute("seamless", "seamless"), p.setAttribute("class", "jsPDF_sillysvg_iframe"), h.body.appendChild(p), p), g = (a = t, (l = ((s = d).contentWindow || s.contentDocument).document).write(a), l.close(), l.getElementsByTagName("svg")[0]), m = [1, 1], y = parseFloat(g.getAttribute("width")), v = parseFloat(g.getAttribute("height")); y && v && (r && i ? m = [r / y, i / v] : r ? m = [r / y, r / y] : i && (m = [i / v, i / v])); var w, b, x, N, L = g.childNodes; for (w = 0, b = L.length; w < b; w++)(x = L[w]).tagName && "PATH" === x.tagName.toUpperCase() && ((N = o(x.getAttribute("d").split(" ")))[0] = N[0] * m[0] + e, N[1] = N[1] * m[1] + n, this.lines.call(this, N[2], N[0], N[1], m)); return this }, et.addSVG = et.addSvg, et.addSvgAsImage = function (t, e, n, r, i, o, a, s) { if (isNaN(e) || isNaN(n)) throw console.error("jsPDF.addSvgAsImage: Invalid coordinates", arguments), new Error("Invalid coordinates passed to jsPDF.addSvgAsImage"); if (isNaN(r) || isNaN(i)) throw console.error("jsPDF.addSvgAsImage: Invalid measurements", arguments), new Error("Invalid measurements (width and/or height) passed to jsPDF.addSvgAsImage"); var l = document.createElement("canvas"); l.width = r, l.height = i; var h = l.getContext("2d"); return h.fillStyle = "#fff", h.fillRect(0, 0, l.width, l.height), canvg(l, t, { ignoreMouse: !0, ignoreAnimation: !0, ignoreDimensions: !0, ignoreClear: !0 }), this.addImage(l.toDataURL("image/jpeg", 1), e, n, r, i, a, s), this }, lt.API.putTotalPages = function (t) { var e, n = 0; n = parseInt(this.internal.getFont().id.substr(1), 10) < 15 ? (e = new RegExp(t, "g"), this.internal.getNumberOfPages()) : (e = new RegExp(this.pdfEscape16(t, this.internal.getFont()), "g"), this.pdfEscape16(this.internal.getNumberOfPages() + "", this.internal.getFont())); for (var r = 1; r <= this.internal.getNumberOfPages(); r++)for (var i = 0; i < this.internal.pages[r].length; i++)this.internal.pages[r][i] = this.internal.pages[r][i].replace(e, n); return this }, lt.API.viewerPreferences = function (t, e) { var n; t = t || {}, e = e || !1; var r, i, o = { HideToolbar: { defaultValue: !1, value: !1, type: "boolean", explicitSet: !1, valueSet: [!0, !1], pdfVersion: 1.3 }, HideMenubar: { defaultValue: !1, value: !1, type: "boolean", explicitSet: !1, valueSet: [!0, !1], pdfVersion: 1.3 }, HideWindowUI: { defaultValue: !1, value: !1, type: "boolean", explicitSet: !1, valueSet: [!0, !1], pdfVersion: 1.3 }, FitWindow: { defaultValue: !1, value: !1, type: "boolean", explicitSet: !1, valueSet: [!0, !1], pdfVersion: 1.3 }, CenterWindow: { defaultValue: !1, value: !1, type: "boolean", explicitSet: !1, valueSet: [!0, !1], pdfVersion: 1.3 }, DisplayDocTitle: { defaultValue: !1, value: !1, type: "boolean", explicitSet: !1, valueSet: [!0, !1], pdfVersion: 1.4 }, NonFullScreenPageMode: { defaultValue: "UseNone", value: "UseNone", type: "name", explicitSet: !1, valueSet: ["UseNone", "UseOutlines", "UseThumbs", "UseOC"], pdfVersion: 1.3 }, Direction: { defaultValue: "L2R", value: "L2R", type: "name", explicitSet: !1, valueSet: ["L2R", "R2L"], pdfVersion: 1.3 }, ViewArea: { defaultValue: "CropBox", value: "CropBox", type: "name", explicitSet: !1, valueSet: ["MediaBox", "CropBox", "TrimBox", "BleedBox", "ArtBox"], pdfVersion: 1.4 }, ViewClip: { defaultValue: "CropBox", value: "CropBox", type: "name", explicitSet: !1, valueSet: ["MediaBox", "CropBox", "TrimBox", "BleedBox", "ArtBox"], pdfVersion: 1.4 }, PrintArea: { defaultValue: "CropBox", value: "CropBox", type: "name", explicitSet: !1, valueSet: ["MediaBox", "CropBox", "TrimBox", "BleedBox", "ArtBox"], pdfVersion: 1.4 }, PrintClip: { defaultValue: "CropBox", value: "CropBox", type: "name", explicitSet: !1, valueSet: ["MediaBox", "CropBox", "TrimBox", "BleedBox", "ArtBox"], pdfVersion: 1.4 }, PrintScaling: { defaultValue: "AppDefault", value: "AppDefault", type: "name", explicitSet: !1, valueSet: ["AppDefault", "None"], pdfVersion: 1.6 }, Duplex: { defaultValue: "", value: "none", type: "name", explicitSet: !1, valueSet: ["Simplex", "DuplexFlipShortEdge", "DuplexFlipLongEdge", "none"], pdfVersion: 1.7 }, PickTrayByPDFSize: { defaultValue: !1, value: !1, type: "boolean", explicitSet: !1, valueSet: [!0, !1], pdfVersion: 1.7 }, PrintPageRange: { defaultValue: "", value: "", type: "array", explicitSet: !1, valueSet: null, pdfVersion: 1.7 }, NumCopies: { defaultValue: 1, value: 1, type: "integer", explicitSet: !1, valueSet: null, pdfVersion: 1.7 } }, a = Object.keys(o), s = [], l = 0, h = 0, u = 0, c = !0; function f(t, e) { var n, r = !1; for (n = 0; n < t.length; n += 1)t[n] === e && (r = !0); return r } if (void 0 === this.internal.viewerpreferences && (this.internal.viewerpreferences = {}, this.internal.viewerpreferences.configuration = JSON.parse(JSON.stringify(o)), this.internal.viewerpreferences.isSubscribed = !1), n = this.internal.viewerpreferences.configuration, "reset" === t || !0 === e) { var p = a.length; for (u = 0; u < p; u += 1)n[a[u]].value = n[a[u]].defaultValue, n[a[u]].explicitSet = !1 } if ("object" === se(t)) for (r in t) if (i = t[r], f(a, r) && void 0 !== i) { if ("boolean" === n[r].type && "boolean" == typeof i) n[r].value = i; else if ("name" === n[r].type && f(n[r].valueSet, i)) n[r].value = i; else if ("integer" === n[r].type && Number.isInteger(i)) n[r].value = i; else if ("array" === n[r].type) { for (l = 0; l < i.length; l += 1)if (c = !0, 1 === i[l].length && "number" == typeof i[l][0]) s.push(String(i[l] - 1)); else if (1 < i[l].length) { for (h = 0; h < i[l].length; h += 1)"number" != typeof i[l][h] && (c = !1); !0 === c && s.push([i[l][0] - 1, i[l][1] - 1].join(" ")) } n[r].value = "[" + s.join(" ") + "]" } else n[r].value = n[r].defaultValue; n[r].explicitSet = !0 } return !1 === this.internal.viewerpreferences.isSubscribed && (this.internal.events.subscribe("putCatalog", function () { var t, e = []; for (t in n) !0 === n[t].explicitSet && ("name" === n[t].type ? e.push("/" + t + " /" + n[t].value) : e.push("/" + t + " " + n[t].value)); 0 !== e.length && this.internal.write("/ViewerPreferences\n<<\n" + e.join("\n") + "\n>>") }), this.internal.viewerpreferences.isSubscribed = !0), this.internal.viewerpreferences.configuration = n, this },
        /** ==================================================================== 
           * jsPDF XMP metadata plugin
           * Copyright (c) 2016 Jussi Utunen, u-jussi@suomi24.fi
           * 
           * 
           * ====================================================================
           */
        nt = lt.API, ot = it = rt = "", nt.addMetadata = function (t, e) { return it = e || "http://jspdf.default.namespaceuri/", rt = t, this.internal.events.subscribe("postPutResources", function () { if (rt) { var t = '<rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#"><rdf:Description rdf:about="" xmlns:jspdf="' + it + '"><jspdf:metadata>', e = unescape(encodeURIComponent('<x:xmpmeta xmlns:x="adobe:ns:meta/">')), n = unescape(encodeURIComponent(t)), r = unescape(encodeURIComponent(rt)), i = unescape(encodeURIComponent("</jspdf:metadata></rdf:Description></rdf:RDF>")), o = unescape(encodeURIComponent("</x:xmpmeta>")), a = n.length + r.length + i.length + e.length + o.length; ot = this.internal.newObject(), this.internal.write("<< /Type /Metadata /Subtype /XML /Length " + a + " >>"), this.internal.write("stream"), this.internal.write(e + n + r + i + o), this.internal.write("endstream"), this.internal.write("endobj") } else ot = "" }), this.internal.events.subscribe("putCatalog", function () { ot && this.internal.write("/Metadata " + ot + " 0 R") }), this }, function (f, t) { var e = f.API; var m = e.pdfEscape16 = function (t, e) { for (var n, r = e.metadata.Unicode.widths, i = ["", "0", "00", "000", "0000"], o = [""], a = 0, s = t.length; a < s; ++a) { if (n = e.metadata.characterToGlyph(t.charCodeAt(a)), e.metadata.glyIdsUsed.push(n), e.metadata.toUnicode[n] = t.charCodeAt(a), -1 == r.indexOf(n) && (r.push(n), r.push([parseInt(e.metadata.widthOfGlyph(n), 10)])), "0" == n) return o.join(""); n = n.toString(16), o.push(i[4 - n.length], n) } return o.join("") }, p = function (t) { var e, n, r, i, o, a, s; for (o = "/CIDInit /ProcSet findresource begin\n12 dict begin\nbegincmap\n/CIDSystemInfo <<\n  /Registry (Adobe)\n  /Ordering (UCS)\n  /Supplement 0\n>> def\n/CMapName /Adobe-Identity-UCS def\n/CMapType 2 def\n1 begincodespacerange\n<0000><ffff>\nendcodespacerange", r = [], a = 0, s = (n = Object.keys(t).sort(function (t, e) { return t - e })).length; a < s; a++)e = n[a], 100 <= r.length && (o += "\n" + r.length + " beginbfchar\n" + r.join("\n") + "\nendbfchar", r = []), i = ("0000" + t[e].toString(16)).slice(-4), e = ("0000" + (+e).toString(16)).slice(-4), r.push("<" + e + "><" + i + ">"); return r.length && (o += "\n" + r.length + " beginbfchar\n" + r.join("\n") + "\nendbfchar\n"), o += "endcmap\nCMapName currentdict /CMap defineresource pop\nend\nend" }; e.events.push(["putFont", function (t) { !function (t, e, n, r) { if (t.metadata instanceof f.API.TTFFont && "Identity-H" === t.encoding) { for (var i = t.metadata.Unicode.widths, o = t.metadata.subset.encode(t.metadata.glyIdsUsed, 1), a = "", s = 0; s < o.length; s++)a += String.fromCharCode(o[s]); var l = n(); r({ data: a, addLength1: !0 }), e("endobj"); var h = n(); r({ data: p(t.metadata.toUnicode), addLength1: !0 }), e("endobj"); var u = n(); e("<<"), e("/Type /FontDescriptor"), e("/FontName /" + t.fontName), e("/FontFile2 " + l + " 0 R"), e("/FontBBox " + f.API.PDFObject.convert(t.metadata.bbox)), e("/Flags " + t.metadata.flags), e("/StemV " + t.metadata.stemV), e("/ItalicAngle " + t.metadata.italicAngle), e("/Ascent " + t.metadata.ascender), e("/Descent " + t.metadata.decender), e("/CapHeight " + t.metadata.capHeight), e(">>"), e("endobj"); var c = n(); e("<<"), e("/Type /Font"), e("/BaseFont /" + t.fontName), e("/FontDescriptor " + u + " 0 R"), e("/W " + f.API.PDFObject.convert(i)), e("/CIDToGIDMap /Identity"), e("/DW 1000"), e("/Subtype /CIDFontType2"), e("/CIDSystemInfo"), e("<<"), e("/Supplement 0"), e("/Registry (Adobe)"), e("/Ordering (" + t.encoding + ")"), e(">>"), e(">>"), e("endobj"), t.objectNumber = n(), e("<<"), e("/Type /Font"), e("/Subtype /Type0"), e("/ToUnicode " + h + " 0 R"), e("/BaseFont /" + t.fontName), e("/Encoding /" + t.encoding), e("/DescendantFonts [" + c + " 0 R]"), e(">>"), e("endobj"), t.isAlreadyPutted = !0 } }(t.font, t.out, t.newObject, t.putStream) }]); e.events.push(["putFont", function (t) { !function (t, e, n, r) { if (t.metadata instanceof f.API.TTFFont && "WinAnsiEncoding" === t.encoding) { t.metadata.Unicode.widths; for (var i = t.metadata.rawData, o = "", a = 0; a < i.length; a++)o += String.fromCharCode(i[a]); var s = n(); r({ data: o, addLength1: !0 }), e("endobj"); var l = n(); r({ data: p(t.metadata.toUnicode), addLength1: !0 }), e("endobj"); var h = n(); for (e("<<"), e("/Descent " + t.metadata.decender), e("/CapHeight " + t.metadata.capHeight), e("/StemV " + t.metadata.stemV), e("/Type /FontDescriptor"), e("/FontFile2 " + s + " 0 R"), e("/Flags 96"), e("/FontBBox " + f.API.PDFObject.convert(t.metadata.bbox)), e("/FontName /" + t.fontName), e("/ItalicAngle " + t.metadata.italicAngle), e("/Ascent " + t.metadata.ascender), e(">>"), e("endobj"), t.objectNumber = n(), a = 0; a < t.metadata.hmtx.widths.length; a++)t.metadata.hmtx.widths[a] = parseInt(t.metadata.hmtx.widths[a] * (1e3 / t.metadata.head.unitsPerEm)); e("<</Subtype/TrueType/Type/Font/ToUnicode " + l + " 0 R/BaseFont/" + t.fontName + "/FontDescriptor " + h + " 0 R/Encoding/" + t.encoding + " /FirstChar 29 /LastChar 255 /Widths " + f.API.PDFObject.convert(t.metadata.hmtx.widths) + ">>"), e("endobj"), t.isAlreadyPutted = !0 } }(t.font, t.out, t.newObject, t.putStream) }]); var h = function (t) { var e, n, r = t.text || "", i = t.x, o = t.y, a = t.options || {}, s = t.mutex || {}, l = s.pdfEscape, h = s.activeFontKey, u = s.fonts, c = (s.activeFontSize, ""), f = 0, p = "", d = u[n = h].encoding; if ("Identity-H" !== u[n].encoding) return { text: r, x: i, y: o, options: a, mutex: s }; for (p = r, n = h, "[object Array]" === Object.prototype.toString.call(r) && (p = r[0]), f = 0; f < p.length; f += 1)u[n].metadata.hasOwnProperty("cmap") && (e = u[n].metadata.cmap.unicode.codeMap[p[f].charCodeAt(0)]), e ? c += p[f] : p[f].charCodeAt(0) < 256 && u[n].metadata.hasOwnProperty("Unicode") ? c += p[f] : c += ""; var g = ""; return parseInt(n.slice(1)) < 14 || "WinAnsiEncoding" === d ? g = function (t) { for (var e = "", n = 0; n < t.length; n++)e += "" + t.charCodeAt(n).toString(16); return e }(l(c, n)) : "Identity-H" === d && (g = m(c, u[n])), s.isHex = !0, { text: g, x: i, y: o, options: a, mutex: s } }; e.events.push(["postProcessText", function (t) { var e = t.text || "", n = t.x, r = t.y, i = t.options, o = t.mutex, a = (i.lang, []), s = { text: e, x: n, y: r, options: i, mutex: o }; if ("[object Array]" === Object.prototype.toString.call(e)) { var l = 0; for (l = 0; l < e.length; l += 1)"[object Array]" === Object.prototype.toString.call(e[l]) && 3 === e[l].length ? a.push([h(Object.assign({}, s, { text: e[l][0] })).text, e[l][1], e[l][2]]) : a.push(h(Object.assign({}, s, { text: e[l] })).text); t.text = a } else t.text = h(Object.assign({}, s, { text: e })).text }]) }(lt, "undefined" != typeof self && self || "undefined" != typeof global && global || "undefined" != typeof window && window || Function("return this")()), at = lt.API, st = function (t) { return void 0 !== t && (void 0 === t.vFS && (t.vFS = {}), !0) }, at.existsFileInVFS = function (t) { return !!st(this.internal) && void 0 !== this.internal.vFS[t] }, at.addFileToVFS = function (t, e) { return st(this.internal), this.internal.vFS[t] = e, this }, at.getFileFromVFS = function (t) { return st(this.internal), void 0 !== this.internal.vFS[t] ? this.internal.vFS[t] : null }, lt.API.addHTML = function (t, d, g, s, m) { if ("undefined" == typeof html2canvas && "undefined" == typeof rasterizeHTML) throw new Error("You need either https://github.com/niklasvh/html2canvas or https://github.com/cburgmer/rasterizeHTML.js"); "number" != typeof d && (s = d, m = g), "function" == typeof s && (m = s, s = null), "function" != typeof m && (m = function () { }); var e = this.internal, y = e.scaleFactor, v = e.pageSize.getWidth(), w = e.pageSize.getHeight(); if ((s = s || {}).onrendered = function (l) { d = parseInt(d) || 0, g = parseInt(g) || 0; var t = s.dim || {}, h = Object.assign({ top: 0, right: 0, bottom: 0, left: 0, useFor: "content" }, s.margin), e = t.h || Math.min(w, l.height / y), u = t.w || Math.min(v, l.width / y) - d, c = s.format || "JPEG", f = s.imageCompression || "SLOW"; if (l.height > w - h.top - h.bottom && s.pagesplit) { var p = function (t, e, n, r, i) { var o = document.createElement("canvas"); o.height = i, o.width = r; var a = o.getContext("2d"); return a.mozImageSmoothingEnabled = !1, a.webkitImageSmoothingEnabled = !1, a.msImageSmoothingEnabled = !1, a.imageSmoothingEnabled = !1, a.fillStyle = s.backgroundColor || "#ffffff", a.fillRect(0, 0, r, i), a.drawImage(t, e, n, r, i, 0, 0, r, i), o }, n = function () { for (var t, e, n = 0, r = 0, i = {}, o = !1; ;) { var a; if (r = 0, i.top = 0 !== n ? h.top : g, i.left = 0 !== n ? h.left : d, o = (v - h.left - h.right) * y < l.width, "content" === h.useFor ? 0 === n ? (t = Math.min((v - h.left) * y, l.width), e = Math.min((w - h.top) * y, l.height - n)) : (t = Math.min(v * y, l.width), e = Math.min(w * y, l.height - n), i.top = 0) : (t = Math.min((v - h.left - h.right) * y, l.width), e = Math.min((w - h.bottom - h.top) * y, l.height - n)), o) for (; ;) { "content" === h.useFor && (0 === r ? t = Math.min((v - h.left) * y, l.width) : (t = Math.min(v * y, l.width - r), i.left = 0)); var s = [a = p(l, r, n, t, e), i.left, i.top, a.width / y, a.height / y, c, null, f]; if (this.addImage.apply(this, s), (r += t) >= l.width) break; this.addPage() } else s = [a = p(l, 0, n, t, e), i.left, i.top, a.width / y, a.height / y, c, null, f], this.addImage.apply(this, s); if ((n += e) >= l.height) break; this.addPage() } m(u, n, null, s) }.bind(this); if ("CANVAS" === l.nodeName) { var r = new Image; r.onload = n, r.src = l.toDataURL("image/png"), l = r } else n() } else { var i = Math.random().toString(35), o = [l, d, g, u, e, c, i, f]; this.addImage.apply(this, o), m(u, e, i, o) } }.bind(this), "undefined" != typeof html2canvas && !s.rstz) return html2canvas(t, s); if ("undefined" == typeof rasterizeHTML) return null; var n = "drawDocument"; return "string" == typeof t && (n = /^http/.test(t) ? "drawURL" : "drawHTML"), s.width = s.width || v * y, rasterizeHTML[n](t, void 0, s).then(function (t) { s.onrendered(t.image) }, function (t) { m(null, t) }) },
        /**
           * jsPDF fromHTML plugin. BETA stage. API subject to change. Needs browser
           * Copyright (c) 2012 Willow Systems Corporation, willow-systems.com
           *               2014 Juan Pablo Gaviria, https://github.com/juanpgaviria
           *               2014 Diego Casorran, https://github.com/diegocr
           *               2014 Daniel Husar, https://github.com/danielhusar
           *               2014 Wolfgang Gassler, https://github.com/woolfg
           *               2014 Steven Spungin, https://github.com/flamenco
           *
           * @license
           * 
           * ====================================================================
           */
        function (t) { var P, k, i, a, s, l, h, u, I, w, f, c, p, n, C, B, d, g, m, j; P = function () { return function (t) { return e.prototype = t, new e }; function e() { } }(), w = function (t) { var e, n, r, i, o, a, s; for (n = 0, r = t.length, e = void 0, a = i = !1; !i && n !== r;)(e = t[n] = t[n].trimLeft()) && (i = !0), n++; for (n = r - 1; r && !a && -1 !== n;)(e = t[n] = t[n].trimRight()) && (a = !0), n--; for (o = /\s+$/g, s = !0, n = 0; n !== r;)"\u2028" != t[n] && (e = t[n].replace(/\s+/g, " "), s && (e = e.trimLeft()), e && (s = o.test(e)), t[n] = e), n++; return t }, c = function (t) { var e, n, r; for (e = void 0, n = (r = t.split(",")).shift(); !e && n;)e = i[n.trim().toLowerCase()], n = r.shift(); return e }, p = function (t) { var e; return -1 < (t = "auto" === t ? "0px" : t).indexOf("em") && !isNaN(Number(t.replace("em", ""))) && (t = 18.719 * Number(t.replace("em", "")) + "px"), -1 < t.indexOf("pt") && !isNaN(Number(t.replace("pt", ""))) && (t = 1.333 * Number(t.replace("pt", "")) + "px"), void 0, 16, (e = n[t]) ? e : void 0 !== (e = { "xx-small": 9, "x-small": 11, small: 13, medium: 16, large: 19, "x-large": 23, "xx-large": 28, auto: 0 }[t]) ? n[t] = e / 16 : (e = parseFloat(t)) ? n[t] = e / 16 : (e = t.match(/([\d\.]+)(px)/), Array.isArray(e) && 3 === e.length ? n[t] = parseFloat(e[1]) / 16 : n[t] = 1) }, I = function (t) { var e, n, r, i, o; return o = t, i = document.defaultView && document.defaultView.getComputedStyle ? document.defaultView.getComputedStyle(o, null) : o.currentStyle ? o.currentStyle : o.style, n = void 0, (e = {})["font-family"] = c((r = function (t) { return t = t.replace(/-\D/g, function (t) { return t.charAt(1).toUpperCase() }), i[t] })("font-family")) || "times", e["font-style"] = a[r("font-style")] || "normal", e["text-align"] = s[r("text-align")] || "left", "bold" === (n = l[r("font-weight")] || "normal") && ("normal" === e["font-style"] ? e["font-style"] = n : e["font-style"] = n + e["font-style"]), e["font-size"] = p(r("font-size")) || 1, e["line-height"] = p(r("line-height")) || 1, e.display = "inline" === r("display") ? "inline" : "block", n = "block" === e.display, e["margin-top"] = n && p(r("margin-top")) || 0, e["margin-bottom"] = n && p(r("margin-bottom")) || 0, e["padding-top"] = n && p(r("padding-top")) || 0, e["padding-bottom"] = n && p(r("padding-bottom")) || 0, e["margin-left"] = n && p(r("margin-left")) || 0, e["margin-right"] = n && p(r("margin-right")) || 0, e["padding-left"] = n && p(r("padding-left")) || 0, e["padding-right"] = n && p(r("padding-right")) || 0, e["page-break-before"] = r("page-break-before") || "auto", e.float = h[r("cssFloat")] || "none", e.clear = u[r("clear")] || "none", e.color = r("color"), e }, C = function (t, e, n) { var r, i, o, a, s; if (o = !1, a = i = void 0, r = n["#" + t.id]) if ("function" == typeof r) o = r(t, e); else for (i = 0, a = r.length; !o && i !== a;)o = r[i](t, e), i++; if (r = n[t.nodeName], !o && r) if ("function" == typeof r) o = r(t, e); else for (i = 0, a = r.length; !o && i !== a;)o = r[i](t, e), i++; for (s = "string" == typeof t.className ? t.className.split(" ") : [], i = 0; i < s.length; i++)if (r = n["." + s[i]], !o && r) if ("function" == typeof r) o = r(t, e); else for (i = 0, a = r.length; !o && i !== a;)o = r[i](t, e), i++; return o }, j = function (t, e) { var n, r, i, o, a, s, l, h, u; for (n = [], r = [], i = 0, u = t.rows[0].cells.length, l = t.clientWidth; i < u;)h = t.rows[0].cells[i], r[i] = { name: h.textContent.toLowerCase().replace(/\s+/g, ""), prompt: h.textContent.replace(/\r?\n/g, ""), width: h.clientWidth / l * e.pdf.internal.pageSize.getWidth() }, i++; for (i = 1; i < t.rows.length;) { for (s = t.rows[i], a = {}, o = 0; o < s.cells.length;)a[r[o].name] = s.cells[o].textContent.replace(/\r?\n/g, ""), o++; n.push(a), i++ } return { rows: n, headers: r } }; var E = { SCRIPT: 1, STYLE: 1, NOSCRIPT: 1, OBJECT: 1, EMBED: 1, SELECT: 1 }, M = 1; k = function (t, i, e) { var n, r, o, a, s, l, h, u; for (r = t.childNodes, n = void 0, (s = "block" === (o = I(t)).display) && (i.setBlockBoundary(), i.setBlockStyle(o)), a = 0, l = r.length; a < l;) { if ("object" === se(n = r[a])) { if (i.executeWatchFunctions(n), 1 === n.nodeType && "HEADER" === n.nodeName) { var c = n, f = i.pdf.margins_doc.top; i.pdf.internal.events.subscribe("addPage", function (t) { i.y = f, k(c, i, e), i.pdf.margins_doc.top = i.y + 10, i.y += 10 }, !1) } if (8 === n.nodeType && "#comment" === n.nodeName) ~n.textContent.indexOf("ADD_PAGE") && (i.pdf.addPage(), i.y = i.pdf.margins_doc.top); else if (1 !== n.nodeType || E[n.nodeName]) if (3 === n.nodeType) { var p = n.nodeValue; if (n.nodeValue && "LI" === n.parentNode.nodeName) if ("OL" === n.parentNode.parentNode.nodeName) p = M++ + ". " + p; else { var d = o["font-size"], g = (3 - .75 * d) * i.pdf.internal.scaleFactor, m = .75 * d * i.pdf.internal.scaleFactor, y = 1.74 * d / i.pdf.internal.scaleFactor; u = function (t, e) { this.pdf.circle(t + g, e + m, y, "FD") } } 16 & n.ownerDocument.body.compareDocumentPosition(n) && i.addText(p, o) } else "string" == typeof n && i.addText(n, o); else { var v; if ("IMG" === n.nodeName) { var w = n.getAttribute("src"); v = B[i.pdf.sHashCode(w) || w] } if (v) { i.pdf.internal.pageSize.getHeight() - i.pdf.margins_doc.bottom < i.y + n.height && i.y > i.pdf.margins_doc.top && (i.pdf.addPage(), i.y = i.pdf.margins_doc.top, i.executeWatchFunctions(n)); var b = I(n), x = i.x, N = 12 / i.pdf.internal.scaleFactor, L = (b["margin-left"] + b["padding-left"]) * N, A = (b["margin-right"] + b["padding-right"]) * N, S = (b["margin-top"] + b["padding-top"]) * N, _ = (b["margin-bottom"] + b["padding-bottom"]) * N; void 0 !== b.float && "right" === b.float ? x += i.settings.width - n.width - A : x += L, i.pdf.addImage(v, x, i.y + S, n.width, n.height), v = void 0, "right" === b.float || "left" === b.float ? (i.watchFunctions.push(function (t, e, n, r) { return i.y >= e ? (i.x += t, i.settings.width += n, !0) : !!(r && 1 === r.nodeType && !E[r.nodeName] && i.x + r.width > i.pdf.margins_doc.left + i.pdf.margins_doc.width) && (i.x += t, i.y = e, i.settings.width += n, !0) }.bind(this, "left" === b.float ? -n.width - L - A : 0, i.y + n.height + S + _, n.width)), i.watchFunctions.push(function (t, e, n) { return !(i.y < t && e === i.pdf.internal.getNumberOfPages()) || 1 === n.nodeType && "both" === I(n).clear && (i.y = t, !0) }.bind(this, i.y + n.height, i.pdf.internal.getNumberOfPages())), i.settings.width -= n.width + L + A, "left" === b.float && (i.x += n.width + L + A)) : i.y += n.height + S + _ } else if ("TABLE" === n.nodeName) h = j(n, i), i.y += 10, i.pdf.table(i.x, i.y, h.rows, h.headers, { autoSize: !1, printHeaders: e.printHeaders, margins: i.pdf.margins_doc, css: I(n) }), i.y = i.pdf.lastCellPos.y + i.pdf.lastCellPos.h + 20; else if ("OL" === n.nodeName || "UL" === n.nodeName) M = 1, C(n, i, e) || k(n, i, e), i.y += 10; else if ("LI" === n.nodeName) { var F = i.x; i.x += 20 / i.pdf.internal.scaleFactor, i.y += 3, C(n, i, e) || k(n, i, e), i.x = F } else "BR" === n.nodeName ? (i.y += o["font-size"] * i.pdf.internal.scaleFactor, i.addText("\u2028", P(o))) : C(n, i, e) || k(n, i, e) } } a++ } if (e.outY = i.y, s) return i.setBlockBoundary(u) }, B = {}, d = function (t, o, e, n) { var a, r = t.getElementsByTagName("img"), i = r.length, s = 0; function l() { o.pdf.internal.events.publish("imagesLoaded"), n(a) } function h(e, n, r) { if (e) { var i = new Image; a = ++s, i.crossOrigin = "", i.onerror = i.onload = function () { if (i.complete && (0 === i.src.indexOf("data:image/") && (i.width = n || i.width || 0, i.height = r || i.height || 0), i.width + i.height)) { var t = o.pdf.sHashCode(e) || e; B[t] = B[t] || i } --s || l() }, i.src = e } } for (; i--;)h(r[i].getAttribute("src"), r[i].width, r[i].height); return s || l() }, g = function (t, o, a) { var s = t.getElementsByTagName("footer"); if (0 < s.length) { s = s[0]; var e = o.pdf.internal.write, n = o.y; o.pdf.internal.write = function () { }, k(s, o, a); var l = Math.ceil(o.y - n) + 5; o.y = n, o.pdf.internal.write = e, o.pdf.margins_doc.bottom += l; for (var r = function (t) { var e = void 0 !== t ? t.pageNumber : 1, n = o.y; o.y = o.pdf.internal.pageSize.getHeight() - o.pdf.margins_doc.bottom, o.pdf.margins_doc.bottom -= l; for (var r = s.getElementsByTagName("span"), i = 0; i < r.length; ++i)-1 < (" " + r[i].className + " ").replace(/[\n\t]/g, " ").indexOf(" pageCounter ") && (r[i].innerHTML = e), -1 < (" " + r[i].className + " ").replace(/[\n\t]/g, " ").indexOf(" totalPages ") && (r[i].innerHTML = "###jsPDFVarTotalPages###"); k(s, o, a), o.pdf.margins_doc.bottom += l, o.y = n }, i = s.getElementsByTagName("span"), h = 0; h < i.length; ++h)-1 < (" " + i[h].className + " ").replace(/[\n\t]/g, " ").indexOf(" totalPages ") && o.pdf.internal.events.subscribe("htmlRenderingFinished", o.pdf.putTotalPages.bind(o.pdf, "###jsPDFVarTotalPages###"), !0); o.pdf.internal.events.subscribe("addPage", r, !1), r(), E.FOOTER = 1 } }, m = function (t, e, n, r, i, o) { if (!e) return !1; var a, s, l, h; "string" == typeof e || e.parentNode || (e = "" + e.innerHTML), "string" == typeof e && (a = e.replace(/<\/?script[^>]*?>/gi, ""), h = "jsPDFhtmlText" + Date.now().toString() + (1e3 * Math.random()).toFixed(0), (l = document.createElement("div")).style.cssText = "position: absolute !important;clip: rect(1px 1px 1px 1px); /* IE6, IE7 */clip: rect(1px, 1px, 1px, 1px);padding:0 !important;border:0 !important;height: 1px !important;width: 1px !important; top:auto;left:-100px;overflow: hidden;", l.innerHTML = '<iframe style="height:1px;width:1px" name="' + h + '" />', document.body.appendChild(l), (s = window.frames[h]).document.open(), s.document.writeln(a), s.document.close(), e = s.document.body); var u, c = new f(t, n, r, i); return d.call(this, e, c, i.elementHandlers, function (t) { g(e, c, i.elementHandlers), k(e, c, i.elementHandlers), c.pdf.internal.events.publish("htmlRenderingFinished"), u = c.dispose(), "function" == typeof o ? o(u) : t && console.error("jsPDF Warning: rendering issues? provide a callback to fromHTML!") }), u || { x: c.x, y: c.y } }, (f = function (t, e, n, r) { return this.pdf = t, this.x = e, this.y = n, this.settings = r, this.watchFunctions = [], this.init(), this }).prototype.init = function () { return this.paragraph = { text: [], style: [] }, this.pdf.internal.write("q") }, f.prototype.dispose = function () { return this.pdf.internal.write("Q"), { x: this.x, y: this.y, ready: !0 } }, f.prototype.executeWatchFunctions = function (t) { var e = !1, n = []; if (0 < this.watchFunctions.length) { for (var r = 0; r < this.watchFunctions.length; ++r)!0 === this.watchFunctions[r](t) ? e = !0 : n.push(this.watchFunctions[r]); this.watchFunctions = n } return e }, f.prototype.splitFragmentsIntoLines = function (t, e) { var n, r, i, o, a, s, l, h, u, c, f, p, d, g; for (12, c = this.pdf.internal.scaleFactor, o = {}, s = l = h = g = a = i = u = r = void 0, p = [f = []], n = 0, d = this.settings.width; t.length;)if (a = t.shift(), g = e.shift(), a) if ((i = o[(r = g["font-family"]) + (u = g["font-style"])]) || (i = this.pdf.internal.getFont(r, u).metadata.Unicode, o[r + u] = i), h = { widths: i.widths, kerning: i.kerning, fontSize: 12 * g["font-size"], textIndent: n }, l = this.pdf.getStringUnitWidth(a, h) * h.fontSize / c, "\u2028" == a) f = [], p.push(f); else if (d < n + l) { for (s = this.pdf.splitTextToSize(a, d, h), f.push([s.shift(), g]); s.length;)f = [[s.shift(), g]], p.push(f); n = this.pdf.getStringUnitWidth(f[0][0], h) * h.fontSize / c } else f.push([a, g]), n += l; if (void 0 !== g["text-align"] && ("center" === g["text-align"] || "right" === g["text-align"] || "justify" === g["text-align"])) for (var m = 0; m < p.length; ++m) { var y = this.pdf.getStringUnitWidth(p[m][0][0], h) * h.fontSize / c; 0 < m && (p[m][0][1] = P(p[m][0][1])); var v = d - y; if ("right" === g["text-align"]) p[m][0][1]["margin-left"] = v; else if ("center" === g["text-align"]) p[m][0][1]["margin-left"] = v / 2; else if ("justify" === g["text-align"]) { var w = p[m][0][0].split(" ").length - 1; p[m][0][1]["word-spacing"] = v / w, m === p.length - 1 && (p[m][0][1]["word-spacing"] = 0) } } return p }, f.prototype.RenderTextFragment = function (t, e) { var n, r; r = 0, this.pdf.internal.pageSize.getHeight() - this.pdf.margins_doc.bottom < this.y + this.pdf.internal.getFontSize() && (this.pdf.internal.write("ET", "Q"), this.pdf.addPage(), this.y = this.pdf.margins_doc.top, this.pdf.internal.write("q", "BT", this.getPdfColor(e.color), this.pdf.internal.getCoordinateString(this.x), this.pdf.internal.getVerticalCoordinateString(this.y), "Td"), r = Math.max(r, e["line-height"], e["font-size"]), this.pdf.internal.write(0, (-12 * r).toFixed(2), "Td")), n = this.pdf.internal.getFont(e["font-family"], e["font-style"]); var i = this.getPdfColor(e.color); i !== this.lastTextColor && (this.pdf.internal.write(i), this.lastTextColor = i), void 0 !== e["word-spacing"] && 0 < e["word-spacing"] && this.pdf.internal.write(e["word-spacing"].toFixed(2), "Tw"), this.pdf.internal.write("/" + n.id, (12 * e["font-size"]).toFixed(2), "Tf", "(" + this.pdf.internal.pdfEscape(t) + ") Tj"), void 0 !== e["word-spacing"] && this.pdf.internal.write(0, "Tw") }, f.prototype.getPdfColor = function (t) { var e, n, r, i = /rgb\s*\(\s*(\d+),\s*(\d+),\s*(\d+\s*)\)/.exec(t); if (null != i) e = parseInt(i[1]), n = parseInt(i[2]), r = parseInt(i[3]); else { if ("string" == typeof t && "#" != t.charAt(0)) { var o = new RGBColor(t); t = o.ok ? o.toHex() : "#000000" } e = t.substring(1, 3), e = parseInt(e, 16), n = t.substring(3, 5), n = parseInt(n, 16), r = t.substring(5, 7), r = parseInt(r, 16) } if ("string" == typeof e && /^#[0-9A-Fa-f]{6}$/.test(e)) { var a = parseInt(e.substr(1), 16); e = a >> 16 & 255, n = a >> 8 & 255, r = 255 & a } var s = this.f3; return 0 === e && 0 === n && 0 === r || void 0 === n ? s(e / 255) + " g" : [s(e / 255), s(n / 255), s(r / 255), "rg"].join(" ") }, f.prototype.f3 = function (t) { return t.toFixed(3) }, f.prototype.renderParagraph = function (t) { var e, n, r, i, o, a, s, l, h, u, c, f, p; if (r = w(this.paragraph.text), f = this.paragraph.style, e = this.paragraph.blockstyle, this.paragraph.priorblockstyle || {}, this.paragraph = { text: [], style: [], blockstyle: {}, priorblockstyle: e }, r.join("").trim()) { s = this.splitFragmentsIntoLines(r, f), l = a = void 0, n = 12 / this.pdf.internal.scaleFactor, this.priorMarginBottom = this.priorMarginBottom || 0, c = (Math.max((e["margin-top"] || 0) - this.priorMarginBottom, 0) + (e["padding-top"] || 0)) * n, u = ((e["margin-bottom"] || 0) + (e["padding-bottom"] || 0)) * n, this.priorMarginBottom = e["margin-bottom"] || 0, "always" === e["page-break-before"] && (this.pdf.addPage(), this.y = 0, c = ((e["margin-top"] || 0) + (e["padding-top"] || 0)) * n), h = this.pdf.internal.write, o = i = void 0, this.y += c, h("q", "BT 0 g", this.pdf.internal.getCoordinateString(this.x), this.pdf.internal.getVerticalCoordinateString(this.y), "Td"); for (var d = 0; s.length;) { for (i = l = 0, o = (a = s.shift()).length; i !== o;)a[i][0].trim() && (l = Math.max(l, a[i][1]["line-height"], a[i][1]["font-size"]), p = 7 * a[i][1]["font-size"]), i++; var g = 0, m = 0; for (void 0 !== a[0][1]["margin-left"] && 0 < a[0][1]["margin-left"] && (g = (m = this.pdf.internal.getCoordinateString(a[0][1]["margin-left"])) - d, d = m), h(g + Math.max(e["margin-left"] || 0, 0) * n, (-12 * l).toFixed(2), "Td"), i = 0, o = a.length; i !== o;)a[i][0] && this.RenderTextFragment(a[i][0], a[i][1]), i++; if (this.y += l * n, this.executeWatchFunctions(a[0][1]) && 0 < s.length) { var y = [], v = []; s.forEach(function (t) { for (var e = 0, n = t.length; e !== n;)t[e][0] && (y.push(t[e][0] + " "), v.push(t[e][1])), ++e }), s = this.splitFragmentsIntoLines(w(y), v), h("ET", "Q"), h("q", "BT 0 g", this.pdf.internal.getCoordinateString(this.x), this.pdf.internal.getVerticalCoordinateString(this.y), "Td") } } return t && "function" == typeof t && t.call(this, this.x - 9, this.y - p / 2), h("ET", "Q"), this.y += u } }, f.prototype.setBlockBoundary = function (t) { return this.renderParagraph(t) }, f.prototype.setBlockStyle = function (t) { return this.paragraph.blockstyle = t }, f.prototype.addText = function (t, e) { return this.paragraph.text.push(t), this.paragraph.style.push(e) }, i = { helvetica: "helvetica", "sans-serif": "helvetica", "times new roman": "times", serif: "times", times: "times", monospace: "courier", courier: "courier" }, l = { 100: "normal", 200: "normal", 300: "normal", 400: "normal", 500: "bold", 600: "bold", 700: "bold", 800: "bold", 900: "bold", normal: "normal", bold: "bold", bolder: "bold", lighter: "normal" }, a = { normal: "normal", italic: "italic", oblique: "italic" }, s = { left: "left", right: "right", center: "center", justify: "justify" }, h = { none: "none", right: "right", left: "left" }, u = { none: "none", both: "both" }, n = { normal: 1 }, t.fromHTML = function (t, e, n, r, i, o) { return this.margins_doc = o || { top: 0, bottom: 0 }, r || (r = {}), r.elementHandlers || (r.elementHandlers = {}), m(this, t, isNaN(e) ? 4 : e, isNaN(n) ? 4 : n, r, i) } }(lt.API), lt.API, ("undefined" != typeof window && window || "undefined" != typeof global && global).html2pdf = function (t, a, e) { var n = a.canvas; if (n) { var r, i; if ((n.pdf = a).annotations = { _nameMap: [], createAnnotation: function (t, e) { var n, r = a.context2d._wrapX(e.left), i = a.context2d._wrapY(e.top), o = (a.context2d._page(e.top), t.indexOf("#")); n = 0 <= o ? { name: t.substring(o + 1) } : { url: t }, a.link(r, i, e.right - e.left, e.bottom - e.top, n) }, setName: function (t, e) { var n = a.context2d._wrapX(e.left), r = a.context2d._wrapY(e.top), i = a.context2d._page(e.top); this._nameMap[t] = { page: i, x: n, y: r } } }, n.annotations = a.annotations, a.context2d._pageBreakAt = function (t) { this.pageBreaks.push(t) }, a.context2d._gotoPage = function (t) { for (; a.internal.getNumberOfPages() < t;)a.addPage(); a.setPage(t) }, "string" == typeof t) { t = t.replace(/<script\b[^<]*(?:(?!<\/script>)<[^<]*)*<\/script>/gi, ""); var o, s, l = document.createElement("iframe"); document.body.appendChild(l), null != (o = l.contentDocument) && null != o || (o = l.contentWindow.document), o.open(), o.write(t), o.close(), r = o.body, s = o.body || {}, t = o.documentElement || {}, i = Math.max(s.scrollHeight, s.offsetHeight, t.clientHeight, t.scrollHeight, t.offsetHeight) } else s = (r = t).body || {}, i = Math.max(s.scrollHeight, s.offsetHeight, t.clientHeight, t.scrollHeight, t.offsetHeight); var h = { async: !0, allowTaint: !0, backgroundColor: "#ffffff", canvas: n, imageTimeout: 15e3, logging: !0, proxy: null, removeContainer: !0, foreignObjectRendering: !1, useCORS: !1, windowHeight: i = a.internal.pageSize.getHeight(), scrollY: i }; a.context2d.pageWrapYEnabled = !0, a.context2d.pageWrapY = a.internal.pageSize.getHeight(), html2canvas(r, h).then(function (t) { e && (l && l.parentElement.removeChild(l), e(a)) }) } else alert("jsPDF canvas plugin not installed") }, window.tmp = html2pdf, function (f) { var r = f.BlobBuilder || f.WebKitBlobBuilder || f.MSBlobBuilder || f.MozBlobBuilder; f.URL = f.URL || f.webkitURL || function (t, e) { return (e = document.createElement("a")).href = t, e }; var n = f.Blob, p = URL.createObjectURL, d = URL.revokeObjectURL, o = f.Symbol && f.Symbol.toStringTag, t = !1, e = !1, g = !!f.ArrayBuffer, i = r && r.prototype.append && r.prototype.getBlob; try { t = 2 === new Blob(["ä"]).size, e = 2 === new Blob([new Uint8Array([1, 2])]).size } catch (t) { } function a(t) { return t.map(function (t) { if (t.buffer instanceof ArrayBuffer) { var e = t.buffer; if (t.byteLength !== e.byteLength) { var n = new Uint8Array(t.byteLength); n.set(new Uint8Array(e, t.byteOffset, t.byteLength)), e = n.buffer } return e } return t }) } function s(t, e) { e = e || {}; var n = new r; return a(t).forEach(function (t) { n.append(t) }), e.type ? n.getBlob(e.type) : n.getBlob() } function l(t, e) { return new n(a(t), e || {}) } if (f.Blob && (s.prototype = Blob.prototype, l.prototype = Blob.prototype), o) try { File.prototype[o] = "File", Blob.prototype[o] = "Blob", FileReader.prototype[o] = "FileReader" } catch (t) { } function h() { var t = !!f.ActiveXObject || "-ms-scroll-limit" in document.documentElement.style && "-ms-ime-align" in document.documentElement.style, e = f.XMLHttpRequest && f.XMLHttpRequest.prototype.send; t && e && (XMLHttpRequest.prototype.send = function (t) { t instanceof Blob && this.setRequestHeader("Content-Type", t.type), e.call(this, t) }); try { new File([], "") } catch (t) { try { var n = new Function('class File extends Blob {constructor(chunks, name, opts) {opts = opts || {};super(chunks, opts || {});this.name = name;this.lastModifiedDate = opts.lastModified ? new Date(opts.lastModified) : new Date;this.lastModified = +this.lastModifiedDate;}};return new File([], ""), File')(); f.File = n } catch (t) { n = function (t, e, n) { var r = new Blob(t, n), i = n && void 0 !== n.lastModified ? new Date(n.lastModified) : new Date; return r.name = e, r.lastModifiedDate = i, r.lastModified = +i, r.toString = function () { return "[object File]" }, o && (r[o] = "File"), r }; f.File = n } } } t ? (h(), f.Blob = e ? f.Blob : l) : i ? (h(), f.Blob = s) : function () { function a(t) { for (var e = [], n = 0; n < t.length; n++) { var r = t.charCodeAt(n); r < 128 ? e.push(r) : r < 2048 ? e.push(192 | r >> 6, 128 | 63 & r) : r < 55296 || 57344 <= r ? e.push(224 | r >> 12, 128 | r >> 6 & 63, 128 | 63 & r) : (n++ , r = 65536 + ((1023 & r) << 10 | 1023 & t.charCodeAt(n)), e.push(240 | r >> 18, 128 | r >> 12 & 63, 128 | r >> 6 & 63, 128 | 63 & r)) } return e } function e(t) { var e, n, r, i, o, a; for (e = "", r = t.length, n = 0; n < r;)switch ((i = t[n++]) >> 4) { case 0: case 1: case 2: case 3: case 4: case 5: case 6: case 7: e += String.fromCharCode(i); break; case 12: case 13: o = t[n++], e += String.fromCharCode((31 & i) << 6 | 63 & o); break; case 14: o = t[n++], a = t[n++], e += String.fromCharCode((15 & i) << 12 | (63 & o) << 6 | (63 & a) << 0) }return e } function s(t) { for (var e = new Array(t.byteLength), n = new Uint8Array(t), r = e.length; r--;)e[r] = n[r]; return e } function n(t) { for (var e = "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789", n = [], r = 0; r < t.length; r += 3) { var i = t[r], o = r + 1 < t.length, a = o ? t[r + 1] : 0, s = r + 2 < t.length, l = s ? t[r + 2] : 0, h = i >> 2, u = (3 & i) << 4 | a >> 4, c = (15 & a) << 2 | l >> 6, f = 63 & l; s || (f = 64, o || (c = 64)), n.push(e[h], e[u], e[c], e[f]) } return n.join("") } var t = Object.create || function (t) { function e() { } return e.prototype = t, new e }; if (g) var r = ["[object Int8Array]", "[object Uint8Array]", "[object Uint8ClampedArray]", "[object Int16Array]", "[object Uint16Array]", "[object Int32Array]", "[object Uint32Array]", "[object Float32Array]", "[object Float64Array]"], l = ArrayBuffer.isView || function (t) { return t && -1 < r.indexOf(Object.prototype.toString.call(t)) }; function h(t, e) { for (var n = 0, r = (t = t || []).length; n < r; n++) { var i = t[n]; i instanceof h ? t[n] = i._buffer : "string" == typeof i ? t[n] = a(i) : g && (ArrayBuffer.prototype.isPrototypeOf(i) || l(i)) ? t[n] = s(i) : g && (o = i) && DataView.prototype.isPrototypeOf(o) ? t[n] = s(i.buffer) : t[n] = a(String(i)) } var o; this._buffer = [].concat.apply([], t), this.size = this._buffer.length, this.type = e && e.type || "" } function i(t, e, n) { var r = h.call(this, t, n = n || {}) || this; return r.name = e, r.lastModifiedDate = n.lastModified ? new Date(n.lastModified) : new Date, r.lastModified = +r.lastModifiedDate, r } if (h.prototype.slice = function (t, e, n) { return new h([this._buffer.slice(t || 0, e || this._buffer.length)], { type: n }) }, h.prototype.toString = function () { return "[object Blob]" }, (i.prototype = t(h.prototype)).constructor = i, Object.setPrototypeOf) Object.setPrototypeOf(i, h); else try { i.__proto__ = h } catch (t) { } function o() { if (!(this instanceof o)) throw new TypeError("Failed to construct 'FileReader': Please use the 'new' operator, this DOM object constructor cannot be called as a function."); var n = document.createDocumentFragment(); this.addEventListener = n.addEventListener, this.dispatchEvent = function (t) { var e = this["on" + t.type]; "function" == typeof e && e(t), n.dispatchEvent(t) }, this.removeEventListener = n.removeEventListener } function u(t, e, n) { if (!(e instanceof h)) throw new TypeError("Failed to execute '" + n + "' on 'FileReader': parameter 1 is not of type 'Blob'."); t.result = "", setTimeout(function () { this.readyState = o.LOADING, t.dispatchEvent(new Event("load")), t.dispatchEvent(new Event("loadend")) }) } i.prototype.toString = function () { return "[object File]" }, o.EMPTY = 0, o.LOADING = 1, o.DONE = 2, o.prototype.error = null, o.prototype.onabort = null, o.prototype.onerror = null, o.prototype.onload = null, o.prototype.onloadend = null, o.prototype.onloadstart = null, o.prototype.onprogress = null, o.prototype.readAsDataURL = function (t) { u(this, t, "readAsDataURL"), this.result = "data:" + t.type + ";base64," + n(t._buffer) }, o.prototype.readAsText = function (t) { u(this, t, "readAsText"), this.result = e(t._buffer) }, o.prototype.readAsArrayBuffer = function (t) { u(this, t, "readAsText"), this.result = t._buffer.slice() }, o.prototype.abort = function () { }, URL.createObjectURL = function (t) { return t instanceof h ? "data:" + t.type + ";base64," + n(t._buffer) : p.call(URL, t) }, URL.revokeObjectURL = function (t) { d && d.call(URL, t) }; var c = f.XMLHttpRequest && f.XMLHttpRequest.prototype.send; c && (XMLHttpRequest.prototype.send = function (t) { t instanceof h ? (this.setRequestHeader("Content-Type", t.type), c.call(this, e(t._buffer))) : c.call(this, t) }), f.FileReader = o, f.File = i, f.Blob = h }() }("undefined" != typeof self && self || "undefined" != typeof window && window || "undefined" != typeof global && global || Function('return typeof this === "object" && this.content')() || Function("return this")()); var ht, ut, ct, ft, pt, dt, gt, mt, yt, vt, wt, bt, xt, Nt, Lt, le = le || function (s) { if (!(void 0 === s || "undefined" != typeof navigator && /MSIE [1-9]\./.test(navigator.userAgent))) { var t = s.document, l = function () { return s.URL || s.webkitURL || s }, h = t.createElementNS("http://www.w3.org/1999/xhtml", "a"), u = "download" in h, c = /constructor/i.test(s.HTMLElement) || s.safari, f = /CriOS\/[\d]+/.test(navigator.userAgent), p = s.setImmediate || s.setTimeout, d = function (t) { p(function () { throw t }, 0) }, g = function (t) { setTimeout(function () { "string" == typeof t ? l().revokeObjectURL(t) : t.remove() }, 4e4) }, m = function (t) { return /^\s*(?:text\/\S*|application\/xml|\S*\/\S*\+xml)\s*;.*charset\s*=\s*utf-8/i.test(t.type) ? new Blob([String.fromCharCode(65279), t], { type: t.type }) : t }, r = function (t, n, e) { e || (t = m(t)); var r, i = this, o = "application/octet-stream" === t.type, a = function () { !function (t, e, n) { for (var r = (e = [].concat(e)).length; r--;) { var i = t["on" + e[r]]; if ("function" == typeof i) try { i.call(t, n || t) } catch (t) { d(t) } } }(i, "writestart progress write writeend".split(" ")) }; if (i.readyState = i.INIT, u) return r = l().createObjectURL(t), void p(function () { var t, e; h.href = r, h.download = n, t = h, e = new MouseEvent("click"), t.dispatchEvent(e), a(), g(r), i.readyState = i.DONE }, 0); !function () { if ((f || o && c) && s.FileReader) { var e = new FileReader; return e.onloadend = function () { var t = f ? e.result : e.result.replace(/^data:[^;]*;/, "data:attachment/file;"); s.open(t, "_blank") || (s.location.href = t), t = void 0, i.readyState = i.DONE, a() }, e.readAsDataURL(t), i.readyState = i.INIT } r || (r = l().createObjectURL(t)), o ? s.location.href = r : s.open(r, "_blank") || (s.location.href = r); i.readyState = i.DONE, a(), g(r) }() }, e = r.prototype; return "undefined" != typeof navigator && navigator.msSaveOrOpenBlob ? function (t, e, n) { return e = e || t.name || "download", n || (t = m(t)), navigator.msSaveOrOpenBlob(t, e) } : (e.abort = function () { }, e.readyState = e.INIT = 0, e.WRITING = 1, e.DONE = 2, e.error = e.onwritestart = e.onprogress = e.onwrite = e.onabort = e.onerror = e.onwriteend = null, function (t, e, n) { return new r(t, e || t.name || "download", n) }) } }("undefined" != typeof self && self || "undefined" != typeof window && window || void 0); function At(x) { var t = 0; if (71 !== x[t++] || 73 !== x[t++] || 70 !== x[t++] || 56 !== x[t++] || 56 != (x[t++] + 1 & 253) || 97 !== x[t++]) throw "Invalid GIF 87a/89a header."; var N = x[t++] | x[t++] << 8, e = x[t++] | x[t++] << 8, n = x[t++], r = n >> 7, i = 1 << (7 & n) + 1; x[t++]; x[t++]; var o = null; r && (o = t, t += 3 * i); var a = !0, s = [], l = 0, h = null, u = 0, c = null; for (this.width = N, this.height = e; a && t < x.length;)switch (x[t++]) { case 33: switch (x[t++]) { case 255: if (11 !== x[t] || 78 == x[t + 1] && 69 == x[t + 2] && 84 == x[t + 3] && 83 == x[t + 4] && 67 == x[t + 5] && 65 == x[t + 6] && 80 == x[t + 7] && 69 == x[t + 8] && 50 == x[t + 9] && 46 == x[t + 10] && 48 == x[t + 11] && 3 == x[t + 12] && 1 == x[t + 13] && 0 == x[t + 16]) t += 14, c = x[t++] | x[t++] << 8, t++; else for (t += 12; ;) { if (0 === (A = x[t++])) break; t += A } break; case 249: if (4 !== x[t++] || 0 !== x[t + 4]) throw "Invalid graphics extension block."; var f = x[t++]; l = x[t++] | x[t++] << 8, h = x[t++], 0 == (1 & f) && (h = null), u = f >> 2 & 7, t++; break; case 254: for (; ;) { if (0 === (A = x[t++])) break; t += A } break; default: throw "Unknown graphic control label: 0x" + x[t - 1].toString(16) }break; case 44: var p = x[t++] | x[t++] << 8, d = x[t++] | x[t++] << 8, g = x[t++] | x[t++] << 8, m = x[t++] | x[t++] << 8, y = x[t++], v = y >> 6 & 1, w = o, b = !1; if (y >> 7) { b = !0; w = t, t += 3 * (1 << (7 & y) + 1) } var L = t; for (t++; ;) { var A; if (0 === (A = x[t++])) break; t += A } s.push({ x: p, y: d, width: g, height: m, has_local_palette: b, palette_offset: w, data_offset: L, data_length: t - L, transparent_index: h, interlaced: !!v, delay: l, disposal: u }); break; case 59: a = !1; break; default: throw "Unknown gif block: 0x" + x[t - 1].toString(16) }this.numFrames = function () { return s.length }, this.loopCount = function () { return c }, this.frameInfo = function (t) { if (t < 0 || t >= s.length) throw "Frame index out of range."; return s[t] }, this.decodeAndBlitFrameBGRA = function (t, e) { var n = this.frameInfo(t), r = n.width * n.height, i = new Uint8Array(r); St(x, n.data_offset, i, r); var o = n.palette_offset, a = n.transparent_index; null === a && (a = 256); var s = n.width, l = N - s, h = s, u = 4 * (n.y * N + n.x), c = 4 * ((n.y + n.height) * N + n.x), f = u, p = 4 * l; !0 === n.interlaced && (p += 4 * (s + l) * 7); for (var d = 8, g = 0, m = i.length; g < m; ++g) { var y = i[g]; if (0 === h && (h = s, c <= (f += p) && (p = l + 4 * (s + l) * (d - 1), f = u + (s + l) * (d << 1), d >>= 1)), y === a) f += 4; else { var v = x[o + 3 * y], w = x[o + 3 * y + 1], b = x[o + 3 * y + 2]; e[f++] = b, e[f++] = w, e[f++] = v, e[f++] = 255 } --h } }, this.decodeAndBlitFrameRGBA = function (t, e) { var n = this.frameInfo(t), r = n.width * n.height, i = new Uint8Array(r); St(x, n.data_offset, i, r); var o = n.palette_offset, a = n.transparent_index; null === a && (a = 256); var s = n.width, l = N - s, h = s, u = 4 * (n.y * N + n.x), c = 4 * ((n.y + n.height) * N + n.x), f = u, p = 4 * l; !0 === n.interlaced && (p += 4 * (s + l) * 7); for (var d = 8, g = 0, m = i.length; g < m; ++g) { var y = i[g]; if (0 === h && (h = s, c <= (f += p) && (p = l + 4 * (s + l) * (d - 1), f = u + (s + l) * (d << 1), d >>= 1)), y === a) f += 4; else { var v = x[o + 3 * y], w = x[o + 3 * y + 1], b = x[o + 3 * y + 2]; e[f++] = v, e[f++] = w, e[f++] = b, e[f++] = 255 } --h } } } function St(t, e, n, r) { for (var i = t[e++], o = 1 << i, a = o + 1, s = a + 1, l = i + 1, h = (1 << l) - 1, u = 0, c = 0, f = 0, p = t[e++], d = new Int32Array(4096), g = null; ;) { for (; u < 16 && 0 !== p;)c |= t[e++] << u, u += 8, 1 === p ? p = t[e++] : --p; if (u < l) break; var m = c & h; if (c >>= l, u -= l, m !== o) { if (m === a) break; for (var y = m < s ? m : g, v = 0, w = y; o < w;)w = d[w] >> 8, ++v; var b = w; if (r < f + v + (y !== m ? 1 : 0)) return void console.log("Warning, gif stream longer than expected."); n[f++] = b; var x = f += v; for (y !== m && (n[f++] = b), w = y; v--;)w = d[w], n[--x] = 255 & w, w >>= 8; null !== g && s < 4096 && (d[s++] = g << 8 | b, h + 1 <= s && l < 12 && (++l, h = h << 1 | 1)), g = m } else s = a + 1, h = (1 << (l = i + 1)) - 1, g = null } return f !== r && console.log("Warning, gif stream shorter than expected."), n } try { exports.GifWriter = function (y, t, e, n) { var v = 0, r = void 0 === (n = void 0 === n ? {} : n).loop ? null : n.loop, w = void 0 === n.palette ? null : n.palette; if (t <= 0 || e <= 0 || 65535 < t || 65535 < e) throw "Width/Height invalid."; function b(t) { var e = t.length; if (e < 2 || 256 < e || e & e - 1) throw "Invalid code/color length, must be power of 2 and 2 .. 256."; return e } y[v++] = 71, y[v++] = 73, y[v++] = 70, y[v++] = 56, y[v++] = 57, y[v++] = 97; var i = 0, o = 0; if (null !== w) { for (var a = b(w); a >>= 1;)++i; if (a = 1 << i, --i, void 0 !== n.background) { if (a <= (o = n.background)) throw "Background index out of range."; if (0 === o) throw "Background index explicitly passed as 0." } } if (y[v++] = 255 & t, y[v++] = t >> 8 & 255, y[v++] = 255 & e, y[v++] = e >> 8 & 255, y[v++] = (null !== w ? 128 : 0) | i, y[v++] = o, y[v++] = 0, null !== w) for (var s = 0, l = w.length; s < l; ++s) { var h = w[s]; y[v++] = h >> 16 & 255, y[v++] = h >> 8 & 255, y[v++] = 255 & h } if (null !== r) { if (r < 0 || 65535 < r) throw "Loop count invalid."; y[v++] = 33, y[v++] = 255, y[v++] = 11, y[v++] = 78, y[v++] = 69, y[v++] = 84, y[v++] = 83, y[v++] = 67, y[v++] = 65, y[v++] = 80, y[v++] = 69, y[v++] = 50, y[v++] = 46, y[v++] = 48, y[v++] = 3, y[v++] = 1, y[v++] = 255 & r, y[v++] = r >> 8 & 255, y[v++] = 0 } var x = !1; this.addFrame = function (t, e, n, r, i, o) { if (!0 === x && (--v, x = !1), o = void 0 === o ? {} : o, t < 0 || e < 0 || 65535 < t || 65535 < e) throw "x/y invalid."; if (n <= 0 || r <= 0 || 65535 < n || 65535 < r) throw "Width/Height invalid."; if (i.length < n * r) throw "Not enough pixels for the frame size."; var a = !0, s = o.palette; if (null == s && (a = !1, s = w), null == s) throw "Must supply either a local or global palette."; for (var l = b(s), h = 0; l >>= 1;)++h; l = 1 << h; var u = void 0 === o.delay ? 0 : o.delay, c = void 0 === o.disposal ? 0 : o.disposal; if (c < 0 || 3 < c) throw "Disposal out of range."; var f = !1, p = 0; if (void 0 !== o.transparent && null !== o.transparent && (f = !0, (p = o.transparent) < 0 || l <= p)) throw "Transparent color index."; if ((0 !== c || f || 0 !== u) && (y[v++] = 33, y[v++] = 249, y[v++] = 4, y[v++] = c << 2 | (!0 === f ? 1 : 0), y[v++] = 255 & u, y[v++] = u >> 8 & 255, y[v++] = p, y[v++] = 0), y[v++] = 44, y[v++] = 255 & t, y[v++] = t >> 8 & 255, y[v++] = 255 & e, y[v++] = e >> 8 & 255, y[v++] = 255 & n, y[v++] = n >> 8 & 255, y[v++] = 255 & r, y[v++] = r >> 8 & 255, y[v++] = !0 === a ? 128 | h - 1 : 0, !0 === a) for (var d = 0, g = s.length; d < g; ++d) { var m = s[d]; y[v++] = m >> 16 & 255, y[v++] = m >> 8 & 255, y[v++] = 255 & m } v = function (e, n, t, r) { e[n++] = t; var i = n++, o = 1 << t, a = o - 1, s = o + 1, l = s + 1, h = t + 1, u = 0, c = 0; function f(t) { for (; t <= u;)e[n++] = 255 & c, c >>= 8, u -= 8, n === i + 256 && (e[i] = 255, i = n++) } function p(t) { c |= t << u, u += h, f(8) } var d = r[0] & a, g = {}; p(o); for (var m = 1, y = r.length; m < y; ++m) { var v = r[m] & a, w = d << 8 | v, b = g[w]; if (void 0 === b) { for (c |= d << u, u += h; 8 <= u;)e[n++] = 255 & c, c >>= 8, u -= 8, n === i + 256 && (e[i] = 255, i = n++); 4096 === l ? (p(o), l = s + 1, h = t + 1, g = {}) : (1 << h <= l && ++h, g[w] = l++), d = v } else d = b } return p(d), p(s), f(1), i + 1 === n ? e[i] = 0 : (e[i] = n - i - 1, e[n++] = 0), n }(y, v, h < 2 ? 2 : h, i) }, this.end = function () { return !1 === x && (y[v++] = 59, x = !0), v } }, exports.GifReader = At } catch (t) { }
    /*
        Copyright (c) 2008, Adobe Systems Incorporated
        All rights reserved.
    
        Redistribution and use in source and binary forms, with or without 
        modification, are permitted provided that the following conditions are
        met:
    
        * Redistributions of source code must retain the above copyright notice, 
          this list of conditions and the following disclaimer.
        
        * Redistributions in binary form must reproduce the above copyright
          notice, this list of conditions and the following disclaimer in the 
          documentation and/or other materials provided with the distribution.
        
        * Neither the name of Adobe Systems Incorporated nor the names of its 
          contributors may be used to endorse or promote products derived from 
          this software without specific prior written permission.
    
        THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS
        IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO,
        THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR
        PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR 
        CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL,
        EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO,
        PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR
        PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF
        LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
        NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS
        SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
      */
    function _t(t) { var N, L, A, S, e, c = Math.floor, _ = new Array(64), F = new Array(64), P = new Array(64), k = new Array(64), y = new Array(65535), v = new Array(65535), Z = new Array(64), w = new Array(64), I = [], C = 0, B = 7, j = new Array(64), E = new Array(64), M = new Array(64), n = new Array(256), O = new Array(2048), b = [0, 1, 5, 6, 14, 15, 27, 28, 2, 4, 7, 13, 16, 26, 29, 42, 3, 8, 12, 17, 25, 30, 41, 43, 9, 11, 18, 24, 31, 40, 44, 53, 10, 19, 23, 32, 39, 45, 52, 54, 20, 22, 33, 38, 46, 51, 55, 60, 21, 34, 37, 47, 50, 56, 59, 61, 35, 36, 48, 49, 57, 58, 62, 63], q = [0, 0, 1, 5, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0], T = [0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11], R = [0, 0, 2, 1, 3, 3, 2, 4, 3, 5, 5, 4, 4, 0, 0, 1, 125], D = [1, 2, 3, 0, 4, 17, 5, 18, 33, 49, 65, 6, 19, 81, 97, 7, 34, 113, 20, 50, 129, 145, 161, 8, 35, 66, 177, 193, 21, 82, 209, 240, 36, 51, 98, 114, 130, 9, 10, 22, 23, 24, 25, 26, 37, 38, 39, 40, 41, 42, 52, 53, 54, 55, 56, 57, 58, 67, 68, 69, 70, 71, 72, 73, 74, 83, 84, 85, 86, 87, 88, 89, 90, 99, 100, 101, 102, 103, 104, 105, 106, 115, 116, 117, 118, 119, 120, 121, 122, 131, 132, 133, 134, 135, 136, 137, 138, 146, 147, 148, 149, 150, 151, 152, 153, 154, 162, 163, 164, 165, 166, 167, 168, 169, 170, 178, 179, 180, 181, 182, 183, 184, 185, 186, 194, 195, 196, 197, 198, 199, 200, 201, 202, 210, 211, 212, 213, 214, 215, 216, 217, 218, 225, 226, 227, 228, 229, 230, 231, 232, 233, 234, 241, 242, 243, 244, 245, 246, 247, 248, 249, 250], U = [0, 0, 3, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0], z = [0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11], H = [0, 0, 2, 1, 2, 4, 4, 3, 4, 7, 5, 4, 4, 0, 1, 2, 119], W = [0, 1, 2, 3, 17, 4, 5, 33, 49, 6, 18, 65, 81, 7, 97, 113, 19, 34, 50, 129, 8, 20, 66, 145, 161, 177, 193, 9, 35, 51, 82, 240, 21, 98, 114, 209, 10, 22, 36, 52, 225, 37, 241, 23, 24, 25, 26, 38, 39, 40, 41, 42, 53, 54, 55, 56, 57, 58, 67, 68, 69, 70, 71, 72, 73, 74, 83, 84, 85, 86, 87, 88, 89, 90, 99, 100, 101, 102, 103, 104, 105, 106, 115, 116, 117, 118, 119, 120, 121, 122, 130, 131, 132, 133, 134, 135, 136, 137, 138, 146, 147, 148, 149, 150, 151, 152, 153, 154, 162, 163, 164, 165, 166, 167, 168, 169, 170, 178, 179, 180, 181, 182, 183, 184, 185, 186, 194, 195, 196, 197, 198, 199, 200, 201, 202, 210, 211, 212, 213, 214, 215, 216, 217, 218, 226, 227, 228, 229, 230, 231, 232, 233, 234, 242, 243, 244, 245, 246, 247, 248, 249, 250]; function r(t, e) { for (var n = 0, r = 0, i = new Array, o = 1; o <= 16; o++) { for (var a = 1; a <= t[o]; a++)i[e[r]] = [], i[e[r]][0] = n, i[e[r]][1] = o, r++ , n++; n *= 2 } return i } function V(t) { for (var e = t[0], n = t[1] - 1; 0 <= n;)e & 1 << n && (C |= 1 << B), n-- , --B < 0 && (255 == C ? (G(255), G(0)) : G(C), B = 7, C = 0) } function G(t) { I.push(t) } function Y(t) { G(t >> 8 & 255), G(255 & t) } function J(t, e, n, r, i) { for (var o, a = i[0], s = i[240], l = function (t, e) { var n, r, i, o, a, s, l, h, u, c, f = 0; for (u = 0; u < 8; ++u) { n = t[f], r = t[f + 1], i = t[f + 2], o = t[f + 3], a = t[f + 4], s = t[f + 5], l = t[f + 6]; var p = n + (h = t[f + 7]), d = n - h, g = r + l, m = r - l, y = i + s, v = i - s, w = o + a, b = o - a, x = p + w, N = p - w, L = g + y, A = g - y; t[f] = x + L, t[f + 4] = x - L; var S = .707106781 * (A + N); t[f + 2] = N + S, t[f + 6] = N - S; var _ = .382683433 * ((x = b + v) - (A = m + d)), F = .5411961 * x + _, P = 1.306562965 * A + _, k = .707106781 * (L = v + m), I = d + k, C = d - k; t[f + 5] = C + F, t[f + 3] = C - F, t[f + 1] = I + P, t[f + 7] = I - P, f += 8 } for (u = f = 0; u < 8; ++u) { n = t[f], r = t[f + 8], i = t[f + 16], o = t[f + 24], a = t[f + 32], s = t[f + 40], l = t[f + 48]; var B = n + (h = t[f + 56]), j = n - h, E = r + l, M = r - l, O = i + s, q = i - s, T = o + a, R = o - a, D = B + T, U = B - T, z = E + O, H = E - O; t[f] = D + z, t[f + 32] = D - z; var W = .707106781 * (H + U); t[f + 16] = U + W, t[f + 48] = U - W; var V = .382683433 * ((D = R + q) - (H = M + j)), G = .5411961 * D + V, Y = 1.306562965 * H + V, J = .707106781 * (z = q + M), X = j + J, K = j - J; t[f + 40] = K + G, t[f + 24] = K - G, t[f + 8] = X + Y, t[f + 56] = X - Y, f++ } for (u = 0; u < 64; ++u)c = t[u] * e[u], Z[u] = 0 < c ? c + .5 | 0 : c - .5 | 0; return Z }(t, e), h = 0; h < 64; ++h)w[b[h]] = l[h]; var u = w[0] - n; n = w[0], 0 == u ? V(r[0]) : (V(r[v[o = 32767 + u]]), V(y[o])); for (var c = 63; 0 < c && 0 == w[c]; c--); if (0 == c) return V(a), n; for (var f, p = 1; p <= c;) { for (var d = p; 0 == w[p] && p <= c; ++p); var g = p - d; if (16 <= g) { f = g >> 4; for (var m = 1; m <= f; ++m)V(s); g &= 15 } o = 32767 + w[p], V(i[(g << 4) + v[o]]), V(y[o]), p++ } return 63 != c && V(a), n } function X(t) { if (t <= 0 && (t = 1), 100 < t && (t = 100), e != t) { (function (t) { for (var e = [16, 11, 10, 16, 24, 40, 51, 61, 12, 12, 14, 19, 26, 58, 60, 55, 14, 13, 16, 24, 40, 57, 69, 56, 14, 17, 22, 29, 51, 87, 80, 62, 18, 22, 37, 56, 68, 109, 103, 77, 24, 35, 55, 64, 81, 104, 113, 92, 49, 64, 78, 87, 103, 121, 120, 101, 72, 92, 95, 98, 112, 100, 103, 99], n = 0; n < 64; n++) { var r = c((e[n] * t + 50) / 100); r < 1 ? r = 1 : 255 < r && (r = 255), _[b[n]] = r } for (var i = [17, 18, 24, 47, 99, 99, 99, 99, 18, 21, 26, 66, 99, 99, 99, 99, 24, 26, 56, 99, 99, 99, 99, 99, 47, 66, 99, 99, 99, 99, 99, 99, 99, 99, 99, 99, 99, 99, 99, 99, 99, 99, 99, 99, 99, 99, 99, 99, 99, 99, 99, 99, 99, 99, 99, 99, 99, 99, 99, 99, 99, 99, 99, 99], o = 0; o < 64; o++) { var a = c((i[o] * t + 50) / 100); a < 1 ? a = 1 : 255 < a && (a = 255), F[b[o]] = a } for (var s = [1, 1.387039845, 1.306562965, 1.175875602, 1, .785694958, .5411961, .275899379], l = 0, h = 0; h < 8; h++)for (var u = 0; u < 8; u++)P[l] = 1 / (_[b[l]] * s[h] * s[u] * 8), k[l] = 1 / (F[b[l]] * s[h] * s[u] * 8), l++ })(t < 50 ? Math.floor(5e3 / t) : Math.floor(200 - 2 * t)), e = t } } this.encode = function (t, e) { var n, r; (new Date).getTime(); e && X(e), I = new Array, C = 0, B = 7, Y(65496), Y(65504), Y(16), G(74), G(70), G(73), G(70), G(0), G(1), G(1), G(0), Y(1), Y(1), G(0), G(0), function () { Y(65499), Y(132), G(0); for (var t = 0; t < 64; t++)G(_[t]); G(1); for (var e = 0; e < 64; e++)G(F[e]) }(), n = t.width, r = t.height, Y(65472), Y(17), G(8), Y(r), Y(n), G(3), G(1), G(17), G(0), G(2), G(17), G(1), G(3), G(17), G(1), function () { Y(65476), Y(418), G(0); for (var t = 0; t < 16; t++)G(q[t + 1]); for (var e = 0; e <= 11; e++)G(T[e]); G(16); for (var n = 0; n < 16; n++)G(R[n + 1]); for (var r = 0; r <= 161; r++)G(D[r]); G(1); for (var i = 0; i < 16; i++)G(U[i + 1]); for (var o = 0; o <= 11; o++)G(z[o]); G(17); for (var a = 0; a < 16; a++)G(H[a + 1]); for (var s = 0; s <= 161; s++)G(W[s]) }(), Y(65498), Y(12), G(3), G(1), G(0), G(2), G(17), G(3), G(17), G(0), G(63), G(0); var i = 0, o = 0, a = 0; C = 0, B = 7, this.encode.displayName = "_encode_"; for (var s, l, h, u, c, f, p, d, g, m = t.data, y = t.width, v = t.height, w = 4 * y, b = 0; b < v;) { for (s = 0; s < w;) { for (f = c = w * b + s, p = -1, g = d = 0; g < 64; g++)f = c + (d = g >> 3) * w + (p = 4 * (7 & g)), v <= b + d && (f -= w * (b + 1 + d - v)), w <= s + p && (f -= s + p - w + 4), l = m[f++], h = m[f++], u = m[f++], j[g] = (O[l] + O[h + 256 >> 0] + O[u + 512 >> 0] >> 16) - 128, E[g] = (O[l + 768 >> 0] + O[h + 1024 >> 0] + O[u + 1280 >> 0] >> 16) - 128, M[g] = (O[l + 1280 >> 0] + O[h + 1536 >> 0] + O[u + 1792 >> 0] >> 16) - 128; i = J(j, P, i, N, A), o = J(E, k, o, L, S), a = J(M, k, a, L, S), s += 32 } b += 8 } if (0 <= B) { var x = []; x[1] = B + 1, x[0] = (1 << B + 1) - 1, V(x) } return Y(65497), new Uint8Array(I) }, function () { (new Date).getTime(); t || (t = 50), function () { for (var t = String.fromCharCode, e = 0; e < 256; e++)n[e] = t(e) }(), N = r(q, T), L = r(U, z), A = r(R, D), S = r(H, W), function () { for (var t = 1, e = 2, n = 1; n <= 15; n++) { for (var r = t; r < e; r++)v[32767 + r] = n, y[32767 + r] = [], y[32767 + r][1] = n, y[32767 + r][0] = r; for (var i = -(e - 1); i <= -t; i++)v[32767 + i] = n, y[32767 + i] = [], y[32767 + i][1] = n, y[32767 + i][0] = e - 1 + i; t <<= 1, e <<= 1 } }(), function () { for (var t = 0; t < 256; t++)O[t] = 19595 * t, O[t + 256 >> 0] = 38470 * t, O[t + 512 >> 0] = 7471 * t + 32768, O[t + 768 >> 0] = -11059 * t, O[t + 1024 >> 0] = -21709 * t, O[t + 1280 >> 0] = 32768 * t + 8421375, O[t + 1536 >> 0] = -27439 * t, O[t + 1792 >> 0] = -5329 * t }(), X(t), (new Date).getTime() }() } function Ft(t, e) { if (this.pos = 0, this.buffer = t, this.datav = new DataView(t.buffer), this.is_with_alpha = !!e, this.bottom_up = !0, this.flag = String.fromCharCode(this.buffer[0]) + String.fromCharCode(this.buffer[1]), this.pos += 2, -1 === ["BM", "BA", "CI", "CP", "IC", "PT"].indexOf(this.flag)) throw new Error("Invalid BMP File"); this.parseHeader(), this.parseBGR() } window.tmp = At, lt.API.adler32cs = (dt = "function" == typeof ArrayBuffer && "function" == typeof Uint8Array, gt = null, mt = function () { if (!dt) return function () { return !1 }; try { var t = {}; "function" == typeof t.Buffer && (gt = t.Buffer) } catch (t) { } return function (t) { return t instanceof ArrayBuffer || null !== gt && t instanceof gt } }(), yt = null !== gt ? function (t) { return new gt(t, "utf8").toString("binary") } : function (t) { return unescape(encodeURIComponent(t)) }, vt = function (t, e) { for (var n = 65535 & t, r = t >>> 16, i = 0, o = e.length; i < o; i++)n = (n + (255 & e.charCodeAt(i))) % 65521, r = (r + n) % 65521; return (r << 16 | n) >>> 0 }, wt = function (t, e) { for (var n = 65535 & t, r = t >>> 16, i = 0, o = e.length; i < o; i++)n = (n + e[i]) % 65521, r = (r + n) % 65521; return (r << 16 | n) >>> 0 }, xt = (bt = {}).Adler32 = (((pt = (ft = function (t) { if (!(this instanceof ft)) throw new TypeError("Constructor cannot called be as a function."); if (!isFinite(t = null == t ? 1 : +t)) throw new Error("First arguments needs to be a finite number."); this.checksum = t >>> 0 }).prototype = {}).constructor = ft).from = ((ht = function (t) { if (!(this instanceof ft)) throw new TypeError("Constructor cannot called be as a function."); if (null == t) throw new Error("First argument needs to be a string."); this.checksum = vt(1, t.toString()) }).prototype = pt, ht), ft.fromUtf8 = ((ut = function (t) { if (!(this instanceof ft)) throw new TypeError("Constructor cannot called be as a function."); if (null == t) throw new Error("First argument needs to be a string."); var e = yt(t.toString()); this.checksum = vt(1, e) }).prototype = pt, ut), dt && (ft.fromBuffer = ((ct = function (t) { if (!(this instanceof ft)) throw new TypeError("Constructor cannot called be as a function."); if (!mt(t)) throw new Error("First argument needs to be ArrayBuffer."); var e = new Uint8Array(t); return this.checksum = wt(1, e) }).prototype = pt, ct)), pt.update = function (t) { if (null == t) throw new Error("First argument needs to be a string."); return t = t.toString(), this.checksum = vt(this.checksum, t) }, pt.updateUtf8 = function (t) { if (null == t) throw new Error("First argument needs to be a string."); var e = yt(t.toString()); return this.checksum = vt(this.checksum, e) }, dt && (pt.updateBuffer = function (t) { if (!mt(t)) throw new Error("First argument needs to be ArrayBuffer."); var e = new Uint8Array(t); return this.checksum = wt(this.checksum, e) }), pt.clone = function () { return new xt(this.checksum) }, ft), bt.from = function (t) { if (null == t) throw new Error("First argument needs to be a string."); return vt(1, t.toString()) }, bt.fromUtf8 = function (t) { if (null == t) throw new Error("First argument needs to be a string."); var e = yt(t.toString()); return vt(1, e) }, dt && (bt.fromBuffer = function (t) { if (!mt(t)) throw new Error("First argument need to be ArrayBuffer."); var e = new Uint8Array(t); return wt(1, e) }), bt), function (t) { t.__bidiEngine__ = t.prototype.__bidiEngine__ = function (t) { var d, g, c, f, i, o, a, s = e, m = [[0, 3, 0, 1, 0, 0, 0], [0, 3, 0, 1, 2, 2, 0], [0, 3, 0, 17, 2, 0, 1], [0, 3, 5, 5, 4, 1, 0], [0, 3, 21, 21, 4, 0, 1], [0, 3, 5, 5, 4, 2, 0]], y = [[2, 0, 1, 1, 0, 1, 0], [2, 0, 1, 1, 0, 2, 0], [2, 0, 2, 1, 3, 2, 0], [2, 0, 2, 33, 3, 1, 1]], v = { L: 0, R: 1, EN: 2, AN: 3, N: 4, B: 5, S: 6 }, l = { 0: 0, 5: 1, 6: 2, 7: 3, 32: 4, 251: 5, 254: 6, 255: 7 }, h = ["(", ")", "(", "<", ">", "<", "[", "]", "[", "{", "}", "{", "«", "»", "«", "‹", "›", "‹", "⁅", "⁆", "⁅", "⁽", "⁾", "⁽", "₍", "₎", "₍", "≤", "≥", "≤", "〈", "〉", "〈", "﹙", "﹚", "﹙", "﹛", "﹜", "﹛", "﹝", "﹞", "﹝", "﹤", "﹥", "﹤"], u = new RegExp(/^([1-4|9]|1[0-9]|2[0-9]|3[0168]|4[04589]|5[012]|7[78]|159|16[0-9]|17[0-2]|21[569]|22[03489]|250)$/), w = !1, b = 0; this.__bidiEngine__ = {}; var x = function (t) { var e = t.charCodeAt(), n = e >> 8, r = l[n]; return void 0 !== r ? s[256 * r + (255 & e)] : 252 === n || 253 === n ? "AL" : u.test(n) ? "L" : 8 === n ? "R" : "N" }, p = function (t) { for (var e, n = 0; n < t.length; n++) { if ("L" === (e = x(t.charAt(n)))) return !1; if ("R" === e) return !0 } return !1 }, N = function (t, e, n, r) { var i, o, a, s, l = e[r]; switch (l) { case "L": case "R": w = !1; break; case "N": case "AN": break; case "EN": w && (l = "AN"); break; case "AL": w = !0, l = "R"; break; case "WS": l = "N"; break; case "CS": r < 1 || r + 1 >= e.length || "EN" !== (i = n[r - 1]) && "AN" !== i || "EN" !== (o = e[r + 1]) && "AN" !== o ? l = "N" : w && (o = "AN"), l = o === i ? o : "N"; break; case "ES": l = "EN" === (i = 0 < r ? n[r - 1] : "B") && r + 1 < e.length && "EN" === e[r + 1] ? "EN" : "N"; break; case "ET": if (0 < r && "EN" === n[r - 1]) { l = "EN"; break } if (w) { l = "N"; break } for (a = r + 1, s = e.length; a < s && "ET" === e[a];)a++; l = a < s && "EN" === e[a] ? "EN" : "N"; break; case "NSM": if (c && !f) { for (s = e.length, a = r + 1; a < s && "NSM" === e[a];)a++; if (a < s) { var h = t[r], u = 1425 <= h && h <= 2303 || 64286 === h; if (i = e[a], u && ("R" === i || "AL" === i)) { l = "R"; break } } } l = r < 1 || "B" === (i = e[r - 1]) ? "N" : n[r - 1]; break; case "B": d = !(w = !1), l = b; break; case "S": g = !0, l = "N"; break; case "LRE": case "RLE": case "LRO": case "RLO": case "PDF": w = !1; break; case "BN": l = "N" }return l }, L = function (t, e, n) { var r = t.split(""); return n && A(r, n, { hiLevel: b }), r.reverse(), e && e.reverse(), r.join("") }, A = function (t, e, n) { var r, i, o, a, s, l = -1, h = t.length, u = 0, c = [], f = b ? y : m, p = []; for (g = d = w = !1, i = 0; i < h; i++)p[i] = x(t[i]); for (o = 0; o < h; o++) { if (s = u, c[o] = N(t, p, c, o), r = 240 & (u = f[s][v[c[o]]]), u &= 15, e[o] = a = f[u][5], 0 < r) if (16 === r) { for (i = l; i < o; i++)e[i] = 1; l = -1 } else l = -1; if (f[u][6]) -1 === l && (l = o); else if (-1 < l) { for (i = l; i < o; i++)e[i] = a; l = -1 } "B" === p[o] && (e[o] = 0), n.hiLevel |= a } g && function (t, e, n) { for (var r = 0; r < n; r++)if ("S" === t[r]) { e[r] = b; for (var i = r - 1; 0 <= i && "WS" === t[i]; i--)e[i] = b } }(p, e, h) }, S = function (t, e, n, r, i) { if (!(i.hiLevel < t)) { if (1 === t && 1 === b && !d) return e.reverse(), void (n && n.reverse()); for (var o, a, s, l, h = e.length, u = 0; u < h;) { if (r[u] >= t) { for (s = u + 1; s < h && r[s] >= t;)s++; for (l = u, a = s - 1; l < a; l++ , a--)o = e[l], e[l] = e[a], e[a] = o, n && (o = n[l], n[l] = n[a], n[a] = o); u = s } u++ } } }, _ = function (t, e, n) { var r = t.split(""), i = { hiLevel: b }; return n || (n = []), A(r, n, i), function (t, e, n) { if (0 !== n.hiLevel && a) for (var r, i = 0; i < t.length; i++)1 === e[i] && 0 <= (r = h.indexOf(t[i])) && (t[i] = h[r + 1]) }(r, n, i), S(2, r, e, n, i), S(1, r, e, n, i), r.join("") }; return this.__bidiEngine__.doBidiReorder = function (t, e, n) { if (function (t, e) { if (e) for (var n = 0; n < t.length; n++)e[n] = n; void 0 === f && (f = p(t)), void 0 === o && (o = p(t)) }(t, e), c || !i || o) if (c && i && f ^ o) b = f ? 1 : 0, t = L(t, e, n); else if (!c && i && o) b = f ? 1 : 0, t = _(t, e, n), t = L(t, e); else if (!c || f || i || o) { if (c && !i && f ^ o) t = L(t, e), t = f ? (b = 0, _(t, e, n)) : (b = 1, t = _(t, e, n), L(t, e)); else if (c && f && !i && o) b = 1, t = _(t, e, n), t = L(t, e); else if (!c && !i && f ^ o) { var r = a; f ? (b = 1, t = _(t, e, n), b = 0, a = !1, t = _(t, e, n), a = r) : (b = 0, t = _(t, e, n), t = L(t, e), a = !(b = 1), t = _(t, e, n), a = r, t = L(t, e)) } } else b = 0, t = _(t, e, n); else b = f ? 1 : 0, t = _(t, e, n); return t }, this.__bidiEngine__.setOptions = function (t) { t && (c = t.isInputVisual, i = t.isOutputVisual, f = t.isInputRtl, o = t.isOutputRtl, a = t.isSymmetricSwapping) }, this.__bidiEngine__.setOptions(t), this.__bidiEngine__ }; var e = ["BN", "BN", "BN", "BN", "BN", "BN", "BN", "BN", "BN", "S", "B", "S", "WS", "B", "BN", "BN", "BN", "BN", "BN", "BN", "BN", "BN", "BN", "BN", "BN", "BN", "BN", "BN", "B", "B", "B", "S", "WS", "N", "N", "ET", "ET", "ET", "N", "N", "N", "N", "N", "ES", "CS", "ES", "CS", "CS", "EN", "EN", "EN", "EN", "EN", "EN", "EN", "EN", "EN", "EN", "CS", "N", "N", "N", "N", "N", "N", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "N", "N", "N", "N", "N", "N", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "N", "N", "N", "N", "BN", "BN", "BN", "BN", "BN", "BN", "B", "BN", "BN", "BN", "BN", "BN", "BN", "BN", "BN", "BN", "BN", "BN", "BN", "BN", "BN", "BN", "BN", "BN", "BN", "BN", "BN", "BN", "BN", "BN", "BN", "BN", "BN", "CS", "N", "ET", "ET", "ET", "ET", "N", "N", "N", "N", "L", "N", "N", "BN", "N", "N", "ET", "ET", "EN", "EN", "N", "L", "N", "N", "N", "EN", "L", "N", "N", "N", "N", "N", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "N", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "N", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "N", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "N", "N", "L", "L", "L", "L", "L", "L", "L", "N", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "N", "L", "N", "N", "N", "N", "N", "ET", "N", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "R", "NSM", "R", "NSM", "NSM", "R", "NSM", "NSM", "R", "NSM", "N", "N", "N", "N", "N", "N", "N", "N", "R", "R", "R", "R", "R", "R", "R", "R", "R", "R", "R", "R", "R", "R", "R", "R", "R", "R", "R", "R", "R", "R", "R", "R", "R", "R", "R", "N", "N", "N", "N", "N", "R", "R", "R", "R", "R", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "AN", "AN", "AN", "AN", "AN", "AN", "N", "N", "AL", "ET", "ET", "AL", "CS", "AL", "N", "N", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "AL", "AL", "N", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "AN", "AN", "AN", "AN", "AN", "AN", "AN", "AN", "AN", "AN", "ET", "AN", "AN", "AL", "AL", "AL", "NSM", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "AN", "N", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "AL", "AL", "NSM", "NSM", "N", "NSM", "NSM", "NSM", "NSM", "AL", "AL", "EN", "EN", "EN", "EN", "EN", "EN", "EN", "EN", "EN", "EN", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "N", "AL", "AL", "NSM", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "N", "N", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "AL", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "R", "R", "R", "R", "R", "R", "R", "R", "R", "R", "R", "R", "R", "R", "R", "R", "R", "R", "R", "R", "R", "R", "R", "R", "R", "R", "R", "R", "R", "R", "R", "R", "R", "R", "R", "R", "R", "R", "R", "R", "R", "R", "R", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "R", "R", "N", "N", "N", "N", "R", "N", "N", "N", "N", "N", "WS", "WS", "WS", "WS", "WS", "WS", "WS", "WS", "WS", "WS", "WS", "BN", "BN", "BN", "L", "R", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "WS", "B", "LRE", "RLE", "PDF", "LRO", "RLO", "CS", "ET", "ET", "ET", "ET", "ET", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "CS", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "WS", "BN", "BN", "BN", "BN", "BN", "N", "LRI", "RLI", "FSI", "PDI", "BN", "BN", "BN", "BN", "BN", "BN", "EN", "L", "N", "N", "EN", "EN", "EN", "EN", "EN", "EN", "ES", "ES", "N", "N", "N", "L", "EN", "EN", "EN", "EN", "EN", "EN", "EN", "EN", "EN", "EN", "ES", "ES", "N", "N", "N", "N", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "N", "N", "N", "ET", "ET", "ET", "ET", "ET", "ET", "ET", "ET", "ET", "ET", "ET", "ET", "ET", "ET", "ET", "ET", "ET", "ET", "ET", "ET", "ET", "ET", "ET", "ET", "ET", "ET", "ET", "ET", "ET", "ET", "ET", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "L", "L", "L", "L", "L", "L", "L", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "L", "L", "L", "L", "L", "N", "N", "N", "N", "N", "R", "NSM", "R", "R", "R", "R", "R", "R", "R", "R", "R", "R", "ES", "R", "R", "R", "R", "R", "R", "R", "R", "R", "R", "R", "R", "R", "N", "R", "R", "R", "R", "R", "N", "R", "N", "R", "R", "N", "R", "R", "N", "R", "R", "R", "R", "R", "R", "R", "R", "R", "R", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "NSM", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "CS", "N", "CS", "N", "N", "CS", "N", "N", "N", "N", "N", "N", "N", "N", "N", "ET", "N", "N", "ES", "ES", "N", "N", "N", "N", "N", "ET", "ET", "N", "N", "N", "N", "N", "AL", "AL", "AL", "AL", "AL", "N", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "AL", "N", "N", "BN", "N", "N", "N", "ET", "ET", "ET", "N", "N", "N", "N", "N", "ES", "CS", "ES", "CS", "CS", "EN", "EN", "EN", "EN", "EN", "EN", "EN", "EN", "EN", "EN", "CS", "N", "N", "N", "N", "N", "N", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "N", "N", "N", "N", "N", "N", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "L", "N", "N", "N", "L", "L", "L", "L", "L", "L", "N", "N", "L", "L", "L", "L", "L", "L", "N", "N", "L", "L", "L", "L", "L", "L", "N", "N", "L", "L", "L", "N", "N", "N", "ET", "ET", "N", "N", "N", "ET", "ET", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N", "N"], o = new t.__bidiEngine__({ isInputVisual: !0 }); t.API.events.push(["postProcessText", function (t) { var e = t.text, n = (t.x, t.y, t.options || {}), r = (t.mutex, n.lang, []); if ("[object Array]" === Object.prototype.toString.call(e)) { var i = 0; for (r = [], i = 0; i < e.length; i += 1)"[object Array]" === Object.prototype.toString.call(e[i]) ? r.push([o.doBidiReorder(e[i][0]), e[i][1], e[i][2]]) : r.push([o.doBidiReorder(e[i])]); t.text = r } else t.text = o.doBidiReorder(e) }]) }(lt), window.tmp = _t, Ft.prototype.parseHeader = function () { if (this.fileSize = this.datav.getUint32(this.pos, !0), this.pos += 4, this.reserved = this.datav.getUint32(this.pos, !0), this.pos += 4, this.offset = this.datav.getUint32(this.pos, !0), this.pos += 4, this.headerSize = this.datav.getUint32(this.pos, !0), this.pos += 4, this.width = this.datav.getUint32(this.pos, !0), this.pos += 4, this.height = this.datav.getInt32(this.pos, !0), this.pos += 4, this.planes = this.datav.getUint16(this.pos, !0), this.pos += 2, this.bitPP = this.datav.getUint16(this.pos, !0), this.pos += 2, this.compress = this.datav.getUint32(this.pos, !0), this.pos += 4, this.rawSize = this.datav.getUint32(this.pos, !0), this.pos += 4, this.hr = this.datav.getUint32(this.pos, !0), this.pos += 4, this.vr = this.datav.getUint32(this.pos, !0), this.pos += 4, this.colors = this.datav.getUint32(this.pos, !0), this.pos += 4, this.importantColors = this.datav.getUint32(this.pos, !0), this.pos += 4, 16 === this.bitPP && this.is_with_alpha && (this.bitPP = 15), this.bitPP < 15) { var t = 0 === this.colors ? 1 << this.bitPP : this.colors; this.palette = new Array(t); for (var e = 0; e < t; e++) { var n = this.datav.getUint8(this.pos++, !0), r = this.datav.getUint8(this.pos++, !0), i = this.datav.getUint8(this.pos++, !0), o = this.datav.getUint8(this.pos++, !0); this.palette[e] = { red: i, green: r, blue: n, quad: o } } } this.height < 0 && (this.height *= -1, this.bottom_up = !1) }, Ft.prototype.parseBGR = function () { this.pos = this.offset; try { var t = "bit" + this.bitPP, e = this.width * this.height * 4; this.data = new Uint8Array(e), this[t]() } catch (t) { console.log("bit decode error:" + t) } }, Ft.prototype.bit1 = function () { var t = Math.ceil(this.width / 8), e = t % 4, n = 0 <= this.height ? this.height - 1 : -this.height; for (n = this.height - 1; 0 <= n; n--) { for (var r = this.bottom_up ? n : this.height - 1 - n, i = 0; i < t; i++)for (var o = this.datav.getUint8(this.pos++, !0), a = r * this.width * 4 + 8 * i * 4, s = 0; s < 8 && 8 * i + s < this.width; s++) { var l = this.palette[o >> 7 - s & 1]; this.data[a + 4 * s] = l.blue, this.data[a + 4 * s + 1] = l.green, this.data[a + 4 * s + 2] = l.red, this.data[a + 4 * s + 3] = 255 } 0 != e && (this.pos += 4 - e) } }, Ft.prototype.bit4 = function () { for (var t = Math.ceil(this.width / 2), e = t % 4, n = this.height - 1; 0 <= n; n--) { for (var r = this.bottom_up ? n : this.height - 1 - n, i = 0; i < t; i++) { var o = this.datav.getUint8(this.pos++, !0), a = r * this.width * 4 + 2 * i * 4, s = o >> 4, l = 15 & o, h = this.palette[s]; if (this.data[a] = h.blue, this.data[a + 1] = h.green, this.data[a + 2] = h.red, this.data[a + 3] = 255, 2 * i + 1 >= this.width) break; h = this.palette[l], this.data[a + 4] = h.blue, this.data[a + 4 + 1] = h.green, this.data[a + 4 + 2] = h.red, this.data[a + 4 + 3] = 255 } 0 != e && (this.pos += 4 - e) } }, Ft.prototype.bit8 = function () { for (var t = this.width % 4, e = this.height - 1; 0 <= e; e--) { for (var n = this.bottom_up ? e : this.height - 1 - e, r = 0; r < this.width; r++) { var i = this.datav.getUint8(this.pos++, !0), o = n * this.width * 4 + 4 * r; if (i < this.palette.length) { var a = this.palette[i]; this.data[o] = a.red, this.data[o + 1] = a.green, this.data[o + 2] = a.blue, this.data[o + 3] = 255 } else this.data[o] = 255, this.data[o + 1] = 255, this.data[o + 2] = 255, this.data[o + 3] = 255 } 0 != t && (this.pos += 4 - t) } }, Ft.prototype.bit15 = function () { for (var t = this.width % 3, e = parseInt("11111", 2), n = this.height - 1; 0 <= n; n--) { for (var r = this.bottom_up ? n : this.height - 1 - n, i = 0; i < this.width; i++) { var o = this.datav.getUint16(this.pos, !0); this.pos += 2; var a = (o & e) / e * 255 | 0, s = (o >> 5 & e) / e * 255 | 0, l = (o >> 10 & e) / e * 255 | 0, h = o >> 15 ? 255 : 0, u = r * this.width * 4 + 4 * i; this.data[u] = l, this.data[u + 1] = s, this.data[u + 2] = a, this.data[u + 3] = h } this.pos += t } }, Ft.prototype.bit16 = function () { for (var t = this.width % 3, e = parseInt("11111", 2), n = parseInt("111111", 2), r = this.height - 1; 0 <= r; r--) { for (var i = this.bottom_up ? r : this.height - 1 - r, o = 0; o < this.width; o++) { var a = this.datav.getUint16(this.pos, !0); this.pos += 2; var s = (a & e) / e * 255 | 0, l = (a >> 5 & n) / n * 255 | 0, h = (a >> 11) / e * 255 | 0, u = i * this.width * 4 + 4 * o; this.data[u] = h, this.data[u + 1] = l, this.data[u + 2] = s, this.data[u + 3] = 255 } this.pos += t } }, Ft.prototype.bit24 = function () { for (var t = this.height - 1; 0 <= t; t--) { for (var e = this.bottom_up ? t : this.height - 1 - t, n = 0; n < this.width; n++) { var r = this.datav.getUint8(this.pos++, !0), i = this.datav.getUint8(this.pos++, !0), o = this.datav.getUint8(this.pos++, !0), a = e * this.width * 4 + 4 * n; this.data[a] = o, this.data[a + 1] = i, this.data[a + 2] = r, this.data[a + 3] = 255 } this.pos += this.width % 4 } }, Ft.prototype.bit32 = function () { for (var t = this.height - 1; 0 <= t; t--)for (var e = this.bottom_up ? t : this.height - 1 - t, n = 0; n < this.width; n++) { var r = this.datav.getUint8(this.pos++, !0), i = this.datav.getUint8(this.pos++, !0), o = this.datav.getUint8(this.pos++, !0), a = this.datav.getUint8(this.pos++, !0), s = e * this.width * 4 + 4 * n; this.data[s] = o, this.data[s + 1] = i, this.data[s + 2] = r, this.data[s + 3] = a } }, Ft.prototype.getData = function () { return this.data }, window.tmp = Ft,
        /*
           Copyright (c) 2013 Gildas Lormeau. All rights reserved.
        
           Redistribution and use in source and binary forms, with or without
           modification, are permitted provided that the following conditions are met:
        
           1. Redistributions of source code must retain the above copyright notice,
           this list of conditions and the following disclaimer.
        
           2. Redistributions in binary form must reproduce the above copyright 
           notice, this list of conditions and the following disclaimer in 
           the documentation and/or other materials provided with the distribution.
        
           3. The names of the authors may not be used to endorse or promote products
           derived from this software without specific prior written permission.
        
           THIS SOFTWARE IS PROVIDED ``AS IS'' AND ANY EXPRESSED OR IMPLIED WARRANTIES,
           INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND
           FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL JCRAFT,
           INC. OR ANY CONTRIBUTORS TO THIS SOFTWARE BE LIABLE FOR ANY DIRECT, INDIRECT,
           INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT
           LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA,
           OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF
           LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
           NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE,
           EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
           */
        function (t) { var d = 15, g = 573, e = [0, 1, 2, 3, 4, 4, 5, 5, 6, 6, 6, 6, 7, 7, 7, 7, 8, 8, 8, 8, 8, 8, 8, 8, 9, 9, 9, 9, 9, 9, 9, 9, 10, 10, 10, 10, 10, 10, 10, 10, 10, 10, 10, 10, 10, 10, 10, 10, 11, 11, 11, 11, 11, 11, 11, 11, 11, 11, 11, 11, 11, 11, 11, 11, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 13, 13, 13, 13, 13, 13, 13, 13, 13, 13, 13, 13, 13, 13, 13, 13, 13, 13, 13, 13, 13, 13, 13, 13, 13, 13, 13, 13, 13, 13, 13, 13, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 0, 0, 16, 17, 18, 18, 19, 19, 20, 20, 20, 20, 21, 21, 21, 21, 22, 22, 22, 22, 22, 22, 22, 22, 23, 23, 23, 23, 23, 23, 23, 23, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29]; function ct() { var p = this; function l(t, e) { for (var n = 0; n |= 1 & t, t >>>= 1, n <<= 1, 0 < --e;); return n >>> 1 } p.build_tree = function (t) { var e, n, r, i = p.dyn_tree, o = p.stat_desc.static_tree, a = p.stat_desc.elems, s = -1; for (t.heap_len = 0, t.heap_max = g, e = 0; e < a; e++)0 !== i[2 * e] ? (t.heap[++t.heap_len] = s = e, t.depth[e] = 0) : i[2 * e + 1] = 0; for (; t.heap_len < 2;)i[2 * (r = t.heap[++t.heap_len] = s < 2 ? ++s : 0)] = 1, t.depth[r] = 0, t.opt_len-- , o && (t.static_len -= o[2 * r + 1]); for (p.max_code = s, e = Math.floor(t.heap_len / 2); 1 <= e; e--)t.pqdownheap(i, e); for (r = a; e = t.heap[1], t.heap[1] = t.heap[t.heap_len--], t.pqdownheap(i, 1), n = t.heap[1], t.heap[--t.heap_max] = e, t.heap[--t.heap_max] = n, i[2 * r] = i[2 * e] + i[2 * n], t.depth[r] = Math.max(t.depth[e], t.depth[n]) + 1, i[2 * e + 1] = i[2 * n + 1] = r, t.heap[1] = r++ , t.pqdownheap(i, 1), 2 <= t.heap_len;); t.heap[--t.heap_max] = t.heap[1], function (t) { var e, n, r, i, o, a, s = p.dyn_tree, l = p.stat_desc.static_tree, h = p.stat_desc.extra_bits, u = p.stat_desc.extra_base, c = p.stat_desc.max_length, f = 0; for (i = 0; i <= d; i++)t.bl_count[i] = 0; for (s[2 * t.heap[t.heap_max] + 1] = 0, e = t.heap_max + 1; e < g; e++)c < (i = s[2 * s[2 * (n = t.heap[e]) + 1] + 1] + 1) && (i = c, f++), s[2 * n + 1] = i, n > p.max_code || (t.bl_count[i]++ , o = 0, u <= n && (o = h[n - u]), a = s[2 * n], t.opt_len += a * (i + o), l && (t.static_len += a * (l[2 * n + 1] + o))); if (0 !== f) { do { for (i = c - 1; 0 === t.bl_count[i];)i--; t.bl_count[i]-- , t.bl_count[i + 1] += 2, t.bl_count[c]-- , f -= 2 } while (0 < f); for (i = c; 0 !== i; i--)for (n = t.bl_count[i]; 0 !== n;)(r = t.heap[--e]) > p.max_code || (s[2 * r + 1] != i && (t.opt_len += (i - s[2 * r + 1]) * s[2 * r], s[2 * r + 1] = i), n--) } }(t), function (t, e, n) { var r, i, o, a = [], s = 0; for (r = 1; r <= d; r++)a[r] = s = s + n[r - 1] << 1; for (i = 0; i <= e; i++)0 !== (o = t[2 * i + 1]) && (t[2 * i] = l(a[o]++, o)) }(i, p.max_code, t.bl_count) } } function ft(t, e, n, r, i) { this.static_tree = t, this.extra_bits = e, this.extra_base = n, this.elems = r, this.max_length = i } ct._length_code = [0, 1, 2, 3, 4, 5, 6, 7, 8, 8, 9, 9, 10, 10, 11, 11, 12, 12, 12, 12, 13, 13, 13, 13, 14, 14, 14, 14, 15, 15, 15, 15, 16, 16, 16, 16, 16, 16, 16, 16, 17, 17, 17, 17, 17, 17, 17, 17, 18, 18, 18, 18, 18, 18, 18, 18, 19, 19, 19, 19, 19, 19, 19, 19, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 21, 21, 21, 21, 21, 21, 21, 21, 21, 21, 21, 21, 21, 21, 21, 21, 22, 22, 22, 22, 22, 22, 22, 22, 22, 22, 22, 22, 22, 22, 22, 22, 23, 23, 23, 23, 23, 23, 23, 23, 23, 23, 23, 23, 23, 23, 23, 23, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 28], ct.base_length = [0, 1, 2, 3, 4, 5, 6, 7, 8, 10, 12, 14, 16, 20, 24, 28, 32, 40, 48, 56, 64, 80, 96, 112, 128, 160, 192, 224, 0], ct.base_dist = [0, 1, 2, 3, 4, 6, 8, 12, 16, 24, 32, 48, 64, 96, 128, 192, 256, 384, 512, 768, 1024, 1536, 2048, 3072, 4096, 6144, 8192, 12288, 16384, 24576], ct.d_code = function (t) { return t < 256 ? e[t] : e[256 + (t >>> 7)] }, ct.extra_lbits = [0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 2, 2, 2, 2, 3, 3, 3, 3, 4, 4, 4, 4, 5, 5, 5, 5, 0], ct.extra_dbits = [0, 0, 0, 0, 1, 1, 2, 2, 3, 3, 4, 4, 5, 5, 6, 6, 7, 7, 8, 8, 9, 9, 10, 10, 11, 11, 12, 12, 13, 13], ct.extra_blbits = [0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 2, 3, 7], ct.bl_order = [16, 17, 18, 0, 8, 7, 9, 6, 10, 5, 11, 4, 12, 3, 13, 2, 14, 1, 15], ft.static_ltree = [12, 8, 140, 8, 76, 8, 204, 8, 44, 8, 172, 8, 108, 8, 236, 8, 28, 8, 156, 8, 92, 8, 220, 8, 60, 8, 188, 8, 124, 8, 252, 8, 2, 8, 130, 8, 66, 8, 194, 8, 34, 8, 162, 8, 98, 8, 226, 8, 18, 8, 146, 8, 82, 8, 210, 8, 50, 8, 178, 8, 114, 8, 242, 8, 10, 8, 138, 8, 74, 8, 202, 8, 42, 8, 170, 8, 106, 8, 234, 8, 26, 8, 154, 8, 90, 8, 218, 8, 58, 8, 186, 8, 122, 8, 250, 8, 6, 8, 134, 8, 70, 8, 198, 8, 38, 8, 166, 8, 102, 8, 230, 8, 22, 8, 150, 8, 86, 8, 214, 8, 54, 8, 182, 8, 118, 8, 246, 8, 14, 8, 142, 8, 78, 8, 206, 8, 46, 8, 174, 8, 110, 8, 238, 8, 30, 8, 158, 8, 94, 8, 222, 8, 62, 8, 190, 8, 126, 8, 254, 8, 1, 8, 129, 8, 65, 8, 193, 8, 33, 8, 161, 8, 97, 8, 225, 8, 17, 8, 145, 8, 81, 8, 209, 8, 49, 8, 177, 8, 113, 8, 241, 8, 9, 8, 137, 8, 73, 8, 201, 8, 41, 8, 169, 8, 105, 8, 233, 8, 25, 8, 153, 8, 89, 8, 217, 8, 57, 8, 185, 8, 121, 8, 249, 8, 5, 8, 133, 8, 69, 8, 197, 8, 37, 8, 165, 8, 101, 8, 229, 8, 21, 8, 149, 8, 85, 8, 213, 8, 53, 8, 181, 8, 117, 8, 245, 8, 13, 8, 141, 8, 77, 8, 205, 8, 45, 8, 173, 8, 109, 8, 237, 8, 29, 8, 157, 8, 93, 8, 221, 8, 61, 8, 189, 8, 125, 8, 253, 8, 19, 9, 275, 9, 147, 9, 403, 9, 83, 9, 339, 9, 211, 9, 467, 9, 51, 9, 307, 9, 179, 9, 435, 9, 115, 9, 371, 9, 243, 9, 499, 9, 11, 9, 267, 9, 139, 9, 395, 9, 75, 9, 331, 9, 203, 9, 459, 9, 43, 9, 299, 9, 171, 9, 427, 9, 107, 9, 363, 9, 235, 9, 491, 9, 27, 9, 283, 9, 155, 9, 411, 9, 91, 9, 347, 9, 219, 9, 475, 9, 59, 9, 315, 9, 187, 9, 443, 9, 123, 9, 379, 9, 251, 9, 507, 9, 7, 9, 263, 9, 135, 9, 391, 9, 71, 9, 327, 9, 199, 9, 455, 9, 39, 9, 295, 9, 167, 9, 423, 9, 103, 9, 359, 9, 231, 9, 487, 9, 23, 9, 279, 9, 151, 9, 407, 9, 87, 9, 343, 9, 215, 9, 471, 9, 55, 9, 311, 9, 183, 9, 439, 9, 119, 9, 375, 9, 247, 9, 503, 9, 15, 9, 271, 9, 143, 9, 399, 9, 79, 9, 335, 9, 207, 9, 463, 9, 47, 9, 303, 9, 175, 9, 431, 9, 111, 9, 367, 9, 239, 9, 495, 9, 31, 9, 287, 9, 159, 9, 415, 9, 95, 9, 351, 9, 223, 9, 479, 9, 63, 9, 319, 9, 191, 9, 447, 9, 127, 9, 383, 9, 255, 9, 511, 9, 0, 7, 64, 7, 32, 7, 96, 7, 16, 7, 80, 7, 48, 7, 112, 7, 8, 7, 72, 7, 40, 7, 104, 7, 24, 7, 88, 7, 56, 7, 120, 7, 4, 7, 68, 7, 36, 7, 100, 7, 20, 7, 84, 7, 52, 7, 116, 7, 3, 8, 131, 8, 67, 8, 195, 8, 35, 8, 163, 8, 99, 8, 227, 8], ft.static_dtree = [0, 5, 16, 5, 8, 5, 24, 5, 4, 5, 20, 5, 12, 5, 28, 5, 2, 5, 18, 5, 10, 5, 26, 5, 6, 5, 22, 5, 14, 5, 30, 5, 1, 5, 17, 5, 9, 5, 25, 5, 5, 5, 21, 5, 13, 5, 29, 5, 3, 5, 19, 5, 11, 5, 27, 5, 7, 5, 23, 5], ft.static_l_desc = new ft(ft.static_ltree, ct.extra_lbits, 257, 286, d), ft.static_d_desc = new ft(ft.static_dtree, ct.extra_dbits, 0, 30, d), ft.static_bl_desc = new ft(null, ct.extra_blbits, 0, 19, 7); function n(t, e, n, r, i) { this.good_length = t, this.max_lazy = e, this.nice_length = n, this.max_chain = r, this.func = i } var pt = [new n(0, 0, 0, 0, 0), new n(4, 4, 8, 4, 1), new n(4, 5, 16, 8, 1), new n(4, 6, 32, 32, 1), new n(4, 4, 16, 16, 2), new n(8, 16, 32, 32, 2), new n(8, 16, 128, 128, 2), new n(8, 32, 128, 256, 2), new n(32, 128, 258, 1024, 2), new n(32, 258, 258, 4096, 2)], dt = ["need dictionary", "stream end", "", "", "stream error", "data error", "", "buffer error", "", ""]; function gt(t, e, n, r) { var i = t[2 * e], o = t[2 * n]; return i < o || i == o && r[e] <= r[n] } function r() { var l, h, u, c, f, p, d, g, i, m, y, v, w, a, b, x, N, L, A, S, _, F, P, k, I, C, B, j, E, M, s, O, q, T, R, D, U, o, z, H, W, V = this, G = new ct, Y = new ct, J = new ct; function X() { var t; for (t = 0; t < 286; t++)s[2 * t] = 0; for (t = 0; t < 30; t++)O[2 * t] = 0; for (t = 0; t < 19; t++)q[2 * t] = 0; s[512] = 1, V.opt_len = V.static_len = 0, D = o = 0 } function K(t, e) { var n, r, i = -1, o = t[1], a = 0, s = 7, l = 4; for (0 === o && (s = 138, l = 3), t[2 * (e + 1) + 1] = 65535, n = 0; n <= e; n++)r = o, o = t[2 * (n + 1) + 1], ++a < s && r == o || (a < l ? q[2 * r] += a : 0 !== r ? (r != i && q[2 * r]++ , q[32]++) : a <= 10 ? q[34]++ : q[36]++ , i = r, l = (a = 0) === o ? (s = 138, 3) : r == o ? (s = 6, 3) : (s = 7, 4)) } function Z(t) { V.pending_buf[V.pending++] = t } function Q(t) { Z(255 & t), Z(t >>> 8 & 255) } function $(t, e) { var n, r = e; 16 - r < W ? (Q(H |= (n = t) << W & 65535), H = n >>> 16 - W, W += r - 16) : (H |= t << W & 65535, W += r) } function tt(t, e) { var n = 2 * t; $(65535 & e[n], 65535 & e[n + 1]) } function et(t, e) { var n, r, i = -1, o = t[1], a = 0, s = 7, l = 4; for (0 === o && (s = 138, l = 3), n = 0; n <= e; n++)if (r = o, o = t[2 * (n + 1) + 1], !(++a < s && r == o)) { if (a < l) for (; tt(r, q), 0 != --a;); else 0 !== r ? (r != i && (tt(r, q), a--), tt(16, q), $(a - 3, 2)) : a <= 10 ? (tt(17, q), $(a - 3, 3)) : (tt(18, q), $(a - 11, 7)); i = r, l = (a = 0) === o ? (s = 138, 3) : r == o ? (s = 6, 3) : (s = 7, 4) } } function nt() { 16 == W ? (Q(H), W = H = 0) : 8 <= W && (Z(255 & H), H >>>= 8, W -= 8) } function rt(t, e) { var n, r, i; if (V.pending_buf[U + 2 * D] = t >>> 8 & 255, V.pending_buf[U + 2 * D + 1] = 255 & t, V.pending_buf[T + D] = 255 & e, D++ , 0 === t ? s[2 * e]++ : (o++ , t-- , s[2 * (ct._length_code[e] + 256 + 1)]++ , O[2 * ct.d_code(t)]++), 0 == (8191 & D) && 2 < B) { for (n = 8 * D, r = _ - N, i = 0; i < 30; i++)n += O[2 * i] * (5 + ct.extra_dbits[i]); if (n >>>= 3, o < Math.floor(D / 2) && n < Math.floor(r / 2)) return !0 } return D == R - 1 } function it(t, e) { var n, r, i, o, a = 0; if (0 !== D) for (; n = V.pending_buf[U + 2 * a] << 8 & 65280 | 255 & V.pending_buf[U + 2 * a + 1], r = 255 & V.pending_buf[T + a], a++ , 0 === n ? tt(r, t) : (tt((i = ct._length_code[r]) + 256 + 1, t), 0 !== (o = ct.extra_lbits[i]) && $(r -= ct.base_length[i], o), tt(i = ct.d_code(--n), e), 0 !== (o = ct.extra_dbits[i]) && $(n -= ct.base_dist[i], o)), a < D;); tt(256, t), z = t[513] } function ot() { 8 < W ? Q(H) : 0 < W && Z(255 & H), W = H = 0 } function at(t, e, n) { var r, i, o; $(0 + (n ? 1 : 0), 3), r = t, i = e, o = !0, ot(), z = 8, o && (Q(i), Q(~i)), V.pending_buf.set(g.subarray(r, r + i), V.pending), V.pending += i } function e(t, e, n) { var r, i, o = 0; 0 < B ? (G.build_tree(V), Y.build_tree(V), o = function () { var t; for (K(s, G.max_code), K(O, Y.max_code), J.build_tree(V), t = 18; 3 <= t && 0 === q[2 * ct.bl_order[t] + 1]; t--); return V.opt_len += 3 * (t + 1) + 5 + 5 + 4, t }(), r = V.opt_len + 3 + 7 >>> 3, (i = V.static_len + 3 + 7 >>> 3) <= r && (r = i)) : r = i = e + 5, e + 4 <= r && -1 != t ? at(t, e, n) : i == r ? ($(2 + (n ? 1 : 0), 3), it(ft.static_ltree, ft.static_dtree)) : ($(4 + (n ? 1 : 0), 3), function (t, e, n) { var r; for ($(t - 257, 5), $(e - 1, 5), $(n - 4, 4), r = 0; r < n; r++)$(q[2 * ct.bl_order[r] + 1], 3); et(s, t - 1), et(O, e - 1) }(G.max_code + 1, Y.max_code + 1, o + 1), it(s, O)), X(), n && ot() } function st(t) { e(0 <= N ? N : -1, _ - N, t), N = _, l.flush_pending() } function lt() { var t, e, n, r; do { if (0 === (r = i - P - _) && 0 === _ && 0 === P) r = f; else if (-1 == r) r--; else if (f + f - 262 <= _) { for (g.set(g.subarray(f, f + f), 0), F -= f, _ -= f, N -= f, n = t = w; e = 65535 & y[--n], y[n] = f <= e ? e - f : 0, 0 != --t;); for (n = t = f; e = 65535 & m[--n], m[n] = f <= e ? e - f : 0, 0 != --t;); r += f } if (0 === l.avail_in) return; t = l.read_buf(g, _ + P, r), 3 <= (P += t) && (v = ((v = 255 & g[_]) << x ^ 255 & g[_ + 1]) & b) } while (P < 262 && 0 !== l.avail_in) } function ht(t) { var e, n, r = I, i = _, o = k, a = f - 262 < _ ? _ - (f - 262) : 0, s = M, l = d, h = _ + 258, u = g[i + o - 1], c = g[i + o]; E <= k && (r >>= 2), P < s && (s = P); do { if (g[(e = t) + o] == c && g[e + o - 1] == u && g[e] == g[i] && g[++e] == g[i + 1]) { i += 2, e++; do { } while (g[++i] == g[++e] && g[++i] == g[++e] && g[++i] == g[++e] && g[++i] == g[++e] && g[++i] == g[++e] && g[++i] == g[++e] && g[++i] == g[++e] && g[++i] == g[++e] && i < h); if (n = 258 - (h - i), i = h - 258, o < n) { if (F = t, s <= (o = n)) break; u = g[i + o - 1], c = g[i + o] } } } while ((t = 65535 & m[t & l]) > a && 0 != --r); return o <= P ? o : P } function ut(t) { return t.total_in = t.total_out = 0, t.msg = null, V.pending = 0, V.pending_out = 0, h = 113, c = 0, G.dyn_tree = s, G.stat_desc = ft.static_l_desc, Y.dyn_tree = O, Y.stat_desc = ft.static_d_desc, J.dyn_tree = q, J.stat_desc = ft.static_bl_desc, W = H = 0, z = 8, X(), function () { var t; for (i = 2 * f, t = y[w - 1] = 0; t < w - 1; t++)y[t] = 0; C = pt[B].max_lazy, E = pt[B].good_length, M = pt[B].nice_length, I = pt[B].max_chain, L = k = 2, v = S = P = N = _ = 0 }(), 0 } V.depth = [], V.bl_count = [], V.heap = [], s = [], O = [], q = [], V.pqdownheap = function (t, e) { for (var n = V.heap, r = n[e], i = e << 1; i <= V.heap_len && (i < V.heap_len && gt(t, n[i + 1], n[i], V.depth) && i++ , !gt(t, r, n[i], V.depth));)n[e] = n[i], e = i, i <<= 1; n[e] = r }, V.deflateInit = function (t, e, n, r, i, o) { return r || (r = 8), i || (i = 8), o || (o = 0), t.msg = null, -1 == e && (e = 6), i < 1 || 9 < i || 8 != r || n < 9 || 15 < n || e < 0 || 9 < e || o < 0 || 2 < o ? -2 : (t.dstate = V, d = (f = 1 << (p = n)) - 1, b = (w = 1 << (a = i + 7)) - 1, x = Math.floor((a + 3 - 1) / 3), g = new Uint8Array(2 * f), m = [], y = [], R = 1 << i + 6, V.pending_buf = new Uint8Array(4 * R), u = 4 * R, U = Math.floor(R / 2), T = 3 * R, B = e, j = o, ut(t)) }, V.deflateEnd = function () { return 42 != h && 113 != h && 666 != h ? -2 : (V.pending_buf = null, g = m = y = null, V.dstate = null, 113 == h ? -3 : 0) }, V.deflateParams = function (t, e, n) { var r = 0; return -1 == e && (e = 6), e < 0 || 9 < e || n < 0 || 2 < n ? -2 : (pt[B].func != pt[e].func && 0 !== t.total_in && (r = t.deflate(1)), B != e && (C = pt[B = e].max_lazy, E = pt[B].good_length, M = pt[B].nice_length, I = pt[B].max_chain), j = n, r) }, V.deflateSetDictionary = function (t, e, n) { var r, i = n, o = 0; if (!e || 42 != h) return -2; if (i < 3) return 0; for (f - 262 < i && (o = n - (i = f - 262)), g.set(e.subarray(o, o + i), 0), N = _ = i, v = ((v = 255 & g[0]) << x ^ 255 & g[1]) & b, r = 0; r <= i - 3; r++)v = (v << x ^ 255 & g[r + 2]) & b, m[r & d] = y[v], y[v] = r; return 0 }, V.deflate = function (t, e) { var n, r, i, o, a, s; if (4 < e || e < 0) return -2; if (!t.next_out || !t.next_in && 0 !== t.avail_in || 666 == h && 4 != e) return t.msg = dt[4], -2; if (0 === t.avail_out) return t.msg = dt[7], -5; if (l = t, o = c, c = e, 42 == h && (r = 8 + (p - 8 << 4) << 8, 3 < (i = (B - 1 & 255) >> 1) && (i = 3), r |= i << 6, 0 !== _ && (r |= 32), h = 113, Z((s = r += 31 - r % 31) >> 8 & 255), Z(255 & s)), 0 !== V.pending) { if (l.flush_pending(), 0 === l.avail_out) return c = -1, 0 } else if (0 === l.avail_in && e <= o && 4 != e) return l.msg = dt[7], -5; if (666 == h && 0 !== l.avail_in) return t.msg = dt[7], -5; if (0 !== l.avail_in || 0 !== P || 0 != e && 666 != h) { switch (a = -1, pt[B].func) { case 0: a = function (t) { var e, n = 65535; for (u - 5 < n && (n = u - 5); ;) { if (P <= 1) { if (lt(), 0 === P && 0 == t) return 0; if (0 === P) break } if (_ += P, e = N + n, ((P = 0) === _ || e <= _) && (P = _ - e, _ = e, st(!1), 0 === l.avail_out)) return 0; if (f - 262 <= _ - N && (st(!1), 0 === l.avail_out)) return 0 } return st(4 == t), 0 === l.avail_out ? 4 == t ? 2 : 0 : 4 == t ? 3 : 1 }(e); break; case 1: a = function (t) { for (var e, n = 0; ;) { if (P < 262) { if (lt(), P < 262 && 0 == t) return 0; if (0 === P) break } if (3 <= P && (v = (v << x ^ 255 & g[_ + 2]) & b, n = 65535 & y[v], m[_ & d] = y[v], y[v] = _), 0 !== n && (_ - n & 65535) <= f - 262 && 2 != j && (L = ht(n)), 3 <= L) if (e = rt(_ - F, L - 3), P -= L, L <= C && 3 <= P) { for (L--; v = (v << x ^ 255 & g[++_ + 2]) & b, n = 65535 & y[v], m[_ & d] = y[v], y[v] = _, 0 != --L;); _++ } else _ += L, L = 0, v = ((v = 255 & g[_]) << x ^ 255 & g[_ + 1]) & b; else e = rt(0, 255 & g[_]), P-- , _++; if (e && (st(!1), 0 === l.avail_out)) return 0 } return st(4 == t), 0 === l.avail_out ? 4 == t ? 2 : 0 : 4 == t ? 3 : 1 }(e); break; case 2: a = function (t) { for (var e, n, r = 0; ;) { if (P < 262) { if (lt(), P < 262 && 0 == t) return 0; if (0 === P) break } if (3 <= P && (v = (v << x ^ 255 & g[_ + 2]) & b, r = 65535 & y[v], m[_ & d] = y[v], y[v] = _), k = L, A = F, L = 2, 0 !== r && k < C && (_ - r & 65535) <= f - 262 && (2 != j && (L = ht(r)), L <= 5 && (1 == j || 3 == L && 4096 < _ - F) && (L = 2)), 3 <= k && L <= k) { for (n = _ + P - 3, e = rt(_ - 1 - A, k - 3), P -= k - 1, k -= 2; ++_ <= n && (v = (v << x ^ 255 & g[_ + 2]) & b, r = 65535 & y[v], m[_ & d] = y[v], y[v] = _), 0 != --k;); if (S = 0, L = 2, _++ , e && (st(!1), 0 === l.avail_out)) return 0 } else if (0 !== S) { if ((e = rt(0, 255 & g[_ - 1])) && st(!1), _++ , P-- , 0 === l.avail_out) return 0 } else S = 1, _++ , P-- } return 0 !== S && (e = rt(0, 255 & g[_ - 1]), S = 0), st(4 == t), 0 === l.avail_out ? 4 == t ? 2 : 0 : 4 == t ? 3 : 1 }(e) }if (2 != a && 3 != a || (h = 666), 0 == a || 2 == a) return 0 === l.avail_out && (c = -1), 0; if (1 == a) { if (1 == e) $(2, 3), tt(256, ft.static_ltree), nt(), 1 + z + 10 - W < 9 && ($(2, 3), tt(256, ft.static_ltree), nt()), z = 7; else if (at(0, 0, !1), 3 == e) for (n = 0; n < w; n++)y[n] = 0; if (l.flush_pending(), 0 === l.avail_out) return c = -1, 0 } } return 4 != e ? 0 : 1 } } function i() { this.next_in_index = 0, this.next_out_index = 0, this.avail_in = 0, this.total_in = 0, this.avail_out = 0, this.total_out = 0 } i.prototype = { deflateInit: function (t, e) { return this.dstate = new r, e || (e = d), this.dstate.deflateInit(this, t, e) }, deflate: function (t) { return this.dstate ? this.dstate.deflate(this, t) : -2 }, deflateEnd: function () { if (!this.dstate) return -2; var t = this.dstate.deflateEnd(); return this.dstate = null, t }, deflateParams: function (t, e) { return this.dstate ? this.dstate.deflateParams(this, t, e) : -2 }, deflateSetDictionary: function (t, e) { return this.dstate ? this.dstate.deflateSetDictionary(this, t, e) : -2 }, read_buf: function (t, e, n) { var r = this.avail_in; return n < r && (r = n), 0 === r ? 0 : (this.avail_in -= r, t.set(this.next_in.subarray(this.next_in_index, this.next_in_index + r), e), this.next_in_index += r, this.total_in += r, r) }, flush_pending: function () { var t = this, e = t.dstate.pending; e > t.avail_out && (e = t.avail_out), 0 !== e && (t.next_out.set(t.dstate.pending_buf.subarray(t.dstate.pending_out, t.dstate.pending_out + e), t.next_out_index), t.next_out_index += e, t.dstate.pending_out += e, t.total_out += e, t.avail_out -= e, t.dstate.pending -= e, 0 === t.dstate.pending && (t.dstate.pending_out = 0)) } }; var o = t.zip || t; o.Deflater = o._jzlib_Deflater = function (t) { var s = new i, l = new Uint8Array(512), e = t ? t.level : -1; void 0 === e && (e = -1), s.deflateInit(e), s.next_out = l, this.append = function (t, e) { var n, r = [], i = 0, o = 0, a = 0; if (t.length) { s.next_in_index = 0, s.next_in = t, s.avail_in = t.length; do { if (s.next_out_index = 0, s.avail_out = 512, 0 != s.deflate(0)) throw new Error("deflating: " + s.msg); s.next_out_index && (512 == s.next_out_index ? r.push(new Uint8Array(l)) : r.push(new Uint8Array(l.subarray(0, s.next_out_index)))), a += s.next_out_index, e && 0 < s.next_in_index && s.next_in_index != i && (e(s.next_in_index), i = s.next_in_index) } while (0 < s.avail_in || 0 === s.avail_out); return n = new Uint8Array(a), r.forEach(function (t) { n.set(t, o), o += t.length }), n } }, this.flush = function () { var t, e, n = [], r = 0, i = 0; do { if (s.next_out_index = 0, s.avail_out = 512, 1 != (t = s.deflate(4)) && 0 != t) throw new Error("deflating: " + s.msg); 0 < 512 - s.avail_out && n.push(new Uint8Array(l.subarray(0, s.next_out_index))), i += s.next_out_index } while (0 < s.avail_in || 0 === s.avail_out); return s.deflateEnd(), e = new Uint8Array(i), n.forEach(function (t) { e.set(t, r), r += t.length }), e } } }("undefined" != typeof self && self || "undefined" != typeof window && window || "undefined" != typeof global && global || Function('return typeof this === "object" && this.content')() || Function("return this")()), ("undefined" != typeof self && self || "undefined" != typeof window && window || "undefined" != typeof global && global || Function('return typeof this === "object" && this.content')() || Function("return this")()).RGBColor = function (t) { var e; t = t || "", this.ok = !1, "#" == t.charAt(0) && (t = t.substr(1, 6)), t = (t = t.replace(/ /g, "")).toLowerCase(); var n = { aliceblue: "f0f8ff", antiquewhite: "faebd7", aqua: "00ffff", aquamarine: "7fffd4", azure: "f0ffff", beige: "f5f5dc", bisque: "ffe4c4", black: "000000", blanchedalmond: "ffebcd", blue: "0000ff", blueviolet: "8a2be2", brown: "a52a2a", burlywood: "deb887", cadetblue: "5f9ea0", chartreuse: "7fff00", chocolate: "d2691e", coral: "ff7f50", cornflowerblue: "6495ed", cornsilk: "fff8dc", crimson: "dc143c", cyan: "00ffff", darkblue: "00008b", darkcyan: "008b8b", darkgoldenrod: "b8860b", darkgray: "a9a9a9", darkgreen: "006400", darkkhaki: "bdb76b", darkmagenta: "8b008b", darkolivegreen: "556b2f", darkorange: "ff8c00", darkorchid: "9932cc", darkred: "8b0000", darksalmon: "e9967a", darkseagreen: "8fbc8f", darkslateblue: "483d8b", darkslategray: "2f4f4f", darkturquoise: "00ced1", darkviolet: "9400d3", deeppink: "ff1493", deepskyblue: "00bfff", dimgray: "696969", dodgerblue: "1e90ff", feldspar: "d19275", firebrick: "b22222", floralwhite: "fffaf0", forestgreen: "228b22", fuchsia: "ff00ff", gainsboro: "dcdcdc", ghostwhite: "f8f8ff", gold: "ffd700", goldenrod: "daa520", gray: "808080", green: "008000", greenyellow: "adff2f", honeydew: "f0fff0", hotpink: "ff69b4", indianred: "cd5c5c", indigo: "4b0082", ivory: "fffff0", khaki: "f0e68c", lavender: "e6e6fa", lavenderblush: "fff0f5", lawngreen: "7cfc00", lemonchiffon: "fffacd", lightblue: "add8e6", lightcoral: "f08080", lightcyan: "e0ffff", lightgoldenrodyellow: "fafad2", lightgrey: "d3d3d3", lightgreen: "90ee90", lightpink: "ffb6c1", lightsalmon: "ffa07a", lightseagreen: "20b2aa", lightskyblue: "87cefa", lightslateblue: "8470ff", lightslategray: "778899", lightsteelblue: "b0c4de", lightyellow: "ffffe0", lime: "00ff00", limegreen: "32cd32", linen: "faf0e6", magenta: "ff00ff", maroon: "800000", mediumaquamarine: "66cdaa", mediumblue: "0000cd", mediumorchid: "ba55d3", mediumpurple: "9370d8", mediumseagreen: "3cb371", mediumslateblue: "7b68ee", mediumspringgreen: "00fa9a", mediumturquoise: "48d1cc", mediumvioletred: "c71585", midnightblue: "191970", mintcream: "f5fffa", mistyrose: "ffe4e1", moccasin: "ffe4b5", navajowhite: "ffdead", navy: "000080", oldlace: "fdf5e6", olive: "808000", olivedrab: "6b8e23", orange: "ffa500", orangered: "ff4500", orchid: "da70d6", palegoldenrod: "eee8aa", palegreen: "98fb98", paleturquoise: "afeeee", palevioletred: "d87093", papayawhip: "ffefd5", peachpuff: "ffdab9", peru: "cd853f", pink: "ffc0cb", plum: "dda0dd", powderblue: "b0e0e6", purple: "800080", red: "ff0000", rosybrown: "bc8f8f", royalblue: "4169e1", saddlebrown: "8b4513", salmon: "fa8072", sandybrown: "f4a460", seagreen: "2e8b57", seashell: "fff5ee", sienna: "a0522d", silver: "c0c0c0", skyblue: "87ceeb", slateblue: "6a5acd", slategray: "708090", snow: "fffafa", springgreen: "00ff7f", steelblue: "4682b4", tan: "d2b48c", teal: "008080", thistle: "d8bfd8", tomato: "ff6347", turquoise: "40e0d0", violet: "ee82ee", violetred: "d02090", wheat: "f5deb3", white: "ffffff", whitesmoke: "f5f5f5", yellow: "ffff00", yellowgreen: "9acd32" }; for (var r in n) t == r && (t = n[r]); for (var i = [{ re: /^rgb\((\d{1,3}),\s*(\d{1,3}),\s*(\d{1,3})\)$/, example: ["rgb(123, 234, 45)", "rgb(255,234,245)"], process: function (t) { return [parseInt(t[1]), parseInt(t[2]), parseInt(t[3])] } }, { re: /^(\w{2})(\w{2})(\w{2})$/, example: ["#00ff00", "336699"], process: function (t) { return [parseInt(t[1], 16), parseInt(t[2], 16), parseInt(t[3], 16)] } }, { re: /^(\w{1})(\w{1})(\w{1})$/, example: ["#fb0", "f0f"], process: function (t) { return [parseInt(t[1] + t[1], 16), parseInt(t[2] + t[2], 16), parseInt(t[3] + t[3], 16)] } }], o = 0; o < i.length; o++) { var a = i[o].re, s = i[o].process, l = a.exec(t); l && (e = s(l), this.r = e[0], this.g = e[1], this.b = e[2], this.ok = !0) } this.r = this.r < 0 || isNaN(this.r) ? 0 : 255 < this.r ? 255 : this.r, this.g = this.g < 0 || isNaN(this.g) ? 0 : 255 < this.g ? 255 : this.g, this.b = this.b < 0 || isNaN(this.b) ? 0 : 255 < this.b ? 255 : this.b, this.toRGB = function () { return "rgb(" + this.r + ", " + this.g + ", " + this.b + ")" }, this.toHex = function () { var t = this.r.toString(16), e = this.g.toString(16), n = this.b.toString(16); return 1 == t.length && (t = "0" + t), 1 == e.length && (e = "0" + e), 1 == n.length && (n = "0" + n), "#" + t + e + n } }, function (t) { var n = "+".charCodeAt(0), r = "/".charCodeAt(0), i = "0".charCodeAt(0), o = "a".charCodeAt(0), a = "A".charCodeAt(0), s = "-".charCodeAt(0), l = "_".charCodeAt(0), u = function (t) { var e = t.charCodeAt(0); return e === n || e === s ? 62 : e === r || e === l ? 63 : e < i ? -1 : e < i + 10 ? e - i + 26 + 26 : e < a + 26 ? e - a : e < o + 26 ? e - o + 26 : void 0 }; t.API.TTFFont = function () { function i(t, e, n) { var r; if (this.rawData = t, r = this.contents = new J(t), this.contents.pos = 4, "ttcf" === r.readString(4)) { if (!e) throw new Error("Must specify a font name for TTC files."); throw new Error("Font " + e + " not found in TTC file.") } r.pos = 0, this.parse(), this.subset = new P(this), this.registerTTF() } return i.open = function (t, e, n, r) { if ("string" != typeof n) throw new Error("Invalid argument supplied in TTFFont.open"); return new i(function (t) { var e, n, r, i, o, a; if (0 < t.length % 4) throw new Error("Invalid string. Length must be a multiple of 4"); var s = t.length; o = "=" === t.charAt(s - 2) ? 2 : "=" === t.charAt(s - 1) ? 1 : 0, a = new Uint8Array(3 * t.length / 4 - o), r = 0 < o ? t.length - 4 : t.length; var l = 0; function h(t) { a[l++] = t } for (n = e = 0; e < r; e += 4, n += 3)h((16711680 & (i = u(t.charAt(e)) << 18 | u(t.charAt(e + 1)) << 12 | u(t.charAt(e + 2)) << 6 | u(t.charAt(e + 3)))) >> 16), h((65280 & i) >> 8), h(255 & i); return 2 === o ? h(255 & (i = u(t.charAt(e)) << 2 | u(t.charAt(e + 1)) >> 4)) : 1 === o && (h((i = u(t.charAt(e)) << 10 | u(t.charAt(e + 1)) << 4 | u(t.charAt(e + 2)) >> 2) >> 8 & 255), h(255 & i)), a }(n), e, r) }, i.prototype.parse = function () { return this.directory = new e(this.contents), this.head = new p(this), this.name = new b(this), this.cmap = new y(this), this.toUnicode = new Map, this.hhea = new g(this), this.maxp = new x(this), this.hmtx = new N(this), this.post = new v(this), this.os2 = new m(this), this.loca = new F(this), this.glyf = new A(this), this.ascender = this.os2.exists && this.os2.ascender || this.hhea.ascender, this.decender = this.os2.exists && this.os2.decender || this.hhea.decender, this.lineGap = this.os2.exists && this.os2.lineGap || this.hhea.lineGap, this.bbox = [this.head.xMin, this.head.yMin, this.head.xMax, this.head.yMax] }, i.prototype.registerTTF = function () { var i, t, e, n, r; if (this.scaleFactor = 1e3 / this.head.unitsPerEm, this.bbox = function () { var t, e, n, r; for (r = [], t = 0, e = (n = this.bbox).length; t < e; t++)i = n[t], r.push(Math.round(i * this.scaleFactor)); return r }.call(this), this.stemV = 0, this.post.exists ? (e = 255 & (n = this.post.italic_angle), !0 & (t = n >> 16) && (t = -(1 + (65535 ^ t))), this.italicAngle = +(t + "." + e)) : this.italicAngle = 0, this.ascender = Math.round(this.ascender * this.scaleFactor), this.decender = Math.round(this.decender * this.scaleFactor), this.lineGap = Math.round(this.lineGap * this.scaleFactor), this.capHeight = this.os2.exists && this.os2.capHeight || this.ascender, this.xHeight = this.os2.exists && this.os2.xHeight || 0, this.familyClass = (this.os2.exists && this.os2.familyClass || 0) >> 8, this.isSerif = 1 === (r = this.familyClass) || 2 === r || 3 === r || 4 === r || 5 === r || 7 === r, this.isScript = 10 === this.familyClass, this.flags = 0, this.post.isFixedPitch && (this.flags |= 1), this.isSerif && (this.flags |= 2), this.isScript && (this.flags |= 8), 0 !== this.italicAngle && (this.flags |= 64), this.flags |= 32, !this.cmap.unicode) throw new Error("No unicode cmap for font") }, i.prototype.characterToGlyph = function (t) { var e; return (null != (e = this.cmap.unicode) ? e.codeMap[t] : void 0) || 0 }, i.prototype.widthOfGlyph = function (t) { var e; return e = 1e3 / this.head.unitsPerEm, this.hmtx.forGlyph(t).advance * e }, i.prototype.widthOfString = function (t, e, n) { var r, i, o, a, s; for (i = a = o = 0, s = (t = "" + t).length; 0 <= s ? a < s : s < a; i = 0 <= s ? ++a : --a)r = t.charCodeAt(i), o += this.widthOfGlyph(this.characterToGlyph(r)) + n * (1e3 / e) || 0; return o * (e / 1e3) }, i.prototype.lineHeight = function (t, e) { var n; return null == e && (e = !1), n = e ? this.lineGap : 0, (this.ascender + n - this.decender) / 1e3 * t }, i }(); var h, J = function () { function t(t) { this.data = null != t ? t : [], this.pos = 0, this.length = this.data.length } return t.prototype.readByte = function () { return this.data[this.pos++] }, t.prototype.writeByte = function (t) { return this.data[this.pos++] = t }, t.prototype.readUInt32 = function () { return 16777216 * this.readByte() + (this.readByte() << 16) + (this.readByte() << 8) + this.readByte() }, t.prototype.writeUInt32 = function (t) { return this.writeByte(t >>> 24 & 255), this.writeByte(t >> 16 & 255), this.writeByte(t >> 8 & 255), this.writeByte(255 & t) }, t.prototype.readInt32 = function () { var t; return 2147483648 <= (t = this.readUInt32()) ? t - 4294967296 : t }, t.prototype.writeInt32 = function (t) { return t < 0 && (t += 4294967296), this.writeUInt32(t) }, t.prototype.readUInt16 = function () { return this.readByte() << 8 | this.readByte() }, t.prototype.writeUInt16 = function (t) { return this.writeByte(t >> 8 & 255), this.writeByte(255 & t) }, t.prototype.readInt16 = function () { var t; return 32768 <= (t = this.readUInt16()) ? t - 65536 : t }, t.prototype.writeInt16 = function (t) { return t < 0 && (t += 65536), this.writeUInt16(t) }, t.prototype.readString = function (t) { var e, n, r; for (n = [], e = r = 0; 0 <= t ? r < t : t < r; e = 0 <= t ? ++r : --r)n[e] = String.fromCharCode(this.readByte()); return n.join("") }, t.prototype.writeString = function (t) { var e, n, r, i; for (i = [], e = n = 0, r = t.length; 0 <= r ? n < r : r < n; e = 0 <= r ? ++n : --n)i.push(this.writeByte(t.charCodeAt(e))); return i }, t.prototype.readShort = function () { return this.readInt16() }, t.prototype.writeShort = function (t) { return this.writeInt16(t) }, t.prototype.readLongLong = function () { var t, e, n, r, i, o, a, s; return t = this.readByte(), e = this.readByte(), n = this.readByte(), r = this.readByte(), i = this.readByte(), o = this.readByte(), a = this.readByte(), s = this.readByte(), 128 & t ? -1 * (72057594037927940 * (255 ^ t) + 281474976710656 * (255 ^ e) + 1099511627776 * (255 ^ n) + 4294967296 * (255 ^ r) + 16777216 * (255 ^ i) + 65536 * (255 ^ o) + 256 * (255 ^ a) + (255 ^ s) + 1) : 72057594037927940 * t + 281474976710656 * e + 1099511627776 * n + 4294967296 * r + 16777216 * i + 65536 * o + 256 * a + s }, t.prototype.writeLongLong = function (t) { var e, n; return e = Math.floor(t / 4294967296), n = 4294967295 & t, this.writeByte(e >> 24 & 255), this.writeByte(e >> 16 & 255), this.writeByte(e >> 8 & 255), this.writeByte(255 & e), this.writeByte(n >> 24 & 255), this.writeByte(n >> 16 & 255), this.writeByte(n >> 8 & 255), this.writeByte(255 & n) }, t.prototype.readInt = function () { return this.readInt32() }, t.prototype.writeInt = function (t) { return this.writeInt32(t) }, t.prototype.read = function (t) { var e, n; for (e = [], n = 0; 0 <= t ? n < t : t < n; 0 <= t ? ++n : --n)e.push(this.readByte()); return e }, t.prototype.write = function (t) { var e, n, r, i; for (i = [], n = 0, r = t.length; n < r; n++)e = t[n], i.push(this.writeByte(e)); return i }, t }(), e = function () { var d; function t(t) { var e, n, r; for (this.scalarType = t.readInt(), this.tableCount = t.readShort(), this.searchRange = t.readShort(), this.entrySelector = t.readShort(), this.rangeShift = t.readShort(), this.tables = {}, n = 0, r = this.tableCount; 0 <= r ? n < r : r < n; 0 <= r ? ++n : --n)e = { tag: t.readString(4), checksum: t.readInt(), offset: t.readInt(), length: t.readInt() }, this.tables[e.tag] = e } return t.prototype.encode = function (t) { var e, n, r, i, o, a, s, l, h, u, c, f, p; for (p in c = Object.keys(t).length, a = Math.log(2), h = 16 * Math.floor(Math.log(c) / a), i = Math.floor(h / a), l = 16 * c - h, (n = new J).writeInt(this.scalarType), n.writeShort(c), n.writeShort(h), n.writeShort(i), n.writeShort(l), r = 16 * c, s = n.pos + r, o = null, f = [], t) for (u = t[p], n.writeString(p), n.writeInt(d(u)), n.writeInt(s), n.writeInt(u.length), f = f.concat(u), "head" === p && (o = s), s += u.length; s % 4;)f.push(0), s++; return n.write(f), e = 2981146554 - d(n.data), n.pos = o + 8, n.writeUInt32(e), n.data }, d = function (t) { var e, n, r, i; for (t = L.call(t); t.length % 4;)t.push(0); for (n = new J(t), r = e = 0, i = t.length; r < i; r += 4)e += n.readUInt32(); return 4294967295 & e }, t }(), c = {}.hasOwnProperty, f = function (t, e) { for (var n in e) c.call(e, n) && (t[n] = e[n]); function r() { this.constructor = t } return r.prototype = e.prototype, t.prototype = new r, t.__super__ = e.prototype, t }; h = function () { function t(t) { var e; this.file = t, e = this.file.directory.tables[this.tag], this.exists = !!e, e && (this.offset = e.offset, this.length = e.length, this.parse(this.file.contents)) } return t.prototype.parse = function () { }, t.prototype.encode = function () { }, t.prototype.raw = function () { return this.exists ? (this.file.contents.pos = this.offset, this.file.contents.read(this.length)) : null }, t }(); var p = function (t) { function e() { return e.__super__.constructor.apply(this, arguments) } return f(e, h), e.prototype.tag = "head", e.prototype.parse = function (t) { return t.pos = this.offset, this.version = t.readInt(), this.revision = t.readInt(), this.checkSumAdjustment = t.readInt(), this.magicNumber = t.readInt(), this.flags = t.readShort(), this.unitsPerEm = t.readShort(), this.created = t.readLongLong(), this.modified = t.readLongLong(), this.xMin = t.readShort(), this.yMin = t.readShort(), this.xMax = t.readShort(), this.yMax = t.readShort(), this.macStyle = t.readShort(), this.lowestRecPPEM = t.readShort(), this.fontDirectionHint = t.readShort(), this.indexToLocFormat = t.readShort(), this.glyphDataFormat = t.readShort() }, e.prototype.encode = function (t) { var e; return (e = new J).writeInt(this.version), e.writeInt(this.revision), e.writeInt(this.checkSumAdjustment), e.writeInt(this.magicNumber), e.writeShort(this.flags), e.writeShort(this.unitsPerEm), e.writeLongLong(this.created), e.writeLongLong(this.modified), e.writeShort(this.xMin), e.writeShort(this.yMin), e.writeShort(this.xMax), e.writeShort(this.yMax), e.writeShort(this.macStyle), e.writeShort(this.lowestRecPPEM), e.writeShort(this.fontDirectionHint), e.writeShort(t), e.writeShort(this.glyphDataFormat), e.data }, e }(), d = function () { function t(n, t) { var e, r, i, o, a, s, l, h, u, c, f, p, d, g, m, y, v, w; switch (this.platformID = n.readUInt16(), this.encodingID = n.readShort(), this.offset = t + n.readInt(), u = n.pos, n.pos = this.offset, this.format = n.readUInt16(), this.length = n.readUInt16(), this.language = n.readUInt16(), this.isUnicode = 3 === this.platformID && 1 === this.encodingID && 4 === this.format || 0 === this.platformID && 4 === this.format, this.codeMap = {}, this.format) { case 0: for (s = m = 0; m < 256; s = ++m)this.codeMap[s] = n.readByte(); break; case 4: for (f = n.readUInt16(), c = f / 2, n.pos += 6, i = function () { var t, e; for (e = [], s = t = 0; 0 <= c ? t < c : c < t; s = 0 <= c ? ++t : --t)e.push(n.readUInt16()); return e }(), n.pos += 2, d = function () { var t, e; for (e = [], s = t = 0; 0 <= c ? t < c : c < t; s = 0 <= c ? ++t : --t)e.push(n.readUInt16()); return e }(), l = function () { var t, e; for (e = [], s = t = 0; 0 <= c ? t < c : c < t; s = 0 <= c ? ++t : --t)e.push(n.readUInt16()); return e }(), h = function () { var t, e; for (e = [], s = t = 0; 0 <= c ? t < c : c < t; s = 0 <= c ? ++t : --t)e.push(n.readUInt16()); return e }(), r = (this.length - n.pos + this.offset) / 2, a = function () { var t, e; for (e = [], s = t = 0; 0 <= r ? t < r : r < t; s = 0 <= r ? ++t : --t)e.push(n.readUInt16()); return e }(), s = y = 0, w = i.length; y < w; s = ++y)for (g = i[s], e = v = p = d[s]; p <= g ? v <= g : g <= v; e = p <= g ? ++v : --v)0 === h[s] ? o = e + l[s] : 0 !== (o = a[h[s] / 2 + (e - p) - (c - s)] || 0) && (o += l[s]), this.codeMap[e] = 65535 & o }n.pos = u } return t.encode = function (t, e) { var n, r, i, o, a, s, l, h, u, c, f, p, d, g, m, y, v, w, b, x, N, L, A, S, _, F, P, k, I, C, B, j, E, M, O, q, T, R, D, U, z, H, W, V, G, Y; switch (k = new J, o = Object.keys(t).sort(function (t, e) { return t - e }), e) { case "macroman": for (d = 0, g = function () { var t, e; for (e = [], p = t = 0; t < 256; p = ++t)e.push(0); return e }(), y = { 0: 0 }, i = {}, I = 0, E = o.length; I < E; I++)null == y[W = t[r = o[I]]] && (y[W] = ++d), i[r] = { old: t[r], new: y[t[r]] }, g[r] = y[t[r]]; return k.writeUInt16(1), k.writeUInt16(0), k.writeUInt32(12), k.writeUInt16(0), k.writeUInt16(262), k.writeUInt16(0), k.write(g), { charMap: i, subtable: k.data, maxGlyphID: d + 1 }; case "unicode": for (F = [], u = [], y = {}, n = {}, m = l = null, C = v = 0, M = o.length; C < M; C++)null == y[b = t[r = o[C]]] && (y[b] = ++v), n[r] = { old: b, new: y[b] }, a = y[b] - r, null != m && a === l || (m && u.push(m), F.push(r), l = a), m = r; for (m && u.push(m), u.push(65535), F.push(65535), S = 2 * (A = F.length), L = 2 * Math.pow(Math.log(A) / Math.LN2, 2), c = Math.log(L / 2) / Math.LN2, N = 2 * A - L, s = [], x = [], f = [], p = B = 0, O = F.length; B < O; p = ++B) { if (_ = F[p], h = u[p], 65535 === _) { s.push(0), x.push(0); break } if (32768 <= _ - (P = n[_].new)) for (s.push(0), x.push(2 * (f.length + A - p)), r = j = _; _ <= h ? j <= h : h <= j; r = _ <= h ? ++j : --j)f.push(n[r].new); else s.push(P - _), x.push(0) } for (k.writeUInt16(3), k.writeUInt16(1), k.writeUInt32(12), k.writeUInt16(4), k.writeUInt16(16 + 8 * A + 2 * f.length), k.writeUInt16(0), k.writeUInt16(S), k.writeUInt16(L), k.writeUInt16(c), k.writeUInt16(N), z = 0, q = u.length; z < q; z++)r = u[z], k.writeUInt16(r); for (k.writeUInt16(0), H = 0, T = F.length; H < T; H++)r = F[H], k.writeUInt16(r); for (V = 0, R = s.length; V < R; V++)a = s[V], k.writeUInt16(a); for (G = 0, D = x.length; G < D; G++)w = x[G], k.writeUInt16(w); for (Y = 0, U = f.length; Y < U; Y++)d = f[Y], k.writeUInt16(d); return { charMap: n, subtable: k.data, maxGlyphID: v + 1 } } }, t }(), y = function (t) { function e() { return e.__super__.constructor.apply(this, arguments) } return f(e, h), e.prototype.tag = "cmap", e.prototype.parse = function (t) { var e, n, r; for (t.pos = this.offset, this.version = t.readUInt16(), n = t.readUInt16(), this.tables = [], this.unicode = null, r = 0; 0 <= n ? r < n : n < r; 0 <= n ? ++r : --r)e = new d(t, this.offset), this.tables.push(e), e.isUnicode && null == this.unicode && (this.unicode = e); return !0 }, e.encode = function (t, e) { var n, r; return null == e && (e = "macroman"), n = d.encode(t, e), (r = new J).writeUInt16(0), r.writeUInt16(1), n.table = r.data.concat(n.subtable), n }, e }(), g = function (t) { function e() { return e.__super__.constructor.apply(this, arguments) } return f(e, h), e.prototype.tag = "hhea", e.prototype.parse = function (t) { return t.pos = this.offset, this.version = t.readInt(), this.ascender = t.readShort(), this.decender = t.readShort(), this.lineGap = t.readShort(), this.advanceWidthMax = t.readShort(), this.minLeftSideBearing = t.readShort(), this.minRightSideBearing = t.readShort(), this.xMaxExtent = t.readShort(), this.caretSlopeRise = t.readShort(), this.caretSlopeRun = t.readShort(), this.caretOffset = t.readShort(), t.pos += 8, this.metricDataFormat = t.readShort(), this.numberOfMetrics = t.readUInt16() }, e }(), m = function (t) { function e() { return e.__super__.constructor.apply(this, arguments) } return f(e, h), e.prototype.tag = "OS/2", e.prototype.parse = function (n) { if (n.pos = this.offset, this.version = n.readUInt16(), this.averageCharWidth = n.readShort(), this.weightClass = n.readUInt16(), this.widthClass = n.readUInt16(), this.type = n.readShort(), this.ySubscriptXSize = n.readShort(), this.ySubscriptYSize = n.readShort(), this.ySubscriptXOffset = n.readShort(), this.ySubscriptYOffset = n.readShort(), this.ySuperscriptXSize = n.readShort(), this.ySuperscriptYSize = n.readShort(), this.ySuperscriptXOffset = n.readShort(), this.ySuperscriptYOffset = n.readShort(), this.yStrikeoutSize = n.readShort(), this.yStrikeoutPosition = n.readShort(), this.familyClass = n.readShort(), this.panose = function () { var t, e; for (e = [], t = 0; t < 10; ++t)e.push(n.readByte()); return e }(), this.charRange = function () { var t, e; for (e = [], t = 0; t < 4; ++t)e.push(n.readInt()); return e }(), this.vendorID = n.readString(4), this.selection = n.readShort(), this.firstCharIndex = n.readShort(), this.lastCharIndex = n.readShort(), 0 < this.version && (this.ascent = n.readShort(), this.descent = n.readShort(), this.lineGap = n.readShort(), this.winAscent = n.readShort(), this.winDescent = n.readShort(), this.codePageRange = function () { var t, e; for (e = [], t = 0; t < 2; ++t)e.push(n.readInt()); return e }(), 1 < this.version)) return this.xHeight = n.readShort(), this.capHeight = n.readShort(), this.defaultChar = n.readShort(), this.breakChar = n.readShort(), this.maxContext = n.readShort() }, e }(), v = function (t) { function e() { return e.__super__.constructor.apply(this, arguments) } return f(e, h), e.prototype.tag = "post", e.prototype.parse = function (r) { var t, e, n, i; switch (r.pos = this.offset, this.format = r.readInt(), this.italicAngle = r.readInt(), this.underlinePosition = r.readShort(), this.underlineThickness = r.readShort(), this.isFixedPitch = r.readInt(), this.minMemType42 = r.readInt(), this.maxMemType42 = r.readInt(), this.minMemType1 = r.readInt(), this.maxMemType1 = r.readInt(), this.format) { case 65536: break; case 131072: for (e = r.readUInt16(), this.glyphNameIndex = [], n = 0; 0 <= e ? n < e : e < n; 0 <= e ? ++n : --n)this.glyphNameIndex.push(r.readUInt16()); for (this.names = [], i = []; r.pos < this.offset + this.length;)t = r.readByte(), i.push(this.names.push(r.readString(t))); return i; case 151552: return e = r.readUInt16(), this.offsets = r.read(e); case 196608: break; case 262144: return this.map = function () { var t, e, n; for (n = [], t = 0, e = this.file.maxp.numGlyphs; 0 <= e ? t < e : e < t; 0 <= e ? ++t : --t)n.push(r.readUInt32()); return n }.call(this) } }, e }(), w = function (t, e) { this.raw = t, this.length = t.length, this.platformID = e.platformID, this.encodingID = e.encodingID, this.languageID = e.languageID }, b = function (t) { function e() { return e.__super__.constructor.apply(this, arguments) } return f(e, h), e.prototype.tag = "name", e.prototype.parse = function (t) { var e, n, r, i, o, a, s, l, h, u, c, f; for (t.pos = this.offset, t.readShort(), e = t.readShort(), a = t.readShort(), n = [], i = h = 0; 0 <= e ? h < e : e < h; i = 0 <= e ? ++h : --h)n.push({ platformID: t.readShort(), encodingID: t.readShort(), languageID: t.readShort(), nameID: t.readShort(), length: t.readShort(), offset: this.offset + a + t.readShort() }); for (s = {}, i = u = 0, c = n.length; u < c; i = ++u)r = n[i], t.pos = r.offset, l = t.readString(r.length), o = new w(l, r), null == s[f = r.nameID] && (s[f] = []), s[r.nameID].push(o); this.strings = s, this.copyright = s[0], this.fontFamily = s[1], this.fontSubfamily = s[2], this.uniqueSubfamily = s[3], this.fontName = s[4], this.version = s[5]; try { this.postscriptName = s[6][0].raw.replace(/[\x00-\x19\x80-\xff]/g, "") } catch (t) { this.postscriptName = s[4][0].raw.replace(/[\x00-\x19\x80-\xff]/g, "") } return this.trademark = s[7], this.manufacturer = s[8], this.designer = s[9], this.description = s[10], this.vendorUrl = s[11], this.designerUrl = s[12], this.license = s[13], this.licenseUrl = s[14], this.preferredFamily = s[15], this.preferredSubfamily = s[17], this.compatibleFull = s[18], this.sampleText = s[19] }, e }(), x = function (t) { function e() { return e.__super__.constructor.apply(this, arguments) } return f(e, h), e.prototype.tag = "maxp", e.prototype.parse = function (t) { return t.pos = this.offset, this.version = t.readInt(), this.numGlyphs = t.readUInt16(), this.maxPoints = t.readUInt16(), this.maxContours = t.readUInt16(), this.maxCompositePoints = t.readUInt16(), this.maxComponentContours = t.readUInt16(), this.maxZones = t.readUInt16(), this.maxTwilightPoints = t.readUInt16(), this.maxStorage = t.readUInt16(), this.maxFunctionDefs = t.readUInt16(), this.maxInstructionDefs = t.readUInt16(), this.maxStackElements = t.readUInt16(), this.maxSizeOfInstructions = t.readUInt16(), this.maxComponentElements = t.readUInt16(), this.maxComponentDepth = t.readUInt16() }, e }(), N = function (t) { function e() { return e.__super__.constructor.apply(this, arguments) } return f(e, h), e.prototype.tag = "hmtx", e.prototype.parse = function (n) { var t, r, i, e, o, a, s; for (n.pos = this.offset, this.metrics = [], e = 0, a = this.file.hhea.numberOfMetrics; 0 <= a ? e < a : a < e; 0 <= a ? ++e : --e)this.metrics.push({ advance: n.readUInt16(), lsb: n.readInt16() }); for (r = this.file.maxp.numGlyphs - this.file.hhea.numberOfMetrics, this.leftSideBearings = function () { var t, e; for (e = [], t = 0; 0 <= r ? t < r : r < t; 0 <= r ? ++t : --t)e.push(n.readInt16()); return e }(), this.widths = function () { var t, e, n, r; for (r = [], t = 0, e = (n = this.metrics).length; t < e; t++)i = n[t], r.push(i.advance); return r }.call(this), t = this.widths[this.widths.length - 1], s = [], o = 0; 0 <= r ? o < r : r < o; 0 <= r ? ++o : --o)s.push(this.widths.push(t)); return s }, e.prototype.forGlyph = function (t) { return t in this.metrics ? this.metrics[t] : { advance: this.metrics[this.metrics.length - 1].advance, lsb: this.leftSideBearings[t - this.metrics.length] } }, e }(), L = [].slice, A = function (t) { function e() { return e.__super__.constructor.apply(this, arguments) } return f(e, h), e.prototype.tag = "glyf", e.prototype.parse = function (t) { return this.cache = {} }, e.prototype.glyphFor = function (t) { var e, n, r, i, o, a, s, l, h, u; return (t = t) in this.cache ? this.cache[t] : (i = this.file.loca, e = this.file.contents, n = i.indexOf(t), 0 === (r = i.lengthOf(t)) ? this.cache[t] = null : (e.pos = this.offset + n, o = (a = new J(e.read(r))).readShort(), l = a.readShort(), u = a.readShort(), s = a.readShort(), h = a.readShort(), this.cache[t] = -1 === o ? new _(a, l, u, s, h) : new S(a, o, l, u, s, h), this.cache[t])) }, e.prototype.encode = function (t, e, n) { var r, i, o, a, s; for (o = [], i = [], a = 0, s = e.length; a < s; a++)r = t[e[a]], i.push(o.length), r && (o = o.concat(r.encode(n))); return i.push(o.length), { table: o, offsets: i } }, e }(), S = function () { function t(t, e, n, r, i, o) { this.raw = t, this.numberOfContours = e, this.xMin = n, this.yMin = r, this.xMax = i, this.yMax = o, this.compound = !1 } return t.prototype.encode = function () { return this.raw.data }, t }(), _ = function () { function t(t, e, n, r, i) { var o, a; for (this.raw = t, this.xMin = e, this.yMin = n, this.xMax = r, this.yMax = i, this.compound = !0, this.glyphIDs = [], this.glyphOffsets = [], o = this.raw; a = o.readShort(), this.glyphOffsets.push(o.pos), this.glyphIDs.push(o.readShort()), 32 & a;)o.pos += 1 & a ? 4 : 2, 128 & a ? o.pos += 8 : 64 & a ? o.pos += 4 : 8 & a && (o.pos += 2) } return 1, 8, 32, 64, 128, t.prototype.encode = function (t) { var e, n, r, i, o; for (n = new J(L.call(this.raw.data)), e = r = 0, i = (o = this.glyphIDs).length; r < i; e = ++r)o[e], n.pos = this.glyphOffsets[e]; return n.data }, t }(), F = function (t) { function e() { return e.__super__.constructor.apply(this, arguments) } return f(e, h), e.prototype.tag = "loca", e.prototype.parse = function (r) { var t; return r.pos = this.offset, t = this.file.head.indexToLocFormat, this.offsets = 0 === t ? function () { var t, e, n; for (n = [], t = 0, e = this.length; t < e; t += 2)n.push(2 * r.readUInt16()); return n }.call(this) : function () { var t, e, n; for (n = [], t = 0, e = this.length; t < e; t += 4)n.push(r.readUInt32()); return n }.call(this) }, e.prototype.indexOf = function (t) { return this.offsets[t] }, e.prototype.lengthOf = function (t) { return this.offsets[t + 1] - this.offsets[t] }, e.prototype.encode = function (t, e) { for (var n = new Uint32Array(this.offsets.length), r = 0, i = 0, o = 0; o < n.length; ++o)if (n[o] = r, i < e.length && e[i] == o) { ++i, n[o] = r; var a = this.offsets[o], s = this.offsets[o + 1] - a; 0 < s && (r += s) } for (var l = new Array(4 * n.length), h = 0; h < n.length; ++h)l[4 * h + 3] = 255 & n[h], l[4 * h + 2] = (65280 & n[h]) >> 8, l[4 * h + 1] = (16711680 & n[h]) >> 16, l[4 * h] = (4278190080 & n[h]) >> 24; return l }, e }(), P = function () { function t(t) { this.font = t, this.subset = {}, this.unicodes = {}, this.next = 33 } return t.prototype.generateCmap = function () { var t, e, n, r, i; for (e in r = this.font.cmap.tables[0].codeMap, t = {}, i = this.subset) n = i[e], t[e] = r[n]; return t }, t.prototype.glyphsFor = function (t) { var e, n, r, i, o, a, s; for (r = {}, o = 0, a = t.length; o < a; o++)r[i = t[o]] = this.font.glyf.glyphFor(i); for (i in e = [], r) (null != (n = r[i]) ? n.compound : void 0) && e.push.apply(e, n.glyphIDs); if (0 < e.length) for (i in s = this.glyphsFor(e)) n = s[i], r[i] = n; return r }, t.prototype.encode = function (t, e) { var n, r, i, o, a, s, l, h, u, c, f, p, d, g, m; for (r in n = y.encode(this.generateCmap(), "unicode"), o = this.glyphsFor(t), f = { 0: 0 }, m = n.charMap) f[(s = m[r]).old] = s.new; for (p in c = n.maxGlyphID, o) p in f || (f[p] = c++); return h = function (t) { var e, n; for (e in n = {}, t) n[t[e]] = e; return n }(f), u = Object.keys(h).sort(function (t, e) { return t - e }), d = function () { var t, e, n; for (n = [], t = 0, e = u.length; t < e; t++)a = u[t], n.push(h[a]); return n }(), i = this.font.glyf.encode(o, d, f), l = this.font.loca.encode(i.offsets, d), g = { cmap: this.font.cmap.raw(), glyf: i.table, loca: l, hmtx: this.font.hmtx.raw(), hhea: this.font.hhea.raw(), maxp: this.font.maxp.raw(), post: this.font.post.raw(), name: this.font.name.raw(), head: this.font.head.encode(e) }, this.font.os2.exists && (g["OS/2"] = this.font.os2.raw()), this.font.directory.encode(g) }, t }(); t.API.PDFObject = function () { var o; function a() { } return o = function (t, e) { return (Array(e + 1).join("0") + t).slice(-e) }, a.convert = function (r) { var i, t, e, n; if (Array.isArray(r)) return "[" + function () { var t, e, n; for (n = [], t = 0, e = r.length; t < e; t++)i = r[t], n.push(a.convert(i)); return n }().join(" ") + "]"; if ("string" == typeof r) return "/" + r; if (null != r ? r.isString : void 0) return "(" + r + ")"; if (r instanceof Date) return "(D:" + o(r.getUTCFullYear(), 4) + o(r.getUTCMonth(), 2) + o(r.getUTCDate(), 2) + o(r.getUTCHours(), 2) + o(r.getUTCMinutes(), 2) + o(r.getUTCSeconds(), 2) + "Z)"; if ("[object Object]" !== {}.toString.call(r)) return "" + r; for (t in e = ["<<"], r) n = r[t], e.push("/" + t + " " + a.convert(n)); return e.push(">>"), e.join("\n") }, a }() }(lt),
        /*
          # PNG.js
          # Copyright (c) 2011 Devon Govett
          # MIT LICENSE
          # 
          # 
          */
        Nt = "undefined" != typeof self && self || "undefined" != typeof window && window || "undefined" != typeof global && global || Function('return typeof this === "object" && this.content')() || Function("return this")(), Lt = function () { var h, n, r; function i(t) { var e, n, r, i, o, a, s, l, h, u, c, f, p, d; for (this.data = t, this.pos = 8, this.palette = [], this.imgData = [], this.transparency = {}, this.animation = null, this.text = {}, a = null; ;) { switch (e = this.readUInt32(), h = function () { var t, e; for (e = [], t = 0; t < 4; ++t)e.push(String.fromCharCode(this.data[this.pos++])); return e }.call(this).join("")) { case "IHDR": this.width = this.readUInt32(), this.height = this.readUInt32(), this.bits = this.data[this.pos++], this.colorType = this.data[this.pos++], this.compressionMethod = this.data[this.pos++], this.filterMethod = this.data[this.pos++], this.interlaceMethod = this.data[this.pos++]; break; case "acTL": this.animation = { numFrames: this.readUInt32(), numPlays: this.readUInt32() || 1 / 0, frames: [] }; break; case "PLTE": this.palette = this.read(e); break; case "fcTL": a && this.animation.frames.push(a), this.pos += 4, a = { width: this.readUInt32(), height: this.readUInt32(), xOffset: this.readUInt32(), yOffset: this.readUInt32() }, o = this.readUInt16(), i = this.readUInt16() || 100, a.delay = 1e3 * o / i, a.disposeOp = this.data[this.pos++], a.blendOp = this.data[this.pos++], a.data = []; break; case "IDAT": case "fdAT": for ("fdAT" === h && (this.pos += 4, e -= 4), t = (null != a ? a.data : void 0) || this.imgData, f = 0; 0 <= e ? f < e : e < f; 0 <= e ? ++f : --f)t.push(this.data[this.pos++]); break; case "tRNS": switch (this.transparency = {}, this.colorType) { case 3: if (r = this.palette.length / 3, this.transparency.indexed = this.read(e), this.transparency.indexed.length > r) throw new Error("More transparent colors than palette size"); if (0 < (u = r - this.transparency.indexed.length)) for (p = 0; 0 <= u ? p < u : u < p; 0 <= u ? ++p : --p)this.transparency.indexed.push(255); break; case 0: this.transparency.grayscale = this.read(e)[0]; break; case 2: this.transparency.rgb = this.read(e) }break; case "tEXt": s = (c = this.read(e)).indexOf(0), l = String.fromCharCode.apply(String, c.slice(0, s)), this.text[l] = String.fromCharCode.apply(String, c.slice(s + 1)); break; case "IEND": return a && this.animation.frames.push(a), this.colors = function () { switch (this.colorType) { case 0: case 3: case 4: return 1; case 2: case 6: return 3 } }.call(this), this.hasAlphaChannel = 4 === (d = this.colorType) || 6 === d, n = this.colors + (this.hasAlphaChannel ? 1 : 0), this.pixelBitlength = this.bits * n, this.colorSpace = function () { switch (this.colors) { case 1: return "DeviceGray"; case 3: return "DeviceRGB" } }.call(this), void (this.imgData = new Uint8Array(this.imgData)); default: this.pos += e }if (this.pos += 4, this.pos > this.data.length) throw new Error("Incomplete or corrupt PNG file") } } i.load = function (t, e, n) { var r; return "function" == typeof e && (n = e), (r = new XMLHttpRequest).open("GET", t, !0), r.responseType = "arraybuffer", r.onload = function () { var t; return t = new i(new Uint8Array(r.response || r.mozResponseArrayBuffer)), "function" == typeof (null != e ? e.getContext : void 0) && t.render(e), "function" == typeof n ? n(t) : void 0 }, r.send(null) }, i.prototype.read = function (t) { var e, n; for (n = [], e = 0; 0 <= t ? e < t : t < e; 0 <= t ? ++e : --e)n.push(this.data[this.pos++]); return n }, i.prototype.readUInt32 = function () { return this.data[this.pos++] << 24 | this.data[this.pos++] << 16 | this.data[this.pos++] << 8 | this.data[this.pos++] }, i.prototype.readUInt16 = function () { return this.data[this.pos++] << 8 | this.data[this.pos++] }, i.prototype.decodePixels = function (C) { var B = this.pixelBitlength / 8, j = new Uint8Array(this.width * this.height * B), E = 0, M = this; if (null == C && (C = this.imgData), 0 === C.length) return new Uint8Array(0); function t(t, e, n, r) { var i, o, a, s, l, h, u, c, f, p, d, g, m, y, v, w, b, x, N, L, A, S = Math.ceil((M.width - t) / n), _ = Math.ceil((M.height - e) / r), F = M.width == S && M.height == _; for (y = B * S, g = F ? j : new Uint8Array(y * _), h = C.length, o = m = 0; m < _ && E < h;) { switch (C[E++]) { case 0: for (s = b = 0; b < y; s = b += 1)g[o++] = C[E++]; break; case 1: for (s = x = 0; x < y; s = x += 1)i = C[E++], l = s < B ? 0 : g[o - B], g[o++] = (i + l) % 256; break; case 2: for (s = N = 0; N < y; s = N += 1)i = C[E++], a = (s - s % B) / B, v = m && g[(m - 1) * y + a * B + s % B], g[o++] = (v + i) % 256; break; case 3: for (s = L = 0; L < y; s = L += 1)i = C[E++], a = (s - s % B) / B, l = s < B ? 0 : g[o - B], v = m && g[(m - 1) * y + a * B + s % B], g[o++] = (i + Math.floor((l + v) / 2)) % 256; break; case 4: for (s = A = 0; A < y; s = A += 1)i = C[E++], a = (s - s % B) / B, l = s < B ? 0 : g[o - B], 0 === m ? v = w = 0 : (v = g[(m - 1) * y + a * B + s % B], w = a && g[(m - 1) * y + (a - 1) * B + s % B]), u = l + v - w, c = Math.abs(u - l), p = Math.abs(u - v), d = Math.abs(u - w), f = c <= p && c <= d ? l : p <= d ? v : w, g[o++] = (i + f) % 256; break; default: throw new Error("Invalid filter algorithm: " + C[E - 1]) }if (!F) { var P = ((e + m * r) * M.width + t) * B, k = m * y; for (s = 0; s < S; s += 1) { for (var I = 0; I < B; I += 1)j[P++] = g[k++]; P += (n - 1) * B } } m++ } } return C = (C = new kt(C)).getBytes(), 1 == M.interlaceMethod ? (t(0, 0, 8, 8), t(4, 0, 8, 8), t(0, 4, 4, 8), t(2, 0, 4, 4), t(0, 2, 2, 4), t(1, 0, 2, 2), t(0, 1, 1, 2)) : t(0, 0, 1, 1), j }, i.prototype.decodePalette = function () { var t, e, n, r, i, o, a, s, l; for (n = this.palette, o = this.transparency.indexed || [], i = new Uint8Array((o.length || 0) + n.length), r = 0, n.length, e = a = t = 0, s = n.length; a < s; e = a += 3)i[r++] = n[e], i[r++] = n[e + 1], i[r++] = n[e + 2], i[r++] = null != (l = o[t++]) ? l : 255; return i }, i.prototype.copyToImageData = function (t, e) { var n, r, i, o, a, s, l, h, u, c, f; if (r = this.colors, u = null, n = this.hasAlphaChannel, this.palette.length && (u = null != (f = this._decodedPalette) ? f : this._decodedPalette = this.decodePalette(), r = 4, n = !0), h = (i = t.data || t).length, a = u || e, o = s = 0, 1 === r) for (; o < h;)l = u ? 4 * e[o / 4] : s, c = a[l++], i[o++] = c, i[o++] = c, i[o++] = c, i[o++] = n ? a[l++] : 255, s = l; else for (; o < h;)l = u ? 4 * e[o / 4] : s, i[o++] = a[l++], i[o++] = a[l++], i[o++] = a[l++], i[o++] = n ? a[l++] : 255, s = l }, i.prototype.decode = function () { var t; return t = new Uint8Array(this.width * this.height * 4), this.copyToImageData(t, this.decodePixels()), t }; try { n = Nt.document.createElement("canvas"), r = n.getContext("2d") } catch (t) { return -1 } return h = function (t) { var e; return r.width = t.width, r.height = t.height, r.clearRect(0, 0, t.width, t.height), r.putImageData(t, 0, 0), (e = new Image).src = n.toDataURL(), e }, i.prototype.decodeFrames = function (t) { var e, n, r, i, o, a, s, l; if (this.animation) { for (l = [], n = o = 0, a = (s = this.animation.frames).length; o < a; n = ++o)e = s[n], r = t.createImageData(e.width, e.height), i = this.decodePixels(new Uint8Array(e.data)), this.copyToImageData(r, i), e.imageData = r, l.push(e.image = h(r)); return l } }, i.prototype.renderFrame = function (t, e) { var n, r, i; return n = (r = this.animation.frames)[e], i = r[e - 1], 0 === e && t.clearRect(0, 0, this.width, this.height), 1 === (null != i ? i.disposeOp : void 0) ? t.clearRect(i.xOffset, i.yOffset, i.width, i.height) : 2 === (null != i ? i.disposeOp : void 0) && t.putImageData(i.imageData, i.xOffset, i.yOffset), 0 === n.blendOp && t.clearRect(n.xOffset, n.yOffset, n.width, n.height), t.drawImage(n.image, n.xOffset, n.yOffset) }, i.prototype.animate = function (n) { var r, i, o, a, s, t, l = this; return i = 0, t = this.animation, a = t.numFrames, o = t.frames, s = t.numPlays, (r = function () { var t, e; if (t = i++ % a, e = o[t], l.renderFrame(n, t), 1 < a && i / a < s) return l.animation._timeout = setTimeout(r, e.delay) })() }, i.prototype.stopAnimation = function () { var t; return clearTimeout(null != (t = this.animation) ? t._timeout : void 0) }, i.prototype.render = function (t) { var e, n; return t._png && t._png.stopAnimation(), t._png = this, t.width = this.width, t.height = this.height, e = t.getContext("2d"), this.animation ? (this.decodeFrames(e), this.animate(e)) : (n = e.createImageData(this.width, this.height), this.copyToImageData(n, this.decodePixels()), e.putImageData(n, 0, 0)) }, i }(), Nt.PNG = Lt;
    /*
       * Extracted from pdf.js
       * https://github.com/andreasgal/pdf.js
       *
       * Copyright (c) 2011 Mozilla Foundation
       *
       * Contributors: Andreas Gal <gal@mozilla.com>
       *               Chris G Jones <cjones@mozilla.com>
       *               Shaon Barman <shaon.barman@gmail.com>
       *               Vivien Nicolas <21@vingtetun.org>
       *               Justin D'Arcangelo <justindarc@gmail.com>
       *               Yury Delendik
       *
       * 
       */
    var Pt = function () { function t() { this.pos = 0, this.bufferLength = 0, this.eof = !1, this.buffer = null } return t.prototype = { ensureBuffer: function (t) { var e = this.buffer, n = e ? e.byteLength : 0; if (t < n) return e; for (var r = 512; r < t;)r <<= 1; for (var i = new Uint8Array(r), o = 0; o < n; ++o)i[o] = e[o]; return this.buffer = i }, getByte: function () { for (var t = this.pos; this.bufferLength <= t;) { if (this.eof) return null; this.readBlock() } return this.buffer[this.pos++] }, getBytes: function (t) { var e = this.pos; if (t) { this.ensureBuffer(e + t); for (var n = e + t; !this.eof && this.bufferLength < n;)this.readBlock(); var r = this.bufferLength; r < n && (n = r) } else { for (; !this.eof;)this.readBlock(); n = this.bufferLength } return this.pos = n, this.buffer.subarray(e, n) }, lookChar: function () { for (var t = this.pos; this.bufferLength <= t;) { if (this.eof) return null; this.readBlock() } return String.fromCharCode(this.buffer[this.pos]) }, getChar: function () { for (var t = this.pos; this.bufferLength <= t;) { if (this.eof) return null; this.readBlock() } return String.fromCharCode(this.buffer[this.pos++]) }, makeSubStream: function (t, e, n) { for (var r = t + e; this.bufferLength <= r && !this.eof;)this.readBlock(); return new Stream(this.buffer, t, e, n) }, skip: function (t) { t || (t = 1), this.pos += t }, reset: function () { this.pos = 0 } }, t }(), kt = function () { if ("undefined" != typeof Uint32Array) { var k = new Uint32Array([16, 17, 18, 0, 8, 7, 9, 6, 10, 5, 11, 4, 12, 3, 13, 2, 14, 1, 15]), I = new Uint32Array([3, 4, 5, 6, 7, 8, 9, 10, 65547, 65549, 65551, 65553, 131091, 131095, 131099, 131103, 196643, 196651, 196659, 196667, 262211, 262227, 262243, 262259, 327811, 327843, 327875, 327907, 258, 258, 258]), C = new Uint32Array([1, 2, 3, 4, 65541, 65543, 131081, 131085, 196625, 196633, 262177, 262193, 327745, 327777, 393345, 393409, 459009, 459137, 524801, 525057, 590849, 591361, 657409, 658433, 724993, 727041, 794625, 798721, 868353, 876545]), B = [new Uint32Array([459008, 524368, 524304, 524568, 459024, 524400, 524336, 590016, 459016, 524384, 524320, 589984, 524288, 524416, 524352, 590048, 459012, 524376, 524312, 589968, 459028, 524408, 524344, 590032, 459020, 524392, 524328, 59e4, 524296, 524424, 524360, 590064, 459010, 524372, 524308, 524572, 459026, 524404, 524340, 590024, 459018, 524388, 524324, 589992, 524292, 524420, 524356, 590056, 459014, 524380, 524316, 589976, 459030, 524412, 524348, 590040, 459022, 524396, 524332, 590008, 524300, 524428, 524364, 590072, 459009, 524370, 524306, 524570, 459025, 524402, 524338, 590020, 459017, 524386, 524322, 589988, 524290, 524418, 524354, 590052, 459013, 524378, 524314, 589972, 459029, 524410, 524346, 590036, 459021, 524394, 524330, 590004, 524298, 524426, 524362, 590068, 459011, 524374, 524310, 524574, 459027, 524406, 524342, 590028, 459019, 524390, 524326, 589996, 524294, 524422, 524358, 590060, 459015, 524382, 524318, 589980, 459031, 524414, 524350, 590044, 459023, 524398, 524334, 590012, 524302, 524430, 524366, 590076, 459008, 524369, 524305, 524569, 459024, 524401, 524337, 590018, 459016, 524385, 524321, 589986, 524289, 524417, 524353, 590050, 459012, 524377, 524313, 589970, 459028, 524409, 524345, 590034, 459020, 524393, 524329, 590002, 524297, 524425, 524361, 590066, 459010, 524373, 524309, 524573, 459026, 524405, 524341, 590026, 459018, 524389, 524325, 589994, 524293, 524421, 524357, 590058, 459014, 524381, 524317, 589978, 459030, 524413, 524349, 590042, 459022, 524397, 524333, 590010, 524301, 524429, 524365, 590074, 459009, 524371, 524307, 524571, 459025, 524403, 524339, 590022, 459017, 524387, 524323, 589990, 524291, 524419, 524355, 590054, 459013, 524379, 524315, 589974, 459029, 524411, 524347, 590038, 459021, 524395, 524331, 590006, 524299, 524427, 524363, 590070, 459011, 524375, 524311, 524575, 459027, 524407, 524343, 590030, 459019, 524391, 524327, 589998, 524295, 524423, 524359, 590062, 459015, 524383, 524319, 589982, 459031, 524415, 524351, 590046, 459023, 524399, 524335, 590014, 524303, 524431, 524367, 590078, 459008, 524368, 524304, 524568, 459024, 524400, 524336, 590017, 459016, 524384, 524320, 589985, 524288, 524416, 524352, 590049, 459012, 524376, 524312, 589969, 459028, 524408, 524344, 590033, 459020, 524392, 524328, 590001, 524296, 524424, 524360, 590065, 459010, 524372, 524308, 524572, 459026, 524404, 524340, 590025, 459018, 524388, 524324, 589993, 524292, 524420, 524356, 590057, 459014, 524380, 524316, 589977, 459030, 524412, 524348, 590041, 459022, 524396, 524332, 590009, 524300, 524428, 524364, 590073, 459009, 524370, 524306, 524570, 459025, 524402, 524338, 590021, 459017, 524386, 524322, 589989, 524290, 524418, 524354, 590053, 459013, 524378, 524314, 589973, 459029, 524410, 524346, 590037, 459021, 524394, 524330, 590005, 524298, 524426, 524362, 590069, 459011, 524374, 524310, 524574, 459027, 524406, 524342, 590029, 459019, 524390, 524326, 589997, 524294, 524422, 524358, 590061, 459015, 524382, 524318, 589981, 459031, 524414, 524350, 590045, 459023, 524398, 524334, 590013, 524302, 524430, 524366, 590077, 459008, 524369, 524305, 524569, 459024, 524401, 524337, 590019, 459016, 524385, 524321, 589987, 524289, 524417, 524353, 590051, 459012, 524377, 524313, 589971, 459028, 524409, 524345, 590035, 459020, 524393, 524329, 590003, 524297, 524425, 524361, 590067, 459010, 524373, 524309, 524573, 459026, 524405, 524341, 590027, 459018, 524389, 524325, 589995, 524293, 524421, 524357, 590059, 459014, 524381, 524317, 589979, 459030, 524413, 524349, 590043, 459022, 524397, 524333, 590011, 524301, 524429, 524365, 590075, 459009, 524371, 524307, 524571, 459025, 524403, 524339, 590023, 459017, 524387, 524323, 589991, 524291, 524419, 524355, 590055, 459013, 524379, 524315, 589975, 459029, 524411, 524347, 590039, 459021, 524395, 524331, 590007, 524299, 524427, 524363, 590071, 459011, 524375, 524311, 524575, 459027, 524407, 524343, 590031, 459019, 524391, 524327, 589999, 524295, 524423, 524359, 590063, 459015, 524383, 524319, 589983, 459031, 524415, 524351, 590047, 459023, 524399, 524335, 590015, 524303, 524431, 524367, 590079]), 9], j = [new Uint32Array([327680, 327696, 327688, 327704, 327684, 327700, 327692, 327708, 327682, 327698, 327690, 327706, 327686, 327702, 327694, 0, 327681, 327697, 327689, 327705, 327685, 327701, 327693, 327709, 327683, 327699, 327691, 327707, 327687, 327703, 327695, 0]), 5]; return (t.prototype = Object.create(Pt.prototype)).getBits = function (t) { for (var e, n = this.codeSize, r = this.codeBuf, i = this.bytes, o = this.bytesPos; n < t;)void 0 === (e = i[o++]) && E("Bad encoding in flate stream"), r |= e << n, n += 8; return e = r & (1 << t) - 1, this.codeBuf = r >> t, this.codeSize = n -= t, this.bytesPos = o, e }, t.prototype.getCode = function (t) { for (var e = t[0], n = t[1], r = this.codeSize, i = this.codeBuf, o = this.bytes, a = this.bytesPos; r < n;) { var s; void 0 === (s = o[a++]) && E("Bad encoding in flate stream"), i |= s << r, r += 8 } var l = e[i & (1 << n) - 1], h = l >> 16, u = 65535 & l; return (0 == r || r < h || 0 == h) && E("Bad encoding in flate stream"), this.codeBuf = i >> h, this.codeSize = r - h, this.bytesPos = a, u }, t.prototype.generateHuffmanTable = function (t) { for (var e = t.length, n = 0, r = 0; r < e; ++r)t[r] > n && (n = t[r]); for (var i = 1 << n, o = new Uint32Array(i), a = 1, s = 0, l = 2; a <= n; ++a, s <<= 1, l <<= 1)for (var h = 0; h < e; ++h)if (t[h] == a) { var u = 0, c = s; for (r = 0; r < a; ++r)u = u << 1 | 1 & c, c >>= 1; for (r = u; r < i; r += l)o[r] = a << 16 | h; ++s } return [o, n] }, t.prototype.readBlock = function () { function t(t, e, n, r, i) { for (var o = t.getBits(n) + r; 0 < o--;)e[l++] = i } var e = this.getBits(3); if (1 & e && (this.eof = !0), 0 != (e >>= 1)) { var n, r; if (1 == e) n = B, r = j; else if (2 == e) { for (var i = this.getBits(5) + 257, o = this.getBits(5) + 1, a = this.getBits(4) + 4, s = Array(k.length), l = 0; l < a;)s[k[l++]] = this.getBits(3); for (var h = this.generateHuffmanTable(s), u = 0, c = (l = 0, i + o), f = new Array(c); l < c;) { var p = this.getCode(h); 16 == p ? t(this, f, 2, 3, u) : 17 == p ? t(this, f, 3, 3, u = 0) : 18 == p ? t(this, f, 7, 11, u = 0) : f[l++] = u = p } n = this.generateHuffmanTable(f.slice(0, i)), r = this.generateHuffmanTable(f.slice(i, c)) } else E("Unknown block type in flate stream"); for (var d = (_ = this.buffer) ? _.length : 0, g = this.bufferLength; ;) { var m = this.getCode(n); if (m < 256) d <= g + 1 && (d = (_ = this.ensureBuffer(g + 1)).length), _[g++] = m; else { if (256 == m) return void (this.bufferLength = g); var y = (m = I[m -= 257]) >> 16; 0 < y && (y = this.getBits(y)); u = (65535 & m) + y; m = this.getCode(r), 0 < (y = (m = C[m]) >> 16) && (y = this.getBits(y)); var v = (65535 & m) + y; d <= g + u && (d = (_ = this.ensureBuffer(g + u)).length); for (var w = 0; w < u; ++w, ++g)_[g] = _[g - v] } } } else { var b, x = this.bytes, N = this.bytesPos; void 0 === (b = x[N++]) && E("Bad block header in flate stream"); var L = b; void 0 === (b = x[N++]) && E("Bad block header in flate stream"), L |= b << 8, void 0 === (b = x[N++]) && E("Bad block header in flate stream"); var A = b; void 0 === (b = x[N++]) && E("Bad block header in flate stream"), (A |= b << 8) != (65535 & ~L) && E("Bad uncompressed block length in flate stream"), this.codeBuf = 0, this.codeSize = 0; var S = this.bufferLength, _ = this.ensureBuffer(S + L), F = S + L; this.bufferLength = F; for (var P = S; P < F; ++P) { if (void 0 === (b = x[N++])) { this.eof = !0; break } _[P] = b } this.bytesPos = N } }, t } function E(t) { throw new Error(t) } function t(t) { var e = 0, n = t[e++], r = t[e++]; -1 != n && -1 != r || E("Invalid header in flate stream"), 8 != (15 & n) && E("Unknown compression method in flate stream"), ((n << 8) + r) % 31 != 0 && E("Bad FCHECK in flate stream"), 32 & r && E("FDICT bit set in flate stream"), this.bytes = t, this.bytesPos = 2, this.codeSize = 0, this.codeBuf = 0, Pt.call(this) } }(); window.tmp = kt
}); try { module.exports = jsPDF } catch (t) { }
(function(a){if(typeof define==="function"&&define.amd&&define.amd.jQuery){define(["jquery"],a)}else{if(typeof module!=="undefined"&&module.exports){a(require("jquery"))}else{a(jQuery)}}}(function(f){var y="1.6.15",p="left",o="right",e="up",x="down",c="in",A="out",m="none",s="auto",l="swipe",t="pinch",B="tap",j="doubletap",b="longtap",z="hold",E="horizontal",u="vertical",i="all",r=10,g="start",k="move",h="end",q="cancel",a="ontouchstart" in window,v=window.navigator.msPointerEnabled&&!window.navigator.pointerEnabled&&!a,d=(window.navigator.pointerEnabled||window.navigator.msPointerEnabled)&&!a,C="TouchSwipe";var n={fingers:1,threshold:75,cancelThreshold:null,pinchThreshold:20,maxTimeThreshold:null,fingerReleaseThreshold:250,longTapThreshold:500,doubleTapThreshold:200,swipe:null,swipeLeft:null,swipeRight:null,swipeUp:null,swipeDown:null,swipeStatus:null,pinchIn:null,pinchOut:null,pinchStatus:null,click:null,tap:null,doubleTap:null,longTap:null,hold:null,triggerOnTouchEnd:true,triggerOnTouchLeave:false,allowPageScroll:"auto",fallbackToMouseEvents:true,excludedElements:"label, button, input, select, textarea, a, .noSwipe",preventDefaultEvents:true};f.fn.swipe=function(H){var G=f(this),F=G.data(C);if(F&&typeof H==="string"){if(F[H]){return F[H].apply(this,Array.prototype.slice.call(arguments,1))}else{f.error("Method "+H+" does not exist on jQuery.swipe")}}else{if(F&&typeof H==="object"){F.option.apply(this,arguments)}else{if(!F&&(typeof H==="object"||!H)){return w.apply(this,arguments)}}}return G};f.fn.swipe.version=y;f.fn.swipe.defaults=n;f.fn.swipe.phases={PHASE_START:g,PHASE_MOVE:k,PHASE_END:h,PHASE_CANCEL:q};f.fn.swipe.directions={LEFT:p,RIGHT:o,UP:e,DOWN:x,IN:c,OUT:A};f.fn.swipe.pageScroll={NONE:m,HORIZONTAL:E,VERTICAL:u,AUTO:s};f.fn.swipe.fingers={ONE:1,TWO:2,THREE:3,FOUR:4,FIVE:5,ALL:i};function w(F){if(F&&(F.allowPageScroll===undefined&&(F.swipe!==undefined||F.swipeStatus!==undefined))){F.allowPageScroll=m}if(F.click!==undefined&&F.tap===undefined){F.tap=F.click}if(!F){F={}}F=f.extend({},f.fn.swipe.defaults,F);return this.each(function(){var H=f(this);var G=H.data(C);if(!G){G=new D(this,F);H.data(C,G)}})}function D(a5,au){var au=f.extend({},au);var az=(a||d||!au.fallbackToMouseEvents),K=az?(d?(v?"MSPointerDown":"pointerdown"):"touchstart"):"mousedown",ax=az?(d?(v?"MSPointerMove":"pointermove"):"touchmove"):"mousemove",V=az?(d?(v?"MSPointerUp":"pointerup"):"touchend"):"mouseup",T=az?(d?"mouseleave":null):"mouseleave",aD=(d?(v?"MSPointerCancel":"pointercancel"):"touchcancel");var ag=0,aP=null,a2=null,ac=0,a1=0,aZ=0,H=1,ap=0,aJ=0,N=null;var aR=f(a5);var aa="start";var X=0;var aQ={};var U=0,a3=0,a6=0,ay=0,O=0;var aW=null,af=null;try{aR.bind(K,aN);aR.bind(aD,ba)}catch(aj){f.error("events not supported "+K+","+aD+" on jQuery.swipe")}this.enable=function(){aR.bind(K,aN);aR.bind(aD,ba);return aR};this.disable=function(){aK();return aR};this.destroy=function(){aK();aR.data(C,null);aR=null};this.option=function(bd,bc){if(typeof bd==="object"){au=f.extend(au,bd)}else{if(au[bd]!==undefined){if(bc===undefined){return au[bd]}else{au[bd]=bc}}else{if(!bd){return au}else{f.error("Option "+bd+" does not exist on jQuery.swipe.options")}}}return null};function aN(be){if(aB()){return}if(f(be.target).closest(au.excludedElements,aR).length>0){return}var bf=be.originalEvent?be.originalEvent:be;var bd,bg=bf.touches,bc=bg?bg[0]:bf;aa=g;if(bg){X=bg.length}else{if(au.preventDefaultEvents!==false){be.preventDefault()}}ag=0;aP=null;a2=null;aJ=null;ac=0;a1=0;aZ=0;H=1;ap=0;N=ab();S();ai(0,bc);if(!bg||(X===au.fingers||au.fingers===i)||aX()){U=ar();if(X==2){ai(1,bg[1]);a1=aZ=at(aQ[0].start,aQ[1].start)}if(au.swipeStatus||au.pinchStatus){bd=P(bf,aa)}}else{bd=false}if(bd===false){aa=q;P(bf,aa);return bd}else{if(au.hold){af=setTimeout(f.proxy(function(){aR.trigger("hold",[bf.target]);if(au.hold){bd=au.hold.call(aR,bf,bf.target)}},this),au.longTapThreshold)}an(true)}return null}function a4(bf){var bi=bf.originalEvent?bf.originalEvent:bf;if(aa===h||aa===q||al()){return}var be,bj=bi.touches,bd=bj?bj[0]:bi;var bg=aH(bd);a3=ar();if(bj){X=bj.length}if(au.hold){clearTimeout(af)}aa=k;if(X==2){if(a1==0){ai(1,bj[1]);a1=aZ=at(aQ[0].start,aQ[1].start)}else{aH(bj[1]);aZ=at(aQ[0].end,aQ[1].end);aJ=aq(aQ[0].end,aQ[1].end)}H=a8(a1,aZ);ap=Math.abs(a1-aZ)}if((X===au.fingers||au.fingers===i)||!bj||aX()){aP=aL(bg.start,bg.end);a2=aL(bg.last,bg.end);ak(bf,a2);ag=aS(bg.start,bg.end);ac=aM();aI(aP,ag);be=P(bi,aa);if(!au.triggerOnTouchEnd||au.triggerOnTouchLeave){var bc=true;if(au.triggerOnTouchLeave){var bh=aY(this);bc=F(bg.end,bh)}if(!au.triggerOnTouchEnd&&bc){aa=aC(k)}else{if(au.triggerOnTouchLeave&&!bc){aa=aC(h)}}if(aa==q||aa==h){P(bi,aa)}}}else{aa=q;P(bi,aa)}if(be===false){aa=q;P(bi,aa)}}function M(bc){var bd=bc.originalEvent?bc.originalEvent:bc,be=bd.touches;if(be){if(be.length&&!al()){G(bd);return true}else{if(be.length&&al()){return true}}}if(al()){X=ay}a3=ar();ac=aM();if(bb()||!am()){aa=q;P(bd,aa)}else{if(au.triggerOnTouchEnd||(au.triggerOnTouchEnd==false&&aa===k)){if(au.preventDefaultEvents!==false){bc.preventDefault()}aa=h;P(bd,aa)}else{if(!au.triggerOnTouchEnd&&a7()){aa=h;aF(bd,aa,B)}else{if(aa===k){aa=q;P(bd,aa)}}}}an(false);return null}function ba(){X=0;a3=0;U=0;a1=0;aZ=0;H=1;S();an(false)}function L(bc){var bd=bc.originalEvent?bc.originalEvent:bc;if(au.triggerOnTouchLeave){aa=aC(h);P(bd,aa)}}function aK(){aR.unbind(K,aN);aR.unbind(aD,ba);aR.unbind(ax,a4);aR.unbind(V,M);if(T){aR.unbind(T,L)}an(false)}function aC(bg){var bf=bg;var be=aA();var bd=am();var bc=bb();if(!be||bc){bf=q}else{if(bd&&bg==k&&(!au.triggerOnTouchEnd||au.triggerOnTouchLeave)){bf=h}else{if(!bd&&bg==h&&au.triggerOnTouchLeave){bf=q}}}return bf}function P(be,bc){var bd,bf=be.touches;if(J()||W()){bd=aF(be,bc,l)}if((Q()||aX())&&bd!==false){bd=aF(be,bc,t)}if(aG()&&bd!==false){bd=aF(be,bc,j)}else{if(ao()&&bd!==false){bd=aF(be,bc,b)}else{if(ah()&&bd!==false){bd=aF(be,bc,B)}}}if(bc===q){if(W()){bd=aF(be,bc,l)}if(aX()){bd=aF(be,bc,t)}ba(be)}if(bc===h){if(bf){if(!bf.length){ba(be)}}else{ba(be)}}return bd}function aF(bf,bc,be){var bd;if(be==l){aR.trigger("swipeStatus",[bc,aP||null,ag||0,ac||0,X,aQ,a2]);if(au.swipeStatus){bd=au.swipeStatus.call(aR,bf,bc,aP||null,ag||0,ac||0,X,aQ,a2);if(bd===false){return false}}if(bc==h&&aV()){clearTimeout(aW);clearTimeout(af);aR.trigger("swipe",[aP,ag,ac,X,aQ,a2]);if(au.swipe){bd=au.swipe.call(aR,bf,aP,ag,ac,X,aQ,a2);if(bd===false){return false}}switch(aP){case p:aR.trigger("swipeLeft",[aP,ag,ac,X,aQ,a2]);if(au.swipeLeft){bd=au.swipeLeft.call(aR,bf,aP,ag,ac,X,aQ,a2)}break;case o:aR.trigger("swipeRight",[aP,ag,ac,X,aQ,a2]);if(au.swipeRight){bd=au.swipeRight.call(aR,bf,aP,ag,ac,X,aQ,a2)}break;case e:aR.trigger("swipeUp",[aP,ag,ac,X,aQ,a2]);if(au.swipeUp){bd=au.swipeUp.call(aR,bf,aP,ag,ac,X,aQ,a2)}break;case x:aR.trigger("swipeDown",[aP,ag,ac,X,aQ,a2]);if(au.swipeDown){bd=au.swipeDown.call(aR,bf,aP,ag,ac,X,aQ,a2)}break}}}if(be==t){aR.trigger("pinchStatus",[bc,aJ||null,ap||0,ac||0,X,H,aQ]);if(au.pinchStatus){bd=au.pinchStatus.call(aR,bf,bc,aJ||null,ap||0,ac||0,X,H,aQ);if(bd===false){return false}}if(bc==h&&a9()){switch(aJ){case c:aR.trigger("pinchIn",[aJ||null,ap||0,ac||0,X,H,aQ]);if(au.pinchIn){bd=au.pinchIn.call(aR,bf,aJ||null,ap||0,ac||0,X,H,aQ)}break;case A:aR.trigger("pinchOut",[aJ||null,ap||0,ac||0,X,H,aQ]);if(au.pinchOut){bd=au.pinchOut.call(aR,bf,aJ||null,ap||0,ac||0,X,H,aQ)}break}}}if(be==B){if(bc===q||bc===h){clearTimeout(aW);clearTimeout(af);if(Z()&&!I()){O=ar();aW=setTimeout(f.proxy(function(){O=null;aR.trigger("tap",[bf.target]);if(au.tap){bd=au.tap.call(aR,bf,bf.target)}},this),au.doubleTapThreshold)}else{O=null;aR.trigger("tap",[bf.target]);if(au.tap){bd=au.tap.call(aR,bf,bf.target)}}}}else{if(be==j){if(bc===q||bc===h){clearTimeout(aW);clearTimeout(af);O=null;aR.trigger("doubletap",[bf.target]);if(au.doubleTap){bd=au.doubleTap.call(aR,bf,bf.target)}}}else{if(be==b){if(bc===q||bc===h){clearTimeout(aW);O=null;aR.trigger("longtap",[bf.target]);if(au.longTap){bd=au.longTap.call(aR,bf,bf.target)}}}}}return bd}function am(){var bc=true;if(au.threshold!==null){bc=ag>=au.threshold}return bc}function bb(){var bc=false;if(au.cancelThreshold!==null&&aP!==null){bc=(aT(aP)-ag)>=au.cancelThreshold}return bc}function ae(){if(au.pinchThreshold!==null){return ap>=au.pinchThreshold}return true}function aA(){var bc;if(au.maxTimeThreshold){if(ac>=au.maxTimeThreshold){bc=false}else{bc=true}}else{bc=true}return bc}function ak(bc,bd){if(au.preventDefaultEvents===false){return}if(au.allowPageScroll===m){bc.preventDefault()}else{var be=au.allowPageScroll===s;switch(bd){case p:if((au.swipeLeft&&be)||(!be&&au.allowPageScroll!=E)){bc.preventDefault()}break;case o:if((au.swipeRight&&be)||(!be&&au.allowPageScroll!=E)){bc.preventDefault()}break;case e:if((au.swipeUp&&be)||(!be&&au.allowPageScroll!=u)){bc.preventDefault()}break;case x:if((au.swipeDown&&be)||(!be&&au.allowPageScroll!=u)){bc.preventDefault()}break}}}function a9(){var bd=aO();var bc=Y();var be=ae();return bd&&bc&&be}function aX(){return !!(au.pinchStatus||au.pinchIn||au.pinchOut)}function Q(){return !!(a9()&&aX())}function aV(){var bf=aA();var bh=am();var be=aO();var bc=Y();var bd=bb();var bg=!bd&&bc&&be&&bh&&bf;return bg}function W(){return !!(au.swipe||au.swipeStatus||au.swipeLeft||au.swipeRight||au.swipeUp||au.swipeDown)}function J(){return !!(aV()&&W())}function aO(){return((X===au.fingers||au.fingers===i)||!a)}function Y(){return aQ[0].end.x!==0}function a7(){return !!(au.tap)}function Z(){return !!(au.doubleTap)}function aU(){return !!(au.longTap)}function R(){if(O==null){return false}var bc=ar();return(Z()&&((bc-O)<=au.doubleTapThreshold))}function I(){return R()}function aw(){return((X===1||!a)&&(isNaN(ag)||ag<au.threshold))}function a0(){return((ac>au.longTapThreshold)&&(ag<r))}function ah(){return !!(aw()&&a7())}function aG(){return !!(R()&&Z())}function ao(){return !!(a0()&&aU())}function G(bc){a6=ar();ay=bc.touches.length+1}function S(){a6=0;ay=0}function al(){var bc=false;if(a6){var bd=ar()-a6;if(bd<=au.fingerReleaseThreshold){bc=true}}return bc}function aB(){return !!(aR.data(C+"_intouch")===true)}function an(bc){if(!aR){return}if(bc===true){aR.bind(ax,a4);aR.bind(V,M);if(T){aR.bind(T,L)}}else{aR.unbind(ax,a4,false);aR.unbind(V,M,false);if(T){aR.unbind(T,L,false)}}aR.data(C+"_intouch",bc===true)}function ai(be,bc){var bd={start:{x:0,y:0},last:{x:0,y:0},end:{x:0,y:0}};bd.start.x=bd.last.x=bd.end.x=bc.pageX||bc.clientX;bd.start.y=bd.last.y=bd.end.y=bc.pageY||bc.clientY;aQ[be]=bd;return bd}function aH(bc){var be=bc.identifier!==undefined?bc.identifier:0;var bd=ad(be);if(bd===null){bd=ai(be,bc)}bd.last.x=bd.end.x;bd.last.y=bd.end.y;bd.end.x=bc.pageX||bc.clientX;bd.end.y=bc.pageY||bc.clientY;return bd}function ad(bc){return aQ[bc]||null}function aI(bc,bd){bd=Math.max(bd,aT(bc));N[bc].distance=bd}function aT(bc){if(N[bc]){return N[bc].distance}return undefined}function ab(){var bc={};bc[p]=av(p);bc[o]=av(o);bc[e]=av(e);bc[x]=av(x);return bc}function av(bc){return{direction:bc,distance:0}}function aM(){return a3-U}function at(bf,be){var bd=Math.abs(bf.x-be.x);var bc=Math.abs(bf.y-be.y);return Math.round(Math.sqrt(bd*bd+bc*bc))}function a8(bc,bd){var be=(bd/bc)*1;return be.toFixed(2)}function aq(){if(H<1){return A}else{return c}}function aS(bd,bc){return Math.round(Math.sqrt(Math.pow(bc.x-bd.x,2)+Math.pow(bc.y-bd.y,2)))}function aE(bf,bd){var bc=bf.x-bd.x;var bh=bd.y-bf.y;var be=Math.atan2(bh,bc);var bg=Math.round(be*180/Math.PI);if(bg<0){bg=360-Math.abs(bg)}return bg}function aL(bd,bc){var be=aE(bd,bc);if((be<=45)&&(be>=0)){return p}else{if((be<=360)&&(be>=315)){return p}else{if((be>=135)&&(be<=225)){return o}else{if((be>45)&&(be<135)){return x}else{return e}}}}}function ar(){var bc=new Date();return bc.getTime()}function aY(bc){bc=f(bc);var be=bc.offset();var bd={left:be.left,right:be.left+bc.outerWidth(),top:be.top,bottom:be.top+bc.outerHeight()};return bd}function F(bc,bd){return(bc.x>bd.left&&bc.x<bd.right&&bc.y>bd.top&&bc.y<bd.bottom)}}}));
function is_touch_device(){var t=" -webkit- -moz- -o- -ms- ".split(" "),i=function(n){return window.matchMedia(n).matches},n;return"ontouchstart"in window||window.DocumentTouch&&document instanceof DocumentTouch?!0:(n=["(",t.join("touch-enabled),("),"heartz",")"].join(""),i(n))}function holdSubscription(){$(".subscription-hold").is(":checked")?($("#holdSubscriptionFinalize").prop("disabled",!1),$("#holdSubscriptionFinalize").removeClass("disabled"),$(".subscription-cancel").is(":checked")&&($(".subscription-cancel").prop("checked",!1),$("#cancelSubscriptionFinalize").prop("disabled",!0),$("#cancelSubscriptionFinalize").addClass("disabled"))):($("#holdSubscriptionFinalize").prop("disabled",!0),$("#holdSubscriptionFinalize").addClass("disabled"))}function cancelSubscription(){$(".subscription-cancel").is(":checked")?($("#cancelSubscriptionFinalize").prop("disabled",!1),$("#cancelSubscriptionFinalize").removeClass("disabled"),$(".subscription-hold").is(":checked")&&($(".subscription-hold").prop("checked",!1),$("#holdSubscriptionFinalize").prop("disabled",!0),$("#holdSubscriptionFinalize").addClass("disabled"))):($("#cancelSubscriptionFinalize").prop("disabled",!0),$("#cancelSubscriptionFinalize").addClass("disabled"))}$(document).ready(function(){$(window).resize(function(){ellipses1=$("#bc1 :nth-child(2)");$("#bc1 a:hidden").length>0?ellipses1.show():ellipses1.hide();ellipses2=$("#bc2 :nth-child(2)");$("#bc2 a:hidden").length>0?ellipses2.show():ellipses2.hide()});$("#addTagModal").on("shown.bs.modal",function(){$("#addTag").trigger("focus")})});$("#addTagModal").keyup(function(n){n.keyCode===13&&n.originalEvent.srcElement.attributes[3].nodeValue!=="addTag()"&&$("#btnSubmitAddTag").click()});$(window).keyup(function(n){var t=n.which;if(t===107)return $("#addTagModal").modal("toggle"),!1});$("#subscriptionCancelBtn").click(function(){$("#subscription").modal("toggle");$("#subscriptionCancel").modal("toggle")});$(".form-label-group select").focusin(function(){$(this).val()||$(this).is("select")&&$("option:first-child",$(this)).html().replace(" ","")!==""?$(this).parent().addClass("has-value"):$(this).parent().removeClass("has-value")});$(".form-label-group select").change(function(){$(this).val()||$(this).is("select")&&$("option:first-child",$(this)).html().replace(" ","")!==""?$(this).parent().addClass("has-value"):$(this).parent().removeClass("has-value")});